Aluminum Amides Derived from Metalation of N,N'-Bis(trimethylsilyl)ethylenediamine

The reaction of N,N'-bis(trimethylsilyl)ethylenediamine with H(3)Al.NMe(3) gives products based on metalation (H(2) elimination), [{[CH(2)N(SiMe(3))](2)AlH}(2)] (1) and [{CH(2)N(SiMe(3))}(2)AlN(SiMe(3))CH(2)CH(2)N(H)SiMe(3)] (2), as well as products derived from N-Si bond cleavage and metalation, [{[CH(2)N(SiMe(3))](2)AlH}(2){HAlN(SiMe(3))CH(2)CH(2)NAlH(2)}] (4) and [H(2)Al{CH(2)N(SiMe(3))}(2)AlN(SiMe(3))CH(2)CH(2)NAl(H)(2).NMe(3)}] (5). Similarly, [Me(3)SiN(H)CH(2)CH(2)N(SiMe(3))AlCl(2)] (3) was isolated as the redistributed/metalated product from the reaction of the same diamine with H(2)Al(Cl).NMe(3). The following crystal data were obtained: (1) monoclinic, space group P2(1)/c (No. 14), a = 13.636(4) ?, b = 9.565(3) ?, c = 22.683(4) ?, beta = 105.67(2) degrees, Z = 4; (2) monoclinic, space group C2/c (No. 15), a = 31.887(3) ?, b = 10.145(6) ?, c = 17.718(3) ?, beta = 100.36(1) degrees, Z = 8; (3) triclinic, space group P&onemacr; (No. 2), a = 11.762(3) ?, b = 11.927(3) ?, c = 7.288(2) ?, alpha = 107.46(2) degrees, beta = 95.29(2) degrees, gamma = 110.41(2) degrees, Z = 2; (4) triclinic, space group P&onemacr; (No. 2), a = 13.884(4) ?, b = 15.379(4) ?, c = 11.044(2) ?, alpha = 102.11(2) degrees, beta = 103.85(2) degrees, gamma = 109.28(2) degrees, Z = 2; (5) triclinic, space group P&onemacr; (No. 2), a = 10.925(5) ?, b = 11.060(5) ?, c = 12.726(4) ?, alpha = 92.38(3) degrees, beta = 95.67(2) degrees, gamma = 96.90(2) degrees, Z = 2.     

Hydroxoundecahydro-closo-dodecaborate(2-) as a Nucleophile. Preparation and Structural Characterization of O-Alkyl and O-Acyl Derivatives of Hydroxoundecahydro-closo-dodecaborate(2-)

The syntheses, solid state structures, and spectral properties of O-alkyl and O-acyl derivatives of hydroxoundecahydro-closo-dodecaborate(2-), 1, are described. Alkylation of 1 with ethyl iodide was achieved in dimethyl sulfoxide using potassium hydroxide as a base, leading to [N(n-C(4)H(9))(4)](2)[CH(3)CH(2)O-B(12)H(11)(2-)], 2, bis(tetrabutylammonium) ethoxyundecahydro-closo-dodecaborate(2-) [monoclinic P2(1)/n, a = 1192.4(9) pm, b = 1253.9(4) pm, c = 3049.1(10) pm, beta = 92.69(4) degrees, Z = 4, R1 = 0.0693, wR(2) = 0.1517]. Alkylation with 1,5-dibromopentane afforded the cyclic oxonium salt [PPN][C(5)H(10)O-B(12)H(11)(1-)], 3, (&mgr;-nitrido)bis(triphenylphosphorus)(1+) tetrahydropyrane-undecahydro-closo-dodecaborate(1-) [monoclinic P2(1)/c, a = 1938.1(2) pm, b = 1329.7(10) pm, c = 1944.0(2) pm, beta = 108.82(10) degrees, Z = 4, R1 = 0.0484, wR(2) = 0.0833]. Acylation of 1 in acetonitrile with acyl chlorides in the presence of pyridine yielded [N(n-C(4)H(9))(4)](2)[C(6)H(5)CO(2)-B(12)H(11)(2-)], 4, bis(tetrabutylammonium) undecahydrobenzoyl-closo-dodecaborate(2-) [monoclinic P2(1)/c, a = 1812.0(4) pm, b = 1711.9(3) pm, c = 1685.0(3) pm, beta = 114.03(3) degrees, Z = 4, R1 = 0.0915, wR(2) = 0.2093], and [N(n-C(4)H(9))(4)](2)[CH(3)CO(2)-B(12)H(11)(2-)], 5, bis(tetrabutylammonium) acetoxyundecahydro-closo-dodecaborate(2-) [monoclinic P2(1)/n, a = 1190.5(2) pm, b = 1243.0(10) pm, c = 3078.4(4) pm, beta = 92.76(10) degrees, Z = 4, R1 = 0.0642, wR(2) = 0.1462]. All crystal structures showed distortion of the pseudoicosahedral geometry of the boron cluster. The boron-oxygen distances varied from 144.2(5) pm for 2, 148.5(3) pm for 5, 149.4(12) pm for 4, to 152.8(4) pm for 3. The 3-fold coordinated oxygen of oxonium salt 3 is nearly planar.     

Ligand exchange reaction between an alkylzinc primary amide and a dialkylmagnesium compound: crystal structures of [(thf)MeMg-mu-N(H)SiiPr3]2 and (tmeda)Mg[N(H)SiiPr3]2

The reaction of alkylzinc triisopropylsilylamide with dialkylmagnesium leads to a ligand exchange. Besides the starting materials, heteroleptic alkylmagnesium triisopropylsilylamide and homoleptic magnesium bis(triisopropylsilylamide) are detected by NMR spectroscopy. After the addition of 1,2-bis(dimethylamino)ethane (TMEDA) to the reaction mixture, (tmeda)Mg[N(H)SiiPr3]2 (1) precipitates as colorless cuboids (C24H60MgN4Si2, a = 2269.6(2), b = 1029.58(5), c = 1593.2(1) pm, beta = 120.826(8) degrees , monoclinic, C2/c, Z = 4). The amide nitrogen atoms are coordinated planarily with strongly widened Mg-N-Si bond angles of 139.2(1) degrees . The metalation of triisopropylsilylamine with dimethylmagnesium in THF yields quantitatively heteroleptic [(thf)MeMg-N(H)SiiPr3]2 (2) which crystallizes as colorless needles (C28H66Mg2N2O2Si2, a = 1982.4(2), b = 2034.1(1), c = 907.22(6) pm, beta = 95.021(9), monoclinic, P2(1)/n, Z = 4). Because of the bridging position of the triisopropylsilylamide anion, the tetracoordinate nitrogen atoms show rather long Mg-N bond lengths of 210.7 pm (average value).     

A study of the sequential acid-catalyzed hydroxylation of dodecahydro-closo-dodecaborate(2-)

The closo-[B12H12-n(OH)n]2- (n = 1-4) ions have been synthesized by the reaction of cesium dodecahydro-closo-dodecaborate(2-), Cs21, with aqueous sulfuric acid. Variation of the reaction temperature, time, and acid concentration results in the stepwise introduction of from one to four hydroxyl groups. Each individual hydroxylation step proceeds regioselectively, affording only one isomer per step. Further substitution of the hydroxylated cluster preferentially takes place at a B-H vertex meta to a B-OH vertex. The closo-[B12H12-n(OH)n]2- (n = 1-4) species, designated 2-5, respectively, are characterized by one- and two-dimensional 11B NMR spectroscopy, IR spectroscopy, and high-resolution fast atom bombardment (FAB) mass spectrometry. A rationale that qualitatively explains the influence of the hydroxyl group on the chemical shifts of the individual boron vertices is developed. Furthermore, the solid state structures of closo-[B12H11(OH)]2-, 2, and closo-1,7-[B12H10(OH)2]2-,3, are determined by X-ray diffraction. Crystallographic data are as follows: For [MePPh3](2)2, monoclinic, space group P2(1)/n, a = 890.1(5) pm, b = 1814(1) pm, c = 1270.5(7) pm, beta = 101.66(2) degrees, Z = 2, R = 0.055; for [MePPh3](2)3, monoclinic, space group P2(1)/n, a = 887.6(4) pm, b = 1847.2(8) pm, c = 1271.1(5) pm, beta = 101.17(1) degrees, Z = 2, R = 0.065. In addition, synthetic routes to O-derivatized species of the anions 2-5 such as closo-[B12H11(OTiCpCl2)]2-, 7, closo-1,7-[B12H10(OTiCpCl2)2]2-, 8, closo-1,7,9-[B12H9(OTiCpCl2)3]2-, 9, closo-[B12H11(OCONHPh)]2-, 10, and closo-1,7-[B12H10(OSO2Me)2]2-, 11, are described. The crystal structures of 7 and 11 are determined by single-crystal X-ray diffraction. Crystallographic data are as follows: For [MePPh3](2)7, monoclinic, space group Cc, a = 2530.5(2) pm, b = 1653.3(1) pm, c = 1281.3(1) pm, beta = 118.79(2) degrees, Z = 4, R = 0.085; for [HPy](2)11, monoclinic, space group P2(1)/n, a = 1550.9(8) pm, b = 993.1(5) pm, c = 1726.5(9) pm, beta = 112.36(2) degrees, Z = 4, R = 0.061.     

Synthesis and characterization of aluminum- and gallium-bridged [1.1]chromarenophanes and [1.1]molybdarenophanes

The synthesis and structural characterization of the first [1.1]chromarenophanes and the first [1.1]molybdarenophanes are described. A salt-metathesis reaction of [2-(Me 2NCH 2)C 6H 4]AlCl 2 with freshly prepared [Cr(LiC 6H 5) 2].TMEDA (TMEDA = N, N, N', N'-tetramethylethylenediamine) resulted in the dialumina[1.1]chromarenophane [{2-(Me 2NCH 2)C 6H 4}Al(eta (6)-C 6H 5) 2Cr] 2 ( 2a). The poor solubility of 2a in organic solvents prompted us to synthesize the new intramolecularly coordinated aluminum- and gallium dichlorides [5- tBu-2-(Me 2NCH 2)C 6H 3]ECl 2 [E = Al ( 3a), Ga ( 3b)] in which the phenyl group was equipped with a tert-butyl group. Salt-metathesis reactions of 3a and 3b, respectively, with freshly prepared [M(LiC 6H 5) 2].TMEDA (M = Cr, Mo) resulted in four new [1.1]metallarenophanes of the general type [{5- tBu-2-(Me 2NCH 2)C 6H 3}E(eta (6)-C 6H 5) 2M] 2 [E = Al, M = Cr ( 4a); E = Ga, M = Cr ( 4b); E = Al, M = Mo ( 5a); E = Ga, M = Mo ( 5b)]. 2a, 4a, b, and 5a, b have been structurally characterized by single-crystal analysis [ 2a.1/2C 6H 12: C 48H 56Al 2Cr 2N 2, monoclinic, P2 1/ c, a = 9.9117(9) A, b = 19.9361(16) A, c = 10.638(2) A, alpha = 90 degrees , beta = 112.322(5) degrees , gamma = 90 degrees , Z = 2; 4a.2C 6H 6: C 62H 72Al 2Cr 2N 2, monoclinic, P2 1/ c, a = 10.9626(9) A, b = 19.3350(18) A, c = 12.4626(9) A, alpha = 90 degrees , beta = 100.756(5) degrees , gamma = 90 degrees , Z = 2; 4b.2C 6H 6: C 62H 72Cr 2Ga 2N 2, monoclinic, P2 1/ c, a = 10.8428(2) A, b = 19.4844(4) A, c = 12.4958(2) A, alpha = 90 degrees , beta = 100.6187 degrees , gamma = 90 degrees , Z = 2; 5a.2C 6H 6: C 62H 72Al 2Mo 2N 2, triclinic, P1, a = 10.4377(4) A, b = 11.6510(4) A, c = 11.6514(4) A, alpha = 73.545(3) degrees , beta = 89.318(2) degrees , gamma = 76.120(2) degrees , Z = 1; 5b.2C 6H 6: C 62H 72Ga 2Mo 2N 2, triclinic, P1, a = 10.3451(5) A, b = 11.6752(6) A, c = 11.6900(5) A, alpha = 73.917(3) degrees , beta = 89.550(3) degrees , gamma = 76.774(2) degrees , Z = 1]. All five [1.1]metallarenophanes 2a, 4a, b, and 5a, b crystallize as anti isomers with both Me 2N donor groups in exo positions ( C i point group symmetry). The new [1.1]metallarenophanes show NMR spectra that can be interpreted as being caused by time-averaged C 2 h symmetrical species, which is consistent with the findings of their molecular structures in the solid state. Variable-temperature (1)H NMR measurements for 4a, b and 5a, b (500 MHz; -90 to 90 degrees C) revealed only peak broadening in the lower temperature range of -70 to -90 degrees C. (1)H NMR saturation transfer difference experiments did not show an expected anti-to-anti isomerization, rendering the new [1.1]metallacyclophanes rigid on the NMR time scale. Electrochemical measurements were performed for 4a, b and 5a, b. However, reproducible cyclic voltammograms could only be obtained for the two gallium species 4b and 5b, revealing the expected weak communication between the two transition-metal atoms in both compounds (class II).     

Coordination Chemistry of 2,2'-Dipyridyl Diselenide: X-ray Crystal Structures of PySeSePy, [Zn(PySeSePy)Cl(2)], [(PySeSePy)Hg(C(6)F(5))(2)], [Mo(SePy)(2)(CO)(3)], [W(SePy)(2)(CO)(3)], and [Fe(SePy)(2)(CO)(2)] (PySeSePy = C(5)H(4)NSeSeC(5)H(4)N; SePy = [C(5)H(4)N(2-Se)-N,Se])

The coordination chemistry of 2,2'-dipyridyl diselenide (PySeSePy) (2) (C(10)H(8)N(2)Se(2)) has been investigated and its crystal structure has been determined (monoclinic, P2(1)/c, a = 10.129(2) ?, b = 5.7332(12) ?, c = 19.173(3) ?, beta = 101.493(8) degrees, Z = 4). In metal complexes the ligand was found to coordinate in three different modes, as also confirmed by X-ray structure determination. N,N'-coordination was found in the zinc complex [Zn(PySeSePy)Cl(2)] (3) (C(10)H(8)Cl(2)N(2)Se(2)Zn, triclinic, P&onemacr;, a = 7.9430(10) ?, b = 8.147(2) ?, c = 11.999(2) ?, alpha = 93.685(10) degrees, beta = 107.763(10) degrees, gamma = 115.440(10) degrees, Z = 2) and Se,Se'-coordination in the adduct of the ligand with bis(pentafluorophenyl)mercury(II) [PySeSePyHg(C(6)F(5))(2)] (5) (C(10)H(8)F(10)HgN(2)Se(2), monoclinic, P2(1)/n, a = 7.7325(10) ?, b = 5.9974(14) ?, c = 25.573, beta = 98.037(10) degrees, Z = 2), which however displays only weak interactions between selenium and mercury. The reaction of the ligand with norbornadiene carbonyl complexes of molybdenum and tungsten leads to reductive cleavage of the selenium-selenium bond with oxidation of the metal center and concomitant addition of the resulting selenolate to the metal carbonyl fragment. Thus the 7-coordinate complexes [Mo(SePy)(2)(CO)(3)] (6) (C(13)H(8)MoN(2)O(3)Se(2), monoclinic, P2(1)/n, a = 9.319(3) ?, b = 12.886(5) ?, c = 13.231(6) ?, beta = 109.23(3) degrees, Z = 4) and [W(SePy)(2)(CO)(3)] (7) (C(13)H(8)N(2)O(3)Se(2)W, monoclinic, P2(1)/n, a = 9.303(2) ?, b = 12.853(2) ?, c = 13.232(2) ?, beta = 109.270(10) degrees, Z = 4) were obtained. The same N,Se-coordination pattern emerges from the reaction of [Fe(2)(CO)(9)] with (2) leading to [Fe(SePy)(2)(CO)(2)] (8) (C(12)H(8)FeN(2)O(2)Se(2), monoclinic, P&onemacr;, a = 8.6691(14) ?, b = 12.443(2) ?, c = 14.085(2) ?, alpha = 105.811(10) degrees, beta = 107.533(8) degrees, gamma = 92.075(10) degrees, Z = 4).     

Protonation and methylation of an Anderson-type polyoxoanion [IMo6O24]5-

A series of protonated and methylated Anderson-type molybdoperiodates as well as the unprotonated [IMo6O24]5- have been synthesized and structurally characterized as tetra-n-butylammonium salts: [(n-C4H9)4N]5[IMo6O24] [monoclinic, space group C2/c, a = 33.6101(3) A, b = 15.2575(1) A, c = 24.0294(2) A, beta = 126.9569(3) degrees , Z = 4], [(n-C4H9)4N]4[IMo6O23(OH)] [monoclinic, space group P21/c, a = 9.5587(1) A, b = 24.1364(2) A, c = 18.2788(2) A, beta = 90.1562(5) degrees , Z = 2], [(n-C4H9)4N]3[IMo6O22(OH)2].2DMF [monoclinic, space group P21/a, a = 17.6105(4) A, b = 15.5432(5) A, c = 29.3316(9) A, beta = 91.475(3) degrees , Z = 4], [(n-C4H9)4N]4[IMo6O23(OMe)].3H2O [orthorhombic, space group Pbca, a = 17.0679(4) A, b = 25.6998(6) A, c = 20.7428(4) A, Z = 4], [(n-C4H9)4N]3[IMo6O22(OMe)2] [monoclinic, space group P21/n, a = 10.4009(1) A, b = 14.6658(3) A, c = 23.5395(4) A, beta = 100.324(1) degrees , Z = 2]. In all of these compounds, the [IMo6O24]5- anion is protonated or methylated selectively at O atoms shared by two Mo atoms. The results have also revealed that the protonated Anderson-type molybdoperiodates readily react with methanol in a very selective manner, while the unprotonated [IMo6O24]5- anion does not react with methanol under similar conditions.     

Rhenium(I) carbonyl complexes of 2,4,6-tris(2-pyridyl)-1,3,5-triazine (TPT). Rhenium(I)-promoted methoxylation of the triazine ring carbon atom in dinuclear rhenium complexes

2,4,6-Tris(2-pyridyl)-1,3,5-triazine (TPT) bridged dinuclear rhenium(I) tricarbonyl halide complexes with the composition (mu-TPT)[ReX(CO)(3)](2) (3, X = Cl; 4, X = Br) can be made either by one-pot reaction of TPT with 2 equiv of [ReX(CO)(5)] (X = Cl and Br) in chloroform or by reacting mononuclear [ReX(CO)(3)(TPT)] (2) (1, X = Cl; 2, X = Br) with an excess amount of [ReX(CO)(5)]. Crystal data are as follows. 1: monoclinic, P2(1)/c, a = 11.751(1) A, b = 11.376(1) A, c = 15.562(2) A, beta = 103.584(2) degrees, V = 2022.0(4) A(3), Z = 4. 2: monoclinic, P2(1)/c, a = 11.896(1) A, b = 11.396(1) A, c = 15.655(1) A, beta = 104.474(2) degrees, V = 2054.9(3) A(3), Z = 4. 3: triclinic, P1, a = 11.541(2) A, b = 12.119(2) A, c = 13.199(2) A, alpha = 80.377(2) degrees, beta = 76.204(3) degrees, gamma = 66.826(2) degrees, V = 1642.5(4) A(3), Z = 2. Crystals of 4 crystallized from acetone: triclinic, P1, a = 11.586(5) A, b = 12.144(5) A, c = 13.364(6) A, alpha = 80.599(7) degrees, beta = 76.271(8) degrees, gamma = 67.158(8) degrees, V = 1678.0(12) A(3), Z = 2. Crystals of 4' are obtained from CH(2)Cl(2)-pentane solution: monoclinic, C2/c, a = 17.555(4) A, b = 15.277(3) A, c = 13.093(3) A, beta = 111.179(3) degrees, V = 3274.0(12) A(3), Z = 4. By contrast, similar reactions in the presence of methanol yielded complexes with the composition [mu-C(3)N(3)(OMe)(py)(2)(pyH)][ReX(CO)(3)](2) (5, X = Cl; 6, X = Br). Crystal data for 5: monoclinic, C2/c, a = 26.952(2) A, b = 16.602(1) A, c = 14.641(1) A, beta = 116.147(1) degrees, V = 5880.5(8) A(3), Z = 8. 6: monoclinic, C2/c, a = 27.513(3) A, b = 16.740(2) A, c = 14.837(2) A, beta = 116.925(2) degrees, V = 6092.8(10) A(3), Z = 8. An unusual metal-induced methoxylation at the carbon atom of the triazine ring of the bridging TPT ligand was observed. The nucleophilic attack of MeO(-) on C(3) results in a tetrahedral geometry around the carbon atom. Concomitantly, the uncoordinated pyridyl ring is protonated and rotated into a perpendicular orientation relative to the central C(3)N(3) ring. Reaction of TPT with [NEt(4)](2)[ReBr(3)(CO)(3)] in benzene-methanol resulted in an unexpected dinuclear complex 7, with formulation [mu-C(3)N(3)(OMe)(py)(3)][Re(CO)(3)][ReBr(CO)(3)]. The methoxylated TPT ligand functions simultaneously as a tridentate and bidentate ligand with two fac-Re(CO)(3)(+) cores. Crystal data for 7: monoclinic, P2(1)/n, a = 12.114(1) A, b = 14.878(1) A, c = 15.807(1) A, beta = 104.601(1) degrees, V = 2756.9(3) A(3), Z = 4.     

Synthesis and characterization of novel rhenium(V) tetradentate N2O2 Schiff base monomer and dimer complexes

Several rhenium(V) oxo complexes with tetradentate N(2)O(2) Schiff base ligands were synthesized and characterized. The general synthetic procedure involved reaction of [NBu(4)][ReOCl(4)] with a tetradentate Schiff base ligand (L(1) = N,N'-ethylenebis(acetylacetoneimine), (acac(2)en) or L(2) = N,N'-propylenebis(acetylacetoneimine) (acac(2)pn)) in ethanol solution to generate complexes of the form trans-ReOX(L) where X = Cl(-), MeO(-), ReO(4)(-), or H(2)O. The product isolated from the reaction was found to be dependent on the reaction conditions, in particular the presence or absence of water and/or base. The mu-oxo-Re(2)O(3)(L)(2) dimers were synthesized and characterized for chemical and structural comparison to the related monomers. Conversion of the monomer to its dimer analogue was followed qualitatively by spectrophotometry. The complexes were characterized by (1)H and (13)C NMR, UV-vis, and IR spectroscopy, elemental analysis, and single crystal X-ray diffraction. The crystallographic data reported for the structures are as follows: trans-[ReO(OH(2))(acac(2)en)]Cl (H(20)C(12)ClN(2)O(4)Re) 1, triclinic (Ponemacr;), a = 7.2888(6) A, b = 9.8299(8) A, c = 10.8195(9) A, alpha = 81.7670(10) degrees, beta = 77.1510(10) degrees, gamma = 87.6200(10) degrees, V = 747.96(11) A(3), Z = 2; trans-[ReO(OReO(3))(acac(2)en)] (H(18)C(12)N(2)O(7)Re(2)) 2, monoclinic (P2(1)/c), a = 7.5547(4) A, b = 8.7409(5) A, c= 25.7794(13) A, beta = 92.7780(10) degrees, V = 1700.34(16) A(3), Z = 4; trans-[ReOCl(acac(2)pn)] (H(20)C(13)N(2)O(3)ClRe) 3, monoclinic (P2(1)/c), a = 8.1628(5) A, b = 13.0699(8) A, c = 28.3902(17) A, beta = 97.5630(10) degrees, V = 3002.5(3) A(3), Z = 8; trans-[ReO(OMe)(acac(2)pn)] (H(23)C(14)N(2)O(4)Re) 4, monoclinic (P2(1)/c), a = 6.7104(8) A, b = 27.844(3) A, c = 8.2292(9) A, beta = 92.197(2) degrees, V = 1536.4(3) A(3), Z = 4; trans-[mu-oxo-Re(2)O(3)(acac(2)en)(2)] (H(36)C(24)N(4)O(7)Re(2)) 5, monoclinic (P2(1)/n), a = 9.0064(5) A, b = 12.2612(7) A, c = 12.3695(7) A, beta = 90.2853(10) degrees, V = 1365.94(13) A(3), Z = 2; and trans-[mu-oxo Re(2)O(3)(acac(2)pn)(2)] (H(40)C(26)N(4)O(7)Re(2)) 6, monoclinic (P2(1)/n), a = 9.1190(5) A, b = 12.2452(7) A, c = 12.8863(8) A, beta = 92.0510(10) degrees, V = 1438.01(14) A(3), Z = 2.     

Bis(pyrazol-1-yl)acetates as tripodal heteroscorpionate ligands in iron chemistry: syntheses and structures of iron(II) and iron(III) complexes with bpza, bdmpza, and bdtbpza ligands

The molecular structure of the previously reported species "[Fe(bdtbpza)Cl]" has been revealed by X-ray structure determination to be a ferrous dimer [Fe(bdtbpza)Cl](2) (2c) [bdtbpza = bis(3,5-di-tert-butylpyrazol-1-yl)acetate]. The syntheses of ferrous 2:1 complexes [Fe(bpza)(2)] (3a) and [Fe(bdtbpza)(2)] (3c) as well as ferric 1:1 complexes [NEt(4)][Fe(bpza)Cl(3)] (4a) and [NEt(4)][Fe(bdmpza)Cl(3)] (4b) [bpza = bis(pyrazol-1-yl)acetate, bdmpza = bis(3,5-dimethylpyrazol-1-yl)acetate] are reported. Complexes 3a, previously reported [Fe(bdmpza)(2)] (3b), and 3c are high-spin. No spin crossover to the low-spin state was observed in the temperature range of 5-350 K. 4a and 4b are synthesized in one step and in high yield from [NEt(4)](2)[Cl(3)FeOFeCl(3)]. 4a and 4b are iron(III) high-spin complexes. Crystallographic information: 2c (C(24)H(39)ClFeN(4)O(2).CH(2)Cl(2).CH(3)CN) is triclinic, P1, a = 12.171(16) A, b = 12.851(14) A, c = 13.390(13) A, alpha = 98.61(9) degrees, beta = 113.51(11) degrees, gamma = 108.10(5) degrees, Z = 2; 3a (C(8)H(7)Fe(0.5)N(4)O(2)) is monoclinic, P2(1)/n, a = 7.4784(19) A, b = 7.604(3) A, c = 16.196(4) A, beta = 95.397(9) degrees, Z = 4; 3c (C(24)H(39)Fe(0.5)N(4)O(2)) is monoclinic, P2(1)/n, a = 9.939(6) A, b = 18.161(10) A, c = 13.722(8) A, beta = 97.67(7) degrees, Z = 4; 4b (C(20)H(35)Cl(3)FeN(5)O(2)) is monoclinic, C2/c, a = 30.45(6) A, b = 12.33(2) A, c = 16.17(3) A, beta = 118.47(5) degrees, Z = 8.     

Tetraaza analogues of lithium and sodium alums: synthesis and X-ray structures of the single strand polymer [Li(THF)2(Al[SO2(NtBu)2]2)] infinity and the contact ion pairs [Na(15-crown-5)][Al(SO2(NtBu)2)2] and ([Na(15-crown-5)][O2S(mu-NBn)2Al(mu-NBnSO2NBn)])2

The reaction of an alkali metal aluminohydride MAlH4 (M = Li, Na) with N,N'-bis-(tert-butyl)sulfamide or N,N'-bis-(benzyl)sulfamide in THF produces the complex ions (Al[SO2(NR)2]2)- (R = tBu, Bn). The X-ray structures of [Li(THF)2(Al[SO2(NtBu)2]2)] infinity (1), [Na(15-crown-5)][Al(SO2(NtBu)2)2], (2) and ([Na(15-crown-5)][O2S(mu-NBn)2Al(mu-NBnSO2NBn)])2 (3.3THF) are reported. The two diazasulfate ligands [SO2(NtBu)2]2- are N,N' chelated to Al3+ in both 1 and 2. In the lithium derivative 1 the spirocyclic (Al[SO2(NtBu)2]2)- anions are bridged by the bis-solvated cations Li(THF)2+ to give a polymeric strand. In the sodium salt 2 the complex anion is O,O' chelated to Na+, which is further encapsulated by a 15-crown-5 ligand to give a monomeric ion-pair complex. By contrast, the benzyl derivative 3 forms a dimer in which the terminal [SO2(NBn)2]2- ligands are (N,N'),(O,O') bis-chelated to Al3+ and Na+, respectively, and the bridging ligands adopt a novel N,O-chelate, N'-monodentate bonding mode. The central core of 3 consists of two four-membered AlOSN rings bridged by two NtBu groups. Crystal data: 1, orthorhombic, Pna2(1), a = 20.159(5) degrees, b = 10.354(3) degrees, c = 15.833(4) degrees, alpha = beta = gamma = 90 degrees, V = 3304.7(15) A3, Z = 4; 2, monoclinic, P2(1)/n, a = 16.031(2) A, b = 9.907(2) A, c = 23.963(4) A, beta = 103.326(2) degrees, Z = 4; 3, triclinic, P1, a = 12.7237(11) A, b = 14.0108(13) A, c = 16.2050(14) A, alpha = 110.351(2) degrees, beta = 111.538(2) degrees, gamma = 97.350(2) degrees, Z = 1.     

Trimerization of alkali dicyanamides M[N(CN)2] and formation of tricyanomelaminates M3[C6N9] (M = K, Rb) in the melt: crystal structure determination of three polymorphs of K[N(CN)2], two of Rb[N(CN)2], and one of K3[C6N9] and Rb3[C6N9] from X-ray powder diffractometry

The alkali dicyanamides M[N(CN)2] (M=K, Rb) were synthesized through ion exchange, and the corresponding tricyanomelaminates M3[C6N9] were obtained by heating the respective dicyanamides. The thermal behavior of the dicyanamides and their reaction to form the tricyanomelaminates were investigated by temperature-dependent X-ray powder diffractometry and thermoanalytical measurements. Potassium dicyanamide K[N(CN)2] was found to undergo four phase transitions: At 136 degrees C the low-temperature modification alpha-K[N(CN)2] transforms to beta-K[N(CN)2], and at 187degrees C the latter transforms to the high-temperature modification gamma-K[N(CN)2], which melts at 232 degrees C. Above 310 degrees C the dicyanamide ions [N(CN)2]- trimerize and the resulting tricyanomelaminate K3[C6N9] solidifies. Two modifications of rubidium dicyanamide have been identified: Even at -25 degrees C, the a form slowly transforms to beta-Rb[N(CN)2] within weeks. Rb[N(CN)2] has a melting point of 190 degrees C. Above 260 degrees C the dicyanamide ions [N(CN)2]- of the rubidium salt trimerize in the melt and the tricyanomelaminate Rb3[C6N9] solidifies. The crystal structures of all phases were determined by powder diffraction methods and were refined by the Rietveld method. alpha-K[N(CN)2] (Pbcm, a = 836.52(1), b = 46.90(1), c =7 21.27(1) pm, Z = 4), gamma-K[N(CN)2] (Pnma, a = 855.40(3), b = 387.80(1), 1252.73(4) pm, Z = 4), and Rb[N(CN)2] (C2/c, a = 1381.56(2), b = 1000.02(1), c = 1443.28(2) pm, 116.8963(6) degrees, Z = 16) represent new structure types. The crystal structure of beta-K[N(CN)2] (P2(1/n), a = -726.92(1), b 1596.34(2), c = 387.037(5) pm, 111.8782(6) degrees, Z = 4) is similar but not isotypic to the structure of alpha Na[N(CN)2]. alpha-Rb[N(CN)2] (Pbcm, a = 856.09(1), b = 661.711(7), c = 765.067(9) pm, Z = 4) is isotypic with alpha-K[N(CN)2]. The alkali dicyanamides contain the bent planar anion [N(CN)2]- of approximate symmetry C2, (average bond lengths: C-N(bridge) 133, C-N(term) 113 pm; average angles N-C-N 170 degrees, C-N-C 120 degrees). K3[C6N9] (P2(1/c), a = 373.82(1), b = 1192.48(5), c = 2500.4(1) pm, beta = 101.406(3) degrees, Z = 4) and Rb,[C6N9] (P2(1/c), a = 389.93(2), b = 1226.06(6), c = 2547.5(1) pm, 98.741(5) degrees, Z=4) are isotypic and they contain the planar cyclic anion [C6N9]3-. Although structurally related, Na3[C6N9] is not isotypic with the tricyanomelaminates M3[C6N9] (M = K, Rb).     

Synthesis and characterization of diverse coordination polymers. Linear and zigzag chains involving their structural transformation via intermolecular hydrogen-bonded, interpenetrating ladders polycatenane, and noninterpenetrating square grid from long, rigid N,N'-bidentate ligands: 1,4-bis[(x-pyridyl)ethynyl]benzene (x = 3 and 4)

The long, rigid ligands 1,4-bis[(3-pyridyl)ethynyl]benzene (L1) and 1,4-bis[(4-pyridyl)ethynyl]benzene (L2) were used in the synthesis of 10 new organic-inorganic coordination frameworks, each of them adopting different structural motifs. Synthesis, single-crystal X-ray structure determination, and spectroscopic and thermogravimetric analyses are presented. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] with L1 afforded the following one-dimensional zigzag chain structures: [Cd(C20H12N2)0.5(NO3)(CH3OH)]n (1, monoclinic, C2/c; a = 7.586(1) A, b = 23.222(1) A, c = 13.572(1) A, beta = 92.824(1), Z = 4); [{Cu(C20H12N2)(NO3)2(CH3OH)} x CH3OH]n (2, orthorhombic, P2(1)2(1)2(1); a = 8.589(1) A, b = 15.766(1) A, c = 17.501(1) A, Z = 4); [Co(C20H12N2)2(NO3)2(H2O)2] (5, triclinic, P1; a = 7.493(1) A, b = 8.948(1) A, c = 14.854(1) A, alpha = 100.427(1), beta = 97.324(1), gamma = 110.901(1), Z = 1); [Cu(C20H12N2)(hfac)2]n (4, monoclinic, C2/c, a = 18.828(1) A, b = 14.671(1) A, c = 13.427(1) A, beta = 90.447(1) degrees, Z = 4). Moreover, the minority phase compound formed from Cu(NO3)2 x 3H2O and L1 yielded a metallocyclic chain structure, [Cu(C20H12N2)(NO3)]n (3, triclinic, P; a = 8.728(1) A, b = 10.018(1) A, c = 11.893(1) A, alpha = 109.991(1), beta = 97.109(1), gamma = 115.542(1), Z = 1). In addition to the dinuclear coordination complex 5, all other polymeric structures (1-4) from L1 are composed of interpenetrating 2D and 3D cross-linked zigzag chains via hydrogen-bonding interactions. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] and L2 were dependent on the nature of the metal center and resulted in the formation of four different interpenetrating and noninterpenetrating compounds (6-10): [Co(C20H12N2)1.5(NO3)2]n (6, triclinic, P; a = 14.172(1) A, b = 15.795(1) A, c = 18.072(1) A, alpha = 115.380(1), beta = 101.319(1), gamma = 93.427(2), Z = 4), which consists of T-shaped building blocks assembled into three-dimensional interpenetrating polycatenated ladders; [Cd(C20H12N2)2(NO3)2]n (7, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), which adopts a two-dimensional noninterpenetrating square-grid motif; [Cu(C20H12N2)(hfac)2]n (8, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), composed of three sets of distinct one-dimensional linear chains; [Cu(C20H12N2)(EtOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2EtOH (9, triclinic, P; a = 12.248(2) A, b = 13.711(3) A, c = 18.257(4) A, alpha = 108.078(4) degrees, beta = 97.890(4) degrees, gamma = 103.139(5) degrees, Z = 2) and [Cu(C20H12N2)(MeOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2MeOH (10, triclinic, P; a = 12.136(1) A, b = 13.738(2) A, c = 17.563(3) A, alpha = 107.663(3) degrees, beta = 94.805(4) degrees, gamma = 104.021(4) degrees, Z = 2). Both 9 and 10 stack into infinite interpenetrating ladders through bundles of infinite chains and are described in our preliminary communication.     

Cationic Re(V) oxo complexes with poly(pyrazolyl)borates: synthesis, characterization, and stability

Cationic Re(V) oxo compounds of the type [ReO(OSiMe3)(eta 2-B(pz)4)(L)2]X [X = Cl, L = 4-(NMe2)C5H4N (1), 1-Meimz (1-methylimidazole; 2), 1/2 dmpe (1,2-bis(dimethylphosphino)ethane; 3), py (4a); X = I, L = py (4b)] can be prepared by reacting trans-[ReO2(eta 2-B(pz)4)(L)2] with XSiMe3. In solution, cations 1-4 are reactive species, and those with unidentate nitrogen donor ligands (1, 2, and 4) rearrange into the neutral derivatives [ReO(Cl)(OSiMe3)(eta 2-B(pz)4)(L)] [L = py (5), 4-(NMe2)C5H4N (6), 1-Meimz (7)], which are also reported herein. Compounds 1-3 and 5-7 have been fully characterized by the usual spectroscopic techniques, which in some cases includes X-ray crystallographic analysis (3, 6, and 7). Compound 3 crystallizes from CH2Cl2/n-hexane as yellow crystals with one molecule of CH2Cl2 solvent, and compounds 6 and 7 crystallize from THF/n-hexane as violet and red crystals, respectively, with one molecule of THF solvent in the case of 6. Crystallographic data: 3, orthorhombic space group Pn2(1)a, a = 11.311(2) A, b = 19.135(2) A, c = 15.443(2) A, V = 3342.4(8) A3, Z = 4; 6, triclinic space group P1, a = 8.7179(11) A, b = 12.5724(8) A, c = 17.750(2) A, alpha = 70.454(7) degrees, beta = 77.935(9) degrees, gamma = 77.129(8) degrees, V = 1768.1(3) A3, Z = 2; 7, monoclinic space group P2(1)/c, a = 16.356(2) A, b = 20.384(3) A, c = 17.360(3) A, beta = 106.971(12) degrees, V = 5535.8(14) A3, Z = 8.     

Novel metal-organic frameworks with specific topology from new tripodal ligands: 1,3,5-tris(1-imidazolyl)benzene and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene

Reactions of two new tripodal ligands 1,3,5-tris(1-imidazolyl)benzene (4) and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene (5) with metal [Ag(I), Cu(II), Zn(II), Ni(II)] salts lead to the formation of novel two-dimensional (2D) metal-organic frameworks [Ag(2)(4)(2)][p-C(6)H(4)(COO)(2)].H(2)O (6), [Ag(4)]ClO(4) (7), [Cu(4)(2)(H(2)O)(2)](CH(3)COO)(2).2H(2)O (8), [Zn(4)(2)(H(2)O)(2)](NO(3))(2) (9), [Ni(4)(2)(N(3))(2)].2H(2)O (10), and [Ag(5)]ClO(4) (11). All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 6: monoclinic, C2/c, a = 23.766(3) A, b = 12.0475(10) A, c = 13.5160(13) A, beta = 117.827(3) degrees, Z = 4. For compound 7: orthorhombic, P2(1)2(1)2(1), a = 7.2495(4) A, b = 12.0763(7) A, c = 19.2196(13) A, Z = 4. For compound 8: monoclinic, P2(1)/n, a = 8.2969(5) A, b = 12.2834(5) A, c = 17.4667(12) A, beta = 96.5740(10) degrees, Z = 2. For compound 9: monoclinic, P2(1)/n, a =10.5699(3) A, b = 11.5037(3) A, c = 13.5194(4) A, beta = 110.2779(10) degrees, Z = 2. For compound 10: monoclinic, P2(1)/n, a = 9.8033(3) A, b = 12.1369(5) A, c = 13.5215(5) A, beta = 107.3280(10) degrees, Z = 2. For compound 11: monoclinic C2/c, a = 18.947(2) A, b = 9.7593(10) A, c = 19.761(2) A, beta = 97.967(2) degrees, Z = 8. Both complexes 6 and 7 are noninterpenetrating frameworks based on the (6, 3) nets, and 8, 9 and 10 are based on the (4, 4) nets while complex 11 has a twofold parallel interpenetrated network with 4.8(2) topology. It is interesting that, in complexes 6,7, and 11 with three-coordinated planar silver(I) atoms, each ligand 4 or 5 connects three metal atoms, while in the case of complexes 8, 9, and 10 with six-coordinated octahedral metal atoms, each ligand 4 only links two metal atoms, and another imidazole nitrogen atom of 4 did not participate in the coordination with the metal atoms in these complexes. The results show that the nature of organic ligand and geometric needs of metal atoms have great influence on the structure of metal-organic frameworks.     

Polyfluorinated Tris(pyrazolyl)borates. Syntheses and Spectroscopic and Structural Characterization of Group 1 and Group 11 Metal Complexes of [HB(3,5-(CF(3))(2)Pz)(3)](-) and [HB(3-(CF(3))Pz)(3)](-)

The fluorinated tris(pyrazolyl)borate ligands [HB(3,5-(CF(3))(2)Pz)(3)](-) and [HB(3-(CF(3))Pz)(3)](-) (where Pz = pyrazolyl) have been synthesized as their sodium salts from the corresponding pyrazoles and NaBH(4) in high yield. These sodium complexes and the related [HB(3,5-(CF(3))(2)Pz)(3)]K(DMAC) were used as ligand transfer agents in the preparation of the copper and silver complexes [HB(3,5-(CF(3))(2)Pz)(3)]Cu(DMAC), [HB(3,5-(CF(3))(2)Pz)(3)]CuPPh(3), [HB(3,5-(CF(3))(2)Pz)(3)]AgPPh(3), and [HB(3-(CF(3))Pz)(3)]AgPPh(3). Metal complexes of the fluorinated [HB(3,5-(CF(3))(2)Pz)(3)](-) ligand have highly electrophilic metal sites relative to their hydrocarbon analogs. This is evident from the formation of stable adducts with neutral oxygen donors such as H(2)O, dimethylacetamide, or thf. Furthermore, the metal compounds derived from fluorinated ligands show fairly long-range coupling between fluorines of the trifluoromethyl groups and the hydrogen, silver, or phosphorus. The solid state structures show that the fluorines are in close proximity to these nuclei, thus suggesting a possible through-space coupling mechanism. Crystal structures of the sodium adducts exhibit significant metal-fluorine interactions. The treatment of [HB(3,5-(CF(3))(2)Pz)(3)]Na(H(2)O) with Et(4)NBr led to [Et(4)N][HB(3,5-(CF(3))(2)Pz)(3)], which contains a well-separated [Et(4)N](+) cation and the [HB(3,5-(CF(3))(2)Pz)(3)](-) anion in the solid state. Crystal data with Mo Kalpha (lambda = 0.710 73 ?) at 193 K: [HB(3,5-(CF(3))(2)Pz)(3)]Na(H(2)O), C(15)H(6)BF(18)N(6)NaO, a = 7.992(2) ?, b = 15.049(2) ?, c = 9.934(2) ?, beta = 101.16(2) degrees, monoclinic, P2(1)/m, Z = 2; [{HB(3-(CF(3))Pz)(3)}Na(thf)](2), C(32)H(30)B(2)F(18)N(12)Na(2)O(2), a = 9.063(3) ?, b = 10.183(2) ?, c = 12.129(2) ?, alpha = 94.61(1) degrees, beta = 101.16(2) degrees, gamma = 95.66(2) degrees, triclinic, &Pmacr;1, Z = 1; [HB(3,5-(CF(3))(2)Pz)(3)]Cu(DMAC), C(19)H(13)BCuF(18)N(7)O, a = 15.124(4) ?, b = 8.833(2) ?, c = 21.637(6) ?, beta = 105.291(14) degrees, monoclinic, P2(1)/n, Z = 4; [HB(3,5-(CF(3))(2)Pz)(3)]CuPPh(3), C(33)H(19)BCuF(18)N(6)P, a = 9.1671(8) ?, b = 14.908(2) ?, c = 26.764(3) ?, beta = 94.891(1) degrees, monoclinic, P2(1)/c, Z = 4; [HB(3,5-(CF(3))(2)Pz)(3)]AgPPh(3).0.5C(6)H(14), C(36)H(26)AgBF(18)N(6)P, a = 13.929(2) ?, b = 16.498(2) ?, c = 18.752(2) ?, beta = 111.439(6) degrees, monoclinic, P2(1)/c, Z = 4; [Et(4)N][HB(3,5-(CF(3))(2)Pz)(3)], C(23)H(24)BF(18)N(7), a = 10.155(2) ?, b = 18.580(4) ?, c = 16.875(5) ?, beta = 99.01(2) degrees, monoclinic, P2(1)/n, Z = 4.     

Re(III)Cl(3)] core complexes with bifunctional single amino acid chelates

The reactions of the Re(V) starting material [ReO(PPh(3))(2)Cl(3)] with ligands of the type XN(Y)Z [X = Y = 2-pyridylmethyl, Z = -CH(2)CO(2)Et (L(1)Et), -CH(2)CH(2)CO(2)Et (L(2)Et), -CH(2)CH(2)CH(2)CH(2)CH(NHCO(2)Bu(t))CO(2)H (L(3)H); X = 2-pyridylmethyl, Y = 2-(1-methylimidazolyl)methyl, Z = -CH(2)CO(2)Et (L(4)Et)] yielded the Re(III) trichloride complexes of the type [ReCl(3)(L(n)R)]. The complexes are mononuclear, paramagnetic species with a facial geometry of the chloride ligands. The nitrogen donors of the tridentate L(n)()R ligands complete the distorted octahedral coordination spheres of the complexes. Crystal data: [ReCl(3)(L(1)Et)] (1), monoclinic, C2/m, a = 16.088(3) A, b = 9.980(2) A, c = 12.829(2) A, beta = 91.384(3) degrees, Z = 4, D(calc) = 1.967 g/cm(-)(3); [ReCl(3)(L(4)Et)] (4), monoclinic, C2/c, a = 22.880(1) A, b = 7.4926(4) A, c = 22.560(1) A, beta = 94.186(1) degrees, Z = 8, D(calc) = 2.001 g/cm(-3).     

Lanthanide-transition-metal carbonyl complexes. 1. Syntheses and structures of ytterbium(II) solvent-separated ion pairs and isocarbonyl polymeric arrays of tetracarbonylcobaltate

Transmetalation reactions of metallic ytterbium with Hg[Co(CO)(4)](2) in the coordinating solvents pyridine and THF yield the solvent-separated ion pairs [Yb(L)(6)] [Co(CO)(4)](2) (1a, L = Pyr; 2a, L = THF). The IR spectrum of 1a in pyridine indicates that the tetracarbonylcobaltate anion is not directly bonded to the divalent Yb cation owing to the strong coordinating ability of pyridine. On the other hand, IR spectra of 2a in THF are concentration dependent. In dilute solutions there is an equilibrium between the solvent-separated ion pair and a weak contact ion pair. Higher concentrations of 2a facilitate the formation of a tight ion pair that has a low-frequency isocarbonyl absorption. Remarkably, complexes 1a and 2a are easily transformed in toluene into the two-dimensional sheetlike arrays [(Pyr)(4)Yb[(mu-CO)(2)Co(CO)(2)](2)](infinity) (1b) and [(THF)(2)Yb[(mu-CO)(3)Co(CO)](2).Tol](infinity) (2b). The two-dimensional frameworks are supported by isocarbonyl linkages. Infrared spectra of toluene solutions substantiate the existence of the isocarbonyl bridges with low-frequency absorptions at 1780 cm(-1). Compounds 1b and 2b belong to a rare class of lanthanide-transition-metal carbonyl extended arrays, only three others of which have been structurally established. Dissolving 1b in pyridine regenerates 1a, but the complete conversion of 2b into 2a cannot be achieved. Crystal data: 1a.Pyr is monoclinic, P2(1)/c, a = 11.171(1) A, b = 11.925(1) A, c = 33.978(1) A, beta = 95.10(1) degrees, Z = 4; 2a is monoclinic, C2/c, a = 17.724(1) A, b = 12.468(1) A, c = 18.413(1) A, beta = 100.34(1) degrees, Z = 4; 1b is monoclinic, C2/c, a = 11.047(1) A, b = 13.423(1) A, c = 21.933(1) A, beta = 103.49(1) degrees, Z = 4; 2b is monoclinic, C2/c, a = 28.589(1) A, b = 7.223(1) A, c = 14.983(1) A, beta = 118.90(1) degrees, Z = 4.     

Nucleophilic Addition of CH, NH, and OH Bonds to the Phosphadiazonium Cation and Interpretation of (31)P Chemical Shifts at Dicoordinate Phosphorus Centers

The phosphadiazonium cation [MesNP](+) reacts quantitatively with the fluorenylide anion, MesNH(2), and MesOH (Mes = 2,4,6-tri-tert-butylphenyl), resulting in formal insertion of the N-P moiety into the H-Y (Y = C, N, O) bonds. Specifically, reaction of MesNPCl with fluorenyllithium gives the aminofluorenylidenephosphine [crystal data: C(31)H(38)NP, monoclinic, P2(1)/c, a = 9.568(8) ?, b = 24.25(2) ?, c = 11.77(1) ?, beta = 101.38(8) degrees, Z = 4]. Similarly, reaction of [MesNP][GaCl(4)] with MesNH(2) gives the diaminophosphenium salt [MesN(H)PN(H)Mes][GaCl(4)] [crystal data: C(36)H(60)Cl(4)GaN(2)P, monoclinic, C2/c, a = 24.921(2) ?, b = 10.198(4) ?, c = 16.445(2) ?, beta = 93.32(1) degrees, Z = 4], and reaction with MesOH gives the first example of an aminooxyphosphenium salt [MesN(H)POMes][GaCl(4)]. It is proposed that the reactions involve nucleophilic attack at phosphorus followed by a 1,3-hydrogen migration from Y to N. Experimental evidence for the formation of sigma-complex intermediates is provided by the isolation of [MesNP-PPh(3)][SO(3)CF(3)] [crystal data: C(37)H(44)F(3)NO(3)P(2)S, triclinic, P&onemacr;, a = 10.663(1) ?, b = 19.439(1) ?, c = 10.502(1) ?, alpha = 103.100(7) degrees, beta = 113.311(7) degrees, gamma = 93.401(7) degrees, Z = 2]. As part of the unequivocal characterization of the aminooxyphosphenium salt, detailed solid-state (31)P NMR studies and GIAO calculations on the phosphenium cations have been performed. Contrary to popular belief, the phosphorus shielding in dicoordinate cations is not caused by the positive charge but results from efficient mixing between the phosphorus lone pair and pi orbitals.     

Coordination of lanthanide triflates and perchlorates with N,N,N',N'-tetramethylsuccinamide

Compounds formed from the reaction of N,N,N',N'-tetramethylsuccinamide (TMSA) with trivalent lanthanide salts possessing the poorly coordinating counteranions triflate (CF3SO3-) and perchlorate (ClO4-) have been prepared and examined. Structural features of these Ln-TMSA compounds have been studied in the solid phase by thermogravimetric analysis, infrared spectroscopy, and, in selected cases, by single-crystal X-ray diffraction and in solution by infrared spectroscopy. Eight-coordinate compounds, [Ln(TMSA)4]3+, derived from coordination of four succinamide ligands to the metal ion could be formed with all lanthanides examined (Ln = La, Pr, Nd, Eu, Yb, Lu). Structural analyses by single-crystal X-ray diffraction were performed for the lanthanide triflate salts Ln(C8H16N2O2)4(CF3SO3)3: Ln = La, compound 1, monoclinic, P2(1)/n, a = 11.0952(2) A, b = 19.2672(2) A, c = 24.9759(3) A, beta = 90.637(1) degrees, Z = 4, Dcalcd = 1.586 g cm-3; Ln = Nd, compound 2, monoclinic, C2/c, a = 24.6586(10) A, b = 19.3078(7) A, c = 11.1429(4) A, beta = 90.450(1) degrees, Z = 4, Dcalcd = 1.603 g cm-3; Ln = Eu, compound 3, monoclinic, C2/c, a = 24.4934(2) A, b = 19.3702(1) A, c = 11.1542(1) A, beta = 90.229(1) degrees, Z = 4, Dcalcd = 1.617 g cm-3; Ln = Lu, compound 5, monoclinic, C2/c, a = 24.2435(4) A, b = 19.6141(2) A, c = 11.2635(1) A, beta = 90.049(1) degrees, Z = 4, Dcalcd = 1.626 g cm-3. X-ray analysis was also carried out for the perchlorate salt: Ln = Eu, compound 4, triclinic, P1, a = 10.9611(2) A, b = 14.6144(3) A, c = 15.7992(2) A, alpha = 106.594(1) degrees, beta = 91.538(1) degrees, gamma = 90.311(1) degrees, Z = 2, Dcalcd = 1.561 g cm-3. In the presence of significant amounts of water, 7-coordinate compounds with mixed aquo-TMSA cation structures [Ln(TMSA)3(H2O)]3+ (Ln = Yb) and [Ln(TMSA)2(H2O)3]3+ (Ln = La, Pr, Nd, Eu, Yb) have been isolated with structural determinations by single-crystal X-ray diffraction obtained for the following species: Yb(C8H16N2O2)3(H2O)(CF3SO3)3, compound 6, monoclinic, P2(1)/n, a = 8.9443(3) A, b = 11.1924(4) A, c = 44.2517(13) A, beta = 93.264(1) degrees, Z = 4, Dcalcd = 1.735 g cm-3; Yb(C8H16N2O2)3(H2O)(ClO4)3, compound 7, monoclinic, Cc, a = 19.2312(6) A, b = 11.1552(3) A, c = 19.8016(4) A, beta = 111.4260(1) degrees, Z = 4, Dcalcd = 1.690 g cm-3; Yb(C8H16N2O2)2(H2O)3(CF3SO3)3, compound 8, triclinic, P1, a = 8.6719(1) A, b = 12.2683(2) A, c = 19.8094(3) A, alpha = 75.815(1) degrees, beta = 86.805(1) degrees, gamma = 72.607(1) degrees, Z = 2, Dcalcd = 1.736 g cm-3. Unlike in the analogous nitrate salts, only bidentate binding of the succinamide ligand to the lanthanide metal is observed. IR spectroscopy studies in anhydrous acetonitrile suggest that the solid-state structures of these Ln-TMSA compounds are maintained in solution.