The reaction of hexachlorocyclotriphosphazatriene with P-aminophenol |
| |
Authors: | Hanife İbişoğlu Ali Metin Güzel Fatma Yuksel |
| |
Institution: | 1. Department of Chemistry, Gebze Technical University, Gebze, Kocaeli, Turkeyibisoglu@gtu.edu.tr;3. Department of Chemistry, Gebze Technical University, Gebze, Kocaeli, Turkey |
| |
Abstract: | The reaction of hexachlorocyclotriphosphazatriene (1) with p-aminophenol (2) produced two new products: the open chain compound N3P3Cl5(NHC6H4OH) (3), and the bridged compound N3P3Cl5(NHC6H4O)N3P3Cl5(4). The compounds 3 and 4 were separated and characterized by elemental analysis, massspectrometry and NMR spectroscopy. The molecular structures of compounds 3 and 4 were determined by X-ray crystallography. Compound 3 is the first example of cyclotriphosphazene including (p-hydroxyphenyl) amino group and compound 4 was the first example of the N-substituted p-aminophenoxy group with cyclotriphosphazene. |
| |
Keywords: | Cyclophosphazene p-aminophenol phosphazene X-ray |
|
|