Exploring the effect of metal ions and counteranions on the structure and magnetic properties of five dodecanuclear Co(II) and Ni(II) clusters

We present the synthesis, characterization of the structures, and magnetic properties of five isostructural dodecanuclear coordination clusters of Ni(II) and Co(II): Co(12)(bm)(12)(NO(3))(O(2)CMe)(6)(EtOH)(6)](NO(3))(5) (1), Ni(12)(bm)(12)(NO(3))(O(2)CMe)(6)(H(2)O)(3)(EtOH)(3)](NO(3))(5)·2H(2)O (2), mixed-metal composition (Ni/Co 1:1) Co(6)Ni(6)(bm)(12)(NO(3))(O(2)CMe)(6)(NO(3))(5) (3), and M(12)(bm)(12)(NO(3))(O(2)CMe)(6)(EtOH)(6)](ClO(4))(5) (M=Co (4), Ni (5)), in which Hbm=(1H-benzimidazol-2-yl)methanol. They consist of analogous structural cores that are constructed by three cubanes (M(4)O(4)) that surround the templating nitrate and bridging auxiliary acetate and the directing ligands bm. They have different magnetic behaviors. Whereas there is the absence of the out-of-phase ac susceptibility (χ') for the Ni(II)-based compounds 2 and 5, the Co(II)-containing compounds 1, 3, and 4 have prominent χ' signals that exhibit frequency dependence, which indicates slow magnetic relaxation behavior above 1.8 K. In particular, the larger perchlorate counterions in 4 further change the overall correlation interaction between clusters, thus leading to an enhanced blocking temperature for the less-symmetrical 4 (pseudo-C(3)) relative to 1 and 3 (true C(3)). Interestingly, electrospray ionization mass spectrometry (ESI-MS) indicates that the three dodecanuclear clusters of 1-3 retain their compositions in solution. The mixed-metal cluster cores of 3 are formed based on the nature of the interchangeability between metal centers in solution.