Octanuclear and nonanuclear supramolecular copper(II) complexes with linear "tritopic" ligands: structural and magnetic studies

The structures and magnetic properties of self-assembled copper(II) clusters and grids with the "tritopic" ligands 2poap (a), Cl2poap (b), m2poap (c), Cl2pomp (d), and 2pomp (e) are described [ligands derived by reaction of 4-R-2,6-pyridinedicarboxylic hydrazide (R = H, Cl, MeO) with 2-pyridinemethylimidate (a-c, respectively) or 2-acetylpyridine (d, R = Cl; e, R = H)]. Cl2poap and Cl2pomp self-assemble with Cu(NO(3))(2) to form octanuclear "pinwheel" cluster complexes [Cu(8)(Cl2poap-2H)(4)(NO(3))(8)].20H(2)O (1) and [Cu(8)(Cl2pomp-2H)(4)(NO(3))(8)].15H(2)O (2), built on a square [2 x 2] grid with four pendant copper arms, using "mild" reaction conditions. Similar reactions of Cl2pomp and 2pomp with Cu(ClO(4))(2) produce pinwheel clusters [Cu(8)(Cl2pomp-2H)(4)(H(2)O)(8)](ClO(4))(8).7H(2)O (3) and [Cu(8)(2pomp-2H)(4)(H(2)O)(8)](ClO(4))(8) (4), respectively. Heating a solution of 1 in MeOH/H(2)O produces a [3 x 3] nonanuclear square grid complex, [Cu(9)(Cl2poap-H)(3)(Cl2poap-2H)(3)](NO(3))(9).18H(2)O (5), which is also produced by direct reaction of the ligand and metal salt under similar conditions. Reaction of m2poap with Cu(NO(3))(2) produces only the [3 x 3] grid [Cu(9)(m2poap-H)(2)(m2poap-2H)(4)](NO(3))(8).17H(2)O (6) under similar conditions. Mixing the tritopic ligand 2poap with pyridine-2,6-dicarboxylic acid (picd) in the presence of Cu(NO(3))(2) produces a remarkable mixed ligand, nonanuclear grid complex [Cu(9)(2poap-H)(4)(picd-H)(3)(picd-2H)](NO(3))(9).9H(2)O (7), in which aromatic pi-stacking interactions are important in stabilizing the structure. Complexes 1-3 and 5-7 involve single oxygen atom (alkoxide) bridging connections between adjacent copper centers, while complex 4 has an unprecedented mixed micro-(N-N) and micro-O metal ion connectivity. Compound 1 (C(76)H(92)N(44)Cu(8)O(50)Cl(4)) crystallizes in the tetragonal system, space group I, with a = 21.645(1) A, c = 12.950(1) A, and Z = 2. Compound 2 (C(84)H(88)N(36)O(44)Cl(4)Cu(8)) crystallizes in the tetragonal system, space group I, with a = 21.2562(8) A, c = 12.7583(9) A, and Z = 2. Compound 4 (C(84)H(120)N(28)O(66)Cl(8)Cu(8)) crystallizes in the tetragonal system, space group I4(1)/a, with a = 20.7790(4) A, c = 32.561(1) A, and Z = 4. Compound 7(C(104)H(104)N(46)O(56)Cu(9)) crystallizes in the triclinic system, space group P, with a = 15.473(1) A, b = 19.869(2) A, c = 23.083(2) A, alpha = 88.890(2) degrees, beta = 81.511(2) degrees, gamma = 68.607(1) degrees, and Z = 2. All complexes exhibit dominant intramolecular ferromagnetic exchange coupling, resulting from an orthogonal bridging arrangement within each polynuclear structure.     

New Cu(II) complexes based on the hydroxo-bridged dinuclear [Cu(OH)2Cu] units: step-like di- and trimerizations of [Cu(OH)2Cu] units

Four new Cu(II) complexes {[Cu(4)(bpy)(4)(OH)(4)(H(2)O)(2)]}(NO(3))(2)(C(7)H(5)O(2))(2)·6H(2)O 1, {[Cu(4)(bpy)(4)(OH)(4)(H(2)O)(2)]}(NO(3))(2)(C(5)H(6)O(4))·8H(2)O 2, {[Cu(4)(bpy)(4)(OH)(4)(H(2)O)(2)]}(C(5)H(6)O(4))(2)·16H(2)O 3 and {[Cu(6)(bpy)(6)(OH)(6)(H(2)O)(2)]}(C(8)H(7)O(2))(6)·12H(2)O 4 were synthesized (bpy = 2,2'-bipyridine, H(2)(C(5)H(6)O(4)) = glutaric acid, H(C(7)H(5)O(2)) = benzoic acid, H(C(8)H(7)O(2)) = phenyl acetic acid). The building units in 1-3 are the tetranuclear [Cu(4)(bpy)(4)(H(2)O)(2)(μ(2)-OH)(2)(μ(3)-OH)(2)](4+) complex cations, and in 4 the hexanuclear [Cu(6)(bpy)(6)(H(2)O)(2)(μ(2)-OH)(2)(μ(3)-OH)(4)](6+) complex cations, respectively. The tetra- and hexanuclear cluster cores [Cu(4)(μ(2)-OH)(2)(μ(3)-OH)(2)] and [Cu(6)(μ(2)-OH)(2)(μ(3)-OH)(4)] in the complex cations could be viewed as from step-like di- and trimerization of the well-known hydroxo-bridged dinuclear [Cu(2)(μ(2)-OH)(2)] entities via the out-of-plane Cu-O(H) bonds. The complex cations are supramolecularly assembled into (4,4) topological networks via intercationic ππ stacking interactions. The counteranions and lattice H(2)O molecules are sandwiched between the 2D cationic networks to form hydrogen-bonded networks in 1-3, while the phenyl acetate anions and the lattice H(2)O molecules generate 3D hydrogen-bonded anionic framework to interpenetrate with the (4,4) topological cationic networks with the hexanuclear complex cations in the channels. The ferromagnetic coupling between Cu(II) ions in the [Cu(4)(μ(2)-OH)(2)(μ(3)-OH)(2)] cores of 1-3 is significantly stronger via equatorial-equatorial OH(-) bridges than via equatorial-apical ones. The outer and the central [Cu(2)(OH)(2)] unit within the [Cu(6)(μ(2)-OH)(2)(μ(3)-OH)(4)] cluster cores in 4 exhibit weak ferromagnetic and antiferromagnetic interactions, respectively. Results about i.r. spectra, thermal and elemental analyses are presented.     

Two Cobalt(Ⅱ) Complexes Derived from the Hydrolysis Product of Di-Schiff Base Ligand N,N'-Bis-(1-benzimidazo-2-ylethylidene)-ethane-1,2-diamine: Preparation,Characterization and Crystal Structure of the 6-Coordinate Species [CoL2]X·H2O (X = ClO4-,NO3-)

The reactions of Co(CIO4)2.6H2O and Co(NO3)2·6H2O with the di-Schiff base ligand N,N'-bis-(1-benzimidazo-2-yl-ethylidene)-ethane-1,2-diamine (LA) in ethanol have been investigated.The reactions of LA with excess amount of cobalt salts yield the six-coordinate complexes [CoL2](CIO4)2·H2O 1 and [CoL2](NO3)2·H2O 2 as isolatable products (L = N-(1-benzimidazo-2-yl-ethylidene)-ethane-1,2-diamine), where L is a tri-dentate mono-Schiff base ligand, resulting from the hydrolysis of the precursor di-Schiff base LA.Both complexes were characterized by X-ray crystallography.Crystal data for complex 1: monoclinic, space group P21/c, a = 11.9214(10), b = 23.5828(17), c = 14.0387(12)(A), β= 135.219[4]°,C22H30CI2CoN9O9,Mr = 680.37, V = 2780.1(4)(A)3, Z = 4, Dc = 1.625 g/cm3,μ(MoKa) = 0.876 mm-1, F(000) = 1404,the final R = 0.0725 and wR = 0.1530 for 5726 observed reflections (I＞2σ(I)).Crystal data for complex 2: monoclinic, space group P21/c, a = 18.2162(16), b = 10.0610(6), c = 18.593(2)(A),β=130.099(3)°, C22H30CoN10O7, Mr = 605.49, V = 2606.5(4)(A)3, Z = 4, Dc = 1.543 g/cm3,μ(MoKα)= 0.722 mm-1, F(000) = 1260, the final R = 0.0619 and wR = 0.1429 for 5194 observed reflections (I ＞ 2σ(I)).X-ray diffraction analysis reveals that each cobalt atom in the two complexes is chelated by six nitrogen atoms from two tridentate iigands L, exhibiting a slightly distorted octahedral coordination sphere.In both complexes, the strong hydrogen-bonding interactions between the lattice waters and N-H groups of the ligands result in 1D chains which are further connected by ClO4- (or NO3-) groups to form a 3D framework.In complex 2, the strong π-π interactions increase the stability of the structure.     

Complexes of copper(II) with 3-(ortho-substituted phenylhydrazo)pentane-2,4-diones: syntheses, properties and catalytic activity for cyclohexane oxidation

Reactions of copper(II) with 3-phenylhydrazopentane-2,4-diones X-2-C(6)H(4)-NHN=C{C(=O)CH(3)}(2) bearing a substituent in the ortho-position [X = OH (H(2)L(1)) 1, AsO(3)H(2) (H(3)L(2)) 2, Cl (HL(3)) 3, SO(3)H (H(2)L(4)) 4, COOCH(3) (HL(5)) 5, COOH (H(2)L(6)) 6, NO(2) (HL(7)) 7 or H (HL(8)) 8] lead to a variety of complexes including the monomeric [CuL(4)(H(2)O)(2)]·H(2)O 10, [CuL(4)(H(2)O)(2)] 11 and [Cu(HL(4))(2)(H(2)O)(4)] 12, the dimeric [Cu(2)(H(2)O)(2)(μ-HL(2))(2)] 9 and the polymeric [Cu(μ-L(6))](n)] 13 ones, often bearing two fused six-membered metallacycles. Complexes 10-12 can interconvert, depending on pH and temperature, whereas the Cu(II) reactions with 4 in the presence of cyanoguanidine or imidazole (im) afford the monomeric compound [Cu(H(2)O)(4){NCNC(NH(2))(2)}(2)](HL(4))(2)·6H(2)O 14 and the heteroligand polymer [Cu(μ-L(4))(im)](n)15, respectively. The compounds were characterized by single crystal X-ray diffraction (complexes), electrochemical and thermogravimetric studies, as well as elemental analysis, IR, (1)H and (13)C NMR spectroscopies (diones) and ESI-MS. The effects of the substituents in 1-8 on the HOMO-LUMO gap and the relative stability of the model compounds [Cu(OH)(L(8))(H(2)O)]·H(2)O, [Cu(L(1))(H(2)O)(2)]·H(2)O and [Cu(L(4))(H(2)O)(2)]·H(2)O are discussed on the basis of DFT calculations that show the stabilization follows the order: two fused 6-membered > two fused 6-membered/5-membered > one 6-membered metallacycles. Complexes 9, 10, 12 and 13 act as catalyst precursors for the peroxidative oxidation (with H(2)O(2)) of cyclohexane to cyclohexanol and cyclohexanone, in MeCN/H(2)O (total yields of ca. 20% with TONs up to 566), under mild conditions.     

An isomorphous series of cubic, copper-based triazolyl isophthalate MOFs: linker substitution and adsorption properties

An isomorphous series of 10 microporous copper-based metal-organic frameworks (MOFs) with the general formulas (∞)(3)[{Cu(3)(μ(3)-OH)(X)}(4){Cu(2)(H(2)O)(2)}(3)(H-R-trz-ia)(12)] (R = H, CH(3), Ph; X(2-) = SO(4)(2-), SeO(4)(2-), 2 NO(3)(2-) (1-8)) and (∞)(3)[{Cu(3)(μ(3)-OH)(X)}(8){Cu(2)(H(2)O)(2)}(6)(H-3py-trz-ia)(24)Cu(6)]X(3) (R = 3py; X(2-) = SO(4)(2-), SeO(4)(2-) (9, 10)) is presented together with the closely related compounds (∞)(3)[Cu(6)(μ(4)-O)(μ(3)-OH)(2)(H-Metrz-ia)(4)][Cu(H(2)O)(6)](NO(3))(2)·10H(2)O (11) and (∞)(3)[Cu(2)(H-3py-trz-ia)(2)(H(2)O)(3)] (12(Cu)), which are obtained under similar reaction conditions. The porosity of the series of cubic MOFs with twf-d topology reaches up to 66%. While the diameters of the spherical pores remain unaffected, adsorption measurements show that the pore volume can be fine-tuned by the substituents of the triazolyl isophthalate ligand and choice of the respective copper salt, that is, copper sulfate, selenate, or nitrate.     

Unprecedented Pseudo Water Tapes Stabilized by a One-dimensional Cu（Ⅱ） Coordination Polymer

A new compound,[Cu(mal)(tmdpy)(H2O)]·4H2O(1,H2mal = malonic acid,tmdpy = 4,4'-trimethylenedipyridine) has been synthesized by the hydrothermal synthesis and structurally characterized by X-ray crystallography. It crystallizes in triclinic,space group P1 with a = 9.1662(6),b = 10.6266(7),c = 11.3056(7) ,α = 84.6390(10),β = 72.1030(10),γ = 73.0420(10) o,V = 1002.37(11) 3,C16H26CuN2O9,Mr = 453.93,Z = 2,Dc = 1.504 g/cm3,μ = 1.140 mm-1,F(000) = 474,R = 0.0375 and wR = 0.0975 for 3187 observed reflections(I > 2σ(I)) . In the structure of 1,the tmdpy ligands link the [Cu(mal)(H2O) ] units into an infinite chain,and the water molecules and carboxylate oxygen donors(O(2) and O(4)) from the mal ligands cooperatively built an interesting hydrogen bonding network with unprecedented pseudo water tape substructures.     

Syntheses and Crystal Structures of Two Gd（Ⅲ） Hydrogen Supramolecules Based on p-Sulfonatothiacalix[4]arene

Two novel polymeric complexes, [Gd（HsTCAS）（H2O）7]·4H2O 1 and [Gd（HsTCAS） （CH3COCH3）（H2O）6]·6H2O 2 （H4TCAS = p-sulfonatothiacalix[4]arene）, have been synthesized and characterized by single-crystal X-ray diffraction analyses. Complex 1 crystallizes in monoclinic, space group C2/m with a = 20.2308（12）, b = 19.0894（10）, c = 12.2448（7）A, β = 101.847（3）°, V = 4628.1（5）A^3, C24H43GdO27S8, Mr = 1169.25, Z = 4, Dc = 1.690 g/cm^3, F（000） = 2380,μ = 1.879 mm^-1, the final R = 0.0404 and wR = 0.1038 for 5127 observed reflections with I 〉 2σ（I）. Complex 2 is pseudo-isostructural with complex 1.     

Potent and selective inhibition of T-cell protein tyrosine phosphatase (TCPTP) by a dinuclear copper(II) complex

A dinuclear Cu(II) complex, [Cu(2)(μ-IDA)(phen)(3)(NO(3))]NO(3)·4H(2)O (phen = 1,10-phenanthroline, H(2)IDA = iminodiacetic acid), was found to potently and selectively inhibit T-cell protein tyrosine phosphatase, and lead to the anti-proliferation and apoptosis of C6 glioma cells.     

Reversible single crystal to single crystal transformation with anion exchange-induced weak Cu2+···I⁻ interactions and modification of the structures and properties of MOFs

{[Cu(6)(TTTMB)(8)(OH)(4)(H(2)O)(6)]·8(NO(3))·34.5H(2)O}(n) can reversibly transform to {[Cu(6)(TTTMB)(8)I(3)]·9I·26H(2)O}(n) upon a single crystal to single crystal process. The transformation is accompanied by the formation of weak Cu(2+)I(-) interactions and changes in the coordination numbers, as well as modulation in their properties.     

Synthesis, Structure and Characterization of [Cu(2,2''-bpy)2][{Cu(2,2''-bpy)2}2W12O40(H2)]·4H2O

An organic-inorganic compound [Cu(2,2'-bpy)2][{Cu(2,2'-bpy)2}2W12O4o(H2)]·4H2O (Mr = 4048.00) was prepared from the hydrothermal reaction of Na2WO4·2H2O, CuCl2·2H2O,2,2'-bipyridine (2,2'-bpy) and H2O at 160 ℃ for 4 days. The compound crystallizes in the monoclinic system, space group P21/n with a = 18.9196(8), b = 20.4212(8), c = 21.8129(9)(A), β=96.992(3)°, V= 8365.0(6) (A)3, Dc= 3.214 g/cm3, Z = 4,μ(MoKα) = 17.269 mm-1 and F(000) = 7324.Of the 119837 total reflections, 17315 were unique (Rint = 0.0489). The final R = 0.0385 and wR =0.0770 for 11142 observed reflections with I ＞ 2σ(I). Single-crystal X-ray diffraction reveals that the structure is composed of [{Cu(2,2'-bpy)2}2W12O40(H2)]2- anions, discrete [Cu(2,2'-bpy)2]2 cations and lattice water molecules, and the anion is made up of a {W12O40(H2)}6- α-Keggin core decorated with two {Cu(2,2'-bpy)2}2 groups through bridging oxygen atoms.     

Anionic gallium-based metal-organic framework and its sorption and ion-exchange properties

A gallium-based metal-organic framework Ga(6)(C(9)H(3)O(6))(8)·(C(2)H(8)N)(6)(C(3)H(7)NO)(3)(H(2)O)(26) [1, Ga(6)(1,3,5-BTC)(8)·6DMA·3DMF·26H(2)O], GaMOF-1; BTC = benzenetricarboxylate/trimesic acid and DMA = dimethylamine], with space group I43d, a = 19.611(1) ?, and V = 7953.4(6) ?(3), was synthesized using solvothermal techniques and characterized by synchrotron-based X-ray microcrystal diffraction. Compound 1 contains isolated gallium tetrahedra connected by the organic linker (BTC) forming a 3,4-connected anionic porous network. Disordered positively charged ions and solvent molecules are present in the pore, compensating for the negative charge of the framework. These positively charged molecules could be exchanged with alkali-metal ions, as is evident by an ICP-MS study. The H(2) storage capacity of the parent framework is moderate with a H(2) storage capacity of ~0.5 wt % at 77 K and 1 atm.     

New diamondoid-like [Cu3B(μ-O)6] core self-assembled from Bis-Tris biobuffer for mild hydrocarboxylation of alkanes to carboxylic acids

The new tricopper(II) complex [Cu(3)(μ(3)-BO)(H(3)L)(3)][BF(4)]·2H(2)O (1) with an unprecedented diamondoid-like [Cu(3)B(μ-O)(6)] core has been easily generated by self-assembly in an aqueous medium from Cu(NO(3))(2), NaBF(4), NaOH and Bis-Tris (H(5)L) biobuffer, (HOCH(2))(3)CN(CH(2)CH(2)OH)(2). Compound 1 efficiently promotes the mild single-pot hydrocarboxylation, by CO and H(2)O, of various linear and cyclic C(n) (n = 2-8) alkanes into the corresponding C(n+1) carboxylic acids.     

Hydrothermal Synthesis and Crystal Structure of a Copper Complex

The title compound [Cu(IB)2]n·n(H2O) 1 was synthesized via the hydrothermal reaction of CuSO4·5H2O and NaOH with 4-(1H-Imidazol-1-yl)benzoic acid(HIB),and character-rized by elemental analysis and infrared spectra.The crystal of 1 crystallizes in monoclinic,space group C2/c with a = 14.349(7),b = 5.977(3),c = 21.368(9) ,β = 104.956(9)o,V = 1770.5(2)3,Z = 4,C20H16CuN4O5,Mr = 455.92,Dc = 1.710 g/cm3,F(000) = 932 and μ(MoKα) = 1.279 mm-1.The final R = 0.0337 and wR = 0.0888 for 1972 observed reflections with Ⅰ 2σ(Ⅰ) and R = 0.0369 and wR = 0.0926 for all data.X-ray diffraction reveals that the IB ligand links the Cu(Ⅱ) atoms into a double stranded chain.The extensive supramolecular interactions lead to the formation of an infinite 2D structure.     

1,2,4-Triazole functionalized adamantanes: a new library of polydentate tectons for designing structures of coordination polymers

A series of functionalized adamantanes: 1,3-bis(1,2,4-triazol-4-yl)(tr(2)ad); 1,3,5-tris(1,2,4-triazol-4-yl)-(tr(3)ad); 1,3,5,7-tetrakis(1,2,4-triazol-4-yl)adamantanes (tr(4)ad) and 3,5,7-tris(1,2,4-triazol-4-yl)-1-azaadamantane (tr(3)ada) were developed as a new family of geometrically rigid polydentate tectons for supramolecular synthesis of framework solids. The coordination compounds were prepared under hydrothermal conditions; their structures reveal a special potential of the triazolyl adamantanes for the generation of highly-connected and open frameworks as well as structures based upon polynuclear metal clusters assembled with short-distance N(1),N(2)-triazole bridges. Complexes [Cd{L}(2)]A·nH(2)O [L = tr(3)ad, A = 2NO(3)(-) (4), CdCl(4)(2-) (5); L = tr(3)ada, A = CdI(4)(2-) (7)] are isomorphous and adopt a layered 3,6-connected structure of CdI(2) type. [{Cu(3)(OH)}(2)(SO(4))(5)(H(2)O)(2){tr(3)ad}(3)]·26H(2)O (6) is a layered polymer based upon Cu(3)(μ(3)-OH) nodes and trigonal tr(3)ad links. In [Cu(3)(OH)(2){tr(3)ada}(2)(H(2)O)(4)](ClO(4))(4) (8), [Cu(2){tr(3)ada}(2)(H(2)O)(3)](SO(4))(2)·7H(2)O (9) and [Cd(2){tr(3)ada}(3)]Cl(4)·28H(2)O (10) (UCl(3)-type net) the organic tripodal ligands bridge polynuclear metal clusters. Complexes [Ag{tr(4)ad}]NO(3)·3.5H(2)O (11) and [Cu{tr(4)ad}(H(2)O)](ClO(4))(2)·3H(2)O (12) have 3D SrAl(2)-type frameworks with the metal ions and adamantane tectons as topologically equivalent tetrahedral nodes, while in [Cd(3)Cl(6){tr(4)ad}(2)]·9H(2)O (13) the ligands bridge trinuclear six-connected Cd(3)Cl(6)(μ-tr)(4)(tr)(2) clusters. In the compounds [Cd(2){tr(2)ad}(4)(H(2)O)(4)](CdBr(4))(2)·2H(2)O (2) and [Cd{tr(2)ad}(4){CdI(3)}(2)]·4H(2)O (3) the bitopic ligands provide simple links between the metal ions, while in [Ag(2){tr(2)ad}(2)](NO(3))(2)·2H(2)O (1) the ligand is tetradentate and generates a 3D framework.     

Synthesis and Crystal Structure of [Cu2（DMF）（H2O）（C7H4NO4）2（C7H3NO4）]2·3.5DMF

A new copper（H） complex [Cu2（DMF）（H2O）（C7H4NO4）2（C7H3NO4）]2-3.5DMF has been synthesized and its structure was determined by single-crystal X-ray diffraction. The crystal is of triclinic, space group P1^- with a = 10.722（3）, b = 18.170（4）, c = 20.923（7）A,α = 105.297（9）, β = 101.701（10）, γ = 105.74（1）°, V= 3615（1）A^3, Z = 2, C58.50H64.50Cu4N1l.50O3150, Mr = 1686.90, Dc = 1.550 g/cm^3,μ= 1.255 mm^-1, F（000） = 1728.00, T = 150（2） K, the final R = 0.0640 and wR = 0.173 for 11310 observed reflections with I 〉 2σ（I）. In the crystal, each formular unit consists of two dinuclear copper（H） compounds, between which the O-H…O hydrogen bonds exist. Each Cu^Ⅱ cation is six-coordinated in an octahedral geometry. The intermolecular hydrogenbonding interaction leads to a 3-D framework of the title compound.     

Synthesis and characterization of diverse coordination polymers. Linear and zigzag chains involving their structural transformation via intermolecular hydrogen-bonded, interpenetrating ladders polycatenane, and noninterpenetrating square grid from long, rigid N,N'-bidentate ligands: 1,4-bis[(x-pyridyl)ethynyl]benzene (x = 3 and 4)

The long, rigid ligands 1,4-bis[(3-pyridyl)ethynyl]benzene (L1) and 1,4-bis[(4-pyridyl)ethynyl]benzene (L2) were used in the synthesis of 10 new organic-inorganic coordination frameworks, each of them adopting different structural motifs. Synthesis, single-crystal X-ray structure determination, and spectroscopic and thermogravimetric analyses are presented. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] with L1 afforded the following one-dimensional zigzag chain structures: [Cd(C20H12N2)0.5(NO3)(CH3OH)]n (1, monoclinic, C2/c; a = 7.586(1) A, b = 23.222(1) A, c = 13.572(1) A, beta = 92.824(1), Z = 4); [{Cu(C20H12N2)(NO3)2(CH3OH)} x CH3OH]n (2, orthorhombic, P2(1)2(1)2(1); a = 8.589(1) A, b = 15.766(1) A, c = 17.501(1) A, Z = 4); [Co(C20H12N2)2(NO3)2(H2O)2] (5, triclinic, P1; a = 7.493(1) A, b = 8.948(1) A, c = 14.854(1) A, alpha = 100.427(1), beta = 97.324(1), gamma = 110.901(1), Z = 1); [Cu(C20H12N2)(hfac)2]n (4, monoclinic, C2/c, a = 18.828(1) A, b = 14.671(1) A, c = 13.427(1) A, beta = 90.447(1) degrees, Z = 4). Moreover, the minority phase compound formed from Cu(NO3)2 x 3H2O and L1 yielded a metallocyclic chain structure, [Cu(C20H12N2)(NO3)]n (3, triclinic, P; a = 8.728(1) A, b = 10.018(1) A, c = 11.893(1) A, alpha = 109.991(1), beta = 97.109(1), gamma = 115.542(1), Z = 1). In addition to the dinuclear coordination complex 5, all other polymeric structures (1-4) from L1 are composed of interpenetrating 2D and 3D cross-linked zigzag chains via hydrogen-bonding interactions. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] and L2 were dependent on the nature of the metal center and resulted in the formation of four different interpenetrating and noninterpenetrating compounds (6-10): [Co(C20H12N2)1.5(NO3)2]n (6, triclinic, P; a = 14.172(1) A, b = 15.795(1) A, c = 18.072(1) A, alpha = 115.380(1), beta = 101.319(1), gamma = 93.427(2), Z = 4), which consists of T-shaped building blocks assembled into three-dimensional interpenetrating polycatenated ladders; [Cd(C20H12N2)2(NO3)2]n (7, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), which adopts a two-dimensional noninterpenetrating square-grid motif; [Cu(C20H12N2)(hfac)2]n (8, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), composed of three sets of distinct one-dimensional linear chains; [Cu(C20H12N2)(EtOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2EtOH (9, triclinic, P; a = 12.248(2) A, b = 13.711(3) A, c = 18.257(4) A, alpha = 108.078(4) degrees, beta = 97.890(4) degrees, gamma = 103.139(5) degrees, Z = 2) and [Cu(C20H12N2)(MeOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2MeOH (10, triclinic, P; a = 12.136(1) A, b = 13.738(2) A, c = 17.563(3) A, alpha = 107.663(3) degrees, beta = 94.805(4) degrees, gamma = 104.021(4) degrees, Z = 2). Both 9 and 10 stack into infinite interpenetrating ladders through bundles of infinite chains and are described in our preliminary communication.     

Synthesis and Characterization of a Novel 3D Coordination Polymer Based on Cu(Ⅱ) Cations and Mellitic Acid

A new mellitate complex [Cu3(μ2-mellitate)(μ2-H2O)(H2O)2·H2O]n 1 has been synthesi- zed by the reaction of mellitic acid and Cu(CH3COO)2·H2O in the presence of base. Crystallogra- phic data for 1: C12H80O16Cu3, Mr = 598.80, orthorhombic, Pbcn, a = 8.4378(6), b = 10.0396(7), c = 17.6799(12) A, V = 1497.70(18) A3, Z = 4, Dc = 2.656 g/cm3,μ = 4.327 mm-1, F(000) = 1180, R = 0.0431 and wR = 0.0964 for 1075 observed reflections (Ⅰ> 2σ(Ⅰ)). X-ray crystal structural analysis revealed that the mellitate anions behave as the bridging ligands and link eight copper atoms repeatedly to form a novel three-dimensional metal-organic coordination polymer with two different rhombic tunnels in the solid-state structure.     

Synthesis and Crystal Structure of a New Three-dimensional Supramolecule of Copper(Ⅱ)Schiff Base Complex

A new three-dimensional supramolecule composed of copper-Schiff base complex,[Cu(naphdien)]Cl·H2O,where naphdien is Schiff base of 2-hydroxy-1-naphthaldehyde and diethyle-netriamine,has been synthesized and determined by single-crystal X-ray diffraction.It belongs to the monoclinic system,space group P21/c,with a=7.3490(15),b=7.0847(16),c=30.845(3)(A),β=95.33(3)°,V=1599.O(5)(A)3,Z=4,C15H20ClCuN3O2,Mr=373.33,Dc=1.551 g/cm3,μ=1.543mm-1,F(000)=772,R=0.0536 and wR=0.0927 for 2788 unique reflections with 1659 observed ones(I＞2σ(I)).In the crystal structure,mononuclear units[Cu(naphdien)]Cl·H2O are linked into a two-dimensional framework via strong hydrogen bonds,and extended into a three-dimensional supramolecular structure through π-π stacking interactions.     

A 2-D Copper Coordination Polymer [Cu(4,4''''-bpy)(H_2O)_4](C_4H_2O_4)(H_2O)_4 Integrated by Hydrogen Bonds and VDW Interactions

1 INTRODUCTION A great deal of interest in transition metal com- plex assembly has recently been devoted to the development of rational synthetic routes to novel one-, two- and three-dimensional crystal frameworks, due to their potential applications in…     

Two novel heterometallic Cu(II)-Sr(II) coordination polymers based on 3,5-pyrazoledicarboxylic acid: synthesis, crystal structures and magnetic properties

The syntheses, crystal structures and magnetic properties are described for two novel 2D heterometallic Cu(II)-Sr(II) coordination polymers {Sr(H(2)O)(6)[(Im)(4)Cu(4)(pdc)(4)Sr(H(2)O)(4)]·6H(2)O}(n) (1) and [Cu(2)(H(2)O)(2)(pdc)(2)Sr(H(2)O)(3)](n) (2) (H(3)pdc = 3,5-pyrazoledicarboxylic acid; Im = imidazole). The 1 : 1 : 1 : 5 reaction of SrCl(2)·6H(2)O, Cu(NO(3))(2)·3H(2)O, H(3)pdc and imidazole in H(2)O-EtOH at 120 °C under autogenous pressure gave 1. Complex 2 was obtained from the 1 : 1 : 1 H(3)pdc/Sr(OH)(2)·8H(2)O/Cu(NO(3))(2)·3H(2)O reaction mixture in H(2)O-EtOH under solvothermal conditions. Complex 1 can be described as a 2D grid-shaped network with the four Cu(II) ions in a saddle-like conformation. In complex 2, Sr(II) ions link metalloligands [Cu(2)(pdc)(2)(H(2)O)(2)](2-) to generate a 2D layer framework. Variable-temperature solid-state dc magnetic susceptibility studies have been performed in the temperature range 2.0-300 K for complexes 1 and 2. Antiferromagnetic Cu(II)···Cu(II) exchange interactions were found for both 1 and 2.