共查询到20条相似文献,搜索用时 968 毫秒
1.
Yucesan G Golub V O'Connor CJ Zubieta J 《Dalton transactions (Cambridge, England : 2003)》2005,(13):2241-2251
The hydrothermal reactions of CuSO4.5H2O, Na3VO4, 2,2':6':2'-terpyridine (terpy), and the appropriate organophosphonate ligand yield a series of materials of the Cu(ii)-terpy/oxovanadium organophosphonate family. The complexes exhibit distinct structures spanning one-, two- and three-dimensions and exhibiting diverse oxovanadium building blocks. Thus, [{Cu(terpy)}(V2O4)(O3PPh)(HO3PPh)2] (1) is one-dimensional and constructed from binuclear units of corner-sharing V(v) square pyramids. While [{Cu(terpy)}VO(O3PCH2PO3)] (2), [{Cu(terpy)}2(V4O10)(O3PCH2CH2PO3)] (3), and [{Cu(terpy)}(V2O4){O3P(CH2)3PO3}].2.5H(2)O (4.2.5H2O) are similarly one-dimensional, the V/O structural components consist of isolated V(iv) square pyramids, tetranuclear V(v) units of three tetrahedra and one square pyramid in a corner-sharing arrangement, and isolated V(v) tetrahedra and square pyramids, respectively. The second propylenediphosphonate derivative, [{Cu(terpy)}(V2O4){O3P(CH2)3PO3}] (5) is three-dimensional and exhibits isolated V(v) tetrahedra as the vanadate component. The two-dimensional structure of [{Cu(terpy)(H2O)}(V3O6){O3P(CH2)4PO3}] (6) is mixed valence with isolated V(iv) square pyramids and binuclear units of corner-sharing V(v) tetrahedra providing the V/O substructures. 相似文献
2.
The hydrothermal syntheses of a family of new alkali-metal/ammonium vanadium(V) methylphosphonates, M(VO(2))(3)(PO(3)CH(3))(2) (M = K, NH(4), Rb, Tl), are described. The crystal structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) have been determined from single-crystal X-ray data. Crystal data: K(VO(2))(3)(PO(3)CH(3))(2), M(r) = 475.93, trigonal, R32 (No. 155), a = 7.139(3) ?, c = 19.109(5) ?, Z = 3; NH(4)(VO(2))(3)(PO(3)CH(3))(2), M(r) = 454.87, trigonal, R32 (No. 155), a = 7.150(3) ?, c = 19.459(5) ?, Z = 3. These isostructural, noncentrosymmetric phases are built up from hexagonal tungsten oxide (HTO) like sheets of vertex-sharing VO(6) octahedra, capped on both sides of the V/O sheets by PCH(3) entities (as [PO(3)CH(3)](2-) methylphosphonate groups). In both phases, the vanadium octahedra display a distinctive two short + two intermediate + two long V-O bond distance distribution within the VO(6) unit. Interlayer potassium or ammonium cations provide charge balance for the anionic (VO(2))(3)(PO(3)CH(3))(2) sheets. Powder X-ray, TGA, IR, and Raman data for these phases are reported and discussed. The structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) are compared and contrasted with related layered phases based on the HTO motif. 相似文献
3.
Keramidas AD Papaioannou AB Vlahos A Kabanos TA Bonas G Makriyannis A Rapropoulou CP Terzis A 《Inorganic chemistry》1996,35(2):357-367
Reaction of the amide ligand N-[2-((2-pyridylmethylene)amino)phenyl]pyridine-2-carboxamide (Hcapca) with VCl(3) affords the compound trans-[VCl(2)(capca)] (1), the first example of a vanadium(III) complex containing a vanadium-deprotonated amide nitrogen bond, while reaction of bis(pentane-2,4-dionato)oxovanadium(IV) with the related ligands N-[2-((2-phenolylmethylene)amino)phenyl]pyridine-2-carboxamide (H(2)phepca), 1-(2-hydroxybenzamido)-2-(2-pyridinecarboxamido)benzene (H(3)hypyb), and 1,2-bis(2-hydroxybenzamido)benzene (H(4)hybeb) yields the complexes [VO(phepca)] (2), Na[VO(hypyb)].2CH(3)OH (4.2CH(3)OH), and Na(2)[VO(hybeb)].3CH(3)OH (5.3CH(3)OH) respectively. The preparation of the complex {N-[2-((2-thiophenoylmethylene)amino)phenyl]pyridine-2-carboxamido}oxovanadium(IV) (3) has been achieved by reaction of N-(2-aminophenyl)pyridine-2-carboxamide and 2-mercaptobenzaldehyde with [VO(CH(3)COO)(2)](x)(). Oxidation of complex 5.3CH(3)OH with silver nitrate gives its vanadium(V) analogue (8.CH(3)OH), which is readily converted to its corresponding tetraethylammonium salt (10.CH(2)Cl(2)) by a reaction with Et(4)NCl. The crystal structures of the octahedral 1.CH(3)CN, and the square-pyramidal complexes 3, 4.CH(3)CN, 5.2CH(3)OH, and 10 were demonstrated by X-ray diffraction analysis. Crystal data are as follows: 1.CH(3)CN, C(18)H(13)Cl(2)N(4)OV.CH(3)CN M(r) = 464.23, monoclinic, P2(1)/n, a = 10.5991(7) ?, b = 13.9981(7) ?, c = 14.4021(7) ?, beta = 98.649(2)(o), V = 2112.5(3) A(3), Z = 4, R = 0.0323, and R(w) 0.0335; 3, C(19)H(13)N(3)O(2)SV, M(r) = 398.34, monoclinic, P2(1)/n, a = 12.1108(10) ?, b = 19.4439(18) ?, c = 7.2351(7) ?, beta = 103.012(3) degrees, V = 1660.0(4) ?(3), Z = 4, R = 0.0355, and R(w) = 0.0376; 4.CH(3)CN, C(19)H(12)N(3)O(4)VNa.CH(3)CN, M(r) = 461.31, monoclinic, P2(1)/c, a = 11.528(1) ?, b = 11.209(1) ?, c = 16.512(2) ?, beta = 103.928(4)(o), V = 2071.0(5) ?(3), Z = 4, R = 0.0649, and R(w) = 0.0806; 5.2CH(3)OH, C(20)H(10)N(2)O(5)VNa(2).2CH(3)OH, M(r) = 519.31, triclinic, P1, a = 12.839(1) ?, b = 8.334(1) ?, c = 12.201(1) ?, alpha = 106.492(2) degrees, beta = 105.408(2) degrees, gamma = 73.465(2) degrees, V = 1175.6(3) ?(3), Z = 2, R = 0.0894, and R(w) = 0.1043; 10, C(28)H(32)N(3)O(5)V M(r) = 541.52, monoclinic, P2(1)/c, a = 11.711(3) ?, b = 18.554(5) ?, c = 12.335(3) ?, beta = 95.947(9) degrees, V = 2666(2) ?(3), Z = 4, R = 0.0904, and R(w) = 0.0879. In addition to the synthesis and crystallographic studies, we report the optical, infrared, magnetic, and electrochemical properties of these complexes. Electron paramagnetic resonance [of oxovanadium(IV) species] and (1)H, (13)C{(1)H}, and (51)V nuclear magnetic resonance [of oxovanadium(V) complex] properties are reported as well. This study represents the first systematic study of vanadium(III), V(IV)O(2+), and V(V)O(3+) species containing a vanadium-deprotonated amide nitrogen bond. 相似文献
4.
Amine-templated vanadium sulfates of the formula [HN(CH(2))(6)NH][(V(IV)O)(2)(OH)(2)(SO(4))(2)].H(2)O, I, [H(3)N(CH(2))(2)NH(3)][V(III)(OH)(SO(4))(2)].H(2)O, II, and [H(2)N(CH(2))(4)NH(2)][(V(IV)O)(H(2)O)(SO(4))(2)], III, have been prepared under hydrothermal conditions. These vanadium sulfates add to the new emerging family of organically templated metal sulfates. Compound I has a linear chain structure consisting of V(2)O(8) square-pyramid dimers connected by corner-sharing SO(4) tetrahedra, creating four-membered rings along the chain. Both II and III possess simple linear chain topologies formed by VO(6) octahedra and SO(4) tetrahedra, with II having the tancoite chain structure. Compound I crystallizes in the triclinic space group P1 (No. 2) with a = 7.4852(4) A, b = 9.5373(5) A, c = 11.9177(6) A, alpha = 77.22 degrees, beta = 76.47(2) degrees, gamma = 80.86 degrees, Z = 2. Compound II: monoclinic, space group P2(1)/c (No. 14), a = 6.942(2) A, b = 10.317(3) A, c = 15.102(6) A, beta = 90.64(4) degrees, Z = 4. Compound III: triclinic, space group P1 (No. 2) with a = 6.2558(10) A, b = 7.0663(14) A, c = 15.592(4) A, alpha = 90.46(2) degrees, beta = 90.47(2) degrees, gamma = 115.68(2) degrees, Z = 2. Magnetic susceptibility measurements reveal weak antiferromagnetic interactions in I and III and ferromagnetic interactions in II. 相似文献
5.
Hydrothermal reactions of the V2O5/2,2':6':2"-terpyridine/ZnO/H2O system under a variety of conditions yielded the organic-inorganic hybrid materials [V2O4(terpy)2]3[V10O28].2H2O (VOXI-10), [VO2(terpy)][V4O10] (VOXI-11), and [V9O22(terpy)3] (VOXI-12). The structure of VOXI-10 consists of discrete binuclear cations [V2O4(terpy)2]2+ and one-dimensional chains [V10O28]6-, constructed of cyclic [V4O12]4- clusters linked through (VO4) tetrahedra. In contrast, the structure of VOXI-11 exhibits discrete mononuclear cations [VO2(terpy)]1+ and a two-dimensional vanadium oxide network, [V4O10]1-. The structure of the oxide layer is constructed from ribbons of edge-sharing square pyramids; adjacent ribbons are connected through corner-sharing interactions into the two-dimensional architecture. VOXI-12 is also a network structure; however, in this case the terpy ligand is incorporated into the two-dimensional oxide network whose unique structure is constructed from cyclic [V6O18]6- clusters and linear (V3O5(terpy)3) moieties of corner-sharing vanadium octahedra. The rings form chains through corner-sharing linkages; adjacent chains are connected through the trinuclear units. Crystal data: VOXI-10, C90H70N18O42V16, triclinic P1, a = 12.2071(7) A, b = 13.8855(8) A, 16.9832(10) A, alpha = 69.584(1) degrees, beta = 71.204(1) degrees, gamma = 84.640(1) degrees, Z = 1; VOXI-11, C15H11N3O12V5, monoclinic, P2(1)/n, a = 7.7771(1) A, b = 10.3595(2) A, c = 25.715(4) A, beta = 92.286(1) degrees, Z = 4; VOXI-12, C45H33N9O22V9, monoclinic C2/c, a = 23.774(2) A, b = 9.4309(6) A, c = 25.380(2) A, beta = 112.047(1) degrees, Z = 4. 相似文献
6.
1 INTRODUCTION Metal organophosphonates have attracted considerable attention for over three decades due to their potential or practical applications, include- ing ion exchanges[1, 2], molecular sensors[3] and optics[4, 5]. Recently, a number of porous m… 相似文献
7.
Tetranuclear V(III) complexes, [HB(pz)(3)](4)V(4)(&mgr;-C(6)H(5)OPO(3))(4) (I), its acetonitrile solvate (I.4CH(3)CN), and [HB(pz)(3)](4)V(4)(&mgr;-O(2)NC(6)H(4)OPO(3))(4).4C(7)H(8).H(2)O (II), and tetranuclear vanadyl complexes, (t-Bupz)(4)V(4)O(4)(&mgr;-C(6)H(5)PO(3))(4).2H(2)O (III) and (t-Bupz)(5)V(4)O(4)(&mgr;-C(6)H(5)PO(3))(4).4CH(3)CN.0.6 H(2)O (IV), have been prepared and characterized by spectroscopic, magnetic, and electrochemical methods (pz = pyrazole, t-Bupz = tert-butylpyrazole). The use of organic solvents and bulky organic groups as ancillary ligands leads to formation of neutral species instead of the anionic clusters commonly found in the hydrothermal synthesis of vanadium organophosphate/phosphonate systems. Complexes I.4CH(3)CN and IV have also been characterized by single-crystal X-ray diffraction. Crystal data: I.4CH(3)CN, triclinic, P&onemacr;, a = 15.495(3) ?, b = 17.000(3) ?, c = 17.949(4) ?, alpha = 89.17(3) degrees, beta = 86.00(3) degrees, gamma = 78.60(3) degrees, Z = 2; IV, triclinic, P&onemacr;, a = 15.541(3) ?, b = 16.340(2) ?, c = 19.069(5) ?, alpha = 83.58(2) degrees, beta = 79.67(2) degrees, gamma = 63.68(1) degrees, Z = 2. Both are closed clusters, the core structure of the first consisting of a cubane-like arrangement of metal octahedra and phosphate tetrahedra and the core structure of the second consisting of a distorted, collapsed variant of the first. Unlike other vanadium phosphate clusters, these compounds form in the absence of a central, templating agent. As such they represent the simplest form of a closed cluster in which steric forces and cluster connectivity requirements play the primary role in organizing the cluster framework. 相似文献
8.
The hydrothermal reactions of MoO(3), an appropriate Cu(II) source, tetra-2-pyridylpyrazine (tpypyz), and phosphoric acid and/or an organophosphonate yielded a series of organic-inorganic hybrid materials of the copper-molybdophosphonate family. A common feature of the structures is the entrainment within the extended architectures of chemically robust [Mo(5)O(15)(O(3)PR)(2)](4)(-) clusters as molecular building blocks. The cluster is a characteristic feature of the one-dimensional materials [[Cu(2)(tpypyz)(H(2)O)(3)]Mo(5)O(15)(HPO(4))(O(3)PCH(2)CO(2)H)].H(2)O (1.H(2)O) and [[Cu(2)(tpypyz)(H(2)O)]Mo(5)O(15)(O(3)PC(6)H(5))(2)].2H(2)O (2.2H(2)O), the two-dimensional network [[Cu(2)(tpypyz)(H(2)O)(3)]Mo(5)O(15)(HPO(4))(2)].2H(2)O (5.2H(2)O) and the three-dimensional frameworks [[Cu(2)(tpypyz)(H(2)O)(2)]Mo(5)O(15)[O(3)P(CH(2))(n)()PO(3)]].xH(2)O [n = 3, x = 2.25 (6.2.25H(2)O); n = 4, x = 0.33 (7.0.33H(2)O)]. In the case of methylenediphosphonate as the phosphorus component, the unique chelating nature of the ligand precludes formation of the pentamolybdate core, resulting in the chain structures [[Cu(2)(tpypyz)(H(2)O)]Mo(3)O(8) (HO(3)PCH(2)PO(3))(2)].8H(2)O (3.8H(2)O) and [[Cu(2)(tpypyz)(H(2)O)](2)(Mo(3)O(8))(2)(O(3)PCH(2)PO(3))(3)].16.9H(2)O (4.16.9H(2)O). For structures 1-7, the secondary metal-ligand building block is the binuclear [Cu(2)(tpypyz)(H(2)O)(x)](4+) cluster. There is considerable structural versatility as a result of the variability in the number of attachment sites at the phosphomolybdate clusters, the coordination geometry of the Cu(II), which may be four-, five-, or six-coordinate, the extent of aqua ligation, and the participation of phosphate oxygen atoms as well as molybdate oxo groups in bonding to the copper sites. Crystal data: 1.H(2)O, C(26)H(28)N(6)Cu(2)Mo(5)O(28)P(2), monoclinic C2/c, a = 42.497(2) A, b = 10.7421(4) A, c = 20.5617(8) A, beta = 117.178(1) degrees, V = 8350.1(5) A(3), Z = 8; 2.2H(2)O, C(36)H(32)N(6)Cu(2)Mo(5)O(24)P(2), monoclinic P2(1)/c, a = 11.2478(7) A, b = 19.513(1) A, c = 21.063(1) A, beta = 93.608(1) degrees, V = 4613.7(5) A(3), Z = 4; 3.8H(2)O, C(26)H(40)N(6)Cu(2)Mo(3)O(29)P(4), monoclinic C2/c, a = 32.580(2) A, b = 17.8676(9) A, c = 15.9612(8) A, beta = 104.430(1) degrees, V = 8993.3(8) A(3), Z = 8; 4.16.9H(2)O, C(51)H(71.75)Cu(4)Mo(6)N(12)O(51)P(6), monoclinic P2(1)/c, a = 27.929(3) A, b = 12.892(2) A, c = 22.763(3) A, beta = 90.367(2) degrees, V = 8195.7(2) A(3), Z = 4;( )()5.2H(2)O, C(24)H(28)N(6)Cu(2)Mo(5)O(28)P(2), monoclinic P2(1)/n, a = 11.3222(4) A, b = 18.7673(7) A, c = 19.4124(7) A, beta = 98.819(1) degrees, V = 4076.1(3) A(3), Z = 4; 6.2.25H(2)O, C(27)H(28.5)N(6)Cu(2)Mo(5)O(24.25)P(2), monoclinic C2/c, a = 12.8366(5) A, b = 18.4221(8) A, c = 34.326(1) A, beta = 100.546(1) degrees, V = 7980.1(6) A(3), Z = 8; 7.(1)/(3)H(2)O, C(28)H(28.7)N(6)Cu(2)Mo(5)O(23.3)P(2), monoclinic C2/c, a = 12.577(1) A, b = 18.336(1) A, c = 36.476(3) A, beta = 91.929(2) degrees, V = 8407.3 A(3), Z = 8. 相似文献
9.
Ouellette W Koo BK Burkholder E Golub V O'Connor CJ Zubieta J 《Dalton transactions (Cambridge, England : 2003)》2004,(10):1527-1538
Hydrothermal reactions of Na3VO4, an appropriate Cu(II) source, bisterpy and an organodiphosphonate, H2O3P(CH2)nPO3H2 (n = 1-6) yielded a family of materials of the type [Cu2(bisterpy)]4+/VxOy(n-)/[O3P(CH2)nPO3]4-. This family of bimetallic oxides is characterized by an unusual structural diversity. The oxides [[Cu2(bisterpy)]V2O4[O3PCH2PO3H]2] (1), [[Cu2(bisterpy)(H2O)]VO2[O3P(CH2)3PO3][HO3P(CH2)3PO3H2]] (4) and [[Cu2(bisterpy)]V2O4[O3P(CH2)6PO3H]2].2H2O (7.2H2O) are one-dimensional, while [[Cu2(bisterpy)(H2O)2]V2O4[O3P(CH2)2PO3][HO3P(CH2)2PO3H]2] (2), [[Cu2(bisterpy)]V4O8[O3P(CH23PO3]2].4H2O (3.4H2O) and [[Cu2(bisterpy)]V2O4(OH)2[O3P(CH2)4PO3]].4H2O (5.4H2O) are two-dimensional. The V(IV) oxide [[Cu2(bisterpy)]V4O4[O3P(CH2)5PO3H]4].7.3H2O (6.7.3H2O) provides a relatively unusual example of a three-dimensional bimetallic oxide phosphonate. The structures reveal a variety of V/P/O substructures as building blocks. 相似文献
10.
Hydrothermal reactions of solutions containing a vanadate source, an organodiphosphonate, an organonitrogen component, and HF (V/P/O/F) yield a series of oxyfluorovanadium-diphosphonates with charge-compensation provided by organoammonium cations or hydronium cations. While V/P/O/F networks provide the recurrent structural motif, the linkage between the layers and the details of the polyhedral connectivities within the layers are quite distinct for the five structures of this study. [H2pip][V4F4O2(H2O)2{O3P(CH2)3PO3}2] (1) (pip = piperazine) is a conventional three-dimensional (3D) "pillared" layer structure, whose V/P/O/F networks are buttressed by the propylene chains of the diphosphonate ligands. In contrast, [H2en][V2O2F2(H2O)2{O3P(CH2)4PO3}] (2) and [H2en]2[V6F12(H2O)2{O3P(CH2)5PO3}2 {HO3P(CH2)5PO3H}] (3) are two-dimensional (2D) slablike structures constructed of pairs of V/P/O/F networks sandwiching the pillaring organic tethers of the diphosphonate ligands. Despite the common overall topology, the layer substructures are quite different: isolated {VO5F} octahedra in 2 and chains of corner-sharing {VO(3)F(3)} octahedra in 3. The 3D structure of [H2en]2[V7O6F4(H2O)2{O3P(CH2)2PO3}4].7H2O (4.7H2O) exhibits a layer substructure that contains the ethylene bridges of the diphosphonate ligands and are linked through corner-sharing octahedral {VO6} sites. The connectivity requirements provide large channels that enclose readily removed water of crystallization. The structure of [H3O][V3F2(H2O)2{O3P(CH2)2PO3}2].3.5H2O (5.3.5H2O) is also 3D. Because of the similiarity with 4.7H2O, it exhibits V/P/O/F layers that include the organic tethers of the diphosphonates and are linked through corner-sharing {VO6} octahedra. In contrast to the network substructure of 4.7H2O, which contains binuclear and trinuclear vanadium clusters, the layers of 5.3.5 H2O are constructed from chains of corner-sharing {VO4F2} octahedra. Thermal studies of the open framework materials 4 and 5 reveal that incorporation of fluoride into the inorganic substructures provides robust scaffoldings that retain their crystallinity to 450 degrees C and above. In the case of 4, dehydration does not change the powder X-ray diffraction pattern of the material, which remains substantially unchanged to 450 degrees C. In the case of 5, there are two dehydration steps, that is, the higher temperature process associated with loss of coordinated water. This second dehydration results in structural changes as monitored by powder X-ray diffraction, but this new phase is retained to ca. 450 degrees C. The materials of this study exhibit a range of reduced oxidation states: 1 is mixed valence V(IV)/V(III) while 2 and 4.7H(2)O are exclusively V(IV) and 3 and 5.3.5H2O are exclusively V(III). These oxidation states are reflected in the magnetic properties of the materials. The paramagnetism of 1 arises from the presence of V(III) and V(IV) sites and conforms to the Curie-Weiss law with C = 2.38 em K/(Oe mol) and = -66 K with mu(eff) (300 K) = 4.33 mu(B). Compounds 3-5 exhibit Curie-Weiss law dependence of magnetism on temperature with mu(eff) (300 K) = 5.45 mu(B) for 3 (six V(III) sites), mu(eff) = 4.60 mu(B) for 4 (seven V(IV) sites) and mu(eff) = 4.13 mu(B) for 5 (two V(III) sites). Compound 2 exhibits antiferromagnetic interactions, and the magnetism may be described in terms of the Heisenberg linear antiferromagnetic chain model for V(IV). The effective magnetic moment at 300 K is 2.77 mu(B) (two V(IV) sites). 相似文献
11.
The hydrothermal reactions of MCl(2).6H2O (M = Co, Ni) NaVO3, 4,4'-dipyridylamine (dpa), and H2O yield materials of the type [M(Hdpa)2V4O12] (M = Co (1), Ni (2)). The two-dimensional structures of 1 and 2 are constructed from bimetallic oxide networks (MV4O12)n2n- with monodentate Hdpa projecting the protonated ring into the interlamellar region. The oxide network may be described as ruffled chains of corner-sharing (VO4) tetrahedra linked by (NiO4N2) octahedra into the two-dimensional assembly. Crystal data: C10H10Co0.5N3O6V2(1), monoclinic P2(1)/c, a = 10.388(1) A, b = 7.6749(7) A, c = 16.702(2) A, beta = 102.516(1) degrees, Z = 4. C10H10N3Ni0.5O6V2 (2), monoclinic, P2(1)/c, c = 10.3815(2) A, b = 7.7044(2) A, c = 16.6638(4) A, beta = 102.573(1) degrees, Z = 4. 相似文献
12.
(H(3)O)(2)[V(4)(HPO(4))(PO(4))(3)O(6)F](2)[NC(7)H(14)](6) (labeled ULM-17) has been hydrothermally synthesized (150 degrees, 24 h, autogeneous pressure). It is monoclinic (space group P2(1)/c (No. 14)) with a = 21.4747(6) ?, b = 17.7223(5) ?, c = 20.1616(6) ?, beta = 94.329(1) degrees, and Z = 4. The structure consists in the hexagonal close packing of discrete hydronium cations, protonated quinuclidine and molecular anions [V(4)(HPO(4))(PO(4))(3)O(6)F](4)(-) (1) The structure presents two kinds of octameric anions built up from the tetrahedral arrangement of V(V)O(5)F octahedra sharing edges and vertices, capped by phosphorus tetrahedra. The stability of the solid is ensured via strong hydrogen bonds between the oxygens of the polyanions and the hydrogens of both hydronium and quinuclidinium cations. The particuliar location of fluorine at the center of the molecular anion 4-fold coordinated by V(V) was studied by solid state NMR. 相似文献
13.
The reaction of UO(2)(NO(3))(2).6H(2)O with Cs(2)CO(3) or CsCl, H(3)PO(4), and Ga(2)O(3) under mild hydrothermal conditions results in the formation of Cs(4)[(UO(2))(2)(GaOH)(2)(PO(4))(4)].H(2)O (UGaP-1) or Cs[UO(2)Ga(PO(4))(2)] (UGaP-2). The structure of UGaP-1 was solved from a twinned crystal revealing a three-dimensional framework structure consisting of one-dimensional (1)(infinity)[Ga(OH)(PO(4))(2)](4-) chains composed of corner-sharing GaO(6) octahedra and bridging PO(4) tetrahedra that extend along the c axis. The phosphate anions bind the UO(2)(2+) cations to form UO(7) pentagonal bipyramids. The UO(7) moieties edge-share to create dimers that link the gallium phosphate substructure into a three-dimensional (3)(infinity)[(UO(2))(2)(GaOH)(2)(PO(4))(4)](4-) anionic lattice that has intersecting channels running down the b and c axes. Cs(+) cations and water molecules occupy these channels. The structure of UGaP-2 is also three-dimensional and contains one-dimensional (1)(infinity)[Ga(PO(4))(2)](3-) gallium phosphate chains that extend down the a axis. These chains are formed from fused eight-membered rings of corner-sharing GaO(4) and PO(4) tetrahedra. The chains are in turn linked together into a three-dimensional (3)(infinity)[UO(2)Ga(PO(4))(2)](1-) framework by edge-sharing UO(7) dimers as occurs in UGaP-1. There are channels that run down the a and b axes through the framework. These channels contain the Cs(+) cations. Ion-exchange studies indicate that the Cs(+) cations in UGaP-1 and UGaP-2 can be exchanged for Ca(2+) and Ba(2+). Crystallographic data: UGaP-1, monoclinic, space group P2(1)/c, a = 18.872(1), b = 9.5105(7), c = 14.007(1) A, beta = 109.65(3)(o) , Z = 4 (T = 295 K); UGaP-2, triclinic, space group P, a = 7.7765(6), b = 8.5043(7), c = 8.9115(7) A, alpha = 66.642(1)(o), beta = 70.563(1)(o), gamma = 84.003(2)(o), Z = 2 (T = 193 K). 相似文献
14.
Ushak S Spodine E Le Fur E Venegas-Yazigi D Pivan JY Schnelle W Cardoso-Gil R Kniep R 《Inorganic chemistry》2006,45(14):5393-5398
Two new hybrid organic/inorganic copper oxovanadium diphosphonates [Cu2(phen)2(O3PCH2PO3)(V2O5)(H2O)] x H2O (1) and [(Cu2(phen)2(O3P(CH2)3PO3)(V2O5)] x C3H8 (2) have been obtained by hydrothermal synthesis. The compounds are monoclinic, and they crystallize in the space group P2(1)/n with cell parameters of a = 11.788(2) A, b = 17.887(3) A, c = 14.158(2) A, and beta = 93.99(0) degrees and in the space group C2/c with cell parameters of a = 11.025(1) A, b = 18.664(2) A, c = 15.054(2) A, and beta = 90.06(0) degrees, respectively. Both compounds present two-dimensional frameworks built up from infinite chains of corner-sharing vanadium tetrahedra and diphosphonate groups connected by copper tetramers for (1) and copper dimers for (2). The remarkable feature of (2) is the encapsulation of propane molecules, stabilized by strong hydrogen bonding between the layers. The magnetic properties of the compounds have been investigated showing antiferromagnetic coupling with Tmax = 64 K for (1) and Curie-like paramagnetic behavior for (2). 相似文献
15.
Ouellette W Golub V O'Connor CJ Zubieta J 《Dalton transactions (Cambridge, England : 2003)》2005,(2):291-309
Hydrothermal reactions of a vanadate source, an appropriate Cu(II) source, bisterpy and an organodiphosphonate, H2O3P(CH2)nPO3H2(n= 1-5), in the presence of HF, yielded a family of materials of the type oxyfluorovanadium/copper-bisterpy/organodiphosphonate. Under similar reaction conditions, variations in diphosphonate tether length n provided the one-dimensional [{Cu2(bisterpy)}V2F2O2{HO3PCH2PO3}{O3PCH2PO3}](1) and [{Cu2(bisterpy)}V2F4O4{HO3P(CH2)2PO3H}](3), the two-dimensional [{Cu2(bisterpy)}V2F2O2(H2O)2{HO3P(CH2)2PO3}2] x 2H2O (2 x 2H2O), [{Cu2(bisterpy)(H2O2}V2F2O2{O3P(CH2)3PO3}{HO3P(CH2)3PO3H}(4) and [{Cu2(bisterpy)}V4F4O4(OH)(H2O){HO3P(CH2)5PO3}{O3P(CH2)5PO3}] x H2O (9 x H2O) and the three-dimensional [{Cu2(bisterpy)}3V8F6O17{HO3P(CH2)3PO3}4]0.8H2O (5 x 0.8H2O), [{Cu2(bisterpy)}V4F2O6{O3P(CH2)4PO3}2](8) and [{Cu2(bisterpy)(H2O)}2V8F4O8(OH)4{HO3P(CH2)5PO3H}2{O3P(CH2)5PO)}3] x 4.8H2O (10 x 4.8H2O). In addition, two members of the oxovanadium/Cu2(bisterpy)/organodiphosphonate family [{Cu2(bisterpy)}V2O4{HO3P(CH2)3PO3}2](6) and [{Cu2(bisterpy)}3V4O8(OH)2{O3P(CH2)3PO3}2{HO3P(CH2)3PO3}2] x 5H2O (7 x 5H2O) cocrystallized from the reaction mixture which provided 5. The overall architectures reveal embedded substructures based on V/P/O(F) clusters, chains, networks, and frameworks. In contrast to the oxovanadium/Cu2(bisterpy)/ organodiphosphonate family, several of the materials of this study also exhibit the direct condensation of vanadium polyhedra to produce binuclear and/or tetranuclear building units. 相似文献
16.
Two new compounds containing the title diphosphono-polyoxometalate anion and diprotonated ethylenediamine (enH(2)) or piperazine (ppzH(2)) countercations have been hydrothermally synthesized and structurally characterized ((enH(2))(4)[Mo(7)O(16)(O(3)PCH(2)PO(3))(3)].7H(2)O, triclinic, P(-)1, Z = 2, a = 10.3455(7) A, b = 13.136(1) A, and c = 20.216(3) A, alpha = 93.247(6) degrees, beta = 96.434(6) degrees, and gamma = 111.900(6) degrees; (ppzH(2))(4)[Mo(7)O(16)(O(3)PCH(2)PO(3))(3)].8H(2)O, triclinic, P(-)1, Z = 2, a = 13.255(2) A, b = 13.638(2) A, and c = 16.874(4) A, alpha = 93.20(2) degrees, beta = 101.27(2) degrees, and gamma = 105.87(1) degrees). The anion is a ring of three pairs of edge-sharing octahedra of Mo(V)O(6) (with Mo(V)-Mo(V) bonds) that share corners with each other. The diphosphonate groups connect the pairs at the periphery. The ring is "capped" by a tetrahedron of Mo(VI)O(4). According to magnetic measurements, the compounds are diamagnetic. 相似文献
17.
Two new iron(III) oxalatophosphates, Cs2Fe(C2O4)(0.5)(HPO4)2 (1) and CsFe(C2O4)(0.5)(H2PO4)(HPO4) (2), have been synthesized by using a low melting point eutectic mixture of choline chloride and malonic acid as a solvent and characterized by single-crystal X-ray diffraction and magnetic susceptibility. Crystal data are as follows: compound 1, monoclinic, P2(1)/c (No. 14), a = 8.5085(4) A, b = 12.7251(6) A, c = 9.8961(4) A, beta = 107.117(1) degrees , V = 1024.01(8) A(3), Z = 4, and R(1) = 0.0264; compound 2, monoclinic, P2(1)/n (No. 14), a = 8.0038(3) A, b = 10.2923(3) A, c = 11.4755(4) A, beta = 100.507(1) degrees , V = 929.47(5) A(3), Z = 4, and R(1) = 0.0311. The structure of 1 comprises FeO6 octahedra connected by HPO4(2-) tetrahedra and bisbidentate oxalate anions to form a 3D framework containing intersecting 12-ring channels, with the charge-compensating Cs+ cations being located at the intersections of these channels. The structure of 2 consists of 2D layers of octahedral FeO6, tetrahedral H2PO4- and HPO4(2-) moieties, and bisbidentate oxalate ligands with the Cs+ cations between the layers. They are the first examples for the use of ionic liquid as a solvent in the synthesis of metal oxalatophosphates. 相似文献
18.
Jüstel T Bendix J Metzler-Nolte N Weyhermüller T Nuber B Wieghardt K 《Inorganic chemistry》1998,37(1):35-43
Reaction of LRu(III)Cl(3) (L = 1,4,7-trimethyl-1,4,7-triazacyclononane) with 1,2-phenylenediamine (opdaH(2)) in H(2)O in the presence of air affords [LRu(II)(bqdi)(OH(2))](PF(6)) (1), where (bqdi) represents the neutral ligand o-benzoquinone diimine. From an alkaline methanol/water mixture of 1 was obtained the dinuclear species [{LRu(II)(bqdi)}(2)(&mgr;-H(3)O(2))](PF(6))(3) (1a). The coordinated water molecule in 1 is labile and can be readily substituted under appropriate reaction conditions by acetonitrile, yielding [LRu(II)(bqdi)(CH(3)CN)](PF(6))(2) (2), and by iodide and azide anions, affording [LRu(II)(bqdi)I](PF(6)).0.5H(2)O (3) and [LRu(bqdi)(N(3))](PF(6)).H(2)O (4), respectively. Heating of solid 4 in vacuum at 160 degrees C generates N(2) and the dinuclear, nitrido-bridged complex [{LRu(o-C(6)H(4)(NH)(2))}(2)(&mgr;-N)](PF(6))(2) (5). Complex 5 is a mixed-valent, paramagnetic species containing one unpaired electron per dinuclear unit whereas complexes 1-4 are diamagnetic. The crystal structures of 1, 1a.3CH(3)CN, 3, 4.H(2)O, and 5.3CH(3)CN.0.5(toluene) have been determined by X-ray crystallography: 1 crystallizes in the monoclinic space group P2(1)/m, Z = 2, with a = 8.412(2) ?, b = 15.562(3) ?, c = 10.025 ?, and beta = 109.89(2) degrees; 1a.3CH(3)CN, in the monoclinic space group C2/c, Z = 4, with a = 19.858(3) ?, b = 15.483(2) ?, c = 18.192(3) ?, and beta = 95.95(2) degrees; 3, in the orthorhombic space group Pnma, Z = 4, with a = 18.399(4) ?, b = 9.287(2) ?, and c = 12.052(2) ?, 4.H(2)O, in the monoclinic space group P2(1)/c, Z = 4, with a = 8.586(1) ?, b = 15.617(3) ?, c = 16.388(5) ?, and beta = 90.84(2) degrees; and 5.3CH(3)CN.0.5(toluene), in the monoclinic space group P2(1)/c, Z = 4, with a = 15.003(3) ?, b = 16.253(3) ?, c = 21.196(4) ?, and beta = 96.78(3) degrees. The structural data indicate that in complexes 1-4 the neutral o-benzoquinone diimine ligand prevails. In contrast, in 5 this ligand has predominantly o-phenylenediamide character, which would render 5 formally a mixed-valent Ru(IV)Ru(V) species. On the other hand, the Ru-N bond lengths of the Ru-N-Ru moiety at 1.805(5) and 1.767(5) ? are significantly longer than those in other crystallographically characterized Ru(IV)=N=Ru(IV) units (1.72-1.74 ?). It appears that the C(6)H(4)(NH)(2) ligand in 5 is noninnocent and that formal oxidation state assignments to the ligands or metal centers are not possible. 相似文献
19.
A 0D vanadium borophosphate [Co(en)(3)](2)[V(3)P(3)BO(19)][H(2)PO(4)].4H(2)O (1) and two 1D vanadium oxides [Co(en)(3)][V(3)O(9)].H(2)O (2) and [Co(dien)(2)][V(3)O(9)].H(2)O (3) have been synthesized hydrothermally from the reaction mixture of V(2)O(5)-H(3)PO(4)-H(3)BO(3)-CoCl(2)-R-H(2)O at 110 degrees C (R: en or dien). The complex cations Co(en)(3)(3+) and Co(dien)(2)(3+) are cooperatively organized in the reaction medium to play a structure-directing role in the formation of the inorganic clusters and chains. The structures are determined by single-crystal X-ray diffraction analysis and further characterized by X-ray powder diffraction, ICP, and TG analyses. The structure of 1 contains isolated [V(3)P(3)BO(19)](5)(-) cluster anions, H(2)PO(4)(-) anions, racemic Co(en)(3)(3+) cations, and H(2)O molecules, which form a complex H-bond network. 2 and 3 both contain chains of corner-sharing VO(4) tetrahedra running along the 2(1) screw axis. The complex cations located in the interchain region interact with the chains through H-bonds. 2 is crystallized in an enantiomorphic space group and only one enantiomer of Co(en)(3)(3+) is involved in the structure. Crystal data: 1, monoclinic, C2/c, a = 32.8492(14) A, b = 11.9601(3) A, c = 22.6001(7) A, beta = 108.9630(8) degrees, Z = 8; 2, orthorhombic, P2(1)2(1)2(1), a = 8.1587(16) A, b = 12.675(3) A, c = 18.046(4) A, Z = 4; 3, monoclinic, P2(1)/c, a = 16.1663(10) A, b = 8.7028(3) A, c = 13.9773(5) A, beta = 103.1340(18) degrees, Z = 4. 相似文献
20.
Friedrich S Memmler H Gade LH Li WS Scowen IJ McPartlin M Housecroft CE 《Inorganic chemistry》1996,35(9):2433-2441
The stabilization of unsupported Ti-M (M = Fe, Ru, Co) heterodinuclear complexes has been achieved by use of amidotitanium building blocks containing tripodal amido ligands. Salt metathesis of H(3)CC(CH(2)NSiMe(3))(3)TiX (1) and C(6)H(5)C(CH(2)NSiMe(3))(3)TiX (2) as well as HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)TiX (3) (X = Cl, a; Br, b) with K[M(CO)(2)Cp] (M = Fe, Ru) and Na[Co(CO)(3)(PR(3))] (R = Ph, Tol) gave the corresponding stable heterobimetallic complexes of which H(3)CC(CH(2)NSiMe(3))(3)Ti-M(CO)(2)Cp (M = Fe, 6; Ru, 7) and HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)Ti-M(CO)(2)Cp (M = Fe, 12; Ru, 13) have been characterized by X-ray crystallography. 6: monoclinic, P2(1)/n, a = 15.496(3) ?, b = 12.983(3) ?, c = 29.219(3) ?, beta = 104.52(2) degrees, Z = 8, V = 5690.71 ?(3), R = 0.070. 7: monoclinic, P2(1)/c, a = 12.977(3) ?, b = 12.084(3) ?, c = 18.217(3) ?, beta = 91.33(2) degrees, Z = 4, V = 2855.91 ?(3), R = 0.048. 12: monoclinic, I2/c, a = 24.660(4) ?, b = 15.452(3) ?, c = 20.631(4) ?, beta = 103.64(3) degrees, Z = 8, V = 7639.65 ?(3), R = 0.079. 13: monoclinic, I2/c, a = 24.473(3) ?, b = 15.417(3) ?, c = 20.783(4) ?, beta = 104.20(2) degrees, Z = 8, V = 7601.84 ?(3), R = 0.066. (1)H- and (13)C-NMR studies in solution indicate free internal rotation of the molecular fragments around the Ti-M bonds. Fenske-Hall calculations performed on the idealized system HC(CH(2)NH)(3)Ti-Fe(CO)(2)Cp (6x) have revealed a significant degree of pi-donor-acceptor interaction between the two metal fragments reinforcing the Ti-Fe sigma-bond. Due to the availability of energetically low-lying pi-acceptor orbitals at the Ti center this partial multiple bonding is more pronounced that in the tin analogue HC(CH(2)NH)(3)Sn-Fe(CO)(2)Cp (15x) in which an N-Sn sigma-orbital may act as pi-acceptor orbital. 相似文献