共查询到20条相似文献,搜索用时 31 毫秒
1.
The reactions of UO(2)(C(2)H(3)O(2))(2).2H(2)O with K(2)TeO(3).H(2)O, Na(2)TeO(3) and TlCl, or Na(2)TeO(3) and Sr(OH)(2).8H(2)O under mild hydrothermal conditions yield K[UO(2)Te(2)O(5)(OH)] (1), Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O (2) and beta-Tl(2)[UO(2)(TeO(3))(2)] (3), or Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2) (4), respectively. The structure of 1 consists of tetragonal bipyramidal U(VI) centers that are bound by terminal oxo groups and tellurite anions. These UO(6) units span between one-dimensional chains of corner-sharing, square pyramidal TeO(4) polyhedra to create two-dimensional layers. Alternating corner-shared oxygen atoms in the tellurium oxide chains are protonated to create short/long bonding patterns. The one-dimensional chains of corner-sharing TeO(4) units found in 1 are also present in 2. However, in 2 there are two distinct chains present, one where alternating corner-shared oxygen atoms are protonated, and one where the chains are unprotonated. The uranyl moieties in 2 are bound by five oxygen atoms from the tellurite chains to create seven-coordinate pentagonal bipyramidal U(VI). The structures of 3 and 4 both contain one-dimensional [UO(2)(TeO(3))(2)](2-) chains constructed from tetragonal bipyramidal U(VI) centers that are bridged by tellurite anions. The chains differ between 3 and 4 in that all of the pyramidal tellurite anions in 3 have the same orientation, whereas the tellurite anions in 4 have opposite orientations on each side of the chain. In 4, there are also additional isolated TeO(3)(2-) anions present. Crystallographic data: 1, orthorhombic, space group Cmcm, a = 7.9993(5) A, b = 8.7416(6) A, c = 11.4413(8) A, Z = 4; 2, orthorhombic, space group Pbam, a = 10.0623(8) A, b = 23.024(2) A, c = 7.9389(6) A, Z = 4; 3, monoclinic, space group P2(1)/n, a = 5.4766(4) A, b = 8.2348(6) A, c = 20.849(3) A, beta = 92.329(1) degrees, Z = 4; 4, monoclinic, space group C2/c, a = 20.546(1) A, b = 5.6571(3) A, c = 13.0979(8) A, beta = 94.416(1) degrees, Z = 4. 相似文献
2.
The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4. 相似文献
3.
Two novel uranyl adipates are reported as synthesized via hydrothermal treatment of uranium oxynitrate and adipic acid. One-dimensional UO(2)(C(6)H(8)O(4))(H(2)O)(2) (1) [a = 9.6306(6) A, c = 11.8125(10) A, tetragonal, P4(3)2(1)2 (No. 96), Z = 4] consists of chains of (UO(2))O(4)(H(2)O)(2) hexagonal bipyramids tethered through a linear adipic acid backbone. Three-dimensional UO(2)(C(6)H(8)O(4)) (2) [a = 5.5835(12) A, b = 8.791(2) A, c = 9.2976(17) A, alpha = 87.769(9) degrees, beta = 78.957(8) degrees, gamma = 81.365(11) degrees, triclinic, P1 (No. 2), Z = 2] is produced by decreasing the hydration level of the reaction conditions. This structure contains a previously unreported [(UO(2))(2)O(8)] building unit cross-linked into a neutral metal-organic framework topology with vacant channels. 相似文献
4.
The alkali metal and alkaline-earth metal uranyl iodates K(2)[(UO(2))(3)(IO(3))(4)O(2)] and Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) have been prepared from the hydrothermal reactions of KCl or BaCl(2) with UO(3) and I(2)O(5) at 425 and 180 degrees C, respectively. While K(2)[(UO(2))(3)(IO(3))(4)O(2)] can be synthesized under both mild and supercritical conditions, the yield increases from <5% to 73% as the temperature is raised from 180 to 425 degrees C. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), however, has only been isolated from reactions performed in the mild temperature regime. Thermal measurements (DSC) indicate that K(2)[(UO(2))(3)(IO(3))(4)O(2)] is more stable than Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) and that both compounds decompose through thermal disproportionation at 579 and 575 degrees C, respectively. The difference in the thermal behavior of these compounds provides a basis for the divergence of their preparation temperatures. The structure of K(2)[(UO(2))(3)(IO(3))(4)O(2)] is composed of [(UO(2))(3)(IO(3))(4)O(2)](2)(-) chains built from the edge-sharing UO(7) pentagonal bipyramids and UO(6) octahedra. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) consists of one-dimensional [(UO(2))(2)(IO(3))(2)O(2)](2)(-) ribbons formed from the edge sharing of distorted UO(7) pentagonal bipyramids. In both compounds the iodate groups occur in both bridging and monodentate binding modes and further serve to terminate the edges of the uranium oxide chains. The K(+) or Ba(2+) cations separate the chains or ribbons in these compounds forming bonds with terminal oxygen atoms from the iodate ligands. Crystallographic data: K(2)[(UO(2))(3)(IO(3))(4)O(2)], triclinic, space group P_1, a = 7.0372(5) A, b = 7.7727(5) A, c = 8.9851(6) A, alpha = 93.386(1) degrees, beta = 105.668(1) degrees, gamma = 91.339(1) degrees, Z = 1; Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), monoclinic, space group P2(1)/c, a = 8.062(4) A, b = 6.940(3) A, c = 21.67(1), beta= 98.05(1) degrees, Z = 4. 相似文献
5.
Wassermann K Lunk HJ Palm R Fuchs J Steinfeldt N Stösser R Pope MT 《Inorganic chemistry》1996,35(11):3273-3279
The previously unknown heteropolyoxometalates [gamma-SiO(4)W(10)O(32)(OH)Cr(2)(OOCR)(2)(OH(2))(2)](5-) (R = H, CH(3)) have been prepared by the reaction of [gamma-SiO(4)W(10)O(32)](8-) with [Cr(OH(2))(6)](3+) in formate or acetate buffer solution. Isolation of these new Cr(III)-substituted polyoxometalates was accomplished both as Cs(+) salts and as the Bu(4)N(+) salt for the acetate-containing anion. The compounds were characterized by elemental analysis, UV/vis, IR, and ESR spectroscopy, and cyclic voltammetry. The single-crystal X-ray structural analysis of (Bu(4)N)(3)H(2)[gamma-SiO(4)W(10)O(32)(OH)Cr(2)(OOCCH(3))(2)(OH(2))(2)].3H(2)O [P2(1)2(1)2(1); a = 17.608(12), b = 20.992(13), c = 24.464(11) ?; Z = 4; R = 0.057 for 6549 observed independent reflections] reveals that the two corner-linked CrO(6) octahedra are additionally bridged by two acetate groups, demonstrating the relationship to the well-studied oxo-centered trinuclear carboxylato complexes of Cr(III). 相似文献
6.
The three-dimensional structure of a complex tubular uranyl phosphonate, (UO(2))(3)(HO(3)PC(6)H(5))(2)(O(3)PC(6)H(5))(2).H(2)O, was determined ab initio from laboratory X-ray powder diffraction data and refined by the Rietveld method. The crystals belong to the space group P2(1)2(1)2(1), with a = 17.1966(2) ?, b = 7.2125(2) ?, c = 27.8282(4) ?, and Z = 4. The structure consists of three independent uranium atoms, among which two are seven-coordinated and the third is eight-coordinated. These metal atoms are connected by four different phosphonate groups to form a one-dimensional channel structure along the b axis. The phenyl groups are arranged on the outer periphery of the channels, and their stacking forces keep the channels intact in the lattice. The determination of this structure which contains 50 non-hydrogen atoms in the asymmetric unit, from conventional X-ray powder data, represents significant progress in the application of powder techniques to structure solution of complex inorganic compounds, including organometallic compounds. 相似文献
7.
Interaction of the lacunary [alpha-XW(9)O(33)](9-) (X = As(III), Sb(III)) with Fe(3+) ions in acidic, aqueous medium leads to the formation of dimeric polyoxoanions, [Fe(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](6-) (X = As(III), Sb(III)) in high yield. X-ray single-crystal analyses were carried out on Na(6)[Fe(4)(H(2)O)(10)(beta-AsW(9)O(33))(2)] x 32H(2)O, which crystallizes in the monoclinic system, space group C2/m, with a = 20.2493(18) A, b = 15.2678(13) A, c = 16.0689(14) A, beta = 95.766(2) degrees, and Z = 2; Na(6)[Fe(4)(H(2)O)(10)(beta-SbW(9)O(33))(2)] x 32H(2)O is isomorphous with a = 20.1542(18) A, b = 15.2204(13) A, c = 16.1469(14) A, and beta = 95.795(2) degrees. The selenium and tellurium analogues are also reported, [Fe(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](4-) (X = Se(IV), Te(IV)). They are synthesized from sodium tungstate and a source of the heteroatom as precursors. X-ray single-crystal analysis was carried out on Cs(4)[Fe(4)(H(2)O)(10)(beta-SeW(9)O(33))(2)] x 21H(2)O, which crystallizes in the triclinic system, space group P macro 1, with a = 12.6648(10) A, b = 12.8247(10) A, c = 16.1588(13) A, alpha = 75.6540(10) degrees, beta = 87.9550(10) degrees, gamma = 64.3610(10) gamma, and Z = 1. All title polyanions consist of two (beta-XW(9)O(33)) units joined by a central pair and a peripheral pair of Fe(3+) ions leading to a structure with idealized C(2h) symmetry. It was also possible to synthesize the Cr(III) derivatives [Cr(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](6-) (X = As(III), Sb(III)), the tungstoselenates(IV) [M(4)(H(2)O)(10)(beta-SeW(9)O(33))(2)]((16)(-)(4n)-) (M(n+) = Cr(3+), Mn(2+), Co(2+), Ni(2+), Zn(2+), Cd(2+), and Hg(2+)), and the tungstotellurates(IV) [M(4)(H(2)O)(10)(beta-TeW(9)O(33))(2)]((16-4n)-) (M(n+) = Cr(3+), Mn(2+), Co(2+), Ni(2+), Cu(2+), Zn(2+), Cd(2+), and Hg(2+)), as determined by FTIR. The electrochemical properties of the iron-containing species were also studied. Cyclic voltammetry and controlled potential coulometry aided in distinguishing between Fe(3+) and W(6+) waves. By variation of pH and scan rate, it was possible to observe the stepwise reduction of the Fe(3+) centers. 相似文献
8.
Bassil BS Dickman MH Reicke M Kortz U Keita B Nadjo L 《Dalton transactions (Cambridge, England : 2003)》2006,(35):4253-4259
The new, monometal substituted silicotungstates [Mn(H(2)O)(2)(gamma-SiW(10)O(35))(2)](10-) (1), [Co(H(2)O)(2)(gamma-SiW(10)O(35))(2)](10-) (2) and [Ni(H(2)O)(2)(gamma-SiW(10)O(35))(2)](10-) (3) have been synthesized and isolated as the potassium salts K(10)[Mn(H(2)O)(2)(gamma-SiW(10)O(35))(2)] x 8.25 H(2)O (K-1), K(10)[Co(H(2)O0(2)(gamma-SiW(10)O(35))(2)] x 8.25 H(2)O (K-2) and K(10)[Ni(H(2)O)(2)(gamma-SiW(10)O(35))(2)] x 13.5 H(2)O (K-3), which have been characterized by IR spectroscopy, single crystal X-ray diffraction, elemental analysis and cyclic voltammetry. Polyanions 1-3 are composed of two (gamma-SiW(10)O(36)) units fused on one side via two W-O-W' bridges and on the other side by an octahedrally coordinated trans-MO(4)(OH(2))(2) transition metal fragment, resulting in a structure with C(2v) point group symmetry. Anions 1-3 were synthesized by reaction of the dilacunary precursor [gamma-SiW(10)O(36)](8-) with Mn(2+), Co(2+) and Ni(2+) ions, respectively, in 1 M KCl solution at pH 4.5. The electrochemical properties of 1-3 were studied by cyclic voltammetry and controlled potential coulometry in a pH 5 buffer medium. The waves associated with the W-centers are compared with each other and with those of the parent lacunary precursor [gamma-SiW(10)O(36)](8-) in the same medium. They appear to be dominated by the acid-base properties of the intermediate reduced species. A facile merging of the waves for 3 is observed while those for 1 and 2 remain split. Controlled potential coulometry of the single wave of 3 or the combined waves of 1 and 2 is accompanied by catalysis of the hydrogen evolution reaction. No redox activity was detected for the Ni(2+) center in 3, whereas the Co(2+) center in 2 shows a one-electron redox process. The two-electron, chemically reversible process of the Mn(2+) center in 1 is accompanied by a film deposition on the electrode surface. 相似文献
9.
The new uranyl molybdate Ag(6)[(UO(2))(3)O(MoO(4))(5)] (1) with an unprecedented uranyl molybdate sheet has been synthesized at 650 degrees C. The structure (monoclinic, C2/c, a = 16.4508(14) A, b = 11.3236(14) A, c = 12.4718(13) A, beta = 100.014(4)(o), V = 2337.4(4) A(3), Z = 4) contains [(UO(2))(3)O(MoO(4))(5)] sheets composed of triuranyl [(UO(2))(3)O] clusters that are connected by MoO(4) tetrahedra. The topology of the uranyl molybdate sheet in 1 represents a major departure from sheets observed in other uranyl compounds. Of the approximately 120 known inorganic uranyl compounds containing sheets of polyhedra, 1 is the only structure that contains trimers of uranyl pentagonal bipyramids that are connected only by the sharing of vertexes with other polyhedra. The sheets are parallel to (001) and are linked by Ag cations. 相似文献
10.
The hydrothermal reaction of MoO(3) with BaH(3)IO(6) at 180 degrees C for 3 days results in the formation of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O (1). Under similar conditions, the reaction of Ba(OH)(2) x 8H(2)O with MoO(3) and Ba(IO(4))(2) x 6H(2)O yields Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O (2). The structure of 1, determined by single-crystal X-ray diffraction, consists of corner- and edge-sharing distorted MoO(6) octahedra that create two-dimensional slabs. Contained within this molybdenum oxide framework are approximately C(2v) tetraoxoiodate(V) anions, IO(4)(3-), that are involved in bonding with five Mo(VI) centers. The two equatorial oxygen atoms of the IO(4)(3-) anion chelate a single Mo(VI) center, whereas the axial atoms are mu(3)-oxo groups and complete the octahedra of four MoO(6) units. The coordination of the tetraoxoiodate(V) anion to these five highly electropositive centers is probably responsible for stabilizing the substantial anionic charge of this anion. The Ba(2+) cations separate the layers from one another and form long ionic contacts with neighboring oxygen atoms and a water molecule. Compound 2 also contains distorted MoO(6) octahedra. However, these solely edge-share with octahedral hexaoxoiodate(VII), IO(6)(5-), anions to form zigzagging one-dimensional, (1)(infinity)[(MoO(2))(IO(6))](3-), chains that are polar. These chains are separated from one another by Ba(2+) cations that are coordinated by additional water molecules. Bond valence sums for the iodine atoms in 1 and 2 are 5.01 and 7.03, respectively. Crystallographic data: 1, monoclinic, space group C2/c, a = 13.584(1) A, b = 7.3977(7) A, c = 20.736(2) A, beta = 108.244(2) degrees, Z = 4; 2, orthorhombic, space group Fdd2, a = 13.356(7) A, b = 45.54(2) A, c = 4.867(3) A, Z = 8. 相似文献
11.
Sokolov MN Dybtsev DN Virovets AV Fedin VP Esparza P Hernandez-Molina R Fenske D Sykes AG 《Inorganic chemistry》2002,41(5):1136-1139
The [3 + 1] reaction of [W(3)S(4)(H(2)O)(9)](4+) with [W(CO)(6)] in 2 M HCl under hydrothermal conditions (130 degrees C) gives the [W(4)S(4)(H(2)O)(12)](6+) cuboidal cluster, reduction potential 35 mV vs NHE (6+/5+ couple). The reduced form is obtained by controlled potential electrolysis. X-ray crystal structure was determined for (Me(2)NH(2))(6)[W(4)S(4)(NCS)(12)].0.5H(2)O. The W-W and W-S bond lengths are 2.840 and 2.379 A, respectively. 相似文献
12.
The transition metal, alkali metal, and main group uranyl selenites, Ag(2)(UO(2))(SeO(3))(2) (1), K[(UO(2))(HSeO(3))(SeO(3))] (2), Rb[(UO(2))(HSeO(3))(SeO(3))] (3), Cs[(UO(2))(HSeO(3))(SeO(3))] (4), Tl[(UO(2))(HSeO(3))(SeO(3))] (5), and Pb(UO(2))(SeO(3))(2) (6), have been prepared from the hydrothermal reactions of AgNO(3), KCl, RbCl, CsCl, TlCl, or Pb(NO(3))(2) with UO(3) and SeO(2) at 180 degrees C for 3 d. The structures of 1-5 contain similar [(UO(2))(SeO(3))(2)](2-) sheets constructed from pentagonal bipyramidal UO(7) units that are joined by bridging SeO(3)(2-) anions. In 1, the selenite oxo ligands that are not utilized within the layers coordinate the Ag(+) cations to create a three-dimensional network structure. In 2-5, half of the selenite ligands are monoprotonated to yield a layer composition of [(UO(2))(HSeO(3))(SeO(3))](1-), and coordination of the K(+), Rb(+), Cs(+), and Tl(+) cations occurs through long ionic contacts. The structure of 6 contains a uranyl selenite layered substructure that differs substantially from those in 1-5 because the selenite anions adopt both bridging and chelating binding modes to the uranyl centers. Furthermore, the Pb(2+) cations form strong covalent bonds with these anions creating a three-dimensional framework. These cations occur as distorted square pyramidal PbO(5) units with stereochemically active lone pairs of electrons. These polyhedra align along the c-axis to create a polar structure. Second-harmonic generation (SHG) measurements revealed a response of 5x alpha-quartz for 6. The diffuse reflectance spectrum of 6 shows optical transitions at 330 and 440 nm. The trailing off of the 440 nm transition to longer wavelengths is responsible for the orange coloration of 6. 相似文献
13.
V Vallet U Wahlgren B Schimmelpfennig Z Szabó I Grenthe 《Journal of the American Chemical Society》2001,123(48):11999-12008
The mechanisms for the exchange of water between [UO(2)(H(2)O)(5)](2+), [UO(2)(oxalate)(2)(H(2)O)](2)(-)(,) and water solvent along dissociative (D), associative (A) and interchange (I) pathways have been investigated with quantum chemical methods. The choice of exchange mechanism is based on the computed activation energy and the geometry of the identified transition states and intermediates. These quantities were calculated both in the gas phase and with a polarizable continuum model for the solvent. There is a significant and predictable difference between the activation energy of the gas phase and solvent models: the energy barrier for the D-mechanism increases in the solvent as compared to the gas phase, while it decreases for the A- and I-mechanisms. The calculated activation energy, Delta U(++), for the water exchange in [UO(2)(H(2)O)(5)](2+) is 74, 19, and 21 kJ/mol, respectively, for the D-, A-, and I-mechanisms in the solvent, as compared to the experimental value Delta H(++) = 26 +/- 1 kJ/mol. This indicates that the D-mechanism for this system can be ruled out. The energy barrier between the intermediates and the transition states is small, indicating a lifetime for the intermediate approximately 10(-10) s, making it very difficult to distinguish between the A- and I-mechanisms experimentally. There is no direct experimental information on the rate and mechanism of water exchange in [UO(2)(oxalate)(2)(H(2)O)](2-) containing two bidentate oxalate ions. The activation energy and the geometry of transition states and intermediates along the D-, A-, and I-pathways were calculated both in the gas phase and in a water solvent model, using a single-point MP2 calculation with the gas phase geometry. The activation energy, Delta U(++), in the solvent for the D-, A-, and I-mechanisms is 56, 12, and 53 kJ/mol, respectively. This indicates that the water exchange follows an associative reaction mechanism. The geometry of the A- and I-transition states for both [UO(2)(H(2)O)(5)](2+) and [UO(2)(oxalate)(2)(H(2)O)](2-) indicates that the entering/leaving water molecules are located outside the plane formed by the spectator ligands. 相似文献
14.
Single crystals of (NH(4))(4)[(UO(2))(5)(MoO(4))(7)](H(2)O)(5) have been synthesized hydrothermally using (NH(4))(6)Mo(7)O(24), (UO(2))(CH(3)COO)(2).2H(2)O, and H(2)O at 180 degrees C. The phase has been characterized by single-crystal X-ray diffraction using a merohedrally twinned single crystal: it is hexagonal, P6(1), a = 11.4067(5) A, c = 70.659(5) A, V = 7961.9(7) A(3), and Z = 6. The structure is based upon an open framework with composition [(UO(2))(5)(MoO(4))(7)](4-) that is composed of UO(7) pentagonal bipyramids that share vertexes with MoO(4) tetrahedra. The framework has large channels (effective pore size: 4.8 x 4.8 A(2)) parallel to the c axis and a system of smaller channels (effective pore size: 2.5 x 3.6 A(2)) parallel to [100], [110], [010], [110], [110], and [110]. The channels are occupied by NH(4)(+) cations and H(2)O molecules. The topological structure of the uranyl molybdate framework can be described either in terms of fundamental chains of UO(7) pentagonal bipyramids and MoO(4) tetrahedra or in terms of tubular building units parallel to the c axis. 相似文献
15.
New quaternary lithium - d(0) cation - lone-pair oxides, Li(6)(Mo(2)O(5))(3)(SeO(3))(6) (Pmn2(1)) and Li(2)(MO(3))(TeO(3)) (P2(1)/n) (M = Mo(6+) or W(6+)), have been synthesized and characterized. The former is noncentrosymmetric and polar, whereas the latter is centrosymmetric. Their crystal structures exhibit zigzag anionic layers composed of distorted MO(6) and asymmetric AO(3) (A = Se(4+) or Te(4+)) polyhedra. The anionic layers stack along a 2-fold screw axis and are separated by Li(+) cations. Powder SHG measurements on Li(6)(Mo(2)O(5))(3)(SeO(3))(6) using 1064 nm radiation reveal a SHG efficiency of approximately 170 × α-SiO(2). Particle size vs SHG efficiency measurements indicate Li(6)(Mo(2)O(5))(3)(SeO(3))(6) is type 1 nonphase-matchable. Converse piezoelectric measurements result in a d(33) value of ~28 pm/V and pyroelectric measurements reveal a pyroelectric coefficient of -0.43 μC/m(2)K at 50 °C for Li(6)(Mo(2)O(5))(3)(SeO(3))(6). Frequency-dependent polarization measurements confirm that Li(6)(Mo(2)O(5))(3)(SeO(3))(6) is nonferroelectric, i.e., the macroscopic polarization is not reversible, or 'switchable'. Infrared, UV-vis, thermogravimetric, and differential thermal analysis measurements and electron localization function calculations were also done for all materials. 相似文献
16.
New synthesis procedures are described to tetranuclear manganese carboxylate complexes containing the [Mn(4)O(2)](8+) or [Mn(4)O(3)X](6+) (X(-) = MeCO(2)(-), F(-), Cl(-), Br(-), NO(3)(-)) core. These involve acidolysis reactions of [Mn(4)O(3)(O(2)CMe)(4)(dbm)(3)] (1; dbm is the anion of dibenzoylmethane) or [Mn(4)O(2)(O(2)CEt)(6)(dbm)(2)] (8) with HX (X(-) = F(-), Cl(-), Br(-), NO(3)(-)); high-yield routes to 1 and 8 are also described. The X(-) = NO(3)(-) complexes [Mn(4)O(3)(NO(3))(O(2)CR)(3)(R'(2)dbm)(3)] (R = Me, R' = H (6); R = Me, R' = Et (7); R = Et, R' = H (12)) represent the first synthesis of the [Mn(4)O(3)(NO(3))](6+) core, which contains an unusual eta(1):mu(3)-NO(3)(-) group. Treatment of known [Mn(4)O(2)(O(2)CEt)(7)(bpy)(2)](ClO(4)) with HNO(3) gives [Mn(4)O(2)(NO(3))(O(2)CEt)(6)(bpy)(2)](ClO(4)) (15) containing a eta(1):eta(1):mu-NO(3)(-) group bridging the two body Mn(III) ions of the [Mn(4)O(2)](8+) butterfly core. Complex 7 x 4CH(2)Cl(2) crystallizes in space group P2(1)2(1)2(1) with (at -168 degrees C) a = 21.110(3) A, b = 22.183(3) A, c = 15.958(2) A, Z = 4, and V = 7472.4(3) A(3). Complex 15 x (3)/(2)CH(2)Cl(2) crystallizes in space group P2(1)/c with (at -165 degrees C) a = 26.025(4) A, b = 13.488(2) A, c = 32.102(6) A, beta = 97.27(1) degrees, Z = 8, and V = 11178(5) A(3). Complex 7 contains a [Mn(4)(mu(3)-O)(3)(mu(3)-NO(3))](6+) core (3Mn(III), Mn(IV)) as seen for previous [Mn(4)O(3)X](6+) complexes. Complex 15 contains a butterfly [Mn(4)(mu(3)-O)(2)](8+) core. (1)H NMR spectra have been recorded for all complexes reported in this work and the various resonances assigned. All complexes retain their structural integrity on dissolution in chloroform and dichloromethane. Magnetic susceptibility (chi(M)) data were collected on 12 in the 5-300 K range in a 10.0 kG (1 T) field. Fitting of the data to the theoretical chi(M) vs T expression appropriate for a [Mn(4)O(3)X](6+) complex of C(3)(v)() symmetry gave J(34) = -23.9 cm(-)(1), J(33) = 4.9 cm(-)(1), and g = 1.98, where J(34) and J(33) refer to the Mn(III)Mn(IV) and Mn(III)Mn(III) pairwise exchange interactions, respectively. The ground state of the molecule is S = 9/2, as found previously for other [Mn(4)O(3)X](6+) complexes. This was confirmed by magnetization data collected at various fields and temperatures. Fitting of the data gave S = 9/2, D = -0.45 cm(-1), and g = 1.96, where D is the axial zero-field splitting parameter. 相似文献
17.
The reaction of the molecular transition metal iodate, Cs[CrO(3)(IO(3))], with UO(3) under mild hydrothermal conditions provides access to a new low-dimensional, mixed-metal U(VI) compound, Cs(2)[(UO(2))(CrO(4))(IO(3))(2)] (1). The structure of 1 is quite unusual and consists of one-dimensional (1)(infinity)[(UO(2))(CrO(4))(IO(3))(2)](2-) ribbons separated by Cs(+) cations. These ribbons are formed from [UO(7)] pentagonal bipyramids that contain a uranyl core, [CrO(4)] tetrahedra, and both monodentate and bridging iodate anions. Crystallographic data: 1, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4 (T = 193 K). 相似文献
18.
Two Np(5+) silicates, Li(6)(NpO(2))(4)(H(2)Si(2)O(7))(HSiO(4))(2)(H(2)O)(4) (LiNpSi1) and K(3)(NpO(2))(3)(SiO(3)OH)(2) (KNpSi1), were synthesized by hydrothermal methods. The crystal structures were determined using direct methods and refined on the basis of F(2) for all unique data collected with Mo Kalpha radation and an APEX II CCD detector. LiNpSi1 crystallizes in orthorhombic space group Pnma with a =13.189(6) A, b = 7.917(3) A, c = 10.708(5) A, V = 1118.1(8) A3, and Z = 2. KNpSi1 is hexagonal, P62m, a = 9.734(1) A, c = 3.8817(7) A, V = 318.50(8) A3, and Z = 1. LiNpSi1 contains chains of edge-sharing neptunyl pentagonal bipyramids linked into two-dimensional sheets through direct linkages between the neptunyl polyhedra and the vertex sharing of the silicate tetrahedra. The structure contains both sorosilicate and nesosilicate units, resulting in a new complex neptunyl silicate sheet. KNpSi1 contains edge-sharing neptunyl square bipyramids linked into a framework structure through the sharing of vertices with the silicate tetrahedra. The neptunyl silicate framework contains channels approximately 6.0 A in diameter. These structures exhibit significant departures from other reported Np(5+) and U(6+) compounds and represent the first reported Np(5+) silicate structures. 相似文献
19.
Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo(8)O(26)](4-) and [V(10)O(28)H(4)](2-) anions were synthesized and structurally characterized: Cu(4)(2-pzc)(4))(H(2)O)(8)(Mo(8)O(26)).2H(2)O (1) and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) A, b = 13.4149(6) A, c = 15.9633(7) A, beta = 90.816(1) degrees; 2, triclinic, space group P1, a = 10.5896(10) A, b = 10.7921(10) A, c = 13.5168(13) A, alpha = 104.689(2) degrees, beta = 99.103(2) degrees, gamma = 113.419(2) degrees. Compound 1 contains [Cu(2-pzc)(H(2)O)(2)] chains charge-balanced by [Mo(8)O(26)](4-) anions. In compound 2, layers of [Cu(3)(2-pzc)(4)(H(2)O)(2)] form cavities that are filled with [V(10)O(28)H(4)](2-) anions. The magnetic properties of both compounds are described. 相似文献
20.
Reaction between the Os(VI)-hydrazido complex, trans-[Os(VI)(tpy)(Cl)(2)(NN(CH(2))(4)O)](2+) (tpy = 2,2':6',2"-terpyridine and O(CH(2))(4)N(-) = morpholide), and a series of N- or O-bases gives as products the substituted Os(VI)-hydrazido complexes, trans-[Os(VI)(4'-RNtpy)(Cl)(2)(NN(CH(2))(4)O)](2+) or trans-[Os(VI)(4'-ROtpy)(Cl)(2)(NN(CH(2))(4)O)](2+) (RN(-) = anilide (PhNH(-)); S,S-diphenyl sulfilimide (Ph(2)S=N(-)); benzophenone imide (Ph(2)C=N(-)); piperidide ((CH(2))(5)N(-)); morpholide (O(CH(2))(4)N(-)); ethylamide (EtNH(-)); diethylamide (Et(2)N(-)); and tert-butylamide (t-BuNH(-)) and RO(-) = tert-butoxide (t-BuO(-)) and acetate (MeCO(2)(-)). The rate law for the formation of the morpholide-substituted complex is first order in trans-[Os(VI)(tpy)(Cl)(2)(NN(CH(2))(4)O)](2+) and second order in morpholine with k(morp)(25 degrees C, CH(3)CN) = (2.15 +/- 0.04) x 10(6) M(-)(2) s(-)(1). Possible mechanisms are proposed for substitution at the 4'-position of the tpy ligand by the added nucleophiles. The key features of the suggested mechanisms are the extraordinary electron withdrawing effect of Os(VI) on tpy and the ability of the metal to undergo intramolecular Os(VI) to Os(IV) electron transfer. These substituted Os(VI)-hydrazido complexes can be electrochemically reduced to the corresponding Os(V), Os(IV), and Os(III) forms. The Os-N bond length of 1.778(4) A and Os-N-N angle of 172.5(4) degrees in trans-[Os(VI)(4'-O(CH(2))(4)Ntpy)(Cl)(2)(NN(CH(2))(4)O)](2+) are consistent with sp-hybridization of the alpha-nitrogen of the hydrazido ligand and an Os-N triple bond. The extensive ring substitution chemistry implied for the Os(VI)-hydrazido complexes is discussed. 相似文献