Amino acid templating of inorganic networks: synthesis and structure of L-asparagine zinc phosphite, C4N2O3H8.ZnHPO3

C(4)N(2)O(3)H(8).ZnHPO(3) is the first zincophosphite framework to be templated by an amino acid (l-asparagine), which bonds to Zn via a carboxyl O atom. It contains infinite, homochiral, helical 4-ring chains of ZnO(4) and HPO(3) groups, stabilized by intra- and interchain N-H.O hydrogen bonds. Crystal data: C(4)N(2)O(3)H(8).ZnHPO(3), M(r) = 277.49, orthorhombic, P2(1)2(1)2(1) (No. 19), a = 5.0349(2) A, b = 9.4539(4) A, c = 18.6092(8) A, V = 885.79 (6) A(3), Z = 4.