Alkyl- und Arylkomplexe des Iridiums und Rhodiums. XIX. Reaktion von Carbonsäuren mit ausgewählten Organoverbindungen von Ir(I) und Rh(I): Bildung von Arylhydrido-, Carboxylatohydrido- und Carboxylato-Derivaten |
| |
Authors: | E Arpac F Mirzaei A Yardimcioglu L Dahlenburg |
| |
Abstract: | Alkyl and Aryl Complexes of Iridium and Rhodium. XIX. Reaction of Carboxylic Acids with Selected Organo Compounds of Ir(I) and Rh(I): Formation of Arylhydrido, Carboxylatohydrido, and Carboxylato Derivatives cis-Arylhydridoiridium(III) complexes IrH(Ar)(O2CR)(CO)(PPh3)2 (R = Me: Ar = C6H5, 4-MeC6H4; R = Et: Ar = 4-MeC6H4, 2,4-Me2C6H3) could be prepared by oxidative addition of carboxylic acids to aryliridium(I) compounds Ir(Ar)(CO)(PPh3)2. Reaction of aliphatic carboxylic acids with alkyliridium(I) derivatives Ir(Alk)(CO)(PPh3)2 and Ir(Alk)PhP(CH2CH2CH2PPh2)2] (Alk = CH2CMe3, CH2SiMe3) lead to dicarboxylatoiridium(III) hydrides IrH(O2CR)2(CO)(PPh3)2 (R = Me, Et, i-Pr) and IrH(O2CR)2PhP(CH2CH2CH2PPh2)2] (R = Me, Et). Ir(4-MeC6H4CO2)(CO)(PPh3)2 was obtained from Ir(CH2SiMe3)(CO)(PPh3)2 and 4-MeC6H4CO2H. Interaction of organorhodium complexes Rh(R′)(CO)(PPh3)2 (R′ = CH2SiMe3, 4-MeC6H4) and Rh(R′)PhP(CH2CH2CH2PPh2)2] (R′ = CH2CMe3, 4-MeC6H4) with aliphatic and aromatic carboxylic acids yielded carboxylatorhodium(I) compounds Rh(O2CR)(CO)(PPh3)2 (R = Me, t-Bu, 4-MeC6H4) and Rh(O2CR)PhP(CH2CH2CH2PPh2)2] (R = Me, 4-MeC6H4). |
| |
Keywords: | |
|
|