Synthesis, characterization and magnetic properties of four new organically templated metal sulfates [C5H14N2][M(II)(H2O)6](SO4)2, (M(II) = Mn, Fe, Co, Ni)

A series of novel organically templated metal sulfates, [C(5)H(14)N(2)][M(II)(H(2)O)(6)](SO(4))(2) with (M(II) = Mn (1), Fe (2), Co (3) and Ni (4)), have been successfully synthesized by slow evaporation and characterized by single-crystal X-ray diffraction as well as with infrared spectroscopy, thermogravimetric analysis and magnetic measurements. All compounds were prepared using a racemic source of the 2-methylpiperazine and they crystallized in the monoclinic systems, P2(1)/n for (1, 3) and P2(1)/c for (2,4). Crystal data are as follows: [C(5)H(14)N(2)][Mn(H(2)O)(6)](SO(4))(2), a = 6.6385(10) ?, b = 11.0448(2) ?, c = 12.6418(2) ?, β = 101.903(10)°, V = 906.98(3) ?(3), Z = 2; [C(5)H(14)N(2)][Fe(H(2)O)(6)](SO(4))(2), a = 10.9273(2) ?, b = 7.8620(10) ?, c = 11.7845(3) ?, β = 116.733(10)°, V = 904.20(3) ?(3), Z = 2; [C(5)H(14)N(2)][Co(H(2)O)(6)](SO(4))(2), a = 6.5710(2) ?, b = 10.9078(3) ?, c = 12.5518(3) ?, β = 101.547(2)°, V = 881.44(4) ?(3), Z = 2; [C(5)H(14)N(2)][Ni(H(2)O)(6)](SO(4))(2), a = 10.8328(2) ?, b = 7.8443(10) ?, c = 11.6790(2) ?, β = 116.826(10)°, V = 885.63(2) ?(3), Z = 2. The three-dimensional structure networks for these compounds consist of isolated [M(II)(H(2)O)(6)](2+) and [C(5)H(14)N(2)](2+) cations and (SO(4))(2-) anions linked by hydrogen-bonds only. The use of racemic 2-methylpiperazine results in crystallographic disorder of the amines and creation of inversion centers. The magnetic measurements indicate that the Mn complex (1) is paramagnetic, while compounds 2, 3 and 4, (M(II) = Fe, Co, Ni respectively) exhibit single ion anisotropy.     

A new type of single-helix coordination polymer with mixed ligands [M2(phen)2(e,a-cis-1,4-chdc)2(H2O)2]n (M=Co and Ni; phen=1,10-phenanthroline; chdc=cyclohexanedicarboxylate)

A new family of single-stranded helices coordination polymers with mixed ligands, [M2(phen)2(e,a-cis-1,4-chdc)2(H2O)2]n (1, M=Co; 2, M=Ni; chdc=cyclohexanedicarboxylic acid; phen=1,10-phenanthroline), were prepared under hydrothermal conditions and characterized by elemental analyses, IR spectra, TG analysis, and single-crystal X-ray diffraction analysis. X-ray crystal structural analyses reveal that 1 and 2 are isomorphic and belong to the monoclinic system. C40H36Co2N4O10, P2(1)/c, a=10.0566(5) A, b=8.8843(5) A, c=20.2912(14) A, beta=100.052(3) degrees, Z=2 for 1; and C40H36Ni2N4O10, P2(1)/c, a=9.8921(6) A, b=9.0151(4) A, c=20.1628(17) A, beta=100.31(2) degrees, Z=2 for 2. In the structures of 1 and 2, the 1,4-chdc ligand possesses only one kind of e,a-cis-conformation although there are both cis- and trans-conformations in the raw material. Two oxygen atoms of one carboxyl in 1,4-chdc ligand and another oxygen atom of contraposition carboxyl link adjacent Co or Ni atoms into an infinite 1-D zigzag chain. The most attractive structural feature of 1 and 2 is that they both exhibit an infinite chiral chainlike structure with 2(1) helices along the b axis. In addition, the right-handed and the left-handed chains are alternate. Meanwhile, the adjacent chains of 1 and 2 are linked via hydrogen bonds into 2-D network structures, which further form 3-D frameworks via pi-pi interactions of 1,10-phen.     

Hydrothermal syntheses and crystal structures of complex-linked three-Dimensional coordination vanadium selenites: M(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (M = Co,Ni)

Two inorganic-organic hybrid compounds with the formula M(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (M = Co, Ni) were hydrothermally synthesized and characterized by single-crystal X-ray diffraction. Compounds Co(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (1) and Ni(4,4'-bipy)(H(2)O)V(2)Se(2)O(10) (2), which are structural analogues, crystallize in the triclinic space group Ponemacr; with crystal data a = 7.9665(3) A, b = 8.1974(3) A, c = 13.8096(4) A, alpha = 85.704(2) degrees, beta = 73.5180(10) degrees, gamma = 75.645(2) degrees, V = 837.76(5) A(3), and Z = 2 and a = 7.9489(19) A, b = 8.128(2) A, c = 13.709 A, alpha = 85.838(6) degrees, beta = 73.736(8) degrees, gamma = 75.594(9) degrees, V = 823.5(4) A(3), and Z = 2, respectively. [M(4,4'-bipy)(H(2)O)V(2)Se(2)O(10)] (M = Co, Ni) have a three-dimensional structure and consist of two subunits, [(VO(2))(SeO(3))](-) infinite chains and [M(4,4'-bipy)(H(2)O)](2+) fragments. The [(VO(2))(SeO(3))](-) chains are composed of [V(2)Se(4)O(14)](4)(-) clusters linked by VO(4)N triangular bipyramids. The 4,4'-bipy molecule as a bifunctional organic ligand is directly linked to Co or Ni and V atoms, affording the three-dimensionality. The compounds were characterized by infrared spectroscopy and differential thermal and thermogravimetric analyses.     

Two novel vanadium tellurites covalently bonded with metal-organic complex moieties: M(phen)V(2)TeO(8) (M = Cu, Ni)

Two novel two-dimensional organic-inorganic hybrid vanadium tellurites M(phen)V(2)TeO(8) (M = Cu (1), Ni (2)) have been hydrothermally synthesized and characterized by the elemental analyses, IR spectra, EPR spectrum, XPS spectra, TG analyses, and single-crystal X-ray diffraction. Compound 1 crystallizes in the monoclinic system, space group P2(1)/c, with a = 9.2193(18) A, b = 7.9853(16) A, c = 21.401(4) A, beta = 97.54(3) degrees, and Z = 4. Compound 2 crystallizes in the monoclinic system, space group P2(1)/c, with a = 9.2163(18) A, b = 7.9897(16) A, c = 21.386(4) A, beta = 97.52(3) degrees, and Z = 4. Compounds 1 and 2 are isostructural, and both exhibit interesting two-dimensional networks with [V(2)TeO(8)]( infinity ) double-chain-like ribbons bridged by metal-organic complex moieties [M(phen)](2+) (M = Cu and Ni). Furthermore, the three-dimensional supramolecular architectures of compounds 1 and 2 are formed by pi-pi stacking interactions of phen groups between adjacent layers.     

Two versatile N,N'-bipyridine-type ligands for preparing organic-inorganic coordination polymers: new cobalt- and nickel-containing framework materials

The Schiff base ligands 1,4-bis(4-pyridyl)-2,3-diaza-1,3-butadiene (L1, monoclinic, P2(1)/c, a = 3.856(1) A, b = 11.032(2) A, c = 12.738(3) A, beta = 92.21(3) degrees, Z = 2) and 2,5-bis(4-pyridyl)-3,4-diaza-2,4-hexadiene (L2, monoclinic, P2(1)/c, a = 10.885(2) A, b = 4.613(1) A, c = 14.978(3) A, beta = 92.827(4) degrees, Z = 2) were used in the synthesis of four new organic-inorganic coordination polymers, each of them adopting a different structural motif. Synthesis, X-ray structural determinations, and spectroscopic and thermogravimetric analyses are presented. The reaction between Co(NO(3))(2).6H(2)O and L1 afforded a two-dimensional noninterpenetrating brick-wall structure, [Co(C(12)N(4)H(10))(1.5)(NO(3))(2)(H(2)O)(CH(2)Cl(2))(2)](n)() (1, triclinic, P1; a = 10.242(7) A, b = 10.802(7) A, c = 15.100(1) A, alpha = 70.031(1), beta = 75.168(11), gamma = 76.155(11), Z = 2), while Ni(NO(3))(2).6H(2)O combined with L1 yielded an interpenetrating three-dimensional rhombus-grid polymer, [Ni(C(12)N(4)H(10))(2)(NO(3))(2)(OC(4)H(8))(1.66)(H(2)O)(0.33)](n) (2, monoclinic, C2/c; a = 20.815(8) A, b = 23.427(8) A, c = 17.291(6) A, beta = 116.148(6), Z = 8). The reaction of Co(NO(3))(2).6H(2)O and L2 was found to be solvent-sensitive and resulted in the formation of two different noninterpenetrating compounds: [Co(C(14)N(4)H(14))(2)(NO(3))(2)(C(6)H(6))(1.5)](n)() (3, monoclinic, C2/c; a = 22.760(2) A, b = 21.010(3) A, c = 25.521(2) A, beta = 97.151(2), Z = 8), which adopts a two-dimensional square-grid motif formed by propeller-type modules, and [Co(C(14)N(4)H(14))(1.5)(NO(3))(2)(CH(2)Cl(2))(2)](n)() (4, monoclinic, P2(1)/n; a = 14.432(2) A, b = 14.543(8) A, c = 15.448(4) A, beta = 96.968(0), Z = 4), consisting of T-shaped building blocks assembled into a one-dimensional ladder-type structure. These four coordination polymers all exhibit impressive thermal stability. Thermogravimetric studies showed that after complete removal of the solvents, the frameworks are stable to temperatures between 234 degrees C and 260 degrees C.     

Two-dimensional metal-organic frameworks (MOFs) constructed from heterotrinuclear coordination units and 4,4'-biphenyldicarboxylate ligands

Three novel metal-organic frameworks (MOFs) formulated as [Zn(2)M(BPDC)(3)(DMF)(2)].4DMF (M = Co(II), Ni(II) or Cd(II); BPDC = 4,4'-biphenyldicarboxylate; DMF = N,N'-dimethylformamide) have been prepared via solvothermal synthesis from mixtures of the corresponding transition metal salts and 4,4'-biphenyldicarboxylic acid (H(2)BPDC). The framework structures are characterized by single-crystal X-ray diffraction analysis, IR and UV-vis diffuse reflectance spectroscopy, thermogravimetric analysis (TGA), and X-ray powder diffraction (XRPD). All three compounds possess essentially the same 2-D layered coordination framework consisting of linear heterotrinuclear secondary building units (SBUs) connected by rigid bridging BPDC ligands. Crystal data: for (C(60)H(66)CoN(6)O(18)Zn(2)): monoclinic, space group P2(1)/n, M = 1348.86, a = 20.463(4), b = 14.819(3), c = 23.023(5) A, beta = 111.75(3) degrees , V = 6484(2) A(3), Z = 4, D(c) = 1.382 Mg m(-3). For (C(60)H(66)N(6)NiO(18)Zn(2)): monoclinic, space group P2(1)/n, M = 1348.64, a = 11.670(2), b = 14.742(3), c = 19.391(4) A, beta = 102.29(3) degrees , V = 3259.5(11) A(3), Z = 2, D(c) = 1.374 Mg m(-3). For (C(60)H(66)CdN(6)O(18)Zn(2)): monoclinic, space group P2(1)/n, M = 1402.33, a = 11.491(2), b = 14.837(3), c = 19.386(4) A, beta = 101.53(3) degrees , V = 3238.3(11) A(3), Z = 2, D(c) = 1.438 Mg m(-3).     

Novel hydrogen-bonded three-dimensional networks encapsulating one-dimensional covalent chains: [M(4,4'-bipy)(H2O)(4)](4-abs)(2).nH2O (4,4'-bipy = 4,4'-bipyridine; 4-abs = 4-aminobenzenesulfonate) (M = Co,n = 1; M = Mn,n = 2)

Two novel compounds, [Co(4,4'-bipy)(H(2)O)(4)](4-abs)(2).H(2)O (1) and [Mn(4,4'-bipy)(H(2)O)(4)](4-abs)(2).2H(2)O (2) (4,4'-bipy = 4,4'-bipyridine; 4-abs = 4-aminobenzenesulfonate), have been synthesized in aqueous solution and characterized by single-crystal X-ray diffraction, elemental analyses, UV-vis and IR spectra, and TG analysis. X-ray structural analysis revealed that 1 and 2 both possess unusual hydrogen-bonded three-dimensional (3-D) networks encapsulating one-dimensional (1-D) covalently bonded infinite [M(4,4'-bipy)(H(2)O)(4)](2+) (M = Co, Mn) chains. The 4-abs anions in 1 form 1-D zigzag chains through hydrogen bonds. These chains are further extended through crystallization water molecules into 3-D hydrogen-bonded networks with 1-D channels, in which the [Co(4,4'-bipy)(H(2)O)(4)](2+) linear covalently bonded chains are located. Crystal data for 1: C(22)H(30)CoN(4)O(11)S(2), monoclinic P2(1), a = 11.380(2) A, b = 8.0274(16) A, c = 15.670(3) A, alpha = gamma = 90 degrees, beta = 92.82(3) degrees, Z = 2. Compound 2 contains interesting two-dimensional (2-D) honeycomb-like networks formed by 4-abs anions and lattice water molecules via hydrogen bonding, which are extended through other crystallization water molecules into three dimensions with 1-D hexagonal channels. The [Mn(4,4'-bipy)(H(2)O)(4)](2+) linear covalent chains exist in these channels. Crystal data for 2: C(22)H(32)MnN(4)O(12)S(2), monoclinic P2(1)/c, a = 15.0833(14) A, b = 8.2887(4) A, c = 23.2228(15) A, alpha = gamma = 90 degrees, beta = 95.186(3) degrees, Z = 4.     

Stabilizing Heterobimetallic Complexes Containing Unsupported Ti-M Bonds (M = Fe, Ru, Co): The Nature of Ti-M Donor-Acceptor Bonds

The stabilization of unsupported Ti-M (M = Fe, Ru, Co) heterodinuclear complexes has been achieved by use of amidotitanium building blocks containing tripodal amido ligands. Salt metathesis of H(3)CC(CH(2)NSiMe(3))(3)TiX (1) and C(6)H(5)C(CH(2)NSiMe(3))(3)TiX (2) as well as HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)TiX (3) (X = Cl, a; Br, b) with K[M(CO)(2)Cp] (M = Fe, Ru) and Na[Co(CO)(3)(PR(3))] (R = Ph, Tol) gave the corresponding stable heterobimetallic complexes of which H(3)CC(CH(2)NSiMe(3))(3)Ti-M(CO)(2)Cp (M = Fe, 6; Ru, 7) and HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)Ti-M(CO)(2)Cp (M = Fe, 12; Ru, 13) have been characterized by X-ray crystallography. 6: monoclinic, P2(1)/n, a = 15.496(3) ?, b = 12.983(3) ?, c = 29.219(3) ?, beta = 104.52(2) degrees, Z = 8, V = 5690.71 ?(3), R = 0.070. 7: monoclinic, P2(1)/c, a = 12.977(3) ?, b = 12.084(3) ?, c = 18.217(3) ?, beta = 91.33(2) degrees, Z = 4, V = 2855.91 ?(3), R = 0.048. 12: monoclinic, I2/c, a = 24.660(4) ?, b = 15.452(3) ?, c = 20.631(4) ?, beta = 103.64(3) degrees, Z = 8, V = 7639.65 ?(3), R = 0.079. 13: monoclinic, I2/c, a = 24.473(3) ?, b = 15.417(3) ?, c = 20.783(4) ?, beta = 104.20(2) degrees, Z = 8, V = 7601.84 ?(3), R = 0.066. (1)H- and (13)C-NMR studies in solution indicate free internal rotation of the molecular fragments around the Ti-M bonds. Fenske-Hall calculations performed on the idealized system HC(CH(2)NH)(3)Ti-Fe(CO)(2)Cp (6x) have revealed a significant degree of pi-donor-acceptor interaction between the two metal fragments reinforcing the Ti-Fe sigma-bond. Due to the availability of energetically low-lying pi-acceptor orbitals at the Ti center this partial multiple bonding is more pronounced that in the tin analogue HC(CH(2)NH)(3)Sn-Fe(CO)(2)Cp (15x) in which an N-Sn sigma-orbital may act as pi-acceptor orbital.     

New metalloligands [M(SC[O]Ph)(4)](-): synthesis and characterization of polymeric [A(MeCN)(x)[M(SC[O]Ph)(4)]] compounds (A = Li,Na and K; M = Ga and In; x = 0-2)

Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials.     

Crystal structures and solution behavior of paramagnetic divalent transition metal complexes (Fe, Co) of the sterically encumbered tridentate macrocycles 1,4,7-R3-1,4,7-triazacyclononane: coordination numbers 5 (R = i-Pr) and 6 (R = i-Bu)

The coordination chemistry of the sterically hindered macrocyclic triamines, 1,4,7-R3-1,4,7-triazacyclononane (R = i-Pr, i-Pr3tacn, and R = i-Bu, i-Bu3tacn) with divalent transition metals has been investigated. These ligands form a series of stable novel complexes with the triflate salts MII(CF3SO3)2 (M = Fe, Co, or Zn) under anaerobic conditions. The complexes Fe(i-Pr3tacn)(CF3SO3)2 (2), [Co(i-Pr3tacn)(SO3CF3)(H2O)](CF3SO3) (3), [Co(i-Pr3tacn)(CH3CN)2](BPh4)2 (4), Zn(i-Pr3tacn)(CF3SO3)2 (5), [Fe(i-Bu3tacn)(CH3CN)2(CF3SO3)](CF3SO3) (6), Fe(i-Bu3tacn)-(H2O)(CF3SO3)2 (7), and Co(i-Bu3tacn)(CF3SO3)2 (8) have been isolated. The behavior of these paramagnetic complexes in solution is explored by their 1H NMR spectra. The solid-state structures of four complexes have been determined by X-ray single-crystal crystallography. Crystallographic parameters are as follows. 2: C17H33F6FeN3O6S2, monoclinic, P2(1)/n, a = 10.895(1) A, b = 14.669(1) A, c = 16.617(1) A, beta = 101.37(1) degrees, Z = 4. 3: C17H35CoF6N3O7S2, monoclinic, P2(1)/c, a = 8.669(2) A, b = 25.538(3) A, c = 12.4349(12) A, beta = 103.132(13) degrees, Z = 4. 6: C24H45F6FeN5O6S2, monoclinic, P2(1)/c, a = 12.953(6) A, b = 16.780(6) A, c = 15.790(5) A, beta = 96.32(2) degrees, Z = 4. 7: C20H41F6FeN3O7S2, monoclinic, C2/c, a = 22.990(2) A, b = 15.768(2) A, c = 17.564(2) A, beta = 107.65(1) degrees, Z = 8. The ligand i-Pr3tacn leads to complexes in which the metal ions are five-coordinate, while it's isobutyl homologue affords six-coordinate complexes. This difference in the stereochemistries around the metal center is attributed to steric interactions involving the bulky alkyl appendages of the macrocycles.     

Inorganic-organic framework structures; M(II) ethylenediphosphonates (M = Co, Ni, Mn) and a Mn(II) ethylenediphosphonato-phenanthroline

The reaction of nickel, cobalt, and manganese with 1,2-ethylenediphosphonic acid or 1,2-ethylenediphosphonic acid and 1,10-phenanthroline under hydrothermal conditions resulted in the pillared layered structures Co2(H2O)2(O3PC2H4PO3) (I) and Ni2(H2O)2(O3PC2H4PO3) (II), which are isostructural to a zinc phase that has previously been characterized by X-ray powder methods. In addition, a 1D chain structure, Mn(HO3P(CH2)2PO3H)(H2O)2(C12H8N2) (III), and a pillared layered structure, Mn(HO3P(CH2)2PO3H) (IV), were obtained. The structures of these phases were solved by single-crystal X-ray diffraction methods. The crystallographic data are as follows: compound I P21/n (No. 14), a = 5.6500(11) A, b = 4.7800(10) A, c = 15.330(3) A, beta = 98.50(3) degrees, V = 409.47(14) A3, Z = 2; compound II P21/n (No. 14), a = 5.5807(11) A, b = 4.7205(9) A, c = 15.250(3) A, beta = 98.55(3) degrees, V = 397.28(13) A3, Z = 2; compound III C2/c (No. 15), a = 12.109(2) A, b = 15.328(3) A, c = 9.848(2) A, beta = 108.88(3) degrees, V = 1729.5(6) A3, Z = 4; compound IV P (No. 2), a = 5.498(5) A, b = 7.715(6) A, c = 8.093(7) A, alpha = 82.986(12) degrees, beta = 75.565(12) degrees, gamma = 80.582(12)degrees, V = 326.7(5) A3, Z = 2. Magnetic measurements show antiferromagnetic behavior below TN = 7 K for I and 13 K for II.     

Structural influences of organonitrogen ligands on vanadium oxide solids. Hydrothermal syntheses and structures of the terpyridine vanadates [V2O4(terpy)2]3[V10O28], [VO2(terpy)][V4O10], and [V9O22(terpy)3

Hydrothermal reactions of the V2O5/2,2':6':2"-terpyridine/ZnO/H2O system under a variety of conditions yielded the organic-inorganic hybrid materials [V2O4(terpy)2]3[V10O28].2H2O (VOXI-10), [VO2(terpy)][V4O10] (VOXI-11), and [V9O22(terpy)3] (VOXI-12). The structure of VOXI-10 consists of discrete binuclear cations [V2O4(terpy)2]2+ and one-dimensional chains [V10O28]6-, constructed of cyclic [V4O12]4- clusters linked through (VO4) tetrahedra. In contrast, the structure of VOXI-11 exhibits discrete mononuclear cations [VO2(terpy)]1+ and a two-dimensional vanadium oxide network, [V4O10]1-. The structure of the oxide layer is constructed from ribbons of edge-sharing square pyramids; adjacent ribbons are connected through corner-sharing interactions into the two-dimensional architecture. VOXI-12 is also a network structure; however, in this case the terpy ligand is incorporated into the two-dimensional oxide network whose unique structure is constructed from cyclic [V6O18]6- clusters and linear (V3O5(terpy)3) moieties of corner-sharing vanadium octahedra. The rings form chains through corner-sharing linkages; adjacent chains are connected through the trinuclear units. Crystal data: VOXI-10, C90H70N18O42V16, triclinic P1, a = 12.2071(7) A, b = 13.8855(8) A, 16.9832(10) A, alpha = 69.584(1) degrees, beta = 71.204(1) degrees, gamma = 84.640(1) degrees, Z = 1; VOXI-11, C15H11N3O12V5, monoclinic, P2(1)/n, a = 7.7771(1) A, b = 10.3595(2) A, c = 25.715(4) A, beta = 92.286(1) degrees, Z = 4; VOXI-12, C45H33N9O22V9, monoclinic C2/c, a = 23.774(2) A, b = 9.4309(6) A, c = 25.380(2) A, beta = 112.047(1) degrees, Z = 4.     

Novel metal-organic frameworks with specific topology from new tripodal ligands: 1,3,5-tris(1-imidazolyl)benzene and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene

Reactions of two new tripodal ligands 1,3,5-tris(1-imidazolyl)benzene (4) and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene (5) with metal [Ag(I), Cu(II), Zn(II), Ni(II)] salts lead to the formation of novel two-dimensional (2D) metal-organic frameworks [Ag(2)(4)(2)][p-C(6)H(4)(COO)(2)].H(2)O (6), [Ag(4)]ClO(4) (7), [Cu(4)(2)(H(2)O)(2)](CH(3)COO)(2).2H(2)O (8), [Zn(4)(2)(H(2)O)(2)](NO(3))(2) (9), [Ni(4)(2)(N(3))(2)].2H(2)O (10), and [Ag(5)]ClO(4) (11). All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 6: monoclinic, C2/c, a = 23.766(3) A, b = 12.0475(10) A, c = 13.5160(13) A, beta = 117.827(3) degrees, Z = 4. For compound 7: orthorhombic, P2(1)2(1)2(1), a = 7.2495(4) A, b = 12.0763(7) A, c = 19.2196(13) A, Z = 4. For compound 8: monoclinic, P2(1)/n, a = 8.2969(5) A, b = 12.2834(5) A, c = 17.4667(12) A, beta = 96.5740(10) degrees, Z = 2. For compound 9: monoclinic, P2(1)/n, a =10.5699(3) A, b = 11.5037(3) A, c = 13.5194(4) A, beta = 110.2779(10) degrees, Z = 2. For compound 10: monoclinic, P2(1)/n, a = 9.8033(3) A, b = 12.1369(5) A, c = 13.5215(5) A, beta = 107.3280(10) degrees, Z = 2. For compound 11: monoclinic C2/c, a = 18.947(2) A, b = 9.7593(10) A, c = 19.761(2) A, beta = 97.967(2) degrees, Z = 8. Both complexes 6 and 7 are noninterpenetrating frameworks based on the (6, 3) nets, and 8, 9 and 10 are based on the (4, 4) nets while complex 11 has a twofold parallel interpenetrated network with 4.8(2) topology. It is interesting that, in complexes 6,7, and 11 with three-coordinated planar silver(I) atoms, each ligand 4 or 5 connects three metal atoms, while in the case of complexes 8, 9, and 10 with six-coordinated octahedral metal atoms, each ligand 4 only links two metal atoms, and another imidazole nitrogen atom of 4 did not participate in the coordination with the metal atoms in these complexes. The results show that the nature of organic ligand and geometric needs of metal atoms have great influence on the structure of metal-organic frameworks.     

Synthesis and characterization of the complexes of pentane-2,4-dione with nickel(II) and cobalt(III): [Ni(acac)2].0.5CH3OH and [Co(acac)2NO3].2H2O (acac = pentane-2,4-dione)

Two mononuclear complexes, [Ni(acac)2].0.5CH3OH (1) and[Co(acac)2NO3].2H2O (2) (acac = pentane-2,4-dione), have been synthesized and characterized by single crystal X-ray analysis. Complex 1 crystallizes in the monoclinic space group P2(1)/c with a = 9.295(4), b = 11.450(5), c = 12.974(6) A, V = 1379.1(11) A(3),beta = 92.854(7), and Z = 4. Complex 2 crystallizes in the triclinic space group P(-1) with a= 8.153(9), b = 9.925(11), c = 10.355(12), V = 746.3(15) A(3), alpha = 70.530(16), beta =71.154(15), gamma = 80.698(16) and Z = 2. Complex 1 has a one-dimensional chain-like structure, which is extended by weak hydrogen contacts, while complex 2 shows a three-dimensional network structure.     

Robust, alkali-stable, triscarbonyl metal derivatives of hexametalate anions, [M6O19[M'(CO)3]n](8-n)- (M = Nb, Ta; M' =Mn, Re; n = 1, 2)

Ten 1:1 and 2:1 complexes of [Mn(CO)(3)](+) and [Re(CO)(3)](+) with [Nb(6)O(19)](8)(-) and [Ta(6)O(19)](8)(-) have been isolated as potassium salts in good yields and characterized by elemental analysis, (17)O NMR and infrared spectroscopy, and single-crystal X-ray structure determinations. Crystal data for 1 (t-Re(2)Ta(6)): empirical formula, K(4)Na(2)Re(2)C(6)Ta(6)O(35)H(20), monoclinic, space group, C2/m, a = 17.648(3) A, b = 10.056(1) A, c = 13.171(2) A, beta = 112.531(2) degrees, Z = 2. 2 (t-Re(2)Nb(6)): empirical formula, K(6)Re(2)C(6)Nb(6)O(38)H(26), monoclinic, space group, C2/m, a = 17.724(1) A, b = 10.0664(6) A, c = 13.1965(7) A, beta = 112.067(1) degrees, Z = 2. 3 (t-Mn(2)Nb(6)): empirical formula, K(6)Mn(2)C(6)Nb(6)O(37)H(24), monoclinic, space group, C2/m, a = 17.812(2) A, b = 10.098(1) A, c = 13.109(2) A, beta = 112.733(2) degrees, Z = 2. 4 (c-Mn(2)Nb(6)): empirical formula, K(6)Mn(2)C(6)Nb(6)O(50)H(50), triclinic, space group, P1, a = 10.2617(6) A, b = 13.4198(8) A, c = 21.411(1) A, alpha = 72.738(1) degrees, beta = 112.067(1) degrees, gamma = 83.501(1) degrees, Z = 2. 5 (c-Re(2)Nb(6)): empirical formula, K(6)Re(2)C(6)Nb(6)O(54)H(58), monoclinic, space group, P2(1)/c, a = 21.687(2) A, b = 10.3085(9) A, c = 26.780(2) A, beta = 108.787(1) degrees, Z = 4. The complexes contain M(CO)(3) groups attached to the surface bridging oxygen atoms of the hexametalate anions to yield structures of nominal C(3)(v)() (1:1), D(3)(d)() (trans 2:1), and C(2)(v)() (cis 2:1) symmetry. The syntheses are carried out in aqueous solution or by aqueous hydrothermal methods, and the complexes have remarkably high thermal, redox, and hydrolytic stabilities. The Re-containing compounds are stable to 400-450 degrees C, at which point CO loss occurs. The Mn compounds lose CO at temperatures above 200 degrees C. Cyclic voltammetry of all complexes in 0.1 M sodium acetate show no redox behavior, except an irreversible oxidation process at approximately 1.0 V vs. Ag/AgCl. In contrast to the parent hexametalate anions that are stable only in alkaline (pH >10) solution, the new complexes are stable, at least kinetically, between pH 4 and pEta approximately 12.     

New d0 transition metal iodates: synthesis, structure, and characterization of BaTi(IO3)6, LaTiO(IO3)5, Ba2VO2(IO3)4.(IO3), K2MoO2(IO3)4, and BaMoO2(IO3)4.H2O

Five new d0 transition metal iodates, BaTi(IO3)6, LaTiO(IO3)5, Ba2VO2(IO3)4.(IO3), K2MoO2(IO3)4, and BaMoO2(IO3)4.H2O, have been synthesized by hydrothermal methods using Ba(OH)2.8H2O, La2O3, K2CO3, TiO2, V2O5, MoO3, and HIO3 as reagents. The structures of these compounds were determined by single-crystal X-ray diffraction. All of the reported materials have zero-dimensional or pseudo-one-dimensional crystal structures composed of MO6 (M = Ti4+, V5+, or Mo6+) octahedra connected to IO3 polyhedra. Infrared and Raman spectroscopy, thermogravimetric analysis, and UV-vis diffuse reflectance spectroscopy are also presented. Crystal data: BaTi(IO3)6, trigonal, space group R-3 (No. 148), with a = b = 11.4711(10) A, c = 11.1465(17) A, V = 1270.2(2) A3, and Z = 3; LaTiO(IO3)5, monoclinic, space group P2(1)/n (No. 14), with a = 7.4798(10) A, b = 18.065(2) A, c = 10.4843(14) A, beta = 91.742(2) degrees , V = 1416.0(3) A3, and Z = 4; Ba2VO2(IO3)4.(IO3), monoclinic, space group P2(1)/c (No. 14), with a = 7.5012(9) A, b = 33.032(4) A, c = 7.2150(9) A, beta = 116.612(2) degrees , V = 1598.3(3) A3, and Z = 4; K2MoO2(IO3)4, monoclinic, space group C2/c (No. 15), with a = 12.959(2) A, b = 6.0793(9) A, c = 17.748(3) A, beta = 102.410(4) degrees , V = 1365.5(4) A3, and Z = 4; BaMoO2(IO3)4.H(2)O, monoclinic, space group P2(1)/n (No. 14), with a = 13.3368(17) A, b = 5.6846(7) A, c = 18.405(2) A, beta = 103.636(2) degrees , V = 1356.0(3) A3, and Z = 4.     

Cyano-bridged bimetallic assemblies from hexacyanometalate, [M(CN)6](3-) (M = Mn(III) and Fe(III)), and [M(N4-macrocycle)]2+ (M=Fe(III), Ni(II) and Zn(II)) building blocks. Syntheses, multidimensional structures, and magnetic properties

Reactions between [M(N(4)-macrocycle)](2+) (M = Zn(II) and Ni(II); macrocycle ligands are either CTH = d,l-5,5,7,12,12,14-hexamethyl-1,4,8,11-tetraazacyclotetradecane or cyclam = 1,4, 8, 11-tetrazaazaciclotetradecane) and [M(CN)(6)](3-) (M = Fe(III) and Mn(III)) give rise to cyano-bridged assemblies with 1D linear chain and 2D honeycomblike structures. The magnetic measurements on the 1D linear chain complex [Fe(cyclam)][Fe(CN)(6)].6H(2)O 1 points out its metamagnetic behavior, where the ferromagnetic interaction operates within the chain and the antiferromagnetic one between chains. The Neel temperature, T(N), is 5.5 K and the critical field at 2 K is 1 T. The unexpected ferromagnetic intrachain interaction can be rationalized on the basis of the axially elongated octahedral geometry of the low spin Fe(III) ion of the [Fe(cyclam)](3+) unit. The isostructural substitution of [Fe(CN)(6)](3-) by [Mn(CN)(6)](3-) in the previously reported complex [Ni(cyclam)](3)[Fe(CN)(6)](2).12H(2)O 2 leads to [Ni(cyclam)](3)[Mn(CN)(6)](2).16 H(2)O 3, which exhibits a corrugated 2D honeycomblike structure and a metamagnetic behavior with T(N) = 16 K and a critical field of 1 T. In the ferromagnetic phase (H > 1 T) this compound shows a very important coercitive field of 2900 G at 2 K. Compound [Ni(CTH)](3)[Fe(CN)(6)](2).13H(2)O 4, C(60)H(116)Fe(2)N(24)Ni(3)O(13), monoclinic, A 2/n, a = 20.462(7), b = 16.292(4), c = 27.262(7) A, beta = 101.29(4) degrees, Z = 4, also has a corrugated 2D honeycomblike structure and a ferromagnetic intralayer interaction, but, in contrast to 2 and 3, does not exhibit any magnetic ordering. This fact is likely due to the increase of the interlayer separation in this compound. ([Zn(cyclam)Fe(CN)(6)Zn(cyclam)] [Zn(cyclam)Fe(CN)(6)].22H(2)O.EtOH) 5, C(44)H(122)Fe(2)N(24)O(23)Zn(3), monoclinic, A 2/n, a = 14.5474(11), b = 37.056(2), c = 14.7173(13) A, beta = 93.94(1) degrees, Z = 4, presents an unique structure made of anionic linear chains containing alternating [Zn(cyclam)](2+) and [Fe(CN)(6)](3)(-) units and cationic trinuclear units [Zn(cyclam)Fe(CN)(6)Zn(cyclam)](+). Their magnetic properties agree well with those expected for two [Fe(CN)(6)](3-) units with spin-orbit coupling effect of the low spin iron(III) ions.     

Pentanuclear homoleptic M(5)L(6) (M = Mn(II), Co(II), Zn(II)) complexes formed by strict self-assembly

A series of trigonal bipyramidal pentanuclear complexes involving the alkoxo-diazine ligands poap and p3oap, containing the M(5)[mu-O](6) core is described, which form by a strict self-assembly process. [Co(5)(poap-H)(6)](ClO(4))(4).3H(2)O (1), [Mn(5)(poap-H)(6)](ClO(4))(4).3.5CH(3)OH.H(2)O (2), [Mn(5)(p3oap-H)(6)](ClO(4))(4).CH(3)CH(2)OH.3H(2)O (3), and [Zn(5)(poap-H)(6)](ClO(4))(4).2.5H(2)O (4) are homoleptic pentanuclear complexes, where there is an exact match between the coordination requirements of the five metal ions in the cluster, and the available coordination pockets in the polytopic ligand. [Zn(4)(poap)(poap-H)(3)(H(2)O)(4)] (NO(3))(5).1.5H(2)O (5) is a square [2 x 2] grid with a Zn(4)[mu-O](4) core, and appears to result from the presence of NO(3), which is thought to be a competing ligand in the self-assembly. X-ray structures are reported for 1, 4, and 5. 1 crystallized in the monoclinic system, space group P2(1)/n with a = 13.385(1) A, b = 25.797(2) A, c = 28.513(3) A, beta = 98.704(2) degrees, and Z = 4. 4 crystallized in the triclinic system, space group P1 with a = 13.0897(9) A, b = 18.889(1) A, c = 20.506(2) A, alpha = 87.116(1) degrees, beta = 74.280(2) degrees, gamma = 75.809(2) degrees, and Z = 2. 5 crystallized in the monoclinic system, space group P2(1)/n with a = 14.8222(7) A, b = 21.408(1) A, c = 21.6197(9) A, beta = 90.698(1) degrees, and Z = 4. Compounds 1-3 exhibit intramolecular antiferromagnetic coupling.     

Coordination-position isomeric M(II)Cu(II) and Cu(II)M(II) (M = Co, Ni, Zn) complexes derived from macrocyclic compartmental ligands

The dinucleating macrocyclic ligands (L(2;2))(2-) and (L(2;3))(2-), comprised of two 2-[(N-methylamino)methyl]-6-(iminomethyl)-4-bromophenolate entities combined by the -(CH(2))(2)- chain between the two aminic nitrogen atoms and by the -(CH(2))(2)- or -(CH(2))(3)- chain between the two iminic nitrogen atoms, have afforded the following M(II)Cu(II) complexes: [CoCu(L(2;2))](ClO(4))(2).MeCN (1A), [NiCu(L(2;2))](ClO(4))(2) (2A), [ZnCu(L(2;2))](ClO(4))(2).0.5MeCN.EtOH (3A), [CoCu(L(2;3))(MeCN)(2-PrOH)](ClO(4))(2) (4A), [NiCu(L(2;3))](ClO(4))(2) (5A), and [ZnCu(L(2;3))](ClO(4))(2).1.5DMF (6A). [CoCu(L(2;2))(MeCN)(3)](ClO(4))(2) (1A') crystallizes in the monoclinic space group P2(1)/n, a = 11.691(2) A, b = 18.572(3) A, c = 17.058(3) A, beta= 91.18(2) degrees, V = 3703(1) A(3), and Z = 4. [NiCu(L(2;2))(DMF)(2)](ClO(4))(2) (2A') crystallizes in the triclinic space group P(-)1, a = 11.260(2) A, b = 16.359(6) A, c = 10.853(4) A, alpha= 96.98(3) degrees, beta= 91.18(2) degrees, gamma= 75.20(2) degrees, V = 1917(1) A(3), and Z = 2. 4A crystallizes in the monoclinic space group P2(1)/c, a = 15.064(8) A, b = 11.434(5) A, c = 21.352(5) A, beta= 95.83(2)degrees, V = 3659(2) A(3), and Z = 4. The X-ray crystallographic results demonstrate the M(II) to reside in the N(amine)(2)O(2) site and the Cu(II) in the N(imine)(2)O(2) site. The complexes 1-6 are regarded to be isomeric with [CuCo(L(2;2)))](ClO(4))(2).DMF (1B), [CuNi(L(2;2)))](ClO(4))(2).DMF.MeOH (2B), [CuZn(L(2;2)))](ClO(4))(2).H(2)O (3B)), [CuCo(L(2;3)))](ClO(4))(2).2H(2)O (4B), [CuNi(L(2;3)))](ClO(4))(2) (5B), and [CuZn(L(2;3)))](ClO(4))(2).H(2)O (6B) reported previously, when we ignore exogenous donating and solvating molecules. The isomeric M(II)Cu(II) and Cu(II)M(II) complexes are differentiated by X-ray structural, magnetic, visible spectroscopic, and electrochemical studies. The two isomeric forms are significantly stabilized by the "macrocyclic effect" of the ligands, but 1A is converted into 1B on an electrode, and 2A is converted into 2B at elevated temperature.     

Synthesis and structures of polymeric Mn, Co, Cu, and Zn complexes of 3-diphenylamino-4-hydroxycyclobut-3-ene-1,2-dione (diphenylaminosquarate) and of the salt [Ni(H2O)6][(C6H5)2NC4O3]2.2H2O

Reaction of M(NO3)2.xH2O (M = Mn, Co, Ni, Cu, Zn) with 3-diphenylamino-4-hydroxycyclobut-3-ene-1,2-dione (diphenylaminosquarate) produces the neutral polymeric species (M[mu-(C6H5)2NC4O3]2[H2O]2)n [M = Mn (1), Cu (2)]; (M[mu-(C6H5)2NC4O3][(C6H5)2NC4O3][H2O]3)n [M = Co (3), Zn (4)]; and in the case of Ni, the salt [Ni(H2O)6][(C6H5)2NC4O3]2.2H2O (5). Complexes 1 and 2 are isomorphous and crystallize in the monoclinic space group P2(1)/c with, for 1, a = 13.138(1) A, b = 10.900(2) A, c = 9.269(2) A, beta = 96.07(1) degrees, and Z = 2. Complexes 3 and 4 are also isomorphous and crystallize in the space group P2(1)/c with, for 3, a = 13.211(1) A, b = 11.038(1) A, c = 18.748(1) A, beta = 97.75(1) degrees, and Z = 4. The nickel salt, 5, crystallizes in the triclinic space group P1 with a = 6.181(1) A, b = 9.417(1) A, c = 15.486(1) A, alpha = 101.37(1) degrees, beta = 95.51(1) degrees, gamma = 107.57(1) degrees, and Z = 1. In 1 and 2, the metal coordination is octahedral, comprising four mu-1,3-bridging diphenylaminosquarate ligands and two trans aqua ligands. In 3 and 4, the metal coordination is again octahedral, comprising two mu-1,3-bridging and one pendant diphenylaminosquarate ligands, the octahedron being completed by three aqua ligands in a meridional configuration. In 5, the hexaaquanickel(II) ion is linked by O-H...O hydrogen bonds to a pair of diphenylaminosquarate anions. These anion-cation units are linked via included water molecules to form hydrogen-bonded chains. The diphenylaminosquarate ligands in the polymeric complexes 1-4 display multiple-bond localization, a feature which is absent in 5. Complex 1 exhibits weak antiferromagnetic coupling, whereas 2 shows no significant magnetic interactions.