共查询到20条相似文献,搜索用时 109 毫秒
1.
(H(3)O)(2)[V(4)(HPO(4))(PO(4))(3)O(6)F](2)[NC(7)H(14)](6) (labeled ULM-17) has been hydrothermally synthesized (150 degrees, 24 h, autogeneous pressure). It is monoclinic (space group P2(1)/c (No. 14)) with a = 21.4747(6) ?, b = 17.7223(5) ?, c = 20.1616(6) ?, beta = 94.329(1) degrees, and Z = 4. The structure consists in the hexagonal close packing of discrete hydronium cations, protonated quinuclidine and molecular anions [V(4)(HPO(4))(PO(4))(3)O(6)F](4)(-) (1) The structure presents two kinds of octameric anions built up from the tetrahedral arrangement of V(V)O(5)F octahedra sharing edges and vertices, capped by phosphorus tetrahedra. The stability of the solid is ensured via strong hydrogen bonds between the oxygens of the polyanions and the hydrogens of both hydronium and quinuclidinium cations. The particuliar location of fluorine at the center of the molecular anion 4-fold coordinated by V(V) was studied by solid state NMR. 相似文献
2.
The hydrothermal reactions of a Cu(II) starting material, a molybdate source, 2,2'-bipyridine or terpyridine, and the appropriate alkyldiphosphonate ligand yield two series of bimetallic organophosphonate hybrid materials of the general types [Cu(n)(bpy)(m)Mo(x)O(y)(H(2)O)(p)[O(3)P(CH(2))(n)PO(3)](z)] and [Cu(n)(terpy)(m)Mo(x)O(y)(H(2)O)(p)[O(3)P(CH(2))(n)PO(3)](z)]. The bipyridyl series includes the one-dimensional materials [Cu(bpy)(MoO(2))(H(2)O)(O(3)PCH(2)PO(3))] (1) and [[Cu(bpy)(2)][Cu(bpy)(H(2)O)](Mo(5)O(15))(O(3)PCH(2)CH(2)CH(2)CH(2)PO(3))].H(2)O (5.H(2)O) and the two-dimensional hybrids [Cu(bpy)(Mo(2)O(5))(H(2)O)(O(3)PCH(2)PO(3))].H(2)O (2.H(2)O), [[Cu(bpy)](2)(Mo(4)O(12))(H(2)O)(2)(O(3)PCH(2)CH(2)PO(3))].2H(2)O (3.2H(2)O), and [Cu(bpy)(Mo(2)O(5))(O(3)PCH(2)CH(2)CH(2)PO(3))](4). The terpyridyl series is represented by the one-dimensional [[Cu(terpy)(H(2)O)](2)(Mo(5)O(15))(O(3)PCH(2)CH(2)PO(3))].3H(2)O (7.3H(2)O) and the two-dimensional composite materials [Cu(terpy)(Mo(2)O(5))(O(3)PCH(2)PO(3))] (6) and [[Cu(terpy)](2)(Mo(5)O(15))(O(3)PCH(2)CH(2)CH(2)PO(3))] (8). The structures exhibit a variety of molybdate building blocks including isolated [MoO(6)] octahedra in 1, binuclear subunits in 2, 4, and 6, tetranuclear embedded clusters in 3, and the prototypical [Mo(5)O(15)(O(3)PR)(2)](4-) cluster type in 5, 7, and 8. These latter materials exemplify the building block approach to the preparation of extended structures. 相似文献
3.
The oxothio polyanions gamma-[SiW(10)M(2)S(2)O(38)](6)(-) (M = Mo(V), W(V)) were obtained through stereospecific addition of the dication [M(2)S(2)O(2)](2+) (M = Mo, W) to the divacant gamma-[SiW(10)O(36)](8)(-) anion in dimethylformamide. These compounds were isolated as crystals and are stable in usual organic solvents and in aqueous medium from pH = 1 to pH = 7. NEt(4)Cs(3)H(2)[SiW(10)Mo(2)S(2)O(38)].6H(2)O (a gamma-isomer derived from the alpha Keggin structure capped by the [Mo(2)S(2)O(2)](2+) fragment containing a metal-metal bond) crystallizes in the triclinic space group P&onemacr; with a = 12.050(3) ?, b = 12.695(2) ?, c = 20.111(4) ?, alpha = 74.35(2) degrees, beta = 86.83(2) degrees, gamma = 63.50(2) degrees, Z = 2. NEt(4)Cs(5)[SiW(12)S(2)O(38)].7H(2)O is isostructural and crystallizes in the triclinic space group P&onemacr; with a = 12.197(4) ?, b = 12.714(3) ?, c = 20.298(3) ?, alpha = 74.75(1) ?, beta = 86.48(2) degrees, gamma = 61.80(2) degrees, Z = 2. (183)W NMR spectra of Li(+) salts in aqueous solution agree with the solid state structures and reveal 100% purity for both anions. Polarographic, infrared and UV-vis data are also given. 相似文献
4.
The hydrothermal reactions of MoO(3), an appropriate Cu(II) source, tetra-2-pyridylpyrazine (tpypyz), and phosphoric acid and/or an organophosphonate yielded a series of organic-inorganic hybrid materials of the copper-molybdophosphonate family. A common feature of the structures is the entrainment within the extended architectures of chemically robust [Mo(5)O(15)(O(3)PR)(2)](4)(-) clusters as molecular building blocks. The cluster is a characteristic feature of the one-dimensional materials [[Cu(2)(tpypyz)(H(2)O)(3)]Mo(5)O(15)(HPO(4))(O(3)PCH(2)CO(2)H)].H(2)O (1.H(2)O) and [[Cu(2)(tpypyz)(H(2)O)]Mo(5)O(15)(O(3)PC(6)H(5))(2)].2H(2)O (2.2H(2)O), the two-dimensional network [[Cu(2)(tpypyz)(H(2)O)(3)]Mo(5)O(15)(HPO(4))(2)].2H(2)O (5.2H(2)O) and the three-dimensional frameworks [[Cu(2)(tpypyz)(H(2)O)(2)]Mo(5)O(15)[O(3)P(CH(2))(n)()PO(3)]].xH(2)O [n = 3, x = 2.25 (6.2.25H(2)O); n = 4, x = 0.33 (7.0.33H(2)O)]. In the case of methylenediphosphonate as the phosphorus component, the unique chelating nature of the ligand precludes formation of the pentamolybdate core, resulting in the chain structures [[Cu(2)(tpypyz)(H(2)O)]Mo(3)O(8) (HO(3)PCH(2)PO(3))(2)].8H(2)O (3.8H(2)O) and [[Cu(2)(tpypyz)(H(2)O)](2)(Mo(3)O(8))(2)(O(3)PCH(2)PO(3))(3)].16.9H(2)O (4.16.9H(2)O). For structures 1-7, the secondary metal-ligand building block is the binuclear [Cu(2)(tpypyz)(H(2)O)(x)](4+) cluster. There is considerable structural versatility as a result of the variability in the number of attachment sites at the phosphomolybdate clusters, the coordination geometry of the Cu(II), which may be four-, five-, or six-coordinate, the extent of aqua ligation, and the participation of phosphate oxygen atoms as well as molybdate oxo groups in bonding to the copper sites. Crystal data: 1.H(2)O, C(26)H(28)N(6)Cu(2)Mo(5)O(28)P(2), monoclinic C2/c, a = 42.497(2) A, b = 10.7421(4) A, c = 20.5617(8) A, beta = 117.178(1) degrees, V = 8350.1(5) A(3), Z = 8; 2.2H(2)O, C(36)H(32)N(6)Cu(2)Mo(5)O(24)P(2), monoclinic P2(1)/c, a = 11.2478(7) A, b = 19.513(1) A, c = 21.063(1) A, beta = 93.608(1) degrees, V = 4613.7(5) A(3), Z = 4; 3.8H(2)O, C(26)H(40)N(6)Cu(2)Mo(3)O(29)P(4), monoclinic C2/c, a = 32.580(2) A, b = 17.8676(9) A, c = 15.9612(8) A, beta = 104.430(1) degrees, V = 8993.3(8) A(3), Z = 8; 4.16.9H(2)O, C(51)H(71.75)Cu(4)Mo(6)N(12)O(51)P(6), monoclinic P2(1)/c, a = 27.929(3) A, b = 12.892(2) A, c = 22.763(3) A, beta = 90.367(2) degrees, V = 8195.7(2) A(3), Z = 4;( )()5.2H(2)O, C(24)H(28)N(6)Cu(2)Mo(5)O(28)P(2), monoclinic P2(1)/n, a = 11.3222(4) A, b = 18.7673(7) A, c = 19.4124(7) A, beta = 98.819(1) degrees, V = 4076.1(3) A(3), Z = 4; 6.2.25H(2)O, C(27)H(28.5)N(6)Cu(2)Mo(5)O(24.25)P(2), monoclinic C2/c, a = 12.8366(5) A, b = 18.4221(8) A, c = 34.326(1) A, beta = 100.546(1) degrees, V = 7980.1(6) A(3), Z = 8; 7.(1)/(3)H(2)O, C(28)H(28.7)N(6)Cu(2)Mo(5)O(23.3)P(2), monoclinic C2/c, a = 12.577(1) A, b = 18.336(1) A, c = 36.476(3) A, beta = 91.929(2) degrees, V = 8407.3 A(3), Z = 8. 相似文献
5.
Kortz U Nellutla S Stowe AC Dalal NS Rauwald U Danquah W Ravot D 《Inorganic chemistry》2004,43(7):2308-2317
The novel dimeric germanotungstates [M(4)(H(2)O)(2)(GeW(9)O(34))(2)](12)(-) (M = Mn(2+), Cu(2+), Zn(2+), Cd(2+)) have been synthesized and characterized by IR spectroscopy, elemental analysis, magnetic measurements, and (183)W-NMR spectroscopy. X-ray single-crystal analyses were carried out on Na(12)[Mn(4)(H(2)O)(2)(GeW(9)O(34))(2)].38H(2)O (Na(12)()-1), which crystallizes in the monoclinic system, space group P2(1)/n, with a = 13.0419(8) A, b = 17.8422(10) A, c = 21.1626(12) A, beta = 93.3120(10) degrees, and Z = 2; Na(11)Cs(2)[Cu(4)(H(2)O)(2)(GeW(9)O(34))(2)]Cl.31H(2)O (Na(11)()Cs-2) crystallizes in the triclinic system, space group P, with a = 12.2338(17) A, b = 12.3833(17) A, c = 15.449(2) A, alpha = 100.041(2) degrees, beta = 97.034(2) degrees, gamma = 101.153(2) degrees, and Z = 1; Na(12)[Zn(4)(H(2)O)(2)(GeW(9)O(34))(2)].32H(2)O (Na(12)()-3) crystallizes in the triclinic system, space group P, with a = 11.589(3) A, b = 12.811(3) A, c = 17.221(4) A, alpha = 97.828(6) degrees, beta = 106.169(6) degrees, gamma = 112.113(5) degrees, and Z = 1; Na(12)[Cd(4)(H(2)O)(2)(GeW(9)O(34))(2)].32.2H(2)O (Na(12)()-4) crystallizes also in the triclinic system, space group P, with a = 11.6923(17) A, b = 12.8464(18) A, c = 17.616(2) A, alpha = 98.149(3) degrees, beta = 105.677(3) degrees, gamma = 112.233(2) degrees, and Z = 1. The polyanions consist of two lacunary B-alpha-[GeW(9)O(34)](10)(-) Keggin moieties linked via a rhomblike M(4)O(16) (M = Mn, Cu, Zn, Cd) group leading to a sandwich-type structure. (183)W-NMR studies of the diamagnetic Zn and Cd derivatives indicate that the solid-state polyoxoanion structures are preserved in solution. EPR measurements on Na(12)()-1 at frequencies up to 188 GHz and temperatures down to 4 K yield a single, exchange-narrowed peak, at g(iso) = 1.9949, typical of Mn systems, and an upper limit of |D| = 20.0 mT; its magnetization studies still await further theoretical treatment. Detailed EPR studies on Na(11)()Cs-2 over temperatures down to 2 K and variable frequencies yield g( parallel ) = 2.4303 and g( perpendicular ) = 2.0567 and A( parallel ) = 4.4 mT (delocalized over the Cu(4) framework), with |D| = 12.1 mT. Magnetization studies in addition yield the exchange parameters J(1) = -11 and J(2) = -82 cm(-)(1), in agreement with the EPR studies. 相似文献
6.
The reaction of UO(2)(NO(3))(2).6H(2)O with Cs(2)CO(3) or CsCl, H(3)PO(4), and Ga(2)O(3) under mild hydrothermal conditions results in the formation of Cs(4)[(UO(2))(2)(GaOH)(2)(PO(4))(4)].H(2)O (UGaP-1) or Cs[UO(2)Ga(PO(4))(2)] (UGaP-2). The structure of UGaP-1 was solved from a twinned crystal revealing a three-dimensional framework structure consisting of one-dimensional (1)(infinity)[Ga(OH)(PO(4))(2)](4-) chains composed of corner-sharing GaO(6) octahedra and bridging PO(4) tetrahedra that extend along the c axis. The phosphate anions bind the UO(2)(2+) cations to form UO(7) pentagonal bipyramids. The UO(7) moieties edge-share to create dimers that link the gallium phosphate substructure into a three-dimensional (3)(infinity)[(UO(2))(2)(GaOH)(2)(PO(4))(4)](4-) anionic lattice that has intersecting channels running down the b and c axes. Cs(+) cations and water molecules occupy these channels. The structure of UGaP-2 is also three-dimensional and contains one-dimensional (1)(infinity)[Ga(PO(4))(2)](3-) gallium phosphate chains that extend down the a axis. These chains are formed from fused eight-membered rings of corner-sharing GaO(4) and PO(4) tetrahedra. The chains are in turn linked together into a three-dimensional (3)(infinity)[UO(2)Ga(PO(4))(2)](1-) framework by edge-sharing UO(7) dimers as occurs in UGaP-1. There are channels that run down the a and b axes through the framework. These channels contain the Cs(+) cations. Ion-exchange studies indicate that the Cs(+) cations in UGaP-1 and UGaP-2 can be exchanged for Ca(2+) and Ba(2+). Crystallographic data: UGaP-1, monoclinic, space group P2(1)/c, a = 18.872(1), b = 9.5105(7), c = 14.007(1) A, beta = 109.65(3)(o) , Z = 4 (T = 295 K); UGaP-2, triclinic, space group P, a = 7.7765(6), b = 8.5043(7), c = 8.9115(7) A, alpha = 66.642(1)(o), beta = 70.563(1)(o), gamma = 84.003(2)(o), Z = 2 (T = 193 K). 相似文献
7.
Bhaduri S Tasiopoulos AJ Bolcar MA Abboud KA Streib WE Christou G 《Inorganic chemistry》2003,42(5):1483-1492
The synthesis of new dinuclear manganese(IV) complexes possessing the [Mn(IV)(2)(mu-O)(2)(mu-O(2)CMe)](3+) core and containing halide ions as terminal ligands is reported. [Mn(2)O(2)(O(2)CMe)Cl(2)(bpy)(2)](2)[MnCl(4)] (1; bpy = 2,2'-bipyridine) was prepared by sequential addition of [MnCl(3)(bpy)(H(2)O)] and (NBzEt(3))(2)[MnCl(4)] to a CH(2)Cl(2) solution of [Mn(3)O(4)(O(2)CMe)(4)(bpy)(2)]. The complex [Mn(IV)(2)O(2)(O(2)CMe)Cl(bpy)(2)(H(2)O)](NO(3))(2) (2) was obtained from a water/acetic acid solution of MnCl(2).4H(2)O, bpy, and (NH(4))(2)[Ce(NO(3))(6)], whereas the [Mn(IV)(2)O(2)(O(2)CR)X(bpy)(2)(H(2)O)](ClO(4))(2) [X = Cl(-) and R = Me (3), Et (5), or C(2)H(4)Cl (6); and X = F(-), R = Me (4)] were prepared by a slightly modified procedure that includes the addition of HClO(4). For the preparation of 4, MnF(2) was employed instead of MnCl(2).4H(2)O. [Mn(2)O(2)(O(2)CMe)Cl(2)(bpy)(2)](2)[MnCl(4)].2CH(2)Cl(2) (1.2CH(2)Cl(2)) crystallizes in the monoclinic space group C2/c with a = 21.756(2) A, b = 12.0587(7) A, c = 26.192(2) A, alpha = 90 degrees, beta = 111.443(2) degrees, gamma = 90 degrees, V = 6395.8(6) A(3), and Z = 4. [Mn(2)O(2)(O(2)CMe)Cl(H(2)O)(bpy)(2)](NO(3))(2).H(2)O (2.H(2)O) crystallizes in the triclinic space group Ponemacr; with a = 11.907(2) A, b = 12.376(2) A, c = 10.986(2) A, alpha = 108.24(1) degrees, beta = 105.85(2) degrees, gamma = 106.57(1) degrees, V = 1351.98(2) A(3), and Z = 2. [Mn(2)O(2)(O(2)CMe)Cl(H(2)O)(bpy)(2)](ClO(4))(2).MeCN (3.MeCN) crystallizes in the triclinic space group Ponemacr; with a = 11.7817(7) A, b = 12.2400(7) A, c = 13.1672(7) A, alpha = 65.537(2) degrees, beta = 67.407(2) degrees, gamma = 88.638(2) degrees, V = 1574.9(2) A(3), and Z = 2. The cyclic voltammogram (CV) of 1 exhibits two processes, an irreversible oxidation of the [MnCl(4)](2)(-) at E(1/2) approximately 0.69 V vs ferrocene and a reversible reduction at E(1/2) = 0.30 V assigned to the [Mn(2)O(2)(O(2)CMe)Cl(2)(bpy)(2)](+/0) couple (2Mn(IV) to Mn(IV)Mn(III)). In contrast, the CVs of 2 and 3 show only irreversible reduction features. Solid-state magnetic susceptibility (chi(M)) data were collected for complexes 1.1.5H(2)O, 2.H(2)O, and 3.H(2)O in the temperature range 2.00-300 K. The resulting data were fit to the theoretical chi(M)T vs T expression for a Mn(IV)(2) complex derived by use of the isotropic Heisenberg spin Hamiltonian (H = -2JS(1)S(2)) and the Van Vleck equation. The obtained fit parameters were (in the format J/g) -45.0(4) cm(-)(1)/2.00(2), -36.6(4) cm(-)(1)/1.97(1), and -39.3(4) cm(-)(1)/1.92(1), respectively, where J is the exchange interaction parameter between the two Mn(IV) ions. Thus, all three complexes are antiferromagnetically coupled. 相似文献
8.
A new phenyltin tungstosilicate derivative, [(PhSnOH(2))(2)(gamma-SiW(10)O(36))(2)](10)(-) (1), has been prepared by reaction of phenyltin trichloride with K(8)[gamma-SiW(10)O(36)].xH(2)O. The new heteropolyanion was characterized by elemental analysis, infrared spectroscopy, multinuclear NMR, and X-ray crystallography. The crystals of Cs(9)H[(PhSnOH(2))(2)(gamma-SiW(10)O(36))(2)].16H(2)O (Cs salt of 1) are triclinic, space group P&onemacr;, with lattice constants a = 12.401(3) ?, b = 13.832(3) ?, c = 16.313(3) ?, alpha = 96.17(2) degrees, beta = 109.73(2) degrees, gamma = 97.13(2) degrees, V = 2579.9(10) ?, and Z = 1. Anion 1 has a structure of virtual C(2)(h)() symmetry with two phenyltin groups sandwiched between two gamma-SiW(10) groups. Such a structure is different from all previously reported polytungstates derived from [gamma-SiW(10)O(36)](8)(-) lacunary anions. 相似文献
9.
The compound [PPh(4)](3)[Cr(Te(4))(3)].DMF has been synthesized from the reaction of Cr(CO)(6) with a polytelluride solution in dimethylformamide at 100 degrees C. The compound has been characterized by (125)Te NMR and single-crystal X-ray diffraction techniques. The compound crystallizes in the triclinic space group P(-)1, with a = 12.991(3) A, b = 14.782(3) A, c = 24.628(5) A, alpha= 90.63(3)o, beta= 104.45(3)o, gamma= 106.49(3)o, and Z = 2 (T = 153 K). The [Cr(Te(4))(3)](3-) anion consists of a Cr(III) center chelated by three Te(4)(2-) ligands in a distorted octahedral environment. The anion has the Deltalambdalambdalambda (or Lambdadeltadeltadelta) conformation. 相似文献
10.
An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters. 相似文献
11.
The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4. 相似文献
12.
The syntheses and structural and physical characterization of the compounds [Cu(bipy)(2)](2)[Mo(CN)(8)].5H(2)O. CH(3)OH (1) with bipy = 2,2'-bipyridine and M(II)(2)[Mo(IV)(CN)(8)].xH(2)O (2 with M = Cu, x = 7.5; 3 with M = Mn, x = 9.5) are presented. 1 crystallizes in the triclinic space group P1; (a = 11.3006(4) A, b = 12.0886(5) A, c = 22.9589(9) A, alpha = 81.799(2) degrees, beta = 79.787(2) degrees, gamma = 62.873(2) degrees, Z = 2). The structure of 1 consists of neutral trinuclear molecules in which a central [Mo(CN8)](4-) anion is linked to two [Cu(bipy)2](2+) cations through two cyanide bridges. 2 crystallizes poorly, and hence, structural information has been obtained from the wide-angle X-ray scattering (WAXS) technique, by comparison with 3 and Fe(II)(2)(H(2)O)(4)[Mo(IV)(CN)(8)].4H(2)O whose X-ray structure has been previously solved. 2, 3, and Fe(II)(2)(H(2)O)(4)[Mo(IV)(CN)(8)].4H(2)O form extended networks with all the cyano groups acting as bridges. The magnetic properties have shown that 1 and 2 behave as paramagnets. Under irradiation with light, they exhibit important modifications of their magnetic properties, with the appearance at low temperature of magnetic interactions. For 1 the modifications are irreversible, whereas they are reversible for 2 after cycling in temperature. These photomagnetic effects are thought to be caused by the conversion of Mo(IV) (diamagnetic) to Mo(V)(paramagnetic) through a photooxidation mechanism for 1 and a photoinduced electron transfer in 2. These results have been correlated with the structural features. 相似文献
13.
Hydrothermal reaction of H(3)PO(3), CH(3)NH(2), zinc(II) acetate, 4,4'-bipyridine (bipy), and (NH(4))(6)Mo(7)O(24).4H(2)O at 180 degrees C led to a novel organic-inorganic layered hybrid, [CH(3)NH(3)][H(2)bipy][Zn(4)(bipy)(3)(H(2)O)(2)Mo(V)(8)Mo(VI)O(36)(PO(4))].4H(2)O (1). Its structure was established by single-crystal X-ray diffraction. It crystallizes in the monoclinic space group P2(1)/c with cell parameters of a = 17.3032(2), b = 17.8113(3), and c = 23.4597 (4) A, beta = 106.410(1) degrees, V = 6935.6(2) A(3), and Z = 4. The structure of compound 1 features a novel 2D layer built from the 8e-reduced tetracapped Keggin [Zn(4)Mo(12)O(36)(PO(4))](3)(-) anions, which are further interconnected by bridging bipy ligands. The four zinc(II) ions are in tetrahedral, trigonal bipyramidal, and octahedral coordination geometries, respectively. 相似文献
14.
The novel nickel-substituted, dimeric phosphotungstate [Ni(3)Na(H(2)O)(2)(PW(9)O(34))(2)](11-) (1) has been synthesized and characterized by IR spectroscopy, elemental analysis, and electrochemistry. X-ray single-crystal analysis was carried out on Na(11)[Ni(3)Na(H(2)O)(2)(PW(9)O(34))(2)].21.25H(2)O, which crystallizes in the triclinic system, space group P1, with a = 12.2467(6) A, b = 16.6031(7) A, c = 22.4017(12) A, alpha = 73.9870(10) degrees, beta = 87.6060(10) degrees, gamma = 79.344(2) degrees, and Z = 2. The polyanion consists of two lacunary B-alpha-[PW(9)O(34)](9-) Keggin moieties linked via three nickel(II) centers and a sodium ion. The structure of 1 is composed of two fused Keggin fragments that represent different Baker-Figgis isomers (alpha- vs beta-type). Electrochemical studies show that 1 exhibits a stable and reproducible voltammetric pattern, with a first wave featuring a chemically reversible four-electron/four-proton process. An investigation of the magnetic properties indicates that the three nickel centers exhibit ferromagnetic exchange interaction. 相似文献
15.
Mbomekalle IM Keita B Nierlich M Kortz U Berthet P Nadjo L 《Inorganic chemistry》2003,42(17):5143-5152
The three novel, multi-nickel-substituted heteropolytungstates [Ni(6)As(3)W(24)O(94)(H(2)O)(2)](17)(-) (1), [Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)](11)(-) (2), and [Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)](17)(-) (3) have been synthesized and characterized by IR, elemental analysis, electrochemistry, and magnetic studies. Single-crystal X-ray analysis was carried out on Na(16.5)Ni(0.25)[Ni(6)As(3)W(24)O(94)(H(2)O)(2)].54H(2)O, which crystallizes in the triclinic system, space group P1, with a = 17.450(4) A, b = 17.476(4) A, c = 22.232(4) A, alpha = 85.73(3) degrees, beta = 89.74(3) degrees, gamma = 84.33(3) degrees, and Z = 2, Na(11)[Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)].30.5H(2)O, which crystallizes in the triclinic system, space group P1, with a = 12.228(2) A, b = 16.743(3) A, c = 23.342(5) A, alpha = 78.50(3) degrees, beta = 80.69(3) degrees, gamma = 78.66(3) degrees, and Z = 2, and Na(17)[Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)].50.5H(2)O, which crystallizes in the monoclinic system, space group P2(1)/c, with a = 17.540(4) A, b = 22.303(5) A, c = 35.067(7) A, beta = 95.87(3) A, and Z = 4. Polyanion 1 consists of two B-alpha-(Ni(3)AsW(9)O(40)) Keggin moieties linked via a unique AsW(6)O(16) fragment, leading to a banana-shaped structure with C(2)(v)() symmetry. The mixed-metal tungstophosphate 3 is isostructural with 1. Polyanion 2 consists of two lacunary B-alpha-[AsW(9)O(34)](9)(-) Keggin moieties linked via three nickel(II) centers and a sodium ion. Electrochemical studies show that 1-3 exhibit a unique and reproducible voltammetric pattern and that all three compounds are stable in a large pH range. An investigation of the magnetic properties of 1-3 indicates that the exchange interactions within the trimetal clusters are ferromagnetic. However, for 1 and 3 intra- and intermolecular interactions between different trinuclear clusters are also present. 相似文献
16.
Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo(8)O(26)](4-) and [V(10)O(28)H(4)](2-) anions were synthesized and structurally characterized: Cu(4)(2-pzc)(4))(H(2)O)(8)(Mo(8)O(26)).2H(2)O (1) and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) A, b = 13.4149(6) A, c = 15.9633(7) A, beta = 90.816(1) degrees; 2, triclinic, space group P1, a = 10.5896(10) A, b = 10.7921(10) A, c = 13.5168(13) A, alpha = 104.689(2) degrees, beta = 99.103(2) degrees, gamma = 113.419(2) degrees. Compound 1 contains [Cu(2-pzc)(H(2)O)(2)] chains charge-balanced by [Mo(8)O(26)](4-) anions. In compound 2, layers of [Cu(3)(2-pzc)(4)(H(2)O)(2)] form cavities that are filled with [V(10)O(28)H(4)](2-) anions. The magnetic properties of both compounds are described. 相似文献
17.
Two new phosphates, Bi(4.25)(PO4)2O(3.375) and Bi(5)(PO(4))(2)O(4.5), have been analyzed by single-crystal X-ray diffraction in the series Bi(4+x)(PO4)2O(3+3x/2) (0.175 < or = x < or = 1). The syntheses of the compositions ranging from x = 0.175 to 0.475 were carried out by the ceramic route. The compositions from x = 0.175 to 0.475 form a solid solution with a structure similar to that of Bi(4.25)(PO4)2O(3.375), while Bi(5)(PO4)2O(4.5) was isolated from a mixture of two phases. Both of the phases form fluorite-related structures but, nevertheless, differ from each other with respect to the arrangement of the bismuth atoms. The uniqueness in the structures is the appearance of isolated PO(4) tetrahedra separated by interleaving [Bi2O2] units. ac impedance studies indicate conductivity on the order of 10(-5) S cm(-1) for Bi(4.25)(PO4)2O(3.375). Crystal data: Bi(4.25)(PO4)2O(3.375), triclinic, space group P (No. 1), with a = 7.047(1) A, b = 9.863(2) A, c = 15.365(4) A, alpha = 77.604(4) degrees, beta = 84.556(4) degrees, gamma = 70.152(4) degrees, V = 980.90(4) A3, and Z = 4; Bi(5)(PO4)2O(4.5), monoclinic, space group C2/c (No. 15), with a = 13.093(1) A, b = 5.707(1) A, c = 15.293(1) A, beta = 98.240(2) degrees, V = 1130.95(4) A(3), and Z = 8. 相似文献
18.
Amine-templated vanadium sulfates of the formula [HN(CH(2))(6)NH][(V(IV)O)(2)(OH)(2)(SO(4))(2)].H(2)O, I, [H(3)N(CH(2))(2)NH(3)][V(III)(OH)(SO(4))(2)].H(2)O, II, and [H(2)N(CH(2))(4)NH(2)][(V(IV)O)(H(2)O)(SO(4))(2)], III, have been prepared under hydrothermal conditions. These vanadium sulfates add to the new emerging family of organically templated metal sulfates. Compound I has a linear chain structure consisting of V(2)O(8) square-pyramid dimers connected by corner-sharing SO(4) tetrahedra, creating four-membered rings along the chain. Both II and III possess simple linear chain topologies formed by VO(6) octahedra and SO(4) tetrahedra, with II having the tancoite chain structure. Compound I crystallizes in the triclinic space group P1 (No. 2) with a = 7.4852(4) A, b = 9.5373(5) A, c = 11.9177(6) A, alpha = 77.22 degrees, beta = 76.47(2) degrees, gamma = 80.86 degrees, Z = 2. Compound II: monoclinic, space group P2(1)/c (No. 14), a = 6.942(2) A, b = 10.317(3) A, c = 15.102(6) A, beta = 90.64(4) degrees, Z = 4. Compound III: triclinic, space group P1 (No. 2) with a = 6.2558(10) A, b = 7.0663(14) A, c = 15.592(4) A, alpha = 90.46(2) degrees, beta = 90.47(2) degrees, gamma = 115.68(2) degrees, Z = 2. Magnetic susceptibility measurements reveal weak antiferromagnetic interactions in I and III and ferromagnetic interactions in II. 相似文献
19.
Karet GB Sun Z Heinrich DD McCusker JK Folting K Streib WE Huffman JC Hendrickson DN Christou G 《Inorganic chemistry》1996,35(22):6450-6460
The syntheses and properties of tetra- and pentanuclear vanadium(IV,V) carboxylate complexes are reported. Reaction of (NBzEt(3))(2)[VOCl(4)] (1a) with NaO(2)CPh and atmospheric H(2)O/O(2) in MeCN leads to formation of (NBzEt(3))(2)[V(5)O(9)Cl(O(2)CPh)(4)] 4a; a similar reaction employing (NEt(4))(2)[VOCl(4)] (1b) gives (NEt(4))(2)[V(5)O(9)Cl(O(2)CPh)(4)] (4b). Complex 4a.MeCN crystallizes in space group P2(1)2(1)2(1) with the following unit cell dimensions at -148 degrees C: a = 13.863(13) ?, b = 34.009(43) ?, c = 12.773(11) ?, and Z = 4. The reaction between (NEt(4))(2)[VOBr(4)] (2a) and NaO(2)CPh under similar conditions gives (NEt(4))(2)[V(5)O(9)Br(O(2)CPh)(4)] (6a), and the use of (PPh(4))(2)[VOBr(4)] (2b) likewise gives (PPh(4))(2)[V(5)O(9)Br(O(2)CPh)(4)] (6b). Complex 6b crystallizes in space group P2(1)2(1)2(1) with the following unit cell dimensions at -139 degrees C: a = 18.638(3) ?, b = 23.557(4) ?, c = 12.731(2) ?, and Z = 4. The anions of 4a and 6b consist of a V(5) square pyramid with each vertical face bridged by a &mgr;(3)-O(2)(-) ion, the basal face bridged by a &mgr;(4)-X(-) (X = Cl, Br) ion, and a terminal, multiply-bonded O(2)(-) ion on each metal. The RCO(2)(-) groups bridge each basal edge to give C(4)(v)() virtual symmetry. The apical and basal metals are V(V) and V(IV), respectively (i.e., the anions are trapped-valence). The reaction of 1b with AgNO(3) and Na(tca) (tca = thiophene-2-carboxylate) in MeCN under anaerobic conditions gives (NEt(4))(2)[V(4)O(8)(NO(3))(tca)(4)] (7). Complex 7.H(2)O crystallizes in space group C2/c with the following unit cell dimensions at -170 degrees C: a = 23.606(4) ?, b = 15.211(3) ?, c = 23.999(5) ?, and Z = 4. The anion of 7 is similar to those of 4a and 6b except that the apical [VO] unit is absent, leaving a V(4) square unit, and the &mgr;(4)-X(-) ion is replaced with a &mgr;(4),eta(1)-NO(3)(-) ion. The four metal centers are now at the V(IV), 3V(V) oxidation level, but the structure indicates four equivalent V centers, suggesting an electronically delocalized system. Variable-temperature magnetic susceptibility data were collected on powdered samples of 4b, 6a, and 7 in the 2.00-300 K range in a 10 kG applied field. 4b and 6a both show a slow increase in effective magnetic moment (&mgr;(eff)) from approximately 3.6-3.7 &mgr;(B) at 320 K to approximately 4.5-4.6 &mgr;(B) at 11.0 K and then a slight decrease to approximately 4.2 &mgr;(B) at 2.00 K. The data were fit to the theoretical expression for a V(IV)(4) square with two exchange parameters J = J(cis)() and J' = J(trans)() (H = -2JS(i)()S(j)()): fitting of the data gave, in the format 4b/6a, J= +39.7/+46.4 cm(-)(1), J' = -11.1/-18.2 cm(-)(1) and g = 1.83/1.90, with the complexes possessing S(T) = 2 ground states. The latter were confirmed by magnetization vs field studies in the 2.00-30.0 K and 0.500-50.0 kG ranges: fitting of the data gave S(T) = 2 and D = 0.00 cm(-)(1) for both complexes, where D is the axial zero-field splitting parameter. Complex 7 shows a nearly temperature-independent &mgr;(eff) (1.6-2.0 &mgr;(B)) consistent with a single d electron per V(4) unit. The (1)H NMR spectra of 4b and 6a in CD(3)CN are consistent with retention of their pentanuclear structure on dissolution. The EPR spectrum of 7 in a toluene/MeCN (1:2) solution at approximately 25 degrees C yields an isotropic signal with a 29-line hyperfine pattern assignable to hyperfine interactions with four equivalent I = (7)/(2) (51)V nuclei. 相似文献
20.
The reactions of the binuclear oxomolybdenum(V) complex [Cl(2)(O)Mo(&mgr;-OEt)(2)(&mgr;-HOEt)Mo(O)Cl(2)] (1) with Me(3)Si(allyl) and SbF(3) produce the compounds [Mo(6)O(6)Cl(6)(&mgr;(3)-O)(2)(&mgr;(2)-OEt)(6)(&mgr;(2)-Cl)(2)] (2) and [Mo(8)O(8)Cl(6)(&mgr;(3)-O)(4)(OH)(2)(&mgr;(2)-OH)(4)(&mgr;(2)-OEt)(4)(HOEt)(4)] (3), respectively. Treatment of 1 with the Lewis base PMe(3) affords the tetrameric complex [Mo(4)O(4)Cl(4)(&mgr;(2)-OEt)(4)(HOEt)(2)(&mgr;(3)-O)(2)] (4), which represents another link in the chain of clusters produced by the reactions of 1 and simulating the build-up of polymeric molybdenum oxides by sol-gel methods. The crystal structure of 4 has been determined [C(12)H(32)Cl(4)Mo(4)O(12), triclinic, P&onemacr;, a = 7.376(2) ?, b = 8.807(3) ?, c = 11.467(4) ?, alpha = 109.61(1) degrees, beta = 92.12(3) degrees, gamma = 103.75(2) degrees, Z = 1]. By contrast, reaction of 1 with the nitrogen base NEt(3), followed by treatment with [PPN]Cl.2H(2)O ([PPN](+) = [Ph(3)P=N=PPh(3)](+)), gives the complex [PPN](+)[Et(3)NH](+)[Cl(2)(O)Mo(&mgr;(2)-O)(2)Mo(O)Cl(2)](2)(-) (6) in 90% yield. Its crystal structure [C(36)H(30)Cl(4)MoNOP(2), triclinic, Pna2(1), a = 21.470(6) ?, b = 16.765(2) ?, c = 9.6155(14) ?, alpha = 90 degrees, beta = 90 degrees, gamma = 90 degrees, Z = 16] includes the anion [Cl(2)(O)Mo(&mgr;(2)-O)(2)Mo(O)Cl(2)](2)(-), which is a charged derivative of the species forming the gels in sol-gel processes starting from chloromolybdenum ethoxides. Furthermore, compound 1 is found to be catalytically active in esterification and dehydration reactions of alcohols. 相似文献