Institution: | Technische Hochschule Merseburg, Institut für Anorganische Chemie, Geusaer Straβe, O-4200 Merseburg Deutschland Lomonossov-Universität, Moskau, Chemische Fakultät, 117 234 Moskau U.S.S.R. |
Abstract: | Reduction of (C5H5)2TiCl2 with Zn in presence of benzyl cyanide gives the (μ-alkyl-ideneamido)titanocene complex (C5H5)2TiCl]2μ-{N=C(CH2C6H5)---C(CH2C6H5)=N}] with C---C bond formation between two benzyl cyanide molecules. X-ray structure investigation indicates a symmetrical structure. The C=N distances are smaller than usual, the Ti---N distances are very short, and the Ti---N---C angle differs only a little from 180°, which infers a heteroallene structure of the complex. |