共查询到20条相似文献,搜索用时 140 毫秒
1.
The B3LYP density functional method has been validated for the di-Mn-substituted gamma-Keggin polyoxometalate (POM) anion, [(SiO4)MnIII2(OH)2W10O32]4-, and for the divacant lacunary silicodecatungastate, gamma-[(SiO4)W10O32]8-. This approach was shown to adequately describe the geometries of [(SiO4)MnIII2(OH)2W10O32]4- and gamma-[(SiO4)W10O32]8. Three different geometrical models, "full", "medium", and "small", for Mn2-gamma-Keggin have also been validated. It was shown that the medium [(SiO4)MnIII2(OH)2W6O24H8]4- model, as well as small [(SiO4)MnIII2(OH)2W4O18H10]2- model, preserves structural features of the full system, [(SiO4)MnIII2(OH)2W10O32]4-. However, the small model distorts the charge distribution at the "active site" of the system and should be used with caution. The same computational approach was employed to elucidate the structure of the di-Fe-substituted gamma-Keggin POM. The structure of the acidic (tetra-protonated form) of lacunary POM, gamma-[(SiO4)W10O32H4]4-, was shown to be gamma-[(SiO4)W10O28(OH)4]4- with four terminal hydroxo ligands, rather than gamma-[(SiO4)W10O30(H2O)2]4- with two aqua and two oxo(terminal) ligands as reported by Mizuno and co-workers (Science 2003, 300, 964). The observed and calculated asymmetry in the W-O(terminal) bond distances of gamma-[(SiO4)W10O32H4]4- is explained in terms of the existence of O1H1...O2H2 and O4H4...O3H3 hydrogen-bonding patterns in the gamma-[(SiO4)W10O28(OH)4]4- structure. 相似文献
2.
Tangoulis V Malamatari DA Soulti K Stergiou V Raptopoulou CP Terzis A Kabanos TA Kessissoglou DP 《Inorganic chemistry》1996,35(17):4974-4983
Two mixed-valence Mn(III)Mn(II) complexes and a homo-valence Mn(II) trinuclear manganese complex of stoichiometry Mn(III)Mn(II)Mn(III)(5-Cl-Hsaladhp)(2)(AcO)(4)(MeOH)(2).4CH(3)OH (1a), Mn(III)Mn(II)Mn(III) (Hsaladhp)(2)(AcO)(2)(5-Cl-Sal)(2)(thf)(2) (3a) and Mn(II)Mn(II)Mn(II) (AcO)(6)(pybim)(2) (1b) where H(3)saladhp is a tridentate Schiff base ligand and pybim a neutral bidentate donor ligand, have been structurally characterized by using X-ray crystallography. The structurally characterized mixed-valence complexes have strictly 180 degrees Mn(III)-Mn(II)-Mn(III) angles as required by crystallographic inversion symmetry. The complexes are valence trapped with two terminal Mn(III) ions showing Jahn-Teller distortion along the acetate or salicylate-Mn(III)-X axis. The Mn.Mn separation is 3.511 ? and 3.507 ? respectively. The mixed-valence complexes have S = (3)/(2) ground state and the homovalence complex S = (5)/(2), with small antiferromagnetic exchange J couplings, -5.6 and -1.8 cm(-1), respectively, while the powder ESR spectra at 4 K show a broad low field signal with g approximately 4.3 for Mn(III)Mn(II)Mn(III) and a broad temperature-dependent signal at g = 2 for Mn(II)Mn(II)Mn(II). Crystal data for 1a: [C(36)H(60)O(20)N(2)Cl(2)Mn(3)], triclinic, space group P&onemacr;, a = 9.272(7) ?, b = 11.046(8) ?, c = 12.635(9) ?, alpha = 76.78(2) degrees, beta = 81.84(2) degrees, gamma = 85.90(2) degrees, Z = 1. Crystal data for 3a: [C(48)H(56)O(18)N(2)Cl(2)Mn(3)], monoclinic, space group P2(1)/n, a = 8.776(3) ?, b = 22.182(7) ?, c = 13.575(4) ?, beta = 94.44(1) degrees, Z = 2. Crystal data for 1b: [C(36)H(36)O(12)N(6)Mn(3)], triclinic, space group P&onemacr;, a = 13.345(6) ?, b = 8.514(4) ?, c = 9.494(4) ?, alpha = 75.48(1) degrees, beta = 75.83(1) degrees, gamma = 76.42(1) degrees, Z = 1. 相似文献
3.
Wemple MW Tsai HL Wang S Claude JP Streib WE Huffman JC Hendrickson DN Christou G 《Inorganic chemistry》1996,35(22):6437-6449
The reaction of Mn(O(2)CPh)(2).2H(2)O and PhCO(2)H in EtOH/MeCN with NBu(n)(4)MnO(4) gives (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(9)(H(2)O)] (4) in high yield (85-95%). Complex 4 crystallizes in monoclinic space group P2(1)/c with the following unit cell parameters at -129 degrees C: a = 17.394(3) ?, b = 19.040(3) ?, c = 25.660(5) ?, beta = 103.51(1) degrees, V = 8262.7 ?(3), Z = 4; the structure was refined on F to R (R(w)) = 9.11% (9.26%) using 4590 unique reflections with F > 2.33sigma(F). The anion of 4 consists of a [Mn(4)(&mgr;(3)-O)(2)](8+) core with a "butterfly" disposition of four Mn(III) atoms. In addition to seven bridging PhCO(2)(-) groups, there is a chelating PhCO(2)(-) group at one "wingtip" Mn atom and terminal PhCO(2)(-) and H(2)O groups at the other. Complex 4 is an excellent steppingstone to other [Mn(4)O(2)]-containing species. Treatment of 4 with 2,2-diethylmalonate (2 equiv) leads to isolation of (NBu(n)(4))(2)[Mn(8)O(4)(O(2)CPh)(12)(Et(2)mal)(2)(H(2)O)(2)] (5) in 45% yield after recrystallization. Complex 5 is mixed-valent (2Mn(II),6Mn(III)) and contains an [Mn(8)O(4)](14+) core that consists of two [Mn(4)O(2)](7+) (Mn(II),3Mn(III)) butterfly units linked together by one of the &mgr;(3)-O(2)(-) ions in each unit bridging to one of the body Mn atoms in the other unit, and thus converting to &mgr;(4)-O(2)(-) modes. The Mn(II) ions are in wingtip positions. The Et(2)mal(2)(-) groups each bridge two wingtip Mn atoms from different butterfly units, providing additional linkage between the halves of the molecule. Complex 5.4CH(2)Cl(2) crystallizes in monoclinic space group P2(1)/c with the following unit cell parameters at -165 degrees C: a = 16.247(5) ?, b = 27.190(8) ?, c = 17.715(5) ?, beta = 113.95(1) degrees, V = 7152.0 ?(3), Z = 4; the structure was refined on F to R (R(w)) = 8.36 (8.61%) using 4133 unique reflections with F > 3sigma(F). The reaction of 4 with 2 equiv of bpy or picolinic acid (picH) yields the known complex Mn(4)O(2)(O(2)CPh)(7)(bpy)(2) (2), containing Mn(II),3Mn(III), or (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(7)(pic)(2)] (6), containing 4Mn(III). Treatment of 4 with dibenzoylmethane (dbmH, 2 equiv) gives the mono-chelate product (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(8)(dbm)] (7); ligation of a second chelate group requires treatment of 7 with Na(dbm), which yields (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(7)(dbm)(2)] (8). Complexes 7 and 8 both contain a [Mn(4)O(2)](8+) (4Mn(III)) butterfly unit. Complex 7 contains chelating dbm(-) and chelating PhCO(2)(-) at the two wingtip positions, whereas 8 contains two chelating dbm(-) groups at these positions, as in 2 and 6. Complex 7.2CH(2)Cl(2) crystallizes in monoclinic space group P2(1) with the following unit cell parameters at -170 degrees C: a = 18.169(3) ?, b = 19.678(4) ?, c = 25.036(4) ?, beta = 101.49(1) degrees, V = 8771.7 ?(3), Z = 4; the structure was refined on F to R (R(w)) = 7.36% (7.59%) using 10 782 unique reflections with F > 3sigma(F). Variable-temperature magnetic susceptibility studies have been carried out on powdered samples of complexes 2 and 5 in a 10.0 kG field in the 5.0-320.0 K range. The effective magnetic moment (&mgr;(eff)) for 2 gradually decreases from 8.61 &mgr;(B) per molecule at 320.0 K to 5.71 &mgr;(B) at 13.0 K and then increases slightly to 5.91 &mgr;(B) at 5.0 K. For 5, &mgr;(eff) gradually decreases from 10.54 &mgr;(B) per molecule at 320.0 K to 8.42 &mgr;(B) at 40.0 K, followed by a more rapid decrease to 6.02 &mgr;(B) at 5.0 K. On the basis of the crystal structure of 5 showing the single Mn(II) ion in each [Mn(4)O(2)](7+) subcore to be at a wingtip position, the Mn(II) ion in 2 was concluded to be at a wingtip position also. Employing the reasonable approximation that J(w)(b)(Mn(II)/Mn(III)) = J(w)(b)(Mn(III)/M(III)), where J(w)(b) is the magnetic exchange interaction between wingtip (w) and body (b) Mn ions of the indicated oxidation state, a theoretical chi(M) vs T expression was derived and used to fit the experimental molar magnetic susceptibility (chi(M)) vs T data. The obtained fitting parameters were J(w)(b) = -3.9 cm(-)(1), J(b)(b) = -9.2 cm(-)(1), and g = 1.80. These values suggest a S(T) = (5)/(2) ground state spin for 2, which was confirmed by magnetization vs field measurements in the 0.5-50.0 kG magnetic field range and 2.0-30.0 K temperature range. For complex 5, since the two bonds connecting the two [Mn(4)O(2)](7+) units are Jahn-Teller elongated and weak, it was assumed that complex 5 could be treated, to a first approximation, as consisting of weakly-interacting halves; the magnetic susceptibility data for 5 at temperatures >/=40 K were therefore fit to the same theoretical expression as used for 2, and the fitting parameters were J(w)(b) = -14.0 cm(-)(1) and J(b)(b) = -30.5 cm(-)(1), with g = 1.93 (held constant). These values suggest an S(T) = (5)/(2) ground state spin for each [Mn(4)O(2)](7+) unit of 5, as found for 2. The interactions between the subunits are difficult to incorporate into this model, and the true ground state spin value of the entire Mn(8) anion was therefore determined by magnetization vs field studies, which showed the ground state of 5 to be S(T) = 3. The results of the studies on 2 and 5 are considered with respect to spin frustration effects within the [Mn(4)O(2)](7+) units. Complexes 2 and 5 are EPR-active and -silent, respectively, consistent with their S(T) = (5)/(2) and S(T) = 3 ground states, respectively. 相似文献
4.
Decaborane(14) reacts with 1-(CH(3))(3)SiC&tbd1;CC(4)H(9) in the presence of dimethyl sulfide to give the new alkenyldecaborane 5-(S(CH(3))(2))-6-[(CH(3))(3)Si(C(4)H(9))C=CH]B(10)H(11) (I). Crystal data for 5-(S(CH(3))(2))-6-[(CH(3))(3)Si(C(4)H(9))C=CH]B(10)H(11): space group P2(1)/n, monoclinic, a = 9.471(1) ?, b = 13.947(3) ?, c = 17.678(3) ?, beta = 100.32(1) degrees. A total of 3366 unique reflections were collected over the range 2.0 degrees = 2theta = 56.0 degrees, of which 1763 reflections had F(o)(2) >/= 3sigma(F(o)(2)) and were used in the final refinement. R(F)() = 0.083; R(w)(F)() = 0.094. The single-crystal X-ray structure of 5-(S(CH(3))(2))-6-[((CH(3))(3)Si)(2)C=CH]B(10)H(11) (A) is also reported. Crystal data for 5-(S(CH(3))(2))-6-[((CH(3))(3)Si)(2)C=CH]B(10)H(11): space group, P2(1)2(1)2(1), orthorhombic, a = 9.059 (3) ?, b = 12.193(4) ?, c = 21.431(3) ?. A total of 4836 unique reflections were collected over the range 6 degrees = 2theta = 140 degrees, of which 3705 reflections had F(o)(2) >/= 3sigma(F(o)(2)) and were used in the final refinement. R(F)() = 0.052; R(w)(F)() = 0.059. The reactions of 5-(S(CH(3))(2))6-[(CH(3))(3)Si(C(4)H(9))C=CH]B(10)H(11) and 5-(S(CH(3))(2))6-[((CH(3))(3)Si)(2)C=CH]B(10)H(11) with a variety of alkyl isocyanides were investigated. All of the alkenyl monocarbon carboranes reported are the result of incorporation of the carbon atom from the isocyanide into the alkenyldecaborane framework and reduction of N&tbd1;C bond to a N-C single bond. The characterization of these compounds is based on (1)H and (11)B NMR data, IR spectroscopy, and mass spectrometry. 相似文献
5.
The hydrothermal chemistry of the CsVO(3)/methylenediphosphonate system was investigated. Variations in reaction temperatures, heating times, and stoichiometries of reactants resulted in the isolation of mononuclear, one-, two-, and three-dimensional species: Cs[VO(HO(3)PCH(2)PO(3)H)(2)(H(2)O)] (1), Cs[VO(HO(3)PCH(2)PO(3))] (2), Cs[(VO)(2)V (O(3)PCH(2)PO(3))(2)(H(2)O)(2)] (3), and [V(HO(3)PCH(2)PO(3))(H(2)O)] (4), respectively. The structure of the anion of 1 consists of isolated V(IV) octahedra. Phase 2 adopts a chain structure constructed from corner-sharing V(IV) octahedra, forming infinite {-V=OV=O-} linkages. The layer structure of 3 contains trinuclear units of corner-sharing {VO(6)} octahedra with the central V site in the III oxidation state and V(IV) centers at the extremities of the cluster. The diphosphonate ligands serve to link neighboring trinuclear motifs into a layer structure three octahedra in depth. The Cs(+) cations occupy cavities within the layers, rather than the more common interlamellar positions. The structure of 4 consists of isolated {V(III)O(6)} octahedra linked by diphosphonate groups into a three-dimensional framework. Crystal data: for 1, CH(6)O(7)P(2)V(0.5)Cs, monoclinic C2, a = 10.991(2) ?, b = 10.161(2) ?, c = 7.445(1) ?, beta = 92.97(3) degrees, Z = 4; for 2, CH(3)O(7)P(2)VCs, monoclinic C2, a = 10.212(2) ?, b = 10.556(2) ?, c = 14.699(3) ?, beta = 94.57(2) degrees, Z = 8; for 3, C(2)H(8)O(16)P(4)V(3)Cs, monoclinic C2/m, a = 9.724(2) ?, b = 8.136(2) ?, c = 10.268(2) ?, beta = 103.75(3) degrees, Z = 2; for 4, CH(5)O(7)P(2)V, monoclinic P2(1)()/n, a = 5.341(1) ?, b = 11.516(2) ?, c = 10.558(2) ?, beta = 99.89(1) degrees, Z = 4. 相似文献
6.
The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1. 相似文献
7.
Eight tris(organotin)-substituted Keggin tungstosilicate heteropolyanions have been synthesized and characterized by elemental analysis, infrared and M?ssbauer spectroscopy, multinuclear NMR, and X-ray crystallography. The new anions contain alpha- or beta-SiW(9)O(34)(10)(-) moieties and are of two structural types, [(RSn)(3)(SiW(9)O(37))](7)(-) (R, isomer: Ph, alpha-, 1; n-Bu, alpha-, 2; Ph, beta-, 3; n-Bu, beta-, 4) and [(RSnOH)(3)(SiW(9)O(34))(2)](14)(-) (Ph, alpha-, 5; n-Bu, alpha-, 6; Ph, beta-, 7; n-Bu, beta-, 8). Crystals of Cs(4)H(3)[(PhSn)(3)(SiW(9)O(37))].8H(2)O (anion 3) are monoclinic, space group C2/c, with lattice constants a = 48.91(2) ?, b = 12.111(3) ?, c = 20.334(9) ?, beta = 102.30 degrees, and Z = 8. The anion has nominal C(3)(v)() symmetry and has a structure with three corner-shared WO(6) octahedra of the beta-Keggin anion replaced by three PhSnO(5) groups. Crystals of Cs(9)H(5)[(BuSnOH)(3)(SiW(9)O(34))(2)].36H(2)O (anion 6) are tetragonal, space group P&fourmacr;2(1)m, with lattice constants a = b = 29.005(4) ?, c = 13.412(4) ?, and Z = 4. The anion has the anticipated D(3)(h)() symmetry and contains three BuSnOH groups sandwiched between A,alpha-SiW(9)O(34)(10)(-) anions. 相似文献
8.
Several new large polyoxotungstates have been synthesized by reaction of lanthanide cations with the well-known "As(4)W(40)" anion, [(B-alpha-AsO(3)W(9)O(30))(4)(WO(2))(4)](28-) (1). The heteropolyanions [(H(2)O)(11)Ln(III)(Ln(III)(2)OH)(B-alpha-AsO(3)W(9)O(30))(4)(WO(2))(4)](20)(-) (Ln = Ce, Nd, Sm, Gd) (2-4) (Ln(3)As(4)W(40)) and [M(m)()(H(2)O)(10)(Ln(III)(2)OH)(2)(B-alpha-AsO(3)W(9)O(30))(4)(WO(2))(4)]((18-m)(-)) (Ln = La, Ce, Gd and M = Ba, K, none) (5-7) (Ln(4)As(4)W(40)) have been isolated as alkali metal and ammonium salts, respectively, and characterized by single-crystal X-ray analysis, elemental analysis, and IR and (183)W-NMR spectroscopy. The X-ray analyses revealed interanionic W-O-Ln bonds between adjacent Ln(x)()As(4)W(40) units forming a "dimer" for x = 3 and chains for x = 4. Upon dissolving in water these bonds hydrolyze and the monomeric species form. The straightforward syntheses which require the use of concentrated NaCl solutions (1-4 M) and the addition of stoichiometric amounts of Ba(2+) or K(+) reemphasize the importance of the presence of appropriate countercations for the assembly of large polyoxometalate structures. 相似文献
9.
Formate is an inhibitor of cytochrome oxidases and also effects conversion of the bovine heart enzyme from the "fast" to the "slow" cyanide-binding form. The molecular basis of these effects is unknown; one possibility is that formate inserts as a bridge into the binuclear heme a(3)-Cu(B) site, impeding the binding of dioxygen or cyanide. Consequently, Fe-Cu-carboxylate interactions are a matter of current interest. We have initiated an examination of such interactions by the synthesis of the first examples of [Fe(III)-(&mgr;(2):eta(2)-RCO(2))-Cu(II)] bridges, minimally represented by Fe(III)-L + Cu(II)-O(2)CR --> [Fe(III)-(RCO(2))-Cu(II)] + L. A series of Cu(II) precursor complexes and solvate forms have been prepared and their structures determined, including [Cu(Me(5)dien)(O(2)CH)](+) (3), [Cu(Me(5)dien)(O(2)CH)(MeOH)](+) (4), [Cu(Me(6)tren)(O(2)CH)](+) (5), and [Cu(Me(5)dien)(OAc)](+) (6). [4](ClO(4)) was obtained in monoclinic space group P2(1)/n with a = 8.166(3) ?, b = 15.119(5) ?, c = 15.070(4) ?, beta = 104.65(2) degrees, and Z = 4. [5](ClO(4))/[6](ClO(4)) crystallize in orthorhombic space groups Pnma/Pna2(1) with a = 16.788(2)/14.928(5) ?, b = 9.542(1)/9.341(4) ?, c = 12.911(1)/12.554(4) ?, and Z = 4/4. In all cases, the carboxylate ligand is terminal and is bound in a syn orientation. Also prepared for the purpose of structural comparison was [Fe(OEP)(O(2)CH)], which occurred in monoclinic space group P2(1)/c with a = 13.342(2) ?, b = 13.621(2) ?, c = 19.333(2) ?, beta = 106.12(2) degrees, and Z = 4. The desired bridges were stabilized in the assemblies [(OEP)Fe(O(2)CH)Cu(Me(5)dien)(OClO(3))](+) (9), [(OEP)Fe(OAc)Cu(Me(5)dien)](2+) (10), and {(OEP)Fe[(O(2)CH)Cu(Me(6)tren)](2)}(3+) (11), which were prepared by the reaction of 3, 6, and 5, respectively, with [Fe(OEP)(OClO(3))] in acetone or dichloromethane. [9](ClO(4))/[10](ClO(4))(2).CH(2)Cl(2) crystallize in triclinic space group P&onemacr; with a = 9.016(3)/13.777(3) ?, b = 15.377(5)/13.847(3) ?, c = 19.253(5)/17.608(4) ?, alpha = 78.12(3)/96.82(3) degrees, beta = 86.30(4)/108.06(3) degrees, gamma = 76.23(3)/114.32(3) degrees, and Z = 2/2. Each assembly contains a [Fe(III)-(RCO(2))-Cu(II)] bridge but with the differing orientations anti-anti (9) and syn-anti (10, 11). The compound [11](ClO(4))(2)(SbF(6)) occurs in orthorhombic space group Pbcn with a = 12.517(6) ?, b = 29.45(1) ?, c = 21.569(8) ?, and Z = 4. Complex 11 is trinuclear; the Fe(III) site has two axial formate ligands with bond distances indicative of a high-spin configuration. Structural features of 9-11 are discussed and are considered in relation to the possible insertion of formate into the binuclear sites of two oxidases whose structures were recently determined. The present results contribute to the series of molecular assemblies with the bridge groups [Fe(III)-X-Cu(II)], X = O(2)(-), OH(-), and RCO(2)(-), all with a common high-spin heme, thereby allowing an examination of electronic structure as dependent on the bridging atom or group and bridge structure. (Me(5)dien = 1,1,4,7,7-pentamethyldiethylenetriamine; Me(6)tren = tris(2-(dimethylamino)ethyl)amine; OEP = octaethylporphyrinate(2-).) 相似文献
10.
Bigoli F Demartin F Deplano P Devillanova FA Isaia F Lippolis V Mercuri ML Pellinghelli MA Trogu EF 《Inorganic chemistry》1996,35(11):3194-3201
Starting from 1,3-dimethyl-4-imidazoline-2-selone (1), 1,2-bis(2-selenoxo-3-methyl-4-imidazolinyl-2-)ethane (3) and 1,3-dimethylimidazolidine-2-selone (4), the following six compounds, [(C(5)H(8)N(2)Se-)(2)](2+).2Br(-) (I), [(C(5)H(8)N(2)Se-)(2)](2+).2I(-) (II), [(C(5)H(8)N(2)Se-)(2)](2+).Cl(-).I(3)(-) (III) [(C(5)H(10)N(2)Se-)(2)](2+).Br(-).IBr(2)(-) (IV), [(C(5)H(7)N(2)Se-)(2)](2+).I(3)(-).(1)/(2)I(4)(-) (V) and [(C(5)H(7)N(2)Se-)(2)](2+).2I(-).CH(3)CN (VI), in which the selenium compounds are oxidized to dications bearing the uncommon -Se-Se- bridge, have been prepared, and I-V crystallographically characterized. I and III were obtained by reacting 1 with IBr and ICl respectively, while II was obtained by reduction of previously described hypervalent selenium compound of 1 (5) bearing the I-Se-I group with elemental tellurium. These three compounds contain the same [(C(5)H(8)N(2)Se-)(2)](2+) dication balanced by two bromides in I, two iodides in II, and Cl(-) and I(3)(-) in III. However, on the basis of the Se-Cl bond length of 2.778(5) ?, III can also be considered as formed by the [(C(5)H(8)N(2)Se-)(2)Cl](+) cation, with I(3)(-) as counterion. Similarly to III, compound IV, which was obtained by reacting 4 with IBr, can be considered as formed by [(C(5)H(10)N(2)Se-)(2)Br](+) cations and IBr(2)(-) anions. As in II, compound V has been prepared by reduction of the hypervalent selenium compound of 3 (6) bearing two I-Se-I groups with elemental tellurium. In V, the [(C(5)H(7)N(2)Se-)(2)](2+) cation is balanced by I(3)(-) and half I(4)(2-) anions. The structural data show that all the cations are very similar, with Se-Se bond lengths ranging from 2.409(2) to 2.440(2) ?. FT-IR and FT-Raman spectra of I-VI allow one to identify two bands around 230 +/- 10 and 193 +/- 5 cm(-1) that are common to all compounds. These bands are generally strong in the FT-Raman and weak in the FT-IR spectra and should contain a contribution of the nu(Se-Se) stretching vibration. The spectra are also in good agreement with the structural features of the polyhalide anions present in the crystals. Crystallographic data are as follows: I is monoclinic, space group P2(1), with a = 9.849(6) ?, b = 11.298(5) ?, c = 7.862(6) ?, beta = 106.44(2) degrees, Z = 2, and R = 0.0362; II is monoclinic, space group P2(1), with a = 8.063(6) ?, b = 11.535(5) ?, c = 10.280(5) ?, beta = 107.13(2) degrees, Z = 2, and R = 0.0429, III is monoclinic, space group P2(1)/n, with a = 10.431(7) ?, b = 18.073(5) ?, c = 11.223(6) ?, beta = 100.76(2) degrees, Z = 4, and R = 0.0490; IV is monoclinic, space group P2(1)/n, with a = 10.298(5) ?, b = 18.428(7) ?, c = 11.475(6) ?, beta = 104.10(4) degrees, Z = 4, and R = 0.0300; V is triclinic, space group P&onemacr;, with a = 7.456(6) ?, b = 11.988(5) ?, c = 12.508(5) ?, alpha = 79.32(2) degrees, beta = 85.49(2) degrees, gamma = 80.62(2) degrees, Z = 2, and R = 0.0340. 相似文献
11.
Jüstel T Bendix J Metzler-Nolte N Weyhermüller T Nuber B Wieghardt K 《Inorganic chemistry》1998,37(1):35-43
Reaction of LRu(III)Cl(3) (L = 1,4,7-trimethyl-1,4,7-triazacyclononane) with 1,2-phenylenediamine (opdaH(2)) in H(2)O in the presence of air affords [LRu(II)(bqdi)(OH(2))](PF(6)) (1), where (bqdi) represents the neutral ligand o-benzoquinone diimine. From an alkaline methanol/water mixture of 1 was obtained the dinuclear species [{LRu(II)(bqdi)}(2)(&mgr;-H(3)O(2))](PF(6))(3) (1a). The coordinated water molecule in 1 is labile and can be readily substituted under appropriate reaction conditions by acetonitrile, yielding [LRu(II)(bqdi)(CH(3)CN)](PF(6))(2) (2), and by iodide and azide anions, affording [LRu(II)(bqdi)I](PF(6)).0.5H(2)O (3) and [LRu(bqdi)(N(3))](PF(6)).H(2)O (4), respectively. Heating of solid 4 in vacuum at 160 degrees C generates N(2) and the dinuclear, nitrido-bridged complex [{LRu(o-C(6)H(4)(NH)(2))}(2)(&mgr;-N)](PF(6))(2) (5). Complex 5 is a mixed-valent, paramagnetic species containing one unpaired electron per dinuclear unit whereas complexes 1-4 are diamagnetic. The crystal structures of 1, 1a.3CH(3)CN, 3, 4.H(2)O, and 5.3CH(3)CN.0.5(toluene) have been determined by X-ray crystallography: 1 crystallizes in the monoclinic space group P2(1)/m, Z = 2, with a = 8.412(2) ?, b = 15.562(3) ?, c = 10.025 ?, and beta = 109.89(2) degrees; 1a.3CH(3)CN, in the monoclinic space group C2/c, Z = 4, with a = 19.858(3) ?, b = 15.483(2) ?, c = 18.192(3) ?, and beta = 95.95(2) degrees; 3, in the orthorhombic space group Pnma, Z = 4, with a = 18.399(4) ?, b = 9.287(2) ?, and c = 12.052(2) ?, 4.H(2)O, in the monoclinic space group P2(1)/c, Z = 4, with a = 8.586(1) ?, b = 15.617(3) ?, c = 16.388(5) ?, and beta = 90.84(2) degrees; and 5.3CH(3)CN.0.5(toluene), in the monoclinic space group P2(1)/c, Z = 4, with a = 15.003(3) ?, b = 16.253(3) ?, c = 21.196(4) ?, and beta = 96.78(3) degrees. The structural data indicate that in complexes 1-4 the neutral o-benzoquinone diimine ligand prevails. In contrast, in 5 this ligand has predominantly o-phenylenediamide character, which would render 5 formally a mixed-valent Ru(IV)Ru(V) species. On the other hand, the Ru-N bond lengths of the Ru-N-Ru moiety at 1.805(5) and 1.767(5) ? are significantly longer than those in other crystallographically characterized Ru(IV)=N=Ru(IV) units (1.72-1.74 ?). It appears that the C(6)H(4)(NH)(2) ligand in 5 is noninnocent and that formal oxidation state assignments to the ligands or metal centers are not possible. 相似文献
12.
New synthesis procedures are described to tetranuclear manganese carboxylate complexes containing the [Mn(4)O(2)](8+) or [Mn(4)O(3)X](6+) (X(-) = MeCO(2)(-), F(-), Cl(-), Br(-), NO(3)(-)) core. These involve acidolysis reactions of [Mn(4)O(3)(O(2)CMe)(4)(dbm)(3)] (1; dbm is the anion of dibenzoylmethane) or [Mn(4)O(2)(O(2)CEt)(6)(dbm)(2)] (8) with HX (X(-) = F(-), Cl(-), Br(-), NO(3)(-)); high-yield routes to 1 and 8 are also described. The X(-) = NO(3)(-) complexes [Mn(4)O(3)(NO(3))(O(2)CR)(3)(R'(2)dbm)(3)] (R = Me, R' = H (6); R = Me, R' = Et (7); R = Et, R' = H (12)) represent the first synthesis of the [Mn(4)O(3)(NO(3))](6+) core, which contains an unusual eta(1):mu(3)-NO(3)(-) group. Treatment of known [Mn(4)O(2)(O(2)CEt)(7)(bpy)(2)](ClO(4)) with HNO(3) gives [Mn(4)O(2)(NO(3))(O(2)CEt)(6)(bpy)(2)](ClO(4)) (15) containing a eta(1):eta(1):mu-NO(3)(-) group bridging the two body Mn(III) ions of the [Mn(4)O(2)](8+) butterfly core. Complex 7 x 4CH(2)Cl(2) crystallizes in space group P2(1)2(1)2(1) with (at -168 degrees C) a = 21.110(3) A, b = 22.183(3) A, c = 15.958(2) A, Z = 4, and V = 7472.4(3) A(3). Complex 15 x (3)/(2)CH(2)Cl(2) crystallizes in space group P2(1)/c with (at -165 degrees C) a = 26.025(4) A, b = 13.488(2) A, c = 32.102(6) A, beta = 97.27(1) degrees, Z = 8, and V = 11178(5) A(3). Complex 7 contains a [Mn(4)(mu(3)-O)(3)(mu(3)-NO(3))](6+) core (3Mn(III), Mn(IV)) as seen for previous [Mn(4)O(3)X](6+) complexes. Complex 15 contains a butterfly [Mn(4)(mu(3)-O)(2)](8+) core. (1)H NMR spectra have been recorded for all complexes reported in this work and the various resonances assigned. All complexes retain their structural integrity on dissolution in chloroform and dichloromethane. Magnetic susceptibility (chi(M)) data were collected on 12 in the 5-300 K range in a 10.0 kG (1 T) field. Fitting of the data to the theoretical chi(M) vs T expression appropriate for a [Mn(4)O(3)X](6+) complex of C(3)(v)() symmetry gave J(34) = -23.9 cm(-)(1), J(33) = 4.9 cm(-)(1), and g = 1.98, where J(34) and J(33) refer to the Mn(III)Mn(IV) and Mn(III)Mn(III) pairwise exchange interactions, respectively. The ground state of the molecule is S = 9/2, as found previously for other [Mn(4)O(3)X](6+) complexes. This was confirmed by magnetization data collected at various fields and temperatures. Fitting of the data gave S = 9/2, D = -0.45 cm(-1), and g = 1.96, where D is the axial zero-field splitting parameter. 相似文献
13.
The exploration in two hydro(solvo)thermal reaction systems As/S/Mn(2+)/phen/methylamine aqueous solution and As/S/Mn(2+)/2,2'-bipy/H(2)O affords five new manganese thioarsenates with diverse structures, namely, (CH(3)NH(3)){[Mn(phen)(2)](As(V)S(4))}·phen (1 and 1'), (CH(3)NH(3))(2){[Mn(phen)](2)(As(V)S(4))(2)} (2), {[Mn(phen)(2)](As(III)(2)S(4))}(n) (3), {[Mn(phen)](3)(As(III)S(3))(2)}·H(2)O (4), and {[Mn(2,2'-bipy)(2)](2)(As(V)S(4))}[As(III)S(S(5))] (5). Compound 1 comprises a {[Mn(phen)(2)](As(V)S(4))}(-) complex anion, a monoprotonated methylamine cation and a phen molecule. Compound 2 contains a butterfly like {[Mn(phen)](2)(As(V)S(4))(2)}(2-) anion charge compensated by two monoprotonated methylamine cations. Compound 3 is a neutral chain formed by a helical (1)(∞)(As(III)S(2)(-)) vierer chain covalently bonds to [Mn(II)(phen)](2+) complexes via all its terminal S atoms. Compound 4 features a neutral chain showing the stabilization of noncondensed (As(III)S(3))(3-) anions in the coordination of [Mn(II)(phen)](2+) complex cations. Compound 5 features a mixed-valent As(III)/As(V) character and an interesting chalcogenidometalates structure, where a polycation formed by the connection of two [Mn(2,2'-bipy)(2)](2+) complex cation and a (As(V)S(4))(3-) anion acts as a countercation for a polythioarsenate anion, [As(III)S(S(5))](-). The title compounds exhibit optical gaps in the range 1.58-2.48 eV and blue photoluminescence. Interestingly, compound 1 displays a weak second harmonic generation (SHG) response being about 1/21 times of KTP (KTiOPO(4)). Magnetic measurements show paramagnetic behavior for 1 and dominant antiferromagnetic behavior for 2-5. Of particular interest is 4, which is the first manganese chalcogenide showing spin-canting characteristic. 相似文献
14.
Dubois L Xiang DF Tan XS Pécaut J Jones P Baudron S Le Pape L Latour JM Baffert C Chardon-Noblat S Collomb MN Deronzier A 《Inorganic chemistry》2003,42(3):750-760
Reactions of the unsymmetrical phenol ligand 2-(bis(2-pyridylmethyl)aminomethyl)-6-((2-pyridylmethyl)(benzyl)aminomethyl)-4-methylphenol with Mn(OAc)(2).4H(2)O or Mn(H(2)O)(6)(ClO(4))(2) in the presence of NaOBz affords the dimanganese(II) complexes 1(CH(3)OH), [Mn(2)(L)(OAc)(2)(CH(3)OH)](ClO(4)), and 2(H(2)O), [Mn(2)(L)(OBz)(2)(H(2)O)](ClO(4)), respectively. On the other hand, reaction of the ligand with hydrated manganese(III) acetate furnishes the mixed-valent derivative 3(H(2)O), [Mn(2)(L)(OAc)(2)(H(2)O)](ClO(4))( 2). The three complexes have been characterized by X-ray crystallography. 1(CH(3)OH) crystallizes in the monoclinic system, space group P2(1)/c, with a = 10.9215(6) A, b = 20.2318(12) A, c = 19.1354(12) A, alpha = 90 degrees, beta = 97.5310(10) degrees, gamma = 90 degrees, V = 4191.7 A(3), and Z = 4. 2(H(2)O) crystallizes in the monoclinic system, space group P2(1)/n, with a = 10.9215(6) A, b = 20.2318(12) A, c = 19.1354(12) A, alpha = 90 degrees, beta = 97.5310(10) degrees, gamma = 90 degrees, V = 4191.7 A(3), and Z = 4. 3(H(2)O) crystallizes in the monoclinic system, space group P2(1)/c, with a = 11.144(6) A, b = 18.737(10) A, c = 23.949(13) A, alpha = 90 degrees, beta = 95.910(10) degrees, gamma = 90 degrees, V = 4974(5) A(3), and Z = 4. Magnetic measurements revealed that the three compounds exhibit very similar magnetic exchange interactions -J = 4.3(3) cm(-)(1). They were used to establish tentative magneto-structural correlations which show that for the dimanganese(II) complexes -J decreases when the Mn-O(phenoxo) distance increases as expected from orbital overlap considerations. For the dimanganese(II,III) complexes, crystallographic results show that the Mn(II)-O(phenoxo) and Mn(III)-O(phenoxo) bond lengths are inversely correlated. An interesting magneto-structural correlation is found between -J and the difference between these bond lengths, delta(Mn)(-)(O) = d(Mn)()II(-)(O) - d(Mn)()III(-)(O): the smaller this difference, the larger -J. Electrochemical studies show that the mixed-valence state is favored in 1-3 by ca. 100 mV with respect to analogous complexes of symmetrical ligands, owing to the asymmetry of the electron density as found in the analogous diiron complexes. 相似文献
15.
Reactions of [(eta(6)-arene)RuCl(2)](2) 1 (arene = p-cymene (a), 1,2,3,4-Me(4)C(6)H(2) (b), 1,2,3-Me(3)C(6)H(2) (c)) with tris(2,6-dimethoxyphenyl)phosphine (TDMPP) led to loss of two molecules of CH(3)Cl to give (eta(6)-arene)Ru[{2-O-C(6)H(3)-6-OMe}(2){C(6)H(3)(OMe)(2)-2,6}], 2a-c, which contains a trihapto ligand (eta(3)-P,O,O) derived from TDMPP, whereas the 1,3,5-Me(3)C(6)H(3) (1d), 1,2,3,5-Me(4)C(6)H(2) (1e), and C(6)Me(6) (1f) complexes did not react with TDMPP. The structures of 2a and 2b were confirmed by X-ray analyses: for 2a, a = 11.691(2) ?, b = 15.228(2) ?, c = 10.320(1) ?, alpha = 95.93(1) degrees, beta = 113.783(9) degrees, gamma = 83.86(1) degrees, triclinic, P&onemacr;, Z = 2, R = 0.051; for 2b, a = 17.79(2) ?, b = 15.43(1) ?, c = 20.93(1) ?, beta = 91.25(8) degrees, monoclinic, P2(1)/n, Z = 8, R = 0.056. Bis(2,6-dimethoxyphenyl)phenylphosphine (BDMPP) reacted with 1a, 1b, and 1d at room temperature to give (eta(6)-arene)RuCl[PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}], 3a,b,d, which contains a dihapto (eta(2)-P,O) ligand derived from BDMPP by an X-ray analysis of 3a: a = 12.33(1) ?, b = 14.246(8) ?, c = 11.236(9) ?, alpha = 91.47(8) degrees, beta = 117.28(6) degrees, gamma = 111.70(6) degrees, triclinic, P&onemacr;, Z = 2, R = 0.040. A similar reaction with 1f recovered the starting materials, but that in refluxing MeCN produced [(eta(6)-C(6)Me(6))Ru[PPh(2-O-C(6)H(3)-6-OMe}(2)], 4f, containing a trihapto (eta(3)-P,O,O) ligand derived from BDMPP. Complex 1d reacted with BDMPP at reflux in MeCN/CH(2)Cl(2) and resulted in a loss of an arene ring to give a five-coordinate complex, Ru[eta(2)-P,O-PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}](2)(MeCN), 5. Treatment of (2,6-dimethoxyphenyl)diphenylphosphine (MDMPP) with 1f gave (eta(6)-C(6)Me(6))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe)],6f, and that with 1b gave (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe}], 6b, and (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl(2)[eta(1)-P-PPh(2){C(6)H(3)(OMe)(2)-2,6}],7b. The phosphine ligand of 6b acted as a bidentate ligand derived from MDMPP: a = 8.074(4) ?, b = 16.816(3) ?, c = 18.916(4) ?, beta = 94.05(3) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.051. Transformation of 7b to 6b readily occurred accompanying an elimination of MeCl. Reaction of 1a with MDMPP eliminated an arene ring to give the octahedral compound RuCl(2)[eta(2)-P,OMe-PPh(2){C(6)H(3)(MeO)(2)-2,6}](2), 8. An X-ray analysis of 8 showed that two MDMPP ligands were in a cis-position: a = 10.596(14) ?, b = 27.586(12) ?, c = 13.036(8) ?, beta = 108.17(7) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.035. 相似文献
16.
Chisholm MH Davidson ER Quinlan KB 《Journal of the American Chemical Society》2002,124(51):15351-15358
Calculations employing density functional theory (Gaussian 98, B3LYP, LANL2DZ, 6-31G) have been undertaken to interrogate the factors influencing the metathesis reaction involving M-M, C-C, and M-C triple bonds for the model compounds M(2)(EH)(6), M(2)(EH)(6)(mu-C(2)H(2)), and [(HE)(3)M(tbd1;CH)](2), where M = Mo, W and E = O, S. Whereas in all cases the ethyne adducts are predicted to be enthalpically favored in the reactions between M(2)(EH)(6) compounds and ethyne, only when M = W and E = O is the alkylidyne product [(HO)(3)W(tbd1;CH)](2) predicted to be more stable than the alkyne adduct. For the reaction M(2)(EH)(6)(mu-C(2)H(2)) --> [(HE)(3)M(tbd1;CH)](2), the deltaG degrees values (kcal mol(-)(1)) are -6 (M = W, E = O), +5 (M = Mo, E = O), +18 (M = W, E = S), and +21 (M = Mo, E = S) and the free energies of activation are calculated to be deltaG() = +19 kcal mol(-)(1) (M = W, E = O) and +34 kcal mol(-)(1) (M = Mo, E = O), where the transition state involves an asymmetric bridged structure M(2)(OH)(4)(mu-OH)(2)(CH)(mu-CH) in which the C-C bond has broken; C.C = 1.89 and 1.98 A for W and Mo, respectively. These results are discussed in terms of the experimental observations of the reactions involving ethyne and the symmetrically substituted alkynes (RCCR, where R = Me, Et) with M(2)(O(t)()Bu)(6) and M(2)(O(t)()Bu)(2)(S(t)()Bu)(4) compounds, where M = Mo, W. 相似文献
17.
Keramidas AD Papaioannou AB Vlahos A Kabanos TA Bonas G Makriyannis A Rapropoulou CP Terzis A 《Inorganic chemistry》1996,35(2):357-367
Reaction of the amide ligand N-[2-((2-pyridylmethylene)amino)phenyl]pyridine-2-carboxamide (Hcapca) with VCl(3) affords the compound trans-[VCl(2)(capca)] (1), the first example of a vanadium(III) complex containing a vanadium-deprotonated amide nitrogen bond, while reaction of bis(pentane-2,4-dionato)oxovanadium(IV) with the related ligands N-[2-((2-phenolylmethylene)amino)phenyl]pyridine-2-carboxamide (H(2)phepca), 1-(2-hydroxybenzamido)-2-(2-pyridinecarboxamido)benzene (H(3)hypyb), and 1,2-bis(2-hydroxybenzamido)benzene (H(4)hybeb) yields the complexes [VO(phepca)] (2), Na[VO(hypyb)].2CH(3)OH (4.2CH(3)OH), and Na(2)[VO(hybeb)].3CH(3)OH (5.3CH(3)OH) respectively. The preparation of the complex {N-[2-((2-thiophenoylmethylene)amino)phenyl]pyridine-2-carboxamido}oxovanadium(IV) (3) has been achieved by reaction of N-(2-aminophenyl)pyridine-2-carboxamide and 2-mercaptobenzaldehyde with [VO(CH(3)COO)(2)](x)(). Oxidation of complex 5.3CH(3)OH with silver nitrate gives its vanadium(V) analogue (8.CH(3)OH), which is readily converted to its corresponding tetraethylammonium salt (10.CH(2)Cl(2)) by a reaction with Et(4)NCl. The crystal structures of the octahedral 1.CH(3)CN, and the square-pyramidal complexes 3, 4.CH(3)CN, 5.2CH(3)OH, and 10 were demonstrated by X-ray diffraction analysis. Crystal data are as follows: 1.CH(3)CN, C(18)H(13)Cl(2)N(4)OV.CH(3)CN M(r) = 464.23, monoclinic, P2(1)/n, a = 10.5991(7) ?, b = 13.9981(7) ?, c = 14.4021(7) ?, beta = 98.649(2)(o), V = 2112.5(3) A(3), Z = 4, R = 0.0323, and R(w) 0.0335; 3, C(19)H(13)N(3)O(2)SV, M(r) = 398.34, monoclinic, P2(1)/n, a = 12.1108(10) ?, b = 19.4439(18) ?, c = 7.2351(7) ?, beta = 103.012(3) degrees, V = 1660.0(4) ?(3), Z = 4, R = 0.0355, and R(w) = 0.0376; 4.CH(3)CN, C(19)H(12)N(3)O(4)VNa.CH(3)CN, M(r) = 461.31, monoclinic, P2(1)/c, a = 11.528(1) ?, b = 11.209(1) ?, c = 16.512(2) ?, beta = 103.928(4)(o), V = 2071.0(5) ?(3), Z = 4, R = 0.0649, and R(w) = 0.0806; 5.2CH(3)OH, C(20)H(10)N(2)O(5)VNa(2).2CH(3)OH, M(r) = 519.31, triclinic, P1, a = 12.839(1) ?, b = 8.334(1) ?, c = 12.201(1) ?, alpha = 106.492(2) degrees, beta = 105.408(2) degrees, gamma = 73.465(2) degrees, V = 1175.6(3) ?(3), Z = 2, R = 0.0894, and R(w) = 0.1043; 10, C(28)H(32)N(3)O(5)V M(r) = 541.52, monoclinic, P2(1)/c, a = 11.711(3) ?, b = 18.554(5) ?, c = 12.335(3) ?, beta = 95.947(9) degrees, V = 2666(2) ?(3), Z = 4, R = 0.0904, and R(w) = 0.0879. In addition to the synthesis and crystallographic studies, we report the optical, infrared, magnetic, and electrochemical properties of these complexes. Electron paramagnetic resonance [of oxovanadium(IV) species] and (1)H, (13)C{(1)H}, and (51)V nuclear magnetic resonance [of oxovanadium(V) complex] properties are reported as well. This study represents the first systematic study of vanadium(III), V(IV)O(2+), and V(V)O(3+) species containing a vanadium-deprotonated amide nitrogen bond. 相似文献
18.
The addition of 4.0 equiv of Na(silox) to Na[W(2)Cl(7)(THF)(5)] afforded (silox)(2)ClW&tbd1;WCl(silox)(2) (1, 65%). Treatment of 1 with 2.0 equiv of MeMgBr in Et(2)O provided (silox)(2)MeW&tbd1;WMe(silox)(2) (2, 81%). In the presence of 1 atm of H(2), reduction of 1 with 2.0 equiv of Na/Hg in DME provided (silox)(2)HW&tbd1;WH(silox)(2) (3, 70%), characterized by a hydride resonance at delta 19.69 (J(WH) = 325 Hz, (1)H NMR). Exposure of 2 to 1 atm of H(2) yielded 3 and CH(4) via (silox)(2)HW&tbd1;WMe(silox)(2) (4); use of D(2) led to [(silox)(2)WD](2) (3-d(2)). Exposure of 3 to ethylene ( approximately 1 atm, 25 degrees C) in hexanes generated (silox)(2)EtW&tbd1;WEt(silox)(2) (5), but solutions of 5 reverted to 3 and free C(2)H(4) upon standing. NMR spectral data are consistent with a sterically locked, gauche, C(2) symmetry for 1-5. Thermolysis of 3 at 100 degrees C (4 h) resulted in partial conversion to (silox)(2)HW&tbd1;W(OSi(t)Bu(2)CMe(2)CH(2))(silox) (6a, approximately 60%) and free H(2), while extended thermolysis with degassing (5 d, 70 degrees C) produced a second cyclometalated rotational isomer, 6b (6a:6b approximately 3:1). When left at 25 degrees C (4 h) in sealed NMR tubes, 6 and free H(2) regenerated 3. Reduction of 1 with 2.0 equiv of Na/Hg in DME also afforded 6a (25%). When 3 was exposed to approximately 3 atm of H(2), equilibrium amounts of [(silox)(2)WH(2)](2) (7) were observed by (1)H NMR spectroscopy (3 + H(2) right harpoon over left harpoon 7; 25.9-88.7 degrees C, DeltaH = -9.6(4) kcal/mol, DeltaS = -21(2) eu). Benzene solutions of 3 and 1-3 atm of D(2) revealed incorporation of deuterium into the silox ligands, presumably via intermediate 6. In sealed tubes containing [(silox)(2)WCl](2) (1) and dihydrogen (1-3 atm), (1)H NMR spectral evidence for [(silox)(2)WCl](2)(&mgr;-H)(2) (8) was obtained, suggesting that formation of 3 from 1 proceeded via reduction of 8. Alternatively, 3 may be formed from direct reduction of 1 to give [(silox)(2)W](2) (9), followed by H(2) addition. Hydride chemical shifts for 7 are temperature dependent, varying from delta 1.39 (-70 degrees C, toluene-d(8)), to delta 3.68 (90 degrees C). (29)Si{(1)H} NMR spectra revealed a similar temperature dependence of the silox (delta 12.43, -60 degrees C, to delta 13.64, 45 degrees C) resonances. These effects may arise from thermal population of a low-lying, deltadelta, paramagnetic excited state of D(2)(d)() [(silox)(2)W](2)(&mgr;-H)(4) (DeltaE approximately 2.1 kcal/mol, chi(7a) approximately 0.03), an explanation favored over thermal equilibration with an energetically similar but structurally distinct isomer (e.g., [(silox)(2)WH(2)](2)(&mgr;-H)(2), DeltaG degrees approximately 0.69 kcal/mol, chi(7b) approximately 0.25) on the basis of spectral arguments. Extended Hückel and ab initio molecular orbital calculations on model complexes [(H(3)SiO)(2)W](2)(&mgr;-H)(4) (staggered bridged 7a', EHMO), [(H(3)SiO)(2)WH(2)](2) (all-terminal 7b', EHMO), [(H(3)SiO)(2)W](2) (9', EHMO), (HO)(4)W(2)(H(4)) (staggered-bridged 7", ab initio), and (HO)(4)W(2)(H(4)) (bent-terminal 7, ab initio) generally support the explanation of a thermally accessible excited state and assign 7 a geometry intermediate between the all-terminal and staggered-bridged forms. 相似文献
19.
(H(3)O)(2)[V(4)(HPO(4))(PO(4))(3)O(6)F](2)[NC(7)H(14)](6) (labeled ULM-17) has been hydrothermally synthesized (150 degrees, 24 h, autogeneous pressure). It is monoclinic (space group P2(1)/c (No. 14)) with a = 21.4747(6) ?, b = 17.7223(5) ?, c = 20.1616(6) ?, beta = 94.329(1) degrees, and Z = 4. The structure consists in the hexagonal close packing of discrete hydronium cations, protonated quinuclidine and molecular anions [V(4)(HPO(4))(PO(4))(3)O(6)F](4)(-) (1) The structure presents two kinds of octameric anions built up from the tetrahedral arrangement of V(V)O(5)F octahedra sharing edges and vertices, capped by phosphorus tetrahedra. The stability of the solid is ensured via strong hydrogen bonds between the oxygens of the polyanions and the hydrogens of both hydronium and quinuclidinium cations. The particuliar location of fluorine at the center of the molecular anion 4-fold coordinated by V(V) was studied by solid state NMR. 相似文献
20.
Kadish KM Autret M Ou Z Akiba Ky Masumoto S Wada R Yamamoto Y 《Inorganic chemistry》1996,35(19):5564-5569
The following five antimony(V) tetraphenylporphyrins with sigma-bonded antimony-carbon bonds were synthesized: [(TPP)Sb(CH(3))(2)](+)PF(6)(-), [(TPP)Sb(OCH(3))(OH)](+)PF(6)(-), [(TPP)Sb(CH(3))(OH)](+)ClO(4)(-), [(TPP)Sb(CH(3))(OCH(3))](+)ClO(4)(-), and [(TPP)Sb(CH(3))(F)](+)PF(6)(-). Each compound is stable toward air and moisture and has a high melting point (>250 degrees C). The electrochemistry and spectroelectrochemistry of these sigma-bonded porphyrins were examined in benzonitrile or dichloromethane containing 0.1 M tetrabutylammonium perchlorate as supporting electrolyte and the data compared to those for three previously synthesized OEP derivatives containing similar sigma-bonded and/or anionic axial ligands. Each porphyrin shows two reversible reductions and up to a maximun of one oxidation within the potential window of the solvent. Spectroelectrochemical data indicate formation of a porphyrin pi anion radical upon the first reduction as do ESR spectra of the singly reduced species. However, a small amount of the Sb(III) porphyrin products may be generated via a chemical reaction following electron tranfer. An X-ray crystallographic analysis of [(TPP)Sb(CH(3))(F)](+)PF(6)(-) is also presented: monoclinic, space group C2/c, Z = 8, a = 24.068(5) ?, b = 19.456(4) ?, c = 18.745(3) ?, beta = 94.69(2) degrees, R = 0.056. 相似文献