共查询到20条相似文献,搜索用时 46 毫秒
1.
Three new strontium vanadium borophosphate compounds, (NH4)2(C2H10N2)6[Sr(H2O)5]2[V2P2BO12]6 10H2O (Sr-VBPO1) (1), (NH4)2(C3H12N2)6[Sr(H2O)4]2[V2P2BO12]6 17H2O (Sr-VBPO2) (2), and (NH4)3(C4H14N2)4.5[Sr(H2O)5]2[Sr(H2O)4][V2P2BO12]6 10H2O (Sr-VBPO3) (3) have been synthesized by interdiffusion methods in the presence of diprotonated ethylenediamine, 1,3-diaminopropane, and 1,4-diaminobutane. Compound 1 has a chain structure, whereas 2 and 3 have layered structures with different arrangements of [(NH4) [symbol: see text] [V2P2BO12]6] cluster anions within the layers. Crystal data: (NH4)2(C2H10N2)6[Sr(H2O)5]2[V2P2BO12]6 10H2O, monoclinic, space group C2/c (no. 15), a = 21.552(1) A, b = 27.694(2) A, c = 20.552(1) A, beta = 113.650(1) degrees, Z = 4; (NH4)2(C3H12N2)6[Sr(H2O)4]2[V2P2BO12]6 17H2O, monoclinic, space group I2/m (no. 12), a = 15.7618(9) A, b = 16.4821(9) A, c = 21.112(1) A, beta = 107.473(1) degrees, Z = 2; (NH4)3(C4H14N2)4.5[Sr(H2O)5]2[Sr(H2O)4] [V2P2BO12]6 10H2O, monoclinic, space group C2/c (no. 15), a = 39.364(2) A, b = 14.0924(7) A, c = 25.342(1) A, beta = 121.259(1) degrees, Z = 4. The differences in the three structures arise from the different steric requirements of the amines that lead to different amine-cluster hydrogen bonds. 相似文献
2.
Stitzer KE El Abed A Darriet J zur Loye HC 《Journal of the American Chemical Society》2001,123(36):8790-8796
Single crystals of Sr6Rh5O15 were grown from a molten potassium carbonate flux. The structure was solved by both the traditional 3-D crystallographic approach and the 4-D superspace group approach using JANA2000. Both methods produced an equivalent structure determination, thereby confirming the 4-D superspace group approach as an effective structure solution method for 3-D commensurate composite structures. Sr6Rh5O15 corresponds to the n = 1, m = 1 member of the A3n+3mA'nB3m+nO9m+6n family of 2H hexagonal perovskite-related oxides. This compound is characterized by pseudo-one-dimensional polyhedral chains of four face-sharing RhO6 octahedra followed by one RhO6 trigonal prism. These chains in turn are separated by [Sr](infinity) chains. Magnetic measurements were carried out on oriented single crystals, and a very large magnetic anisotropy in the magnetic susceptibility was observed. 相似文献
3.
1 INTRODUCTION With the increasing interest in diode-pumped solid state lasers, researches on more efficient new materials for diode pumping become more important. The double borates are a type of excellent laser gain media, for example, Nd3 -doped RAl… 相似文献
4.
Two novel U6+ compounds, Sr5(UO2)20(UO6)2O16(OH)6(H2O)6 (SrFm) and Cs(UO2)9U3O16(OH)5 (CsFm), have been synthesized by mild hydrothermal reactions. The structures of SrFm (orthorhombic, C2221, a = 11.668(1), b = 21.065 (3), c = 13.273 A, V = 3532.5(1) A3, Z = 2) and CsFm (trigonal, R3c, a = 11.395(2), c = 43.722(7) A, V = 4916.7(1) A3, Z = 6) are rare examples of uranyl compounds that contain cation-cation interactions where an O atom of one uranyl ion is directly linked to another uranyl ion. Both structures are complex frameworks. SrFm contains sheets of polyhedra that are linked through cation-cation interactions with uranyl ions located between the sheets. CsFm possesses an unusually complex framework of vertex- and edge-sharing U6+ polyhedra that incorporates cation-cation interactions. 相似文献
5.
From the system MF(2)/PF(5)/XeF(2)/anhydrous hydrogen fluoride (aHF), four compounds [Sr(XeF(2))(3)](PF(6))(2), [Pb(XeF(2))(3)](PF(6))(2), [Sr(3)(XeF(2))(10)](PF(6))(6), and [Pb(3)(XeF(2))(11)](PF(6))(6) were isolated and characterized by Raman spectroscopy and X-ray single-crystal diffraction. The [M(XeF(2))(3)](PF(6))(2) (M = Sr, Pb) compounds are isostructural with the previously reported [Sr(XeF(2))(3)](AsF(6))(2). The structure of [Sr(3)(XeF(2))(10)](PF(6))(6) (space group C2/c; a = 11.778(6) Angstrom, b = 12.497(6) Angstrom, c = 34.60(2) Angstrom, beta = 95.574(4) degrees, V = 5069(4) Angstrom(3), Z = 4) contains two crystallographically independent metal centers with a coordination number of 10 and rather unusual coordination spheres in the shape of tetracapped trigonal prisms. The bridging XeF(2) molecules and one bridging PF(6)- anion, which connect the metal centers, form complicated 3D structures. The structure of [Pb(3)(XeF(2))(11)](PF(6))(6) (space group C2/m; a = 13.01(3) Angstrom, b = 11.437(4) Angstrom, c = 18.487(7) Angstrom, beta = 104.374(9) degrees, V = 2665(6) Angstrom(3), Z = 2) consists of a 3D network of the general formula {[Pb(3)(XeF(2))(10)](PF(6))(6)}n and a noncoordinated XeF(2) molecule fixed in the crystal structure only by weak electrostatic interactions. This structure also contains two crystallographically independent Pb atoms. One of them possesses a unique homoleptic environment built up by eight F atoms from eight XeF(2) molecules in the shape of a cube, whereas the second Pb atom with a coordination number of 9 adopts the shape of a tricapped trigonal prism common for lead compounds. [Pb(3)(XeF(2))(11)](PF(6))(6) and [Sr(3)(XeF(2))(10)](PF(6))(6) are formed when an excess of XeF(2) is used during the process of the crystallization of [M(XeF(2))(3)](PF(6))(2) from their aHF solutions. 相似文献
6.
Nicasio MC Paneque M Pérez PJ Pizzano A Poveda ML Rey L Sirol S Taboada S Trujillo M Monge A Ruiz C Carmona E 《Inorganic chemistry》2000,39(2):180-188
The bis(ethylene) Rh species TpMe2Rh(C2H4)2(1*) (TpMe2 = tris(3,5-dimethyl-1-pyrazol-1-yl)hydroborate) has been obtained from [RhCl(C2H4)2]2 and KTpMe2. Complex 1* easily decomposes in solution to give mainly the butadiene species TpMe2Rh(eta74-C4H6). In the solid state its thermal decomposition follows a different course and the allyl TpMe2RhH(syn-C3H4Me) is cleanly obtained as a mixture of exo and endo isomers. The complexes Tp'Rh(C2H4)2 (Tp' = Tp, TpMe2) afford the monosubstituted species Tp'Rh(C2H4)(PR3) upon reaction with PR3 but react differently with L = CO or CNR: the Tp compound gives dinuclear [TpRh]2(mu-L)3 complexes, while, in the case of 1*, TpMe2Rh(C2H4)(L) species are obtained. The ethylene ligand of complexes TpMe2Rh(C2H4)(PR3) is labile, and several peroxo compounds of composition TpMe2Rh(O2)(PR3) have been isolated by their reaction with O2. All the mononuclear Rh(I) complexes are formulated as 18e- trigonal bipyramidal species on the basis of IR and NMR spectroscopic studies. A series of dihydride complexes of Rh(III) of formulation Tp'RhH2(PR3) have been prepared by the hydrogenation of the corresponding ethylene derivatives. Complexes [TpRh]2(mu-CNCy)3, TpMe2Rh(C2H4)(PEt3), and TpMe2Rh(O2)(PEt3) have been further characterized by X-ray diffraction studies. 相似文献
7.
Dixon FM Masar MS Doan PE Farrell JR Arnold FP Mirkin CA Incarvito CD Zakharov LN Rheingold AL 《Inorganic chemistry》2003,42(10):3245-3255
The ligand 1,4-bis[4-(diphenylphosphino)butyl]-2,3,5,6-tetramethylbenzene, 3, was used to synthesize a mononuclear Rh(II) complex [(eta(1):eta(6):eta(1)-1,4-bis[4-(diphenylphosphino)butyl]-2,3,5,6-tetramethylbenzene)Rh][PF(6)](2), 6+, in a two-legged piano-stool geometry. The structural and electronic properties of this novel complex including a single-crystal EPR analysis are reported. The complex can be cleanly interconverted with its Rh(I) form, allowing for a comparison of the structural properties and reactivity of both oxidation states. The Rh(I) form 6 reacts with CO, tert-butyl isocyanide, and acetonitrile to form a series of 15-membered mononuclear cyclophanes [(eta(1):eta(1)-1,4-bis[4-(diphenylphosphino)butyl]-2,3,5,6-tetramethylbenzene)Rh(CO)(3)][PF(6)] (8), [(eta(1):eta(1)-1,4-bis[4-(diphenylphosphino)butyl]-2,3,5,6-tetramethylbenzene)Rh(CNC(CH(3))(3))(2)][PF(6)] (10), and [(eta(1):eta(1)-1,4-bis[4-(diphenylphosphino)butyl]-2,3,5,6-tetramethylbenzene)Rh(CO)(CH(3)CN)][PF(6)] (11). The Rh(II) complex 6+ reacts with the same small molecules, but over shorter periods of time, to form the same Rh(I) products. In addition, a model two-legged piano-stool complex [(eta(1):eta(6):eta(1)-1,4-bis[3-(diphenylphosphino)propoxy]-2,3,5,6-tetramethylbenzene)Rh][B(C(6)F(5))(4)], 5, has been synthesized and characterized for comparison purposes. The solid-state structures of complexes 5, 6, 6+, and 11 are reported. Structure data for 5: triclinic; P(-)1; a = 10.1587(7) A; b = 11.5228(8) A; c = 17.2381(12) A; alpha = 96.4379(13) degrees; beta = 91.1870(12) degrees; gamma = 106.1470(13) degrees; Z = 2. 6: triclinic; P(-)1; a = 11.1934(5) A; b = 12.4807(6) A; c = 16.1771(7) A; alpha = 81.935(7) degrees; beta = 89.943(1) degrees; gamma = 78.292(1) degrees; Z = 2. 6+: monoclinic; P2(1)/n; a = 11.9371(18) A; b = 32.401(5) A; c = 12.782(2) A; beta = 102.890(3) degrees; Z = 4. 11: triclinic; P(-)1; a = 13.5476(7) A; b = 13.8306(7) A; c = 14.9948(8) A; alpha = 74.551(1) degrees; beta = 73.895(1) degrees; gamma = 66.046(1) degrees; Z = 2. 相似文献
8.
Two novel, noncentrosymmetric borate fluorides, Sr(3)B(6)O(11)F(2) and Ba(3)B(6)O(11)F(2), have been synthesized hydrothermally and their structures determined. The compounds are isostructural, crystallizing in space group P2(1), having lattice parameters of a = 6.4093 (13) ?, b = 8.2898 (17) ?, c = 9.3656 (19) ?, and β = 101.51 (3)° for Sr(3)B(6)O(11)F(2) and a = 6.5572 (13) ?, b = 8.5107 (17) ?, c = 9.6726 (19) ?, and β = 101.21 (3)° for Ba(3)B(6)O(11)F(2). The structure consists of a complex triple-ring borate framework having aligned triangular [BO(3)] groups that impart polarity. Fluorine atoms are bound only to the alkaline-earth metals and are not part of the borate framework, resulting in a vastly different structure from those of the hydrated borates Sr(3)B(6)O(11)(OH)(2) and Ba(3)B(6)O(11)(OH)(2) with similar formulas. The title compounds are transparent to nearly 200 nm, making them potentially useful for deep-ultraviolet nonlinear-optical applications. 相似文献
9.
Two cyclometalated complexes of Rh(III), rac-[Rh(ppy)2chrysi]+ and rac-[Rh(ppy)2 phi]+, have been synthesized and characterized with respect to their binding to DNA. The structure of rac-[Rh(ppy)2 phi]Cl.H2O.CH2Cl2 has been determined by X-ray diffraction (monoclinic, P2(1)/c, Z = 4, a = 18.447(3) A, b = 9.770(1) A, c = 17.661(3) A, beta = 94.821(11) degrees, V = 3172.0(8) A3) and reveals that the complex is a distorted octahedron with nearly planar ligands, similar in structure to the DNA mismatch recognition agent [Rh(bpy)2chrysi]3+. The 2-phenylpyridyl nitrogen atoms are shown to be in the axial positions, as a result of trans-directing effects. This tendency simplifies the synthesis and purification of such complexes by limiting the number of possible isomers generated. The abilities of [Rh(ppy)2chrysi]+ and [Rh(ppy)2 phi]+ to bind and, with photoactivation, to cleave DNA have been demonstrated in assays on duplex DNA in the absence and presence of a single CC mismatch. [Rh(ppy)2chrysi]+ was shown upon photoactivation to cleave DNA selectively at the base pair mismatch whereas [Rh(ppy)2 phi]+ cleaves B-DNA nonspecifically. The reactivity of [Rh(ppy)2chrysi]+ was also compared to that of the known mismatch recognition agent [Rh(bpy)2chrysi]3+. Competitive photocleavage studies revealed that a 14-fold excess of [Rh(ppy)2chrysi]+ was required to achieve the same level of binding as that of [Rh(bpy)2chrysi]3+. However, the ratio of damage induced by [Rh(bpy)2chrysi]3+ to that induced by [Rh(ppy)2chrysi]+ is considerably greater than this value, indicating that decreased photoefficiency for the cyclometalated complex must contribute to its significantly attenuated photoreactivity. These cyclometalated intercalators provide the starting points for the design of a new family of metal complexes targeted to DNA. 相似文献
10.
The new compounds, Sr6Sb6S17, Ba2.62Pb1.38Sb4S10, and Ba3Sb4.66S10 were prepared by the molten polychalcogenide salt method. Sr6Sb6S17 crystallizes in the orthorhombic space group P2(1)2(1)2(1) with a = 8.2871(9) A, b = 15.352(2) A, c = 22.873(3) A, and Z = 4. This compound presents a new structure type composed of [Sb3S7]5- units and trisulfide groups, (S3)2-, held together by Sr2+ ions. The [Sb3S7]5- fragment is formed from three corner-sharing SbS3 trigonal pyramids. The trisulfide groups are separated from the [Sb3S7]5- unit and embedded between the Sr2+ ions. Ba3Sb4.66S10 and Ba2.62Pb1.38Sb4S10 are not isostructural but are closely related to the known mineral sulfosalts of the rathite group. Ba3Sb4.67S10 is monoclinic P2(1)/c with a = 8.955(2) A, b = 8.225(2) A, c = 26.756(5) A, beta = 100.29(3) degrees, and Z = 4. Ba2.62Pb1.38Sb4S10 is monoclinic P2(1) with a = 8.8402(2) A, b = 8.2038(2) A, c = 26.7623(6) A, beta = 99.488(1) degrees, and Z = 4. The Sb atoms are stabilized in SbS3 trigonal pyramids that share corners to build ribbonlike slabs, which are stitched by Ba/Pb atoms to form layers perpendicular to the c-axis. These materials are semiconductors and show optical band gaps of 2.10, 2.14, and 1.64 eV for Sr6Sb6S17, Ba3Sb4.66S10, and Ba2.62Pb1.38Sb4S10, respectively. Raman spectroscopic characterization is reported. Sr6Sb6S17, Ba3Sb4.66S10, and Ba2.62Pb1.38Sb4S10 melt congruently at 729, 770, and 749 degrees C, respectively. 相似文献
11.
The strontium gallium oxynitride Sr(4)GaN(3)O and nitride-carbodiimide Sr(4)GaN(3)(CN(2)) are reported, synthesized as single crystals from molten sodium at 900 degrees C. Red Sr(4)GaN(3)O crystallizes in space group Pbca (No. 61) with a = 7.4002(1) Angstroms, b = 24.3378(5) Angstroms, c = 7.4038(1) Angstroms, and Z = 8, as determined from single-crystal X-ray diffraction measurements at 150 K. The structure may be viewed as consisting of slabs [Sr(4)GaN(3)](2+) containing double layers of isolated [GaN(3)](6-) triangular anions arranged in a "herringbone" fashion, and these slabs are separated by O(2-) anions. Brown Sr(4)GaN(3)(CN(2)) has a closely related structure in which the oxide anions in the Sr(4)GaN(3)O structure are replaced by almost linear carbodiimide [CN(2)](2-) anions [Sr(4)GaN(3)(CN(2)): space group P2(1)/c (No. 14), a = 13.4778(2) Angstroms, b = 7.4140(1) Angstroms, c = 7.4440(1) Angstroms, beta = 98.233(1) degrees, and Z = 4]. 相似文献
12.
Large single crystals of oxygen-deficient Sr6Co5O(15-delta) compounds, i.e., Sr6Co5O14.70 and Sr6Co4.9Ni0.1O14.36, were obtained by using K2CO3 flux in the presence of additives of transition metal oxides. The single-crystal structure determination shows that the structures of Sr6Co5O14.70 and Sr6Co4.9Ni0.1O14.36 crystallize in the space group R and can be described as one-dimensional face-sharing CoO3 polyhedral chains and Sr cation chains. Unlike the other known 2H-perovskite-related oxides in which the polyhedral chains consist of octahedra (Oh) and trigonal prism (TP), the structure of Sr6Co5O14.70 and Sr6Co4.9Ni0.1O14.36 contain Oh and intermediate polyhedra (IP) and can be attributed to a general structure formula A6A'2B3O(15-delta), which is closely related to the known A6A'B4O15 phases by shifting of a B atom and the O3 triangle along the c axis. Further study on O3 reveals that this oxygen position splits into two independent positions, corresponding to polyhedral geometry of IP and TP, respectively. Therefore, the polyhedral chain in the structure should be more precisely described as a random composite of the 4Oh + TP and 3Oh + 2IP. This model is used to interpret the magnetic properties, although not quantitatively. The 4-D structure analysis was also conducted for both Sr6Co5O14.70 and Sr6Co4.9Ni0.1O14.36 with a commensurate modulated structure in a 4-D superspace group, R3m(00gamma)0s, gamma = p/k = 3/5. By considering the same 4-D superspace group R3m(00gamma)0s but different t-phases, one can understand the structure relationship between Sr6Co5O14.70 and Sr6Rh5O15. 相似文献
13.
The tetrabutylammonium gamma-dodecatungstosilicate has been crystallized in a 6/1 acetonitrile/water solvent. An X-ray single-crystal analysis was carried out on [N(C4H9)4]4-gamma-[SiW12O40] which crystallizes in the orthorhombic system, space group P2(1)2(1)2(1), with a = 19.0881(3) A, b = 21.4435(3) A, c = 26.0799(1) A, V = 10674.9(2) A3, Z = 4, and rho(calcd) = 2.392 g/cm3. The idealized C2v arrangement of the anion results from the rotation of 60 degrees of two trigonal [W3O13] groups in the Keggin anion. Taking as reference the geometrical characteristics of the Keggin anion, it appears that the bond lengths and bonds angles within the four [W3O13] groups are not significantly modified while the mu-oxo junctions between the two rotated groups and those between the two unrotated groups involve more acute and opened W-O-W angles, respectively. The syntheses and 183W NMR characterizations of the mixed gamma-[SiW10Mo2O40]n- compounds corresponding to the oxidized (Mo(VI); n = 4) and to the two electron-reduced (Mo(V); n = 6) anions are reported. Structural analysis by 183W NMR has proved unambiguously that the C2v structure of the gamma-[SiW10O36]8- subunit is retained in both the compounds. The electronic behavior of the series gamma-[SiW10M2E2O36]6- (M = Mo or W; E = O or S) is examined, compared and related to 183W NMR data. 相似文献
14.
Liu QD Gao S Li JR Zhou QZ Yu KB Ma BQ Zhang SW Zhang XX Jin TZ 《Inorganic chemistry》2000,39(12):2488-2492
The new heteronuclear iminodiacetic acid (H2L) complexes [LnCu6(mu 3-OH)3(HL)2(L)4](ClO4)(2).25H2O with Ln = La (1) and Tb (2) have been prepared in aqueous solution and characterized by single-crystal X-ray diffraction to be isomorphous (crystallographic data for 1 and 2: hexagonal, P63/m; a = b = 12.6425(14) A, c = 24.541(5) A, Z = 2 (1); a = b = 12.5802(9) A, c = 24.285(4) A, Z = 2 (2)). Ln3+ was found to be located in the center of the trigonal prismatic cage formed by six Cu2+ ions, with a tricapped trigonal prismatic coordination environment of nine O atoms. The magnetic properties of complexes 1 and 2 have been studied. The results indicate the presence of ferromagnetic couplings between Tb3+ and Cu2+ in compound 2. 相似文献
15.
Yang GD Dai JC Lian YX Wu WS Lin JM Hu SM Sheng TL Fu ZY Wu XT 《Inorganic chemistry》2007,46(19):7910-7916
Two new compounds, [Ph3PCH2Ph]2[Zn3(tp)3Cl2] (1) and Ni3(tma)2(H2O)8 (2) (tp = terephthalate, tma = trimesate), are metal-polycarboxylate coordination polymers prepared by similar hydrothermal synthesis techniques. X-ray single-crystal structural analysis shows that both compounds crystallize in the 2D claylike lamellar architectures, in which 1 possesses the interlayer [Ph3PCH2Ph]+ exchangeable cation and has been confirmed by PXRD patterns. 1 (C74H56Cl2O12P2Zn3) belongs to monoclinic P21/c, Z = 2 (a = 18.956(1) A, b = 10.2697(5) A, c = 17.067(1) A, beta = 99.486(4) degrees ). 2 (C18H22O20Ni3) is attributed to triclinic P, Z = 1 (a = 6.6643(8) A, b = 9.622(1) A, c = 10.089(1) A, alpha = 112.675(2) degrees , beta = 94.007(1) degrees, gamma = 106.411(2) degrees ). Linear metal trinuclear clusters bridged by rigid linear tp ligands for 1 and trigonal tma ligands for 2 give rise to a novel 2D 6-linked (3,6) topological anionic network in 1 and an interesting 2D 3,6-linked molybdenite topological neutral network in 2, respectively. Both compounds exhibit intense fluorescent emission bands at 410 nm (lambda(exc) = 355 nm) for 1 and 398 nm (lambda(exc) = 300 nm) for 2 in the solid state at room temperature. 相似文献
16.
Solutions of Rh2(OAc)4 and Et4N[Cp*Ir(CN)3] react to afford crystals of the one-dimensional coordination solid [Et4N[Cp*Ir(CN)3][Rh2(OAc)4]]. This reaction is reversed by coordinating solvents such as MeCN. The structure of the polymer consists of helical anionic chains containing Rh2(OAc)4 units linked via two of the three CN ligands of Cp*Ir(CN)3-. Use of the more Lewis acidic Rh2(O2CCF3)4 in place of Rh2(OAc)4 gave purple [(Et4N)2[Cp*Ir(CN)3]2[Rh2(O2CCF3)4]3], whose insolubility is attributed to stronger Rh-NC bonds as well as the presence of cross-linking. The species [[Cp*Rh(CN)3][Ni(en)n](PF6)] (n = 2, 3) crystallized from an aqueous solution of Et4N[Cp*Rh(CN)3] and [Ni(en)3](PF6)2; [[Cp*Rh(CN)3][Ni(en)2](PF6)] consists of helical chains based on cis-Ni(en)(2)2+ units. Aqueous solutions of Et4N[Cp*Ir(CN)3] and AgNO3 afforded the colorless solid Ag-[Cp*Ir(CN)3]. Recrystallization of this polymer from pyridine gave the hemipyridine adduct [Ag[Ag(py)][Cp*Ir(CN)3]2]. The 13C cross-polarization magic-angle spinning NMR spectrum of the pyridine derivative reveals two distinct Cp* groups, while in the pyridine-free precursor, the Cp*'s appear equivalent. The solid-state structure of [Ag[Ag(py)][Cp*Ir(CN)3]2] reveals a three-dimensional coordination polymer consisting of chains of Cp*Ir(CN)3- units linked to alternating Ag+ and Ag(py)+ units. The network structure arises by the linking of these helices through the third cyanide group on each Ir center. 相似文献
17.
A novel bimetallic porphyrin complex salt, {[MnTPP(CH3OH)2]3Fe(CN)6}·13H2O (TPP = tetraphenylporphyrin), has been synthesized and structurally characterized by X-ray diffraction analysis. The crystal is of trigonal, space group R-3 with a = b = 31.0618(10), c = 11.8366(8) (A), Z = 3, V = 9890.3(8) (A)3, C144H134FeMn3N18O19, Mr = 2641.36, Dc = 1.330 g/cm3, μ(MoΚα) = 0.463 mm-1, F(000) = 4131, R = 0.0525 and wR = 0.1382 for 3045 observed reflections (I > 2((I)). The title complex is composed of one [Fe(CN)6]3- anion, three [MnTPP(CH3OH)2] cations and thirteen water molecules, which are connected by multiform hydrogen bonds leading to a 3D supramolecular network structure. 相似文献
18.
Braga D Gandolfi M Lusi M Paolucci D Polito M Rubini K Grepioni F 《Chemistry (Weinheim an der Bergstrasse, Germany)》2007,13(18):5249-5255
18-Crown[6] ether has been used to prepare a new class of organic-inorganic complexes of general formula 18-crown[6]M[HSO(4)](n) (where M = NH(4) (+), K(+), Sr(2+) and n = 1, 2) by reacting directly in solution or in the solid state the crown ether 18-crown[6] with inorganic salts such as [NH(4)][HSO(4)], K[HSO(4)], and Sr[HSO(4)](2). The structures of 18-crown[6][NH(4)][HSO(4)]2 H(2)O (12 H(2)O), 18-crown[6][NH(4)][HSO(4)] (1), 18-crown[6]K[HSO(4)]2 H(2)O (22 H(2)O), 18-crown[6]K[HSO(4)] (2), and 18-crown[6]Sr[HSO(4)](2) (3) have been characterized by single-crystal X-ray diffraction. The reversible water loss in compounds 12 H(2)O and 22 H(2)O leads to formation of the corresponding anhydrous phases 18-crown[6][NH(4)][HSO(4)] (1), and 18-crown[6]K[HSO(4)] (2), which undergo, on further heating, enantiotropic solid-solid transitions very likely associated with the on-set of a solid state dynamical process. Similar high-temperature behavior is shown by 18-crown[6]Sr[HSO(4)](2) (3). The dehydration and phase-transition processes have been investigated by differential scanning calorimetry (DSC), thermogravimetric analysis (TGA) and variable temperature X-ray powder diffraction. 相似文献
19.
The compounds (Me4N)[A(M(SC(O)Ph)3)2] (A = K, M = Cd (2); A = Na, M = Hg (3); and A = K, M = Hg (4)) were synthesized by reacting the appropriate metal chloride with A+PhC(O)S- and Me4NCl in the ratios 1:3:1 and 2:6:1. The structures of these compounds were determined by single-crystal X-ray diffraction methods. All the compounds are isomorphous, isostructural, and crystallized in the space group P1 with Z = 1. Single-crystal data for 2: a = 106670(2) A, b = 111522(2) A, c = 119294(2) A, alpha = 71782(1) degrees, beta = 85208(1) degrees, gamma = 69418(1) degrees, V = 126140(4) A3, Dcalc = 1528 g cm-3. Single-crystal data for 3: a = 10840(2) A, b = 10946(4) A, c = 12006(3) A, alpha = 7218(2) degrees, beta = 8675(2) degrees, gamma = 6743(2) degrees, V = 12493(6) A3, Dcalc = 1756 g cm-3. Single-crystal data for 4: a = 104780(1) A, b = 112563(2) A, c = 119827(2) A, alpha = 71574(1) degrees, beta = 85084(1) degrees, gamma = 70705(1) degrees, V = 126523(3) A3, Dcalc = 1755 g cm-3. In the [A(M(SC(O)Ph)3)2]- anions, each M(II) atom is bonded to three thiobenzoate ligands through sulfur atoms, giving a trigonal planar MS3 geometry. The carbonyl oxygen atoms from the two [M(SC(O)Ph)3]- anions are bonded to the alkali metal atom, providing an octahedral environment. Solution metal NMR studies showed the concentration-dependent dissociation of the alkali metal ions in the trinuclear anions. 相似文献
20.
The complexes trans-[Rh(X)(XNC)(PPh 3) 2] (X = Cl, 1; Br, 2; SC 6F 5, 3; C 2Ph, 4; XNC = xylyl isocyanide) combine reversibly with molecular oxygen to give [Rh(X)(O 2)(XNC)(PPh 3) 2] of which [Rh(SC 6F 5)(O 2)(XNC)(PPh 3) 2] ( 7) and [Rh(C 2Ph)(O 2)(XNC)(PPh 3) 2] ( 8) are sufficiently stable to be isolated in crystalline form. Complexes 2, 3, 4, and 7 have been structurally characterized. Kinetic data for the dissociation of O 2 from the dioxygen adducts of 1- 4 were obtained using (31)P NMR to monitor changes in the concentration of [Rh(X)(O 2)(XNC)(PPh 3) 2] (X = Cl, Br, SC 6F 5, C 2Ph) resulting from the bubbling of argon through the respective warmed solutions (solvent chlorobenzene). From data recorded at temperatures in the range 30-70 degrees C, activation parameters were obtained as follows: Delta H (++) (kJ mol (-1)): 31.7 +/- 1.6 (X = Cl), 52.1 +/- 4.3 (X = Br), 66.0 +/- 5.8 (X = SC 6F 5), 101.3 +/- 1.8 (X = C 2Ph); Delta S (++) (J K (-1) mol (-1)): -170.3 +/- 5.0 (X = Cl), -120 +/- 13.6 (X = Br), -89 +/- 18.2 (X = SC 6F 5), -6.4 +/- 5.4 (X = C 2Ph). The values of Delta H (++) and Delta S (++) are closely correlated (R (2) = 0.9997), consistent with a common dissociation pathway along which the rate-determining step occurs at a different position for each X. Relative magnitudes of Delta H (++) are interpreted in terms of differing polarizabilities of ligands X. 相似文献