共查询到20条相似文献,搜索用时 15 毫秒
1.
The new cyano complexes of formulas PPh(4)[Fe(III)(bipy)(CN)(4)] x H(2)O (1), [[Fe(III)(bipy)(CN)(4)](2)M(II)(H(2)O)(4)] x 4H(2)O with M = Mn (2) and Zn (3), and [[Fe(III)(bipy)(CN)(4)](2)Zn(II)] x 2H(2)O (4) [bipy = 2,2'-bipyridine and PPh(4) = tetraphenylphosphonium cation] have been synthesized and structurally characterized. The structure of complex 1 is made up of mononuclear [Fe(bipy)(CN)(4)](-) anions, tetraphenyphosphonium cations, and water molecules of crystallization. The iron(III) is hexacoordinated with two nitrogen atoms of a chelating bipy and four carbon atoms of four terminal cyanide groups, building a distorted octahedron around the metal atom. The structure of complexes 2 and 3 consists of neutral centrosymmetric [[Fe(III)(bipy)(CN)(4)](2)M(II)(H(2)O)(4)] heterotrinuclear units and crystallization water molecules. The [Fe(bipy)(CN)(4)](-) entity of 1 is present in 2 and 3 acting as a monodentate ligand toward M(H(2)O)(4) units [M = Mn(II) (2) and Zn(II) (3)] through one cyanide group, the other three cyanides remaining terminal. Four water molecules and two cyanide nitrogen atoms from two [Fe(bipy)(CN)(4)](-) units in trans positions build a distorted octahedron surrounding Mn(II) (2) and Zn(II) (3). The structure of the [Fe(phen)(CN)(4)](-) complex ligand in 2 and 3 is close to that of the one in 1. The intramolecular Fe-M distances are 5.126(1) and 5.018(1) A in 2 and 3, respectively. 4 exhibits a neutral one-dimensional polymeric structure containing two types of [Fe(bipy)(CN)(4)](-) units acting as bismonodentate (Fe(1)) and trismonodentate (Fe(2)) ligands versus the divalent zinc cations through two cis-cyanide (Fe(1)) and three fac-cyanide (Fe(2)) groups. The environment of the iron atoms in 4 is distorted octahedral as in 1-3, whereas the zinc atom is pentacoordinated with five cyanide nitrogen atoms, describing a very distorted square pyramid. The iron-zinc separations across the single bridging cyanides are 5.013(1) and 5.142(1) A at Fe(1) and 5.028(1), 5.076(1), and 5.176(1) A at Fe(2). The magnetic properties of 1-3 have been investigated in the temperature range 2.0-300 K. 1 is a low-spin iron(III) complex with an important orbital contribution. The magnetic properties of 3 correspond to the sum of two magnetically isolated spin triplets, the antiferromagnetic coupling between the low-spin iron(III) centers through the -CN-Zn-NC- bridging skeleton (iron-iron separation larger than 10 A) being very weak. More interestingly, 2 exhibits a significant intramolecular antiferromagnetic interaction between the central spin sextet and peripheral spin doublets, leading to a low-lying spin quartet. 相似文献
2.
Doyle RP Nieuwenhuyzen M Kruger PE 《Dalton transactions (Cambridge, England : 2003)》2005,(23):3745-3750
The reaction in water of M(II) ions (M = Cu, 1; Zn, 2; VO, 3) with 2,2'-bipyridine (bipy) followed by Na4P2O7 leads to the formation of three new complexes which feature the pyrophosphate anion, P2O7(4-), as a bridging ligand. Single crystal X-ray diffraction revealed 1 to be {[(bipy)Cu(H2O)(micro-P2O7)Na2(H2O)6] x 4H2O}, and 2 as a tetranuclear Zn(II) complex, {[(bipy)Zn(H2O)(micro-P2O7)Zn(bipy)]2 x 14H2O}. The structure of 1 consists of a mononuclear [(bipy)Cu(H2O)(P2O7)]2- unit that links via a pyrophosphate bridge to two Na atoms. The hydrated six-coordinate Na atoms themselves join together through bridging water molecules to generate a 2D Na-water sheet. The structure of 2 consists of a tetranuclear Zn(II) cluster (dimer-of-dimers) with two pyrophosphate ligands bridging between four metal centres. Adjacent clusters interact through face-to-face pi-pi interactions via the bipy ligands to yield a 2D sheet. Adjacent sheets pack in register to create channels, which are filled by the water molecules of crystallisation. An intricate 2D H-bonded water network separates adjacent sheets and encapsulates the tetranuclear clusters. Aspects of the pyrophosphate coordination modes in 1 and 2 are of structural relevance to those found within the inorganic pyrophosphatases. Compound 3, {[(bipy)(VO)2]2(micro-P2O7)] x 5H2O}, was isolated as an insoluble lime-green powder. Its dinuclear structure was elucidated from elemental and thermal analysis, magnetic susceptibility measurement and IR spectroscopy. The latter displayed characteristic bridging pyrophosphate and signature V=O stretches, which were corroborated by contrast to the IR spectra of 1 and 2 and through comparison with those found in the structurally characterised dinuclear complex, {[(bipy)Cu(H2O)]2(micro-P2O7) x 7H2O}, 4. 相似文献
3.
Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo(8)O(26)](4-) and [V(10)O(28)H(4)](2-) anions were synthesized and structurally characterized: Cu(4)(2-pzc)(4))(H(2)O)(8)(Mo(8)O(26)).2H(2)O (1) and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) A, b = 13.4149(6) A, c = 15.9633(7) A, beta = 90.816(1) degrees; 2, triclinic, space group P1, a = 10.5896(10) A, b = 10.7921(10) A, c = 13.5168(13) A, alpha = 104.689(2) degrees, beta = 99.103(2) degrees, gamma = 113.419(2) degrees. Compound 1 contains [Cu(2-pzc)(H(2)O)(2)] chains charge-balanced by [Mo(8)O(26)](4-) anions. In compound 2, layers of [Cu(3)(2-pzc)(4)(H(2)O)(2)] form cavities that are filled with [V(10)O(28)H(4)](2-) anions. The magnetic properties of both compounds are described. 相似文献
4.
Triantafillou GD Tolis EI Terzis A Deligiannakis Y Raptopoulou CP Sigalas MP Kabanos TA 《Inorganic chemistry》2004,43(1):79-91
Reaction of [V(IV)OCl(2)(THF)(2)] in aqueous solution with 2 equiv of AgBF(4) or AgSbF(6) and then with 2 equiv of 2,2'-bipyridine (bipy), 4,4'-di-tert-butyl-2,2'-bipyridine (4,4'-dtbipy), or 4,4'-di-methyl-2,2'-bipyridine (4,4'-dmbipy) affords compounds of the general formula cis-[V(IV)O(OH)(L(NN))(2)]Y [where L(NN) = bipy, Y = BF(4)(-) (1), L(NN) = 4,4'-dtbipy, Y = BF(4)(-) (2.1.2H(2)O), L(NN) = 4,4'-dmbipy, Y = BF(4)(-) (3.2H(2)O), and L(NN) = 4,4'-dtbipy, Y = SbF(6)(-) (4)]. Sequential addition of 1 equiv of Ba(ClO(4))(2) and then of 2 equiv of bipy to an aqueous solution containing 1 equiv of V(IV)OSO(4).5H(2)O yields cis-[V(IV)O(OH)(bipy)(2)]ClO(4) (5). The monomeric compounds 1-5 contain the cis-[V(IV)O(OH)](+) structural unit. Reaction of 1 equiv of V(IV)OSO(4).5H(2)O in water and of 1 equiv of [V(IV)OCl(2)(THF)(2)] in ethanol with 2 equiv of bipy gives the compounds cis-[V(IV)O(OSO(3))(bipy)(2)].CH(3)OH.1.5H(2)O (6.CH(3)OH.1.5H(2)O) and cis-[V(IV)OCl(bipy)(2)]Cl (7), respectively, while reaction of 1 equiv of [V(IV)OCl(2)(THF)(2)] in CH(2)Cl(2) with 2 equiv of 4,4'-dtbipy gives the compound cis-[V(IV)OCl(4,4'-dtbipy)(2)]Cl.0.5CH(2)Cl(2) (8.0.5CH(2)Cl(2)). Compounds cis-[V(IV)O(BF(4))(4,4'-dtbipy)(2)]BF(4) (9), cis-[V(IV)O(BF(4))(4,4'-dmbipy)(2)]BF(4) (10), and cis-[V(IV)O(SbF(6))(4,4'-dtbipy)(2)]SbF(6) (11) were synthesized by sequential addition of 2 equiv of 4,4'-dtbipy or 4,4'-dmbipy and 2 equiv of AgBF(4) or AgSbF(6) to a dichloromethane solution containing 1 equiv of [V(IV)OCl(2)(THF)(2)]. The crystal structures of 2.1.2H(2)O, 6.CH(3)OH.1.5H(2)O, and 8.0.5CH(2)Cl(2) were demonstrated by X-ray diffraction analysis. Crystal data are as follows: Compound 2.1.2H(2)O crystallizes in the orthorhombic space group Pbca with (at 298 K) a = 21.62(1) A, b = 13.33(1) A, c = 27.25(2) A, V = 7851(2) A(3), Z = 8. Compound 6.CH(3)OH.1.5H(2)O crystallizes in the monoclinic space group P2(1)/a with (at 298 K) a = 12.581(4) A, b = 14.204(5) A, c = 14.613(6) A, beta = 114.88(1) degrees, V = 2369(1), Z = 4. Compound 8.0.5CH(2)Cl(2) crystallizes in the orthorhombic space group Pca2(1) with (at 298 K) a = 23.072(2) A, b = 24.176(2) A, c = 13.676(1) A, V = 7628(2) A(3), Z = 8 with two crystallographically independent molecules per asymmetric unit. In addition to the synthesis and crystallographic studies, we report the optical, infrared, magnetic, conductivity, and CW EPR properties of these oxovanadium(IV) compounds as well as theoretical studies on [V(IV)O(bipy)(2)](2+) and [V(IV)OX(bipy)(2)](+/0) species (X = OH(-), SO(4)(2)(-), Cl(-)). 相似文献
5.
Four new zinc diphosphonate compounds with formulas [NH(3)(CH(2))(2)NH(3)]Zn(hedpH(2))(2).2H(2)O, 1, [NH(3)(CH(2))(n)()NH(3)]Zn(2)(hedpH)(2).2H(2)O, (n = 4, 2; n = 5, 3; n = 6, 4) (hedp = 1-hydroxyethylidenediphosphonate) have been synthesized under hydrothermal conditions at 110 degrees C and in the presence of alkylenediamines NH(2)(CH(2))(n)()NH(2) (n = 2, 4, 5, 6). Crystallographic data for 1: monoclinic, space group C2/c, a = 24.7422(15), b = 5.2889(2), c = 16.0338(2) A, beta = 117.903(1) degrees, V = 1856.17(18) A(3), Z = 4; 2: monoclinic, space group P2(1)/n, a = 5.4970(3), b = 12.1041(6), c = 16.2814(12) A, beta = 98.619(5) degrees, V = 1071.07(11) A(3), Z = 2; 3: monoclinic, space group P2(1)/n, a = 5.5251(2), b = 12.5968(3), c = 16.1705(5) A, beta = 99.182(1) degrees, V = 1111.02(6) A(3), Z = 2; 4: triclinic, space group P-1, a = 5.4785(2), b = 14.1940(5), c = 16.0682(6) A, alpha = 81.982(2) degrees, beta = 89.435(2) degrees, gamma = 79.679(2) degrees, V = 1217.11(8) A(3), Z = 2. In compound 1, two of the phosphonate oxygens are protonated. The metal ions are bridged by the hedpH(2)(2-) groups through three of the remaining four phosphonate oxygens, forming a one-dimensional infinite chain. The protonated ethylenediamines locate between the chains in the lattice. In compounds 2-4, only one phosphonate oxygen is protonated. Compounds 2 and 3 have a similar three-dimensional open-network structure composed of [Zn(2)(hedpH)(2)](n) double chains with strong hydrogen bonding interactions between them, thus generating channels along the [100] direction. The protonated diamines and water molecules reside in the channels. Compound 4 contains two types of [Zn(2)(hedpH)(2)](n) double chains which are held together by strong hydrogen bonds, forming a two-dimensional network. The interlayer spaces are occupied by the [NH(3)(CH(2))(6)NH(3)](2+) cations and water molecules. The significant difference between structures 2-4 is also featured by the coordination geometries of the zinc atoms. The geometries of those in 2 can be described as distorted octahedral, and those in 3 as distorted square pyramidal. In 4, two independent zinc atoms are found, each with a distorted octahedral and a tetrahedral geometry, respectively. 相似文献
6.
Roca M Marcos MD Amorós P Beltrán-Porter A Edwards AJ Beltrán-Porter D 《Inorganic chemistry》1996,35(19):5613-5621
A general synthetic approach to rationalize the solution preparative chemistry of oxovanadium phosphates containing organic species as structural directing agents is presented. Careful attention is payed to the hydrolysis and condensation processes involving the ionic species in solution, and a simple restatement of the partial charge model (PCM) has been used in order to organize the experimental results. The structure of a new V(IV)-Fe(III) bimetallic oxovanadium phosphate, [H(3)N(CH(2))(2)NH(3)](2)[H(3)N(CH(2))(2)NH(2)] [Fe(III)(H(2)O)(2)(V(IV)O)(8)(OH)(4)(HPO(4))(4)(PO(4))(4)].4H(2)O, has been determined by X-ray single crystal diffraction methods. This compound crystallizes in the monoclinic system, space group P2(1)/n and the cell dimensions are as follows: a = 14.383(3) ?, b = 10.150(2) ?, c = 18.355(4) ?, and beta = 90.39(3) degrees (Z = 2). The existence of a complex intercrossing channel system, including a very large channel of 18.4 ? of diameter (in which both water molecules and ethylenediamine species are located), is the more interesting feature of this structure. Thermal decomposition, including the dehydration/rehydration process, has been studied by thermal analysis and variable temperature X-ray powder diffraction techniques. A complementary SEM study of the different intermediate decomposition products is presented. 相似文献
7.
The synthesis and characterization of the novel systems [Zn(2)(H(2)N(CH(2))(2)NH(2))(5)][(Zn(H(2)N(CH(2))(2)NH(2))(2))(2)V(18)O(42)(H(2)O)].9H(2)O (1), [Cd(2)(H(2)N(CH(2))(2)NH(2))(5)][(Cd(H(2)N(CH(2))(2)NH(2))(2))(2)V(18)O(42)(Br)].9H(2)O (2), and [Zn(2)(H(2)N(CH(2))(2)NH(2))(5)][(Zn(H(2)N(CH(2))(2)NH(2))(2))(2)V(18)O(42)(Cl)].9H(2)O (3) have been described. These materials represent a new class of solids that have been prepared by combining conventional coordination compounds with spherical polyoxovanadate clusters. The isomorphous structures of these hybrid solids consist of two-dimensional arrays of container cluster molecules [V(18)O(42)(X)] (X = H(2)O, Br-, Cl-) interlinked by the transition metal complex moieties [M(H(2)N(CH(2))(2)NH(2))(2)] (M = Zn, Cd). These compounds contain an unprecedented complex cation, [M(2)(H(2)N(CH(2))(2)NH(2))(5)](4+). Crystal data for 1: C(9)H(46)N(9)O(26)V(9)Zn(2), monoclinic space group P2(1)/m (No. 11), a = 12.3723(7) A, b = 20.9837(11) A, c = 15.8379(8) A, beta = 97.3320(10) degrees, Z = 4. 相似文献
8.
The reactions of the binuclear oxomolybdenum(V) complex [Cl(2)(O)Mo(&mgr;-OEt)(2)(&mgr;-HOEt)Mo(O)Cl(2)] (1) with Me(3)Si(allyl) and SbF(3) produce the compounds [Mo(6)O(6)Cl(6)(&mgr;(3)-O)(2)(&mgr;(2)-OEt)(6)(&mgr;(2)-Cl)(2)] (2) and [Mo(8)O(8)Cl(6)(&mgr;(3)-O)(4)(OH)(2)(&mgr;(2)-OH)(4)(&mgr;(2)-OEt)(4)(HOEt)(4)] (3), respectively. Treatment of 1 with the Lewis base PMe(3) affords the tetrameric complex [Mo(4)O(4)Cl(4)(&mgr;(2)-OEt)(4)(HOEt)(2)(&mgr;(3)-O)(2)] (4), which represents another link in the chain of clusters produced by the reactions of 1 and simulating the build-up of polymeric molybdenum oxides by sol-gel methods. The crystal structure of 4 has been determined [C(12)H(32)Cl(4)Mo(4)O(12), triclinic, P&onemacr;, a = 7.376(2) ?, b = 8.807(3) ?, c = 11.467(4) ?, alpha = 109.61(1) degrees, beta = 92.12(3) degrees, gamma = 103.75(2) degrees, Z = 1]. By contrast, reaction of 1 with the nitrogen base NEt(3), followed by treatment with [PPN]Cl.2H(2)O ([PPN](+) = [Ph(3)P=N=PPh(3)](+)), gives the complex [PPN](+)[Et(3)NH](+)[Cl(2)(O)Mo(&mgr;(2)-O)(2)Mo(O)Cl(2)](2)(-) (6) in 90% yield. Its crystal structure [C(36)H(30)Cl(4)MoNOP(2), triclinic, Pna2(1), a = 21.470(6) ?, b = 16.765(2) ?, c = 9.6155(14) ?, alpha = 90 degrees, beta = 90 degrees, gamma = 90 degrees, Z = 16] includes the anion [Cl(2)(O)Mo(&mgr;(2)-O)(2)Mo(O)Cl(2)](2)(-), which is a charged derivative of the species forming the gels in sol-gel processes starting from chloromolybdenum ethoxides. Furthermore, compound 1 is found to be catalytically active in esterification and dehydration reactions of alcohols. 相似文献
9.
CHEN Wen-Tong YAO Zhong-Liang HUANG Gan-Sheng FANG Xiao-Niu LIU Dong-Sheng YING Shao-Ming 《结构化学》2010,29(10)
A novel viologen(4,4'bipyridinium)-based complex(CH3-4,4'-H2bipy)(HgCl4)(1),in which the CH3-4,4'-H2bipy(MQ2+)was generated in situ,has been synthesized via hydrothermal reaction and structurally characterized.Complex 1 crystallizes in the space group P21/c of monoclinic system with four formula units in a cell:a = 8.1848(6),b = 21.809(2),c = 9.0285(6)(A),β =.107.377(1)°,V= 1538.0(2)(A)3,C11H11Cl4HgN2,Mr = 513.61,Dc = 2.218 g/cm3,S = 1.009,μ(MoKα)= 10.685 mm-1,F(000)= 956,R = 0.0360 and wR = 0.0812.The crystal structure analysis reveals that the title complex features an isolated structure based on a CH3-4,4'-H2bipy moiety and a mercury atom terminally bound by four chlorine atoms.Photoluminescence investigation reveals a strong emission in blue region,which may originate from π→π* charge-transfer interaction of the CH3-4,4'-H2bipy moiety. 相似文献
10.
A novel ESR-silent polyoxomolybdate Na(21)([Na(5)(H(2)O)(14)][Mo(46)O(134)(OH)(10)(mu-CH(3)COO)(4)]).CH(3)COONa.approximately equal to 90H(2)O (3) was simply synthesized in high yield by reducing an acidified aqueous solution of Na(2)MoO(4).2H(2)O and CH(3)COONa.3H(2)O. The structure of 3 is constructed by a 46-member crown-shaped anion, [Na(5)(H(2)O)(14)]within[Mo(V)(20)Mo(VI)(26)O(134)(OH)(10)(mu-CH(3)COO)(4)](21-), 3a, which is built up by three different but related building blocks in a new mode and further connected into layers via Na(+) and hydrogen bonds. Crystal data of compound 3: triclinic space group P(-1); a = 16.4065(3), b = 17.4236(2), c = 20.8247(3) A; alpha= 87.57, beta= 67.9810(10), gamma= 80.6970(10)o; V = 5445.08(14) A(3); Z = 1; D(calcd) = 2.902. Structure solution and refinement are based on 19014 reflections, R = 0.0750. 相似文献
11.
The hydrothermal reaction of CuSO(4).5H2O, Na2MoO(4).2H2O and 2,2'-bipyridine with the bridging diphosphonate ligand H2O3P(CH2)4PO3H2 yields the one-dimensional chain [(Cu(bpy)2)(Cu(bpy)(H2O)2)(Mo5O15)(O3P(CH2)4PO3)].H2O; the introduction of a second bridging component in the reaction of Cu(MeCO2)2.H2O, MoO3, H2O3PCH2CH2PO3H2 and tetra(2-pyridyl)pyrazine yields the network solid [(Cu2(tpypyz)(H2O)2)(Mo5O15)(O3PCH2CH2PO3)].5.5H2O. 相似文献
12.
The syntheses and structural and physical characterization of the compounds [Cu(bipy)(2)](2)[Mo(CN)(8)].5H(2)O. CH(3)OH (1) with bipy = 2,2'-bipyridine and M(II)(2)[Mo(IV)(CN)(8)].xH(2)O (2 with M = Cu, x = 7.5; 3 with M = Mn, x = 9.5) are presented. 1 crystallizes in the triclinic space group P1; (a = 11.3006(4) A, b = 12.0886(5) A, c = 22.9589(9) A, alpha = 81.799(2) degrees, beta = 79.787(2) degrees, gamma = 62.873(2) degrees, Z = 2). The structure of 1 consists of neutral trinuclear molecules in which a central [Mo(CN8)](4-) anion is linked to two [Cu(bipy)2](2+) cations through two cyanide bridges. 2 crystallizes poorly, and hence, structural information has been obtained from the wide-angle X-ray scattering (WAXS) technique, by comparison with 3 and Fe(II)(2)(H(2)O)(4)[Mo(IV)(CN)(8)].4H(2)O whose X-ray structure has been previously solved. 2, 3, and Fe(II)(2)(H(2)O)(4)[Mo(IV)(CN)(8)].4H(2)O form extended networks with all the cyano groups acting as bridges. The magnetic properties have shown that 1 and 2 behave as paramagnets. Under irradiation with light, they exhibit important modifications of their magnetic properties, with the appearance at low temperature of magnetic interactions. For 1 the modifications are irreversible, whereas they are reversible for 2 after cycling in temperature. These photomagnetic effects are thought to be caused by the conversion of Mo(IV) (diamagnetic) to Mo(V)(paramagnetic) through a photooxidation mechanism for 1 and a photoinduced electron transfer in 2. These results have been correlated with the structural features. 相似文献
13.
The 1/2V2O5-H2C2O4/H3PO4/NH4OH system was investigated using hydrothermal techniques. Four new phases, (NH4)VOPO(4).1.5H2O (1), (NH4)0.5VOPO(4).1.5H2O (2), (NH4)2[VO(H2O)3]2[VO(H2O)][VO(PO4)2]2.3H2O (3), and (NH4)2[VO(HPO4)]2(C2O4).H2O (4), have been prepared and structurally characterized. Compounds 1 and 2 have layered structures closely related to VOPO(4).2H2O and A0.5VOPO4.yH2O (A = mono- or divalent metals), whereas 3 has a 3D open-framework structure. Compound 4 has a layered structure and contains both oxalate and phosphate anions coordinated to vanadium cations. Crystal data: (NH4)VOPO(4).1.5H2O, tetragonal (I), space group I4/mmm (No. 139), a = 6.3160(5) A, c = 13.540(2) A, Z = 4; (NH4)0.5VOPO(4).1.5H2O, monoclinic, space group P2(1)/m (No. 11), a = 6.9669(6) A, b = 17.663(2) A, c = 8.9304(8) A, beta = 105.347(1) degrees, Z = 8; (NH4)2[VO(H2O)3]2[VO(H2O)][VO(PO4)2]2.3H2O, triclinic, space group P1 (No. 2), a = 10.2523(9) A, b = 12.263(1) A, c = 12.362(1) A, alpha = 69.041(2) degrees, beta = 65.653(2) degrees, gamma = 87.789(2) degrees, Z = 2; (NH4)2[VO(HPO4)]2(C2O4).5H2O, monoclinic (C), space group C2/m (No. 12), a = 17.735(2) A, b = 6.4180(6) A, c = 22.839(2) A, beta = 102.017(2) degrees, Z = 6. 相似文献
14.
This paper reports the syntheses and characterization of four isomorphous compounds (NH(3)C(6)H(4)NH(3))M(2)(hedpH)(2).H(2)O [M = Fe (1), Co (2), Mn (3), Zn (4); hedp = C(CH(3))(OH)(PO(3))(2)]. Each contains two crystallographically different kinds of {M(2)(hedpH)(2)}(n) double chains, where the {M(2)(mu-O)(2)} dimer units are connected by O-P-O bridges. The double chains are connected through extensive hydrogen bonds, hence generating a three-dimensional supramolecular network. The temperature-dependent magnetic susceptibility measurements show dominant antiferromagnetic interactions in compounds 1-3, mediated through the mu-O and/or O-P-O bridges between the metal(II) centers. The magnetization measurements reveal that compounds 1-3 experience field-induced magnetic transitions at low temperatures. 相似文献
15.
New ethylenediphosphonates of molybdenum, A[Mo2O5(O3PCH2CH2PO3)] (A = NH4 (1), Tl (2), Cs (3), Rb (4)), and K(H3O)[Mo2O5(O3PCH2CH2PO3)] (5), have been synthesized by a hydrothermal method and structurally characterized by X-ray diffraction, spectroscopic, and thermal studies. These compounds consist of pillared anionic layers [Mo2O5(O3PCH2CH2PO3)]2-, with A+, K+, and H3O+ ions in the interlayer region as well as in the cavities within the anionic layers. Single-crystal X-ray structures of compounds 1 and 5 have been determined. They crystallize in the orthorhombic space group Cmca with Z = 8 and have the following unit cell parameters. For 1, a = 25.60(1), b = 10.016(4), and c = 9.635(3) angstroms and for 5, a = 25.63(1), b = 10.007(2), and c = 9.512(1) angstroms. 相似文献
16.
Two new compounds containing the title diphosphono-polyoxometalate anion and diprotonated ethylenediamine (enH(2)) or piperazine (ppzH(2)) countercations have been hydrothermally synthesized and structurally characterized ((enH(2))(4)[Mo(7)O(16)(O(3)PCH(2)PO(3))(3)].7H(2)O, triclinic, P(-)1, Z = 2, a = 10.3455(7) A, b = 13.136(1) A, and c = 20.216(3) A, alpha = 93.247(6) degrees, beta = 96.434(6) degrees, and gamma = 111.900(6) degrees; (ppzH(2))(4)[Mo(7)O(16)(O(3)PCH(2)PO(3))(3)].8H(2)O, triclinic, P(-)1, Z = 2, a = 13.255(2) A, b = 13.638(2) A, and c = 16.874(4) A, alpha = 93.20(2) degrees, beta = 101.27(2) degrees, and gamma = 105.87(1) degrees). The anion is a ring of three pairs of edge-sharing octahedra of Mo(V)O(6) (with Mo(V)-Mo(V) bonds) that share corners with each other. The diphosphonate groups connect the pairs at the periphery. The ring is "capped" by a tetrahedron of Mo(VI)O(4). According to magnetic measurements, the compounds are diamagnetic. 相似文献
17.
Direct reaction of hydroxy(2-pyridyl)methylphosphonic acid with zinc sulfate under hydrothermal conditions results in the formation of the novel heptanuclear cluster compound [Zn7{(2-C5H4N)CH(OH)PO3}6 (H2O)6]SO4 x 4H2O (1). The inorganic core of the cluster can be described as a cylindrical drum made up of six Zn atoms bridged by six {CPO3} units that is centered by a seventh Zn atom. Crystal data: monoclinic, C2/c, a = 22.690(2) A, b = 16.675(2) A, c = 18.151(2) A, beta = 93.390(2) degrees. 相似文献
18.
The hydrothermal syntheses of a family of new alkali-metal/ammonium vanadium(V) methylphosphonates, M(VO(2))(3)(PO(3)CH(3))(2) (M = K, NH(4), Rb, Tl), are described. The crystal structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) have been determined from single-crystal X-ray data. Crystal data: K(VO(2))(3)(PO(3)CH(3))(2), M(r) = 475.93, trigonal, R32 (No. 155), a = 7.139(3) ?, c = 19.109(5) ?, Z = 3; NH(4)(VO(2))(3)(PO(3)CH(3))(2), M(r) = 454.87, trigonal, R32 (No. 155), a = 7.150(3) ?, c = 19.459(5) ?, Z = 3. These isostructural, noncentrosymmetric phases are built up from hexagonal tungsten oxide (HTO) like sheets of vertex-sharing VO(6) octahedra, capped on both sides of the V/O sheets by PCH(3) entities (as [PO(3)CH(3)](2-) methylphosphonate groups). In both phases, the vanadium octahedra display a distinctive two short + two intermediate + two long V-O bond distance distribution within the VO(6) unit. Interlayer potassium or ammonium cations provide charge balance for the anionic (VO(2))(3)(PO(3)CH(3))(2) sheets. Powder X-ray, TGA, IR, and Raman data for these phases are reported and discussed. The structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) are compared and contrasted with related layered phases based on the HTO motif. 相似文献
19.
A new copper(II) acetate, [Na(2)Cu(CH(3)COO)(4)(H(2)O)].H(2)O (1), has been crystallized from an aqueous solution containing sodium acetate and copper(II) acetate monohydrate in a 4:1 ratio and the structure determined by X-ray crystallography. 1 crystallizes in the monoclinic space group P2(1)/c, with a = 16.638(3) A, b = 11.781(2) A, c = 15.668(3) A, beta = 90.11(3) degrees, V = 3071.0(11) A(3), and Z = 4. In the asymmetric unit, sodium ions bridge two crystallographically unique square planar [Cu(CH(3)COO)(4)](2-) units to their symmetry-generated neighbors to form corrugated 2D sheets of Na(2)Cu(CH(3)COO)(4), which are held together by H-bonding interactions involving the waters of crystallization. In contrast, the structures of known sodium copper acetates are better described as 3D frameworks. The metal centers are bridged by a number of acetates in novel coordination modes. The square planar Cu(II) geometry generated by oxygen atoms from four different acetates is an unexpected feature given the weak ligand field provided by the acetate ligands. 相似文献
20.
Hydrothermal reactions of N-(phosphonomethyl)-N-methylglycine, MeN(CH(2)CO(2)H)(CH(2)PO(3)H(2)) (H(3)L), with zinc(II) acetate resulted in the formation of a novel zinc carboxylate-phosphonate, [Zn(6)L(6)(Zn)][Zn(H(2)O)(6)](2) x 22H(2)O (1). The structure of 1 contains a heptanuclear zinc phosphonate cluster anion, [Zn(6)L(6)(Zn)](4-), in which seven zinc(II) cations form an unusual Zn(6)(Zn) centered octahedron with six of its Zn(3) triangle faces each further capped by a phosphonate group. The Zn(II) cations of the Zn(6) octahedron are five-coordinated whereas the centered Zn(II) cation is octahedrally coordinated. Packing of these cluster anions creates micropores occupied by the hydrated zinc(II) cations as well as lattice water molecules. The structural skeleton of 1 is retained after the removal of the lattice water molecules. 相似文献