New calcium germanium nitrides: Ca2GeN2, Ca4GeN4, and Ca5Ge2N6

We report three new calcium germanium nitrides synthesized as crystals from the elements in sealed niobium tubes at 760 degrees C using liquid sodium as a growth medium. Black Ca2GeN2 is isostructural with the previously reported strontium analogue. It is tetragonal P4(2)/mbc (no. 135) with a = 11.2004(8) A, c = 5.0482(6) A, and Z = 8. It contains GeN2(4-) units which have 18 valence electrons, and consequently are bent, like the isoelectronic molecule SO2. In contrast, clear, orange Ca4GeN4 with fully oxidized germanium contains isolated GeN4(8-) tetrahedra and is monoclinic P2(1)/c (no. 14) with a = 9.2823(8) A, b = 6.0429(5) A, c = 11.1612(9) A, beta = 116.498(6) degrees, and Z = 4. Clear, colorless Ca5Ge2N6, also with fully oxidized germanium, contains infinite chains, 1 infinity[GeN2N2/2(5-)], of corner-sharing tetrahedra similar to those found in pyroxenes. However, the precise structure of this latter phase has not yet been determined because of twinning problems.     

Two new structurally related strontium gallium nitrides: Sr4GaN3O and Sr4GaN3(CN2)

The strontium gallium oxynitride Sr(4)GaN(3)O and nitride-carbodiimide Sr(4)GaN(3)(CN(2)) are reported, synthesized as single crystals from molten sodium at 900 degrees C. Red Sr(4)GaN(3)O crystallizes in space group Pbca (No. 61) with a = 7.4002(1) Angstroms, b = 24.3378(5) Angstroms, c = 7.4038(1) Angstroms, and Z = 8, as determined from single-crystal X-ray diffraction measurements at 150 K. The structure may be viewed as consisting of slabs [Sr(4)GaN(3)](2+) containing double layers of isolated [GaN(3)](6-) triangular anions arranged in a "herringbone" fashion, and these slabs are separated by O(2-) anions. Brown Sr(4)GaN(3)(CN(2)) has a closely related structure in which the oxide anions in the Sr(4)GaN(3)O structure are replaced by almost linear carbodiimide [CN(2)](2-) anions [Sr(4)GaN(3)(CN(2)): space group P2(1)/c (No. 14), a = 13.4778(2) Angstroms, b = 7.4140(1) Angstroms, c = 7.4440(1) Angstroms, beta = 98.233(1) degrees, and Z = 4].     

New vanadium selenites: centrosymmetric Ca2(VO2)2(SeO3)3(H2O)2, Sr2(VO2)2(SeO3)3, and Ba(V2O5)(SeO3), and noncentrosymmetric and polar A4(VO2)2(SeO3)4(Se2O5) (A = Sr2+ or Pb2+)

Five new vanadium selenites, Ca(2)(VO(2))(2)(SeO(3))(3)(H(2)O)(2), Sr(2)(VO(2))(2)(SeO(3))(3), Ba(V(2)O(5))(SeO(3)), Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), have been synthesized and characterized. Their crystal structures were determined by single crystal X-ray diffraction. The compounds exhibit one- or two-dimensional structures consisting of corner- and edge-shared VO(4), VO(5), VO(6), and SeO(3) polyhedra. Of the reported materials, A(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) (A = Sr(2+) or Pb(2+)) are noncentrosymmetric (NCS) and polar. Powder second-harmonic generation (SHG) measurements revealed SHG efficiencies of approximately 130 and 150 × α-SiO(2) for Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), respectively. Piezoelectric charge constants of 43 and 53 pm/V, and pyroelectric coefficients of -27 and -42 μC/m(2)·K at 70 °C were obtained for Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), respectively. Frequency dependent polarization measurements confirmed that the materials are not ferroelectric, that is, the observed polarization cannot be reversed. In addition, the lone-pair on the Se(4+) cation may be considered as stereo-active consistent with calculations. For all of the reported materials, infrared, UV-vis, thermogravimetric, and differential thermal analysis measurements were performed. Crystal data: Ca(2)(VO(2))(2)(SeO(3))(3)(H(2)O)(2), orthorhombic, space group Pnma (No. 62), a = 7.827(4) ?, b = 16.764(5) ?, c = 9.679(5) ?, V = 1270.1(9) ?(3), and Z = 4; Sr(2)(VO(2))(2)(SeO(3))(3), monoclinic, space group P2(1)/c (No. 12), a = 14.739(13) ?, b = 9.788(8) ?, c = 8.440(7) ?, β = 96.881(11)°, V = 1208.8(18) ?(3), and Z = 4; Ba(V(2)O(5))(SeO(3)), orthorhombic, space group Pnma (No. 62), a = 13.9287(7) ?, b = 5.3787(3) ?, c = 8.9853(5) ?, V = 673.16(6) ?(3), and Z = 4; Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), orthorhombic, space group Fdd2 (No. 43), a = 25.161(3) ?, b = 12.1579(15) ?, c = 12.8592(16) ?, V = 3933.7(8) ?(3), and Z = 8; Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), orthorhombic, space group Fdd2 (No. 43), a = 25.029(2) ?, b = 12.2147(10) ?, c = 13.0154(10) ?, V = 3979.1(6) ?(3), and Z = 8.     

Ruthenium Complexes Containing "Noninnocent" o-Benzoquinone Diimine/o-Phenylenediamide(2-) Ligands. Synthesis and Crystal Structure of the Nitrido-Bridged Complex [{LRu(o-C(6)H(4)(NH)(2))}(2)(&mgr;-N)](PF(6))(2).3CH(3)CN.C(6)H(5)CH(3)

Reaction of LRu(III)Cl(3) (L = 1,4,7-trimethyl-1,4,7-triazacyclononane) with 1,2-phenylenediamine (opdaH(2)) in H(2)O in the presence of air affords [LRu(II)(bqdi)(OH(2))](PF(6)) (1), where (bqdi) represents the neutral ligand o-benzoquinone diimine. From an alkaline methanol/water mixture of 1 was obtained the dinuclear species [{LRu(II)(bqdi)}(2)(&mgr;-H(3)O(2))](PF(6))(3) (1a). The coordinated water molecule in 1 is labile and can be readily substituted under appropriate reaction conditions by acetonitrile, yielding [LRu(II)(bqdi)(CH(3)CN)](PF(6))(2) (2), and by iodide and azide anions, affording [LRu(II)(bqdi)I](PF(6)).0.5H(2)O (3) and [LRu(bqdi)(N(3))](PF(6)).H(2)O (4), respectively. Heating of solid 4 in vacuum at 160 degrees C generates N(2) and the dinuclear, nitrido-bridged complex [{LRu(o-C(6)H(4)(NH)(2))}(2)(&mgr;-N)](PF(6))(2) (5). Complex 5 is a mixed-valent, paramagnetic species containing one unpaired electron per dinuclear unit whereas complexes 1-4 are diamagnetic. The crystal structures of 1, 1a.3CH(3)CN, 3, 4.H(2)O, and 5.3CH(3)CN.0.5(toluene) have been determined by X-ray crystallography: 1 crystallizes in the monoclinic space group P2(1)/m, Z = 2, with a = 8.412(2) ?, b = 15.562(3) ?, c = 10.025 ?, and beta = 109.89(2) degrees; 1a.3CH(3)CN, in the monoclinic space group C2/c, Z = 4, with a = 19.858(3) ?, b = 15.483(2) ?, c = 18.192(3) ?, and beta = 95.95(2) degrees; 3, in the orthorhombic space group Pnma, Z = 4, with a = 18.399(4) ?, b = 9.287(2) ?, and c = 12.052(2) ?, 4.H(2)O, in the monoclinic space group P2(1)/c, Z = 4, with a = 8.586(1) ?, b = 15.617(3) ?, c = 16.388(5) ?, and beta = 90.84(2) degrees; and 5.3CH(3)CN.0.5(toluene), in the monoclinic space group P2(1)/c, Z = 4, with a = 15.003(3) ?, b = 16.253(3) ?, c = 21.196(4) ?, and beta = 96.78(3) degrees. The structural data indicate that in complexes 1-4 the neutral o-benzoquinone diimine ligand prevails. In contrast, in 5 this ligand has predominantly o-phenylenediamide character, which would render 5 formally a mixed-valent Ru(IV)Ru(V) species. On the other hand, the Ru-N bond lengths of the Ru-N-Ru moiety at 1.805(5) and 1.767(5) ? are significantly longer than those in other crystallographically characterized Ru(IV)=N=Ru(IV) units (1.72-1.74 ?). It appears that the C(6)H(4)(NH)(2) ligand in 5 is noninnocent and that formal oxidation state assignments to the ligands or metal centers are not possible.     

1H NMR, EPR, UV-Vis, and Electrochemical Studies of Imidazole Complexes of Ru(III). Crystal Structures of cis-[(Im)(2)(NH(3))(4)Ru(III)]Br(3) and [(1MeIm)(6)Ru(II)]Cl(2).2H(2)O

Comparisons of the spectroscopic properties of a number of Ru(III) complexes of imidazole ligands provide methods of distinguishing between various types of bonding that can occur in proteins and nucleic acids. In particular, EPR and (1)H NMR parameters arising from the paramagnetism of Ru(III) should aid in determining binding sites of Ru(III) drugs in macromolecules. Electrochemical studies on several imidazole complexes of ruthenium suggest that imidazole may serve as a significant pi-acceptor ligand in the presence of anionic ligands. Crystal structures are reported on two active immunosuppressant complexes. cis-[(Im)(2)(NH(3))(4)Ru(III)]Br(3) crystallizes in the triclinic space group P&onemacr; (No. 2) with the cell parameters a = 8.961(2) ?, b = 12.677(3) ?, c = 7.630(2) ?, alpha = 98.03(2) degrees, beta = 100.68(2) degrees, gamma = 81.59(2) degrees, and Z = 2 (R = 0.044). [(1MeIm)(6)Ru(II)]Cl(2).2H(2)O crystallizes in the monoclinic space group P2(1)/n (No. 14) with the cell parameters a = 7.994(2) ?, b = 13.173(4) ?, c = 14.904(2) ?, beta = 97.89(1) degrees, and Z = 2 (R = 0.052). The average Ru(II)-N bond distance is 2.106(8) ?.     

Crystal Structures of a Family of New Copper(I) Cyanide Complexes of Thiourea and Substituted Thioureas

The syntheses and crystal structures of the first cyanide, sulfur mixed ligand copper(I) complexes are reported. The first complex of the family was discovered when (CuCN)(3)(C(6)H(12)N(4))(2) (1) (C(6)H(12)N(4) = hexamethylenetetramine) was treated with aqueous thiourea. The sulfur ligands include thiourea (tu), 1,3-dimethyl-2-thiourea (dmtu), 1,3-diethyl-2-thiourea (detu), 1,1,3,3-tetramethyl-2-thiourea (tmtu), and 2-imidazolidinethione (N,N'-ethylenethiourea, etu). Synthesis was effected by adding the ligand to a solution of CuCN in aqueous sodium thiosulfate. Complex 2, (CuCN)(2)(tu)(3)(H(2)O), crystallizes in the triclinic space group P&onemacr;with unit cell dimensions a = 7.696(5) ?, b = 9.346(2) ?, c = 10.772(2) ?, alpha = 106.53(2) degrees, beta = 91.11(4) degrees, gamma = 98.42(3) degrees, and Z = 2. Complex 3, (CuCN)(3)(dmtu)(2), crystallizes in the monoclinic space group Cc with unit cell dimensions a = 10.082(3) ?, b = 14.984(5) ?, c = 11.413(3) ?, beta = 104.50(2) degrees, and Z = 4. Complex 4, (CuCN)(2)(detu)(H(2)O), crystallizes in the monoclinic space group P2(1)/n with unit cell dimensions a = 7.969(5) ?, b = 11.559(4) ?, c = 13.736(5) ?, beta = 100.48(4) degrees, and Z = 4. Complex 5, (CuCN)(tmtu) (polymorph a), crystallizes in the orthorhombic space group P2(1)2(1)2(1) with unit cell dimensions a = 8.653(1) ?, b = 9.426(1) ?, c = 11.620(3) ?, and Z = 4. Complex 6, (CuCN)(tmtu) (polymorph b), which has the same connectivity as 5, crystallizes in the triclinic space group P&onemacr; with unit cell dimensions a = 9.660(4) ?, b = 14.202(4) ?, c = 16.03(1) ?, alpha = 101.68(5) degrees, beta = 107.08(6) degrees, gamma = 70.07(2) degrees, and Z = 8. The difference between the polymorphs is that 5 has a zig-zag chain with a repeat unit of two while 6 has a 4-fold helix. Complex 7, (CuCN)(2)(etu), crystallizes in the monoclinic space group P2(1)( )()with unit cell dimensions a = 3.994(2) ?, b = 13.886(3) ?, c = 7.556(1) ?, beta = 97.07(2) degrees, and Z = 2.     

Vanadium(IV) Complexes with Mixed O,S Donor Ligands. Syntheses, Structures, and Properties of the Anions Tris(2-mercapto-4-methylphenolato)vanadate(IV) and Bis(2-mercaptophenolato)oxovanadate(IV)

Reaction of VO(acac)(2) with 2-mercaptophenol (mpH(2)) in the presence of triethylamine gives the mononuclear tris complex (Et(3)NH)(2)[V(mp)(3)] (1), in which the vanadyl oxygen has been displaced. An analogous reaction using 2-mercapto-4-methylphenol (mmpH(2)) afforded (Et(3)NH)(PNP)[V(mmp)(3)] (2), which was structurally characterized. 2 crystallizes in the orthorhombic space group Pna2(1 )with unit cell parameters (at -163 degrees C) a = 23.974(7) ?, b = 9.569(4) ?, c = 25.101(6) ?, and Z = 4. The coordination geometry around the vanadium is between octahedral and trigonal prismatic. Reaction of VO(acac)(2 )with the sodium salt of 2-mercaptophenol produces the vanadyl(IV) complex Na(Ph(4)P)[VO(mp)(2)].Et(2)O (3), which crystallizes in the triclinic space group P&onemacr; with unit cell parameters (at -135 degrees C) a = 12.185(4) ?, b = 12.658(4) ?, c = 14.244(4) ?, alpha = 103.19(2) degrees, beta = 100.84(2) degrees, and gamma = 114.17(2) degrees. The unit cell of 3 contains a pair of symmetry-related [VO(mp)(2)](2)(-) units bridged through vanadyl and ligand oxygen atoms by a pair of sodium ions, in addition to two PPh(4)(+) ions. The coordination geometry around the vanadium is square pyramidal, with a V=O bond length of 1.611(5) ?. 1, 2, and 3 are characterized by IR and UV-vis spectroscopies, magnetic susceptibility, EPR spectroscopy, and cyclic voltammetry. 1 and 2 can be oxidized by I(2, )Cp(2)Fe(+), or O(2) to [V(mp)(3)](-) and [V(mmp)(3)](-), respectively, which in turn can be reduced back to the dianions by oxalate ion. These reversible redox processes can be followed by UV-vis spectroscopy.     

Contribution of disulfide S2(2-) anions to the crystal and electronic structures in ternary sulfides, Ba12In4S19, Ba4M2S8 (M=Ga, In)

Three semiconducting ternary sulfides have been synthesized from the mixture of elements with about 20% excess of sulfur (to establish oxidant rich conditions) by solid-state reactions at high temperature. Ba(12)In(4)S(19) ≡ (Ba(2+))(12)(In(3+))(4)(S(2-))(17)(S(2))(2-), 1, crystallizes in the trigonal space group R ?3 with a = 9.6182(5) ?, b = 9.6182(5) ?, c = 75.393(7) ?, and Z = 6, with a unique long period-stacking structure of a combination of monometallic InS(4) tetrahedra, linear dimeric In(2)S(7) tetrahedra, disulfide S(2)(2-) anions, and isolated sulfide S(2-) anions that is further enveloped by Ba(2+) cations. Ba(4)In(2)S(8) ≡ (Ba(2+))(4)(In(3+))(2)(S(2-))(6)(S(2))(2-), 2, crystallizes in the triclinic space group P ?1? with a = 6.236(2) ?, b = 10.014(4) ?, c = 13.033(5) ?, α = 104.236(6)°, β = 90.412(4)°, γ = 91.052(6)°, and Z = 2. Ba(4)Ga(2)S(8) ≡ (Ba(2+))(4)(Ga(3+))(2)(S(2-))(6)(S(2))(2-), 3, crystallizes in the monoclinic P2(1)/c with a = 12.739(5) ?, b = 6.201(2) ?, c = 19.830(8) ?, β = 104.254(6)° and Z = 4. Compounds 2 and 3 represent the first one-dimensional (1D) chain structure in ternary Ba/M/S (M = In, Ga) systems. The optical band gaps of 1 and 3 are measured to be around 2.55 eV, which agrees with their yellow color and the calculation results. The CASTEP calculations also reveal that the disulfide S(2)(2-) anions in 1-3 contribute mainly to the bottom of the conduction bands and the top of valence bands, and thus determine the band gaps.     

Influence of the Peripheral Ligand Atoms on the Exchange Interaction in Oxalato-Bridged Nickel(II) Complexes: An Orbital Model. Crystal Structures and Magnetic Properties of (H(3)dien)(2)[Ni(2)(ox)(5)].12H(2)O and [Ni(2)(dien)(2)(H(2)O)(2)(ox)]Cl(2)

Two nickel(II) complexes of formula (H(3)dien)(2)[Ni(2)(ox)(5)].12H(2)O (1) and [Ni(2)(dien)(2)(H(2)O)(2)(ox)]Cl(2) (2) (dien = diethylenetriamine and ox = oxalate dianion) have been synthesized and characterized by single-crystal X-ray diffraction. 1 crystallizes in the orthorhombic system, space group Abnn, with a = 15.386(4) ?, b = 15.710(4) ?, c = 17.071(4) ?, and Z = 4. 2 crystallizes in the monoclinic system, space group P2(1)/c, with a = 10.579(1) ?, b = 7.258(1) ?, c = 13.326(1) ?, beta = 93.52(3) degrees, and Z = 2. The structures of 1 and 2 consist of dinuclear oxalato-bridged nickel(II) units which contain bidentate oxalate (1) and tridentate dien in the fac-conformation (2) as terminal ligands. Both features, oxalato as a peripheral ligand and dien in the fac-conformation (instead of its usual mer-conformation), are unprecedented in the coordination chemistry of nickel(II). The nickel atom is six-coordinated in both compounds, the chromophores being NiO(6) (1) and NiN(3)O(3) (2). The Ni-O(ox) bond distances at the bridge (2.072(4) ? in 1 and 2.11(1) and 2.125(9) ? in 2) are somewhat longer than those concerning the terminal oxalate (2.037(5) and 2.035(3) ? in 1). Magnetic susceptibility data of 1 and 2 in the temperature range 4.2-300 K show the occurrence of intramolecular antiferromagnetic coupling with J = -22.8 (1) and -28.8 (2) cm(-)(1) (J being the parameter of the exchange Hamiltonian H = -JS(A).S(B)). The observed value of -J in the investigated oxalato-bridged nickel(II) complexes, which can vary from 22 to 39 cm(-)(1), is strongly dependent on the nature of the donor atoms from the peripheral ligands. This influence has been analyzed and rationalized through extended Hückel calculations.     

Syntheses and Structural Characterization of Tetrahedral Four-Coordinate Gold(I) Complexes of 1,3,5-Triaza-7-phosphaadamantane. An Example of a Hydrogen-Bond-Directed Supramolecular Assembly

The synthesis and structural characterization of water-soluble four-coordinate gold(I) complexes containing monodentate phosphine ligands are described. The ligands used are 1,3,5-triaza-7-phosphaadamantane (TPA) and its protonated and methylated derivatives, [HTPA]Cl and [MeTPA]I. Formation of the four-coordinate gold(I) species is favored by the small cone angle of the phosphine (102 degrees ) and its ability to form a hydrogen-bonded network between the nitrogen atoms of the ligand and solvent water molecules. The gold center in all four complexes has a nearly regular tetrahedral geometry with an average P-Au-P angle of 109.5 degrees. [(HTPA)(3)(TPA)Au](PF(6))(4).4H(2)O.CH(3)CN(1) crystallizes in the monoclinic space group P2(1)/c (No. 14) with cell constants a = 20.719(3) ?, b = 15.606(2) ?, c = 17.854(2) ?, beta = 114.03(1) degrees, and Z = 4. Refinement of 4977 reflections and 650 parameters yields R = 0.0396 and R(w) = 0.0500. [(TPA)(4)Au]PF(6).1.5HCl.H(2)O (2), crystallizes in the monoclinic space group C2/c (No. 15) with cell constants a = 33.036(7) ?, b = 11.212(2) ?, c = 31.503(5) ?, b = 137.58(1) degrees, and Z = 8. Refinement of 3835 reflections and 470 parameters yields R = 0.0351 and R(w) = 0.0403. [(TPA)(4)Au]Cl(4).6H(2)O (3) was characterized structurally in the cubic space group Fd&thremacr;m (No. 227) with cell constants a = b = c = 20.020(2) ? and Z = 8. Refinement of 290 reflections and 28 parameters yields R = 0.0624 and R(w) = 0.1291. [(MeTPA)(4)Au](PF(6))(5).2CH(3)CN (4) crystallizes in the monoclinic space group C2/c (No. 15) with cell constants a = 23.337(3) ?, b = 14.855(3) ?, c = 35.317(5) ?, b = 97.95(1) degrees, and Z = 8. Refinement of 7840 reflections and 621 parameters yields R = 0.0493 and R(w) = 0.0698.     

Synthesis, Spectroscopic Characterization, and Structural Studies of Bis(&mgr;-sulfido)bis[{O,O-dialkyl (alkylene) dithiophosphato}oxomolybdenum(V)] Complexes. Crystal Structures of Mo(2)O(2)S(2)[S(2)P(OEt)(2)](2), Mo(2)O(2)S(2)[S(2)P(OEt)(2)](2).2NC(5)H(5), and Mo(2)O(3)[S(2)P(OPh)(2)](4)

A series of new complexes, Mo(2)O(2)S(2)[S(2)P(OR)(2)](2) (where R = Et, n-Pr, i-Pr) and Mo(2)O(2)S(2)[S(2)POGO](2) (where G = -CH(2)CMe(2)CH(2)-, -CMe(2)CMe(2)-) have been prepared by the dropwise addition of an ethanolic solution of the ammonium or sodium salt of the appropriate O,O-dialkyl or -alkylene dithiophosphoric acid, or the acid itself, to a hot aqueous solution of molybdenum(V) pentachloride. The complexes were also formed by heating solutions of Mo(2)O(3)[S(2)P(OR)(2)](4) or Mo(2)O(3)[S(2)POGO](4) species in glacial acetic acid. The Mo(2)O(2)S(2)[S(2)P(OR)(2)](2) and Mo(2)O(2)S(2)[S(2)POGO](2) compounds were characterized by elemental analyses, (1)H, (13)C, and (31)P NMR, and infrared and Raman spectroscopy, as were the 1:2 adducts formed on reaction with pyridine. The crystal structures of Mo(2)O(2)S(2)[S(2)P(OEt(2))](2), Mo(2)O(2)S(2)[S(2)P(OEt)(2)](2).2NC(5)H(5), and Mo(2)O(3)[S(2)P(OPh)(2)](4) were determined. Mo(2)O(2)S(2)[S(2)P(OEt)(2)](2) (1) crystallizes in space group C2/c, No. 15, with cell parameters a = 15.644(3) ?, b = 8.339(2) ?, c = 18.269(4) ?, beta = 103.70(2) degrees, V = 2315.4(8) ?(3), Z = 4, R = 0.0439, and R(w) = 0.0353. Mo(2)O(2)S(2)[S(2)P(OEt)(2)](2).2NC(5)H(5) (6) crystallizes in space group P&onemacr;, No. 2, with the cell parameters a = 12.663(4) ?,b = 14.291(5) ?, c = 9.349(3) ?, alpha = 100.04(3) degrees, beta = 100.67(3) degrees, gamma = 73.03(3) degrees V = 1557(1) ?(3), Z = 2, R = 0.0593, and R(w) = 0.0535. Mo(2)O(3)[S(2)P(OPh)(2)](4) (8) crystallizes in space group P2(1)/n, No. 14, with cell parameters a = 15.206(2)?, b = 10.655(3)?, c = 19.406(3)?, beta = 111.67(1) degrees, V = 2921(1)?(3), Z = 2, R = 0.0518, R(w) = 0.0425. The immediate environment about the molybdenum atoms in 1 is essentially square pyramidal if the Mo-Mo interaction is ignored. The vacant positions in the square pyramids are occupied by two pyridine molecules in 6, resulting in an octahedral environment with very long Mo-N bonds. The terminal oxygen atoms in both 1 and 6 are in the syn conformation. In 8, which also has a distorted octahedral environment about molybdenum, two of the dithiophosphate groups are bidentate as in 1 and 6, but the two others have one normal Mo-S bond and one unusually long Mo-S bond.     

Synthesis and Structural Studies of Platinum Complexes Containing Monodentate, Bridging, and Chelating Formamidine Ligands

The reactions of K(2)PtCl(4) with N,N'-diphenylformamidine (HDPhF) and N,N'-di-p-tolylformamidine (HDTolF) produce the trans square-planar compounds PtCl(2)(HDPhF)(2), 1a, and PtCl(2)(HDTolF)(2), 1b. Compound 1a crystallizes as yellow parallelepipeds in the space group P2(1)/c with two independent molecules in the asymmetric unit and unit cell dimensions a = 23.427(7) ?, b = 16.677(6) ?, c = 12.980(4) ?, and beta = 96.10(2) degrees. These compounds are soluble in common organic solvents and have been used as starting materials for the preparation of diplatinum compounds. Treatment of 1a and 1b with NaOMe and the halide abstraction reagent TlPF(6) produces the compounds Pt(2)(&mgr;-DArF)(2)(eta(2)-DArF)(2), Ar = Ph (2a) and Tol (2b), respectively. Compound 2a crystallizes as yellow rods in the space group P&onemacr; with unit cell dimensions a = 12.296(3) ?, b = 12.310(4) ?, c = 15.374(4) ?, alpha = 90.75(2) degrees, beta = 91.02(2) degrees, and gamma = 110.20(2) degrees. Compound 2b crystallizes with a molecule of THF, as yellow rods in the space group P2(1)/c with a = 17.883(3) ?, b = 14.517(3) ?, c = 22.581(3) ?, and beta = 98.17(1) degrees. These compounds contain two cis bridging formamidinato ligands and two formamidinato ligands that are chelated to separate Pt centers. Upon heating, they further react to give the tetrabridged compounds Pt(2)(&mgr;-DArF)(4), Ar = Ph (3a), Tol (3b). Compound 3a crystallizes as orange cubes in the cubic space group I432 with a = 19.671(1) ?. On going from the bis-bridged, bis-chelate structure in 2a to the tetrabridged structure in 3a, the metal-metal separation decreases from 2.910(1) to 2.649(1) ?. Both 2band 3b have been oxidized to give the Pt(II)-Pt(III) compound Pt(2)(&mgr;-DTolF)(4)(PF(6)), 4. Compound 4 crystallizes as cubes in the tetragonal space group P4/ncc with a = 14.392(1) ? and c = 14.436(1) ?. The Pt-Pt distance in 4 is 2.5304(6) ?.     

Ion-Bearing Propellers: Alkali Metal Complexes of Tris(2-alkoxyphenyl)amine Ionophores

NMR spectroscopic studies reveal that binding of Na(+) by tris(2-methoxyphenyl)amine (3) brings two of these tripod ethers together about the metal ion; the related double-tripod-ether ionophore 1,2-bis[2-(bis(2-methoxyphenyl)amino)phenoxy]ethane (4), in which two triarylamines are covalently attached, binds LiI, LiBPh(4), NaI, NaBPh(4), and KB(4-ClPh)(4). Dynamic NMR puts lower limits on binding free energies of 4 for Na(+) (71.8 kJ mol(-)(1)) and K(+) (66.8 kJ mol(-)(1)) ions. X-ray studies of 3(2).NaBPh(4), 4.NaBPh(4), 4.NaB(4-ClPh)(4), and 4.KB(4-ClPh)(4).CH(3)NO(2) show eight-coordinate M(+) ions bound between crystallographically independent, homochiral triarylamine tripod ethers in structures reminiscent of alkali metal [2.2.2] cryptates. Complexes crystallize as follows: 3(2).NaBPh(4), monoclinic, P2(1)/c, Z = 4, a = 10.701(3) ?, b = 37.593(3) ?, c = 13.774(2) ?, and beta = 98.24(2) degrees; 4.NaBPh(4), triclinic, P&onemacr;, Z = 2, a = 12.157(1) ?, b = 14.811(1) ?, c = 15.860(2) ?, alpha = 105.400(8) degrees, beta = 91.594(9) degrees, and gamma = 95.354(8) degrees; 4.NaB(4-ClPh)(4), monoclinic, P2(1)/n, Z = 4, a = 13.652(5) ?, b = 18.75(1) ?, c = 22.805(5) ?, and beta = 92.21(5) degrees; 4.KB(4-ClPh)(4).CH(3)NO(2), monoclinic, Pn, Z = 2, a = 13.663(4) ?, b = 12.228(3) ?, c = 18.712(8) ?, and beta = 91.45(3) degrees. They show variable N-M-N angles; 3(2).NaBPh(4) is surprisingly bent ( angleN-Na-N = 154.5 degrees ), while the 4.M(+) complexes are normal: nearly linear for Na(+) ( angleN-Na-N = 178.6, 178.1 degrees ) and again bent with the larger K(+) ( angleN-K-N = 164.5 degrees ). Finally, free 4 is structurally similar to 3; it crystallizes in the triclinic space group P&onemacr;, with Z = 2, a = 8.068(1) ?, b = 14.599(2) ?, c = 16.475(3) ?, alpha = 115.43(1) degrees, beta = 92.51(1) degrees, and gamma = 90.40(1) degrees.     

Gold(I) Complexes with the nido-Diphosphino Ligand [7,8-(Ph(2)P)(2)-7,8-C(2)B(9)H(10)](-). Preparation of the First Metallocarborane Complex of this Ligand. Crystal Structures of [Au{(PPh(2))(2)C(2)B(9)H(10)}(PPh(3))].CH(2)Cl(2) and [Au(2){(PPh(2))(2)C(2)B(9)H(10)}(2){(PPh(2))(2)(CH(2))(3)}].3Me(2)CO

The reaction of [AuCl(PR(3))] with [1,2-(Ph(2)P)(2)-1,2-C(2)B(10)H(10)] in refluxing ethanol proceeds with partial degradation (removal of a boron atom adjacent to carbon) of the closo species to give [Au{(PPh(2))(2)C(2)B(9)H(10)}(PR(3))] [PR(3) = PPh(3) (1), PPh(2)Me (2), PPh(2)(4-Me-C(6)H(4)) (3), P(4-Me-C(6)H(4))(3) (4), P(4-OMe-C(6)H(4))(3) (5)]. Similarly, the treatment of [Au(2)Cl(2)(&mgr;-P-P)] with [1,2-(Ph(2)P)(2)-1,2-C(2)B(10)H(10)] under the same conditions leads to the complexes [Au(2){(PPh(2))(2)C(2)B(9)H(10)}(2)(&mgr;-P-P)] [P-P = dppe = 1,2-bis(diphenylphosphino)ethane (6), dppp = 1,3-bis(diphenylphosphino)propane (7)], where the dppe or dppp ligands bridge two gold nido-diphosphine units. The reaction of 1 with NaH leads to removal of one proton, and further reaction with [Au(PPh(3))(tht)]ClO(4) gives the novel metallocarborane compound [Au(2){(PPh(2))(2)C(2)B(9)H(9)}(PPh(3))(2)] (8). The structure of complexes 1 and 7 have been established by X-ray diffraction. [Au{(PPh(2))(2)C(2)B(9)H(10)}(PPh(3))] (1) (dichloromethane solvate) crystallizes in the monoclinic space group P2(1)/c, with a = 17.326(3) ?, b = 20.688(3) ?, c = 13.442(2) ?, beta = 104.710(12) degrees, Z = 4, and T = -100 degrees C. [Au(2){(PPh(2))(2)C(2)B(9)H(10)}(2)(&mgr;-dppp)] (7) (acetone solvate) is triclinic, space group P&onemacr;, a = 13.432(3) ?, b = 18.888(3) ?, c = 20.021(3) ?, alpha = 78.56(2) degrees, beta = 72.02(2) degrees, gamma = 73.31(2) degrees, Z = 2, and T = -100 degrees C. In both complexes the gold atom exhibits trigonal planar geometry with the 7,8-bis(diphenylphosphino)-7,8-dicarba-nido-undecaborate(1-) acting as a chelating ligand.     

Tetranuclear and Octanuclear Manganese Carboxylate Clusters: Preparation and Reactivity of (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(9)(H(2)O)] and Synthesis of (NBu(n)(4))(2)[Mn(8)O(4)(O(2)CPh)(12)(Et(2)mal)(2)(H(2)O)(2)] with a "Linked-Butterfly" Structure

The reaction of Mn(O(2)CPh)(2).2H(2)O and PhCO(2)H in EtOH/MeCN with NBu(n)(4)MnO(4) gives (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(9)(H(2)O)] (4) in high yield (85-95%). Complex 4 crystallizes in monoclinic space group P2(1)/c with the following unit cell parameters at -129 degrees C: a = 17.394(3) ?, b = 19.040(3) ?, c = 25.660(5) ?, beta = 103.51(1) degrees, V = 8262.7 ?(3), Z = 4; the structure was refined on F to R (R(w)) = 9.11% (9.26%) using 4590 unique reflections with F > 2.33sigma(F). The anion of 4 consists of a [Mn(4)(&mgr;(3)-O)(2)](8+) core with a "butterfly" disposition of four Mn(III) atoms. In addition to seven bridging PhCO(2)(-) groups, there is a chelating PhCO(2)(-) group at one "wingtip" Mn atom and terminal PhCO(2)(-) and H(2)O groups at the other. Complex 4 is an excellent steppingstone to other [Mn(4)O(2)]-containing species. Treatment of 4 with 2,2-diethylmalonate (2 equiv) leads to isolation of (NBu(n)(4))(2)[Mn(8)O(4)(O(2)CPh)(12)(Et(2)mal)(2)(H(2)O)(2)] (5) in 45% yield after recrystallization. Complex 5 is mixed-valent (2Mn(II),6Mn(III)) and contains an [Mn(8)O(4)](14+) core that consists of two [Mn(4)O(2)](7+) (Mn(II),3Mn(III)) butterfly units linked together by one of the &mgr;(3)-O(2)(-) ions in each unit bridging to one of the body Mn atoms in the other unit, and thus converting to &mgr;(4)-O(2)(-) modes. The Mn(II) ions are in wingtip positions. The Et(2)mal(2)(-) groups each bridge two wingtip Mn atoms from different butterfly units, providing additional linkage between the halves of the molecule. Complex 5.4CH(2)Cl(2) crystallizes in monoclinic space group P2(1)/c with the following unit cell parameters at -165 degrees C: a = 16.247(5) ?, b = 27.190(8) ?, c = 17.715(5) ?, beta = 113.95(1) degrees, V = 7152.0 ?(3), Z = 4; the structure was refined on F to R (R(w)) = 8.36 (8.61%) using 4133 unique reflections with F > 3sigma(F). The reaction of 4 with 2 equiv of bpy or picolinic acid (picH) yields the known complex Mn(4)O(2)(O(2)CPh)(7)(bpy)(2) (2), containing Mn(II),3Mn(III), or (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(7)(pic)(2)] (6), containing 4Mn(III). Treatment of 4 with dibenzoylmethane (dbmH, 2 equiv) gives the mono-chelate product (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(8)(dbm)] (7); ligation of a second chelate group requires treatment of 7 with Na(dbm), which yields (NBu(n)(4))[Mn(4)O(2)(O(2)CPh)(7)(dbm)(2)] (8). Complexes 7 and 8 both contain a [Mn(4)O(2)](8+) (4Mn(III)) butterfly unit. Complex 7 contains chelating dbm(-) and chelating PhCO(2)(-) at the two wingtip positions, whereas 8 contains two chelating dbm(-) groups at these positions, as in 2 and 6. Complex 7.2CH(2)Cl(2) crystallizes in monoclinic space group P2(1) with the following unit cell parameters at -170 degrees C: a = 18.169(3) ?, b = 19.678(4) ?, c = 25.036(4) ?, beta = 101.49(1) degrees, V = 8771.7 ?(3), Z = 4; the structure was refined on F to R (R(w)) = 7.36% (7.59%) using 10 782 unique reflections with F > 3sigma(F). Variable-temperature magnetic susceptibility studies have been carried out on powdered samples of complexes 2 and 5 in a 10.0 kG field in the 5.0-320.0 K range. The effective magnetic moment (&mgr;(eff)) for 2 gradually decreases from 8.61 &mgr;(B) per molecule at 320.0 K to 5.71 &mgr;(B) at 13.0 K and then increases slightly to 5.91 &mgr;(B) at 5.0 K. For 5, &mgr;(eff) gradually decreases from 10.54 &mgr;(B) per molecule at 320.0 K to 8.42 &mgr;(B) at 40.0 K, followed by a more rapid decrease to 6.02 &mgr;(B) at 5.0 K. On the basis of the crystal structure of 5 showing the single Mn(II) ion in each [Mn(4)O(2)](7+) subcore to be at a wingtip position, the Mn(II) ion in 2 was concluded to be at a wingtip position also. Employing the reasonable approximation that J(w)(b)(Mn(II)/Mn(III)) = J(w)(b)(Mn(III)/M(III)), where J(w)(b) is the magnetic exchange interaction between wingtip (w) and body (b) Mn ions of the indicated oxidation state, a theoretical chi(M) vs T expression was derived and used to fit the experimental molar magnetic susceptibility (chi(M)) vs T data. The obtained fitting parameters were J(w)(b) = -3.9 cm(-)(1), J(b)(b) = -9.2 cm(-)(1), and g = 1.80. These values suggest a S(T) = (5)/(2) ground state spin for 2, which was confirmed by magnetization vs field measurements in the 0.5-50.0 kG magnetic field range and 2.0-30.0 K temperature range. For complex 5, since the two bonds connecting the two [Mn(4)O(2)](7+) units are Jahn-Teller elongated and weak, it was assumed that complex 5 could be treated, to a first approximation, as consisting of weakly-interacting halves; the magnetic susceptibility data for 5 at temperatures >/=40 K were therefore fit to the same theoretical expression as used for 2, and the fitting parameters were J(w)(b) = -14.0 cm(-)(1) and J(b)(b) = -30.5 cm(-)(1), with g = 1.93 (held constant). These values suggest an S(T) = (5)/(2) ground state spin for each [Mn(4)O(2)](7+) unit of 5, as found for 2. The interactions between the subunits are difficult to incorporate into this model, and the true ground state spin value of the entire Mn(8) anion was therefore determined by magnetization vs field studies, which showed the ground state of 5 to be S(T) = 3. The results of the studies on 2 and 5 are considered with respect to spin frustration effects within the [Mn(4)O(2)](7+) units. Complexes 2 and 5 are EPR-active and -silent, respectively, consistent with their S(T) = (5)/(2) and S(T) = 3 ground states, respectively.     

Multifunctional Ligands. Phosphinimine-Substituted Cyanofluoroaromatics Including X-ray Molecular Structures of Three Representative Ligands 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(3))(2), 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(2)Me)(2) and 4,6-(CN)(2)C(6)F(2)-1-(N=PPh(3))-3-(N=PPh(2)Me). Formation of Rhodium(I) Complexes

Reaction of 1,3-dicyanotetrafluorobenzene with 2 equiv of (trimethylsilyl)iminophosphoranes gave the disubstituted derivatives 4,6-(CN)(2)C(6)F(2)-1,3-AB: 1, A = B = (N=PPh(3)); 2, A = B = (N=PPh(2)Me); and 3, A = (N=PPh(3)), B = (N=PPh(2)Me). Monosubstituted compounds of the type 2,4-(CN)(2)C(6)F(3)-1-A; notably 4, A = (N=PPh(3)), and 5, A = (N=PPh(2)Me), were readily obtained by reaction of 1 molar equiv of the silylated iminophosphorane with the cyanofluoro aromatic. Substitution of the fluorine para to the CN group(s) occurs in all cases. Reactions of 1,2- and 1,4-dicyanotetrafluorobenzene with (trimethylsilyl)iminophosphoranes gave only monosubstituted derivatives 3,4-(CN)(2)C(6)F(3)-1-A (6, A = (N=PPh(3)), and 7, A = (N=PPh(2)Me)) and 2,5-(CN)(2)C(6)F(3)-1-A (8, A = (N=PPh(3)), and 9, A = (N=PPh(2)Me)), respectively, as the result of electronic deactivation of the second substitutional point. 1, 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(3)), 2, 4,6-(CN)(2)C(6)F(2)-1,3-(N=PPh(2)Me)(2), and 3, 4,6-(CN)(2)C(6)F(2)-1-(N=PPh(3))-3-(N=PPh(2)Me) have been structurally characterized. For 1 (at 21 degrees C), monoclinic, C2/(c) (No. 15), a = 15.289(2) ?, b = 10.196(1) ?, c = 23.491(6) ?, beta = 91.63(2) degrees, V = 3660(2) ?(3), and Z = 4. The P=N bond length is 1.579(2) ? and the P(V)-N-C(phenyl) angle is 134.0(2) degrees. For 2, (at 21 degrees C) monoclinic, C2/(c) (No. 15), a = 18.694(2) ?, b = 8.576(1) ?, c = 40.084(4) ?, beta = 94.00(1) degrees, V = 6411(2) ?(3), and Z = 8. The P(1)=N(1) bond length is 1.570(4) ?, the P(2)=N(2) bond length is 1.589(3) ?, the P(1)-N(1)-C(14) angle is 131.6(3) degrees, and the P(2)-N(2)-C(16) angle is 131.3(3) degrees. For 3, (at -80 degrees C) monoclinic, P2(1)/c (No. 14), a = 9.210(1) ?, b = 18.113(2) ?, c = 20.015(2) ?, beta = 100.07(1) degrees, V = 3287(2) ?(3), and Z = 4. The P(1)=N(1) bond length (PPh(3) group) is 1.567(4) ?, the P(2)=N(2) bond length (PPh(2)Me group) is 1.581(5) ?, the P(1)-N(1)-C(1) angle is 140.4(4) degrees, and the P(2)-N(2)-C(3) angle is 129.4(4) degrees. These new multifunctional chelating ligands readily react with [Rh(cod)Cl](2) and AgClO(4) to give cationic Rh(I) complexes in which the imine and/or the nitrile groups are coordinated to the Rh center.     

Synthesis and characterization of six new quaternary actinide thiophosphate compounds: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6)(,) K(10)Th(3)(P(2)S(7))(4)(PS(4))(2), and A(5)An(PS(4))(3), (A = K, Rb, Cs; An = U, Th)

Six new actinide metal thiophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6) (I), K(10)Th(3)(P(2)S(7))(4)(PS(4))(2) (II), K(5)U(PS(4))(3) (III), K(5)Th(PS(4))(3) (IV), Rb(5)Th(PS(4))(3) (V), and Cs(5)Th(PS(4))(3) (VI). Compound I crystallizes in the monoclinic space group P2(1)/c with a = 33.2897(1) A, b = 14.9295(1) A, c = 17.3528(2) A, beta = 115.478(1) degrees, Z = 8. Compound II crystallizes in the monoclinic space group C2/c with a = 32.8085(6) A, b = 9.0482(2) A, c = 27.2972(3) A, beta = 125.720(1) degrees, Z = 8. Compound III crystallizes in the monoclinic space group P2(1)/c with a = 14.6132(1) A, b = 17.0884(2) A, c = 9.7082(2) A, beta = 108.63(1) degrees, Z = 4. Compound IV crystallizes in the monoclinic space group P2(1)/n with a = 9.7436(1) A, b = 11.3894(2) A, c = 20.0163(3) A, beta = 90.041(1) degrees, Z = 4, as a pseudo-merohedrally twinned cell. Compound V crystallizes in the monoclinic space group P2(1)/c with a = 13.197(4) A, b = 9.997(4) A, c = 18.189(7) A, beta = 100.77(1) degrees, Z = 4. Compound VI crystallizes in the monoclinic space group P2(1)/c with a = 13.5624(1) A, b = 10.3007(1) A, c = 18.6738(1) A, beta = 100.670(1) degrees, Z = 4. Optical band-gap measurements by diffuse reflectance show that compounds I and III contain tetravalent uranium as part of an extended electronic system. Thorium-containing compounds are large-gap materials. Raman spectroscopy on single crystals displays the vibrational characteristics expected for [PS(4)](3)(-), [P(2)S(7)](4-), and the new [P(3)S(10)](5)(-) building blocks. This new thiophosphate building block has not been observed except in the structure of the uranium-containing compound Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6).     

Polydentate N(2)S(2)O and N(2)S(2)O(2) Ligands as Alcoholic Derivatives of (N,N'-Bis(2-mercaptoethyl)-1,5-diazacyclooctane)nickel(II) and (N,N'-Bis(2-mercapto-2-methylpropane)-1,5-diazacyclooctane)nickel(II)

The synthesis, structural characterization, spectroscopic, and electrochemical properties of N(2)S(2)-ligated Ni(II) complexes, (N,N'-bis(2-mercaptoethyl)-1,5-diazacyclooctane)nickel(II), (bme-daco)Ni(II), and (N,N'-bis(2-mercapto-2-methylpropane)1,5-diazacyclooctane)nickel(II), (bme-daco)Ni(II), derivatized at S with alcohol-containing alkyl functionalities, are described. Reaction of (bme-daco)Ni(II) with 2-iodoethanol afforded isomers, (N,N'-bis(5-hydroxy-3-thiapentyl)-1,5-diazacyclooctane-O,N,N',S,S')halonickel(II) iodide (halo = chloro or iodo), 1, and (N,N'-bis(5-hydroxy-3-thiapentyl)-1,5-diazacyclooctane-N,N',S,S')nickel(II) iodide, 2, which differ in the utilization of binding sites in a potentially hexadentate N(2)S(2)O(2) ligand. Blue complex 1 contains nickel in an octahedral environment of N(2)S(2)OX donors; X is best modeled as Cl. It crystallizes in the monoclinic space group P2(1)/n with a = 12.580(6) ?, b = 12.291(6) ?, c = 13.090(7) ?, beta = 97.36(4) degrees, and Z = 4. In contrast, red complex 2 binds only the N(2)S(2) donor set forming a square planar nickel complex, leaving both -CH(2)CH(2)OH arms dangling; the iodide ions serve strictly as counterions. 2 crystallizes in the orthorhombic space group Pca2(1) with a = 15.822(2) ?, b = 13.171(2) ?, c = 10.0390(10) ?, and Z = 4. Reaction of (bme-daco)Ni(II) with 1,3-dibromo-2-propanol affords another octahedral Ni species with a N(2)S(2)OBr donor set, ((5-hydroxy-3,7-dithianonadiyl)-1,5-diazacyclooctane-O,N,N',S,S')bromonickel(II) bromide, 3. Complex 3 crystallizes in the orthorhombic space group Pca2(1) with a = 15.202(5) ?, b = 7.735(2) ?, c = 15.443(4) ?, and Z = 4. Complex 4.2CH(3)CN was synthesized from the reaction of (bme-daco)Ni(II) with 1,3-dibromo-2-propanol. It crystallizes in the monoclinic space group P2/c with a = 20.348(5) ?, b = 6.5120(1) ?, c = 20.548(5) ?, and Z = 4.     

Structural and Spectroscopic Characterization of Iron(III) Dioxoporphodimethene Complexes and Their Autoreduction to an Iron(II) Complex in Pyridine

Three iron complexes of the meso-dioxo derivative of octaethylporphryin (trans-H(2)OEPO(2)) were characterized by X-ray diffraction. Green ClFe(III)(trans-OEPO(2)).1.5C(6)H(6) crystallizes in the monoclinic space group P2(1)/c with a = 13.766(3) ?, b = 19.075(3) ?, c = 15.217(3) ?, beta = 99.87(2) degrees at 123 K with Z = 4. Refinement of 2712 reflections with F > 6.0sigma(F) and 223 parameters yielded R = 0.0624, R(w) = 0.0596. The iron complex contains a domed dioxoporphodimethene macrocyclic ligand. The observation of a five-coordinate iron(III) ion with an axial Fe-Cl distance of 2.232(2) ? and in-plane Fe-N distances averaging 2.082 ? is consistent with its high-spin (S = (5)/(2)) character. This monomer is readily converted to the green {Fe(III)(trans-OEPO(2))}(2)O using aqueous hydroxide. {Fe(III)(trans-OEPO(2))}(2)O crystallizes in the monoclinic space group C2/c with a = 23.541(8) ?, b = 15.392(5) ?, c = 18.686(8) ?, and beta = 90.09(3) degrees at 294 K with Z = 8. Refinement of 3472 reflections with F > 6.0sigma(F) and 393 parameters yielded R = 0.0484, R(w) = 0.0527. The complex possesses a crystallographically imposed 2-fold symmetry axis that passes through the oxo ligand. The dioxoporphodimethene ligands within the molecule are roof-shaped and fold away from each other. The axial Fe-O distance is 1.749(1) ? with longer in-plane Fe-N distances (average 2.077 ?). The Fe-O-Fe angle of 165.4(2) degrees deviates significantly from linearity and is more acute than related porphyrin complexes. Pyridine solutions of either the iron(III) monomer or &mgr;-oxo dimer autoreduce over a period of days to give (py)(2)Fe(II)(trans-OEPO(2)). This red compound crystallizes in the space group P2(1) with a = 19.177(4) ?, b = 20.039(4) ?, c = 10.547(2) ?, and beta = 100.36(3) degrees at 130 K with Z = 2. Refinement of 5090 reflections with one restraint and 984 parameters yielded R1 = 0.0684, wR2 = 0.1763. The complex crystallizes with two distinct molecules in the asymmetric unit; each molecule contains a different degree of disorder with respect to the trans meso oxygen atoms (50/50, 71/29). Each independent molecule exhibits severe ruffling of the macrocycle. The six coordinate iron(II) center is diamagnetic. The axial Fe-N(pyridine) distances average 1.98 ?, and the in-plane Fe-N(pyrrole) distances average 1.95 ?. A common trend observed for the dioxoporphodimethene macrocycle in all of these structures is an elongation toward the trans oxidized meso carbons. These complexes were originally prepared as cis and trans isomeric mixtures that can be enriched in the trans isomer by fractional crystallization. This is evident in their distinctive (1)H NMR spectra. In addition, these compounds are characterized by electron impact mass spectrometry and UV-visible, ESR, and infrared spectroscopies.     

Reactions of [(eta(6)-arene)RuCl(2)](2) with Aromatic Phosphines Containing Methoxy Groups in 2,6-Positions

Reactions of [(eta(6)-arene)RuCl(2)](2) 1 (arene = p-cymene (a), 1,2,3,4-Me(4)C(6)H(2) (b), 1,2,3-Me(3)C(6)H(2) (c)) with tris(2,6-dimethoxyphenyl)phosphine (TDMPP) led to loss of two molecules of CH(3)Cl to give (eta(6)-arene)Ru[{2-O-C(6)H(3)-6-OMe}(2){C(6)H(3)(OMe)(2)-2,6}], 2a-c, which contains a trihapto ligand (eta(3)-P,O,O) derived from TDMPP, whereas the 1,3,5-Me(3)C(6)H(3) (1d), 1,2,3,5-Me(4)C(6)H(2) (1e), and C(6)Me(6) (1f) complexes did not react with TDMPP. The structures of 2a and 2b were confirmed by X-ray analyses: for 2a, a = 11.691(2) ?, b = 15.228(2) ?, c = 10.320(1) ?, alpha = 95.93(1) degrees, beta = 113.783(9) degrees, gamma = 83.86(1) degrees, triclinic, P&onemacr;, Z = 2, R = 0.051; for 2b, a = 17.79(2) ?, b = 15.43(1) ?, c = 20.93(1) ?, beta = 91.25(8) degrees, monoclinic, P2(1)/n, Z = 8, R = 0.056. Bis(2,6-dimethoxyphenyl)phenylphosphine (BDMPP) reacted with 1a, 1b, and 1d at room temperature to give (eta(6)-arene)RuCl[PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}], 3a,b,d, which contains a dihapto (eta(2)-P,O) ligand derived from BDMPP by an X-ray analysis of 3a: a = 12.33(1) ?, b = 14.246(8) ?, c = 11.236(9) ?, alpha = 91.47(8) degrees, beta = 117.28(6) degrees, gamma = 111.70(6) degrees, triclinic, P&onemacr;, Z = 2, R = 0.040. A similar reaction with 1f recovered the starting materials, but that in refluxing MeCN produced [(eta(6)-C(6)Me(6))Ru[PPh(2-O-C(6)H(3)-6-OMe}(2)], 4f, containing a trihapto (eta(3)-P,O,O) ligand derived from BDMPP. Complex 1d reacted with BDMPP at reflux in MeCN/CH(2)Cl(2) and resulted in a loss of an arene ring to give a five-coordinate complex, Ru[eta(2)-P,O-PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}](2)(MeCN), 5. Treatment of (2,6-dimethoxyphenyl)diphenylphosphine (MDMPP) with 1f gave (eta(6)-C(6)Me(6))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe)],6f, and that with 1b gave (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe}], 6b, and (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl(2)[eta(1)-P-PPh(2){C(6)H(3)(OMe)(2)-2,6}],7b. The phosphine ligand of 6b acted as a bidentate ligand derived from MDMPP: a = 8.074(4) ?, b = 16.816(3) ?, c = 18.916(4) ?, beta = 94.05(3) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.051. Transformation of 7b to 6b readily occurred accompanying an elimination of MeCl. Reaction of 1a with MDMPP eliminated an arene ring to give the octahedral compound RuCl(2)[eta(2)-P,OMe-PPh(2){C(6)H(3)(MeO)(2)-2,6}](2), 8. An X-ray analysis of 8 showed that two MDMPP ligands were in a cis-position: a = 10.596(14) ?, b = 27.586(12) ?, c = 13.036(8) ?, beta = 108.17(7) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.035.