Abstract: | The title complex, Ni(C8H8N2S2)(C4H4O5)(H2O)?·?3H2O, was synthesized and its crystal structure determined by X-ray diffraction methods. Two crystallographically independent complex molecules are present in the asymmetric unit. They have similar octahedral coordination geometries, formed by a bidentate dimethylbithiazole (dMbt), a tridentate oxydiacetate dianion (ODA) and a coordinated water molecule. The tridentate ODA ligand displays an unusual facial configuration. A partially overlapped arrangement of nearly parallel dMbt ligands of neighbouring molecules is observed in the crystal, the shortest centroid distance of 3.555(3)?Å between thiazole rings suggesting the existence of aromatic π–π stacking. |