Abstract: | A new polymerization strategy, consisting of nucleophilic substitution reaction between CS32‐, immobilized on a polymeric support, and dimethyl α,α′‐dibromoalkylanedioate in solution, leads to the formation of polytrithiocarbonates. When n = 0, 1 in CH3OOCCHBr(CH2)nCHBrCOOCH3 (α,α′‐dibromoalkylanedioate), only five‐ or six‐membered cyclic trithiocarbonates were obtained; n ≥ 2 resulted in the formation of polytrithiocarbonates. |