共查询到20条相似文献,搜索用时 117 毫秒
1.
Christophe Volkringer Thierry Loiseau Nathalie Guillou Gérard Férey Erik Elkaïm 《Solid State Sciences》2009,11(8):1507-1512
Three new isostructural MOF-type compounds (named MIL-122) have been obtained from the hydrothermal reaction at 210 °C for 24 h of the 1,4,5,8-naphthalenetetracarboxylic acid with aluminum, gallium or indium source in water. The structures of the compounds M2(OH)2[C14H4O8] (M = Al, Ga, In) have been solved ab initio from powder X-ray diffraction analysis using the synchrotron radiation (Soleil; station CRISTAL). The three-dimensional organic–inorganic framework exhibits infinite straight chains of metal-centered octahedra sharing trans corners linked to each other through the 1,4,5,8-naphthalenetetracarboxylate ligand. The cations Al, Ga or In, are coordinated by four oxygen atoms coming from the carboxyl groups and two bridging hydroxyl groups μ2-OH, located in trans position in the octahedral surrounding. The compounds characterized by thermogravimetric and thermodiffraction analyses are thermally stable up to 440, 460 and 380 °C, for Al, Ga and In, respectively. Crystal data: monoclinic cell; P21/c (n°14); for MIL-122 (Al): a = 9.5174(2), b = 10.0706(1), c = 6.6465(2) Å, β = 91.2614(5)°, V = 636.878(2) Å3, Z = 2; for MIL-122 (Ga): a = 9.6501(1), b = 10.0585(1), c = 6.75069(9) Å, β = 92.4786(9)°, V = 654.65(1) Å3, Z = 2; for MIL-122 (In): a = 9.92359(5), b = 10.19765(7), c = 7.19357(4) Å, β = 727.034(8)°, V = 727.034(8)Å3, Z = 2. 相似文献
2.
《Solid State Sciences》2007,9(2):131-136
The new rare-earth dicarboxylate solid Eu2(H2O)4{C6H10–(CO2)2}3·2H2O or MIL-94 has been isolated under hydrothermal conditions. Its layered structure, which was solved using X-ray powder diffraction data, is built up from dimers of nine-coordinated edge-sharing polyhedra linked through 1,3-cyclohexane dicarboxylate (1,3-CHC) moieties. A comparative study of MIL-94 and the layered lanthanide dicarboxylate EuBDC or Eu2(H2O)2{C6H4–(CO2)2}3, which is built up from dimers of corner-sharing polyhedra and 1,3-benzenedicarboxylate (1,3-BDC) linkers, is also reported. Crystal data for MIL-94: orthorhombic space group Pnma (no. 62) with a = 8.8470(1) Å, b = 25.0148(1) Å, c = 14.3716(4) Å and Z = 4. MIL stands for Material Institut Lavoisier. 相似文献
3.
Synthesis,structure and solid state NMR analysis of a new templated titanium(III/IV) fluorophosphate
Christian Serre Mohamed Haouas Françis Taulelle Wouter Van Beek Gérard Férey 《Comptes Rendus Chimie》2010,13(3):336-342
The title compound MIL-131 (MIL stands for Material from Institut Lavoisier) was prepared hydrothermally (4 days, 473 K, autogenous pressure) in the presence of an organic base (N((CH2)2NH2)3). The structure of MIL-131 or TiIIITiIV(OH)F4(HPO4)·(PO4)·(N((CH2)2NH3)3) has been determined ab initio from X-Ray synchrotron powder diffraction data using simulated annealing methods and was refined in the triclinic space group P-1 (no. 2). MIL-131 exhibits a one-dimensional structure built up from inorganic chains of corner sharing TiO5(OH) titanium(III) octahedra and PO4 and HPO4 phosphate tetrahedra, related to TiO2F4 titanium octahedra. Protonated triamine cations are located between the inorganic motifs, and interact strongly with the mineral network through hydrogen bondings both with terminal fluorine atoms and hydroxo or oxo groups. Multinuclear solid state NMR has allowed a clear attribution of the protons, fluoride, and phosphate groups environment within the framework of MIL-131. The large values of chemical shift anisotropy together with the absence of any 13C NMR response confirmed the presence of paramagnetic titanium(III) species deduced from the crystal structure. Finally, 2D MAS 1H-31P CP-HETCOR NMR correlation experiment gives some insight on the nature of the intra-framework hydrogen bonding.Crystal data for MIL-131: a = 14.109(1) Å, b = 8.462(3) Å, c = 7.179(1) Å, α = 93.772(1)°, β = 96.566(2)°, γ = 98.004(1)°, V = 840.36(2) Å3, z = 2. 相似文献
4.
The structures of tin(II)-oxalate, tin(IV)Na–EDTA and tin(IV)Na8-inositol hexaphosphate were investigated using XRD analysis. Samples were identified using the Mössbauer study, thermal analysis and FTIR spectrometry. The Mössbauer study determined two different oxidation states of tin atoms, and consequently two different tin surroundings in the end products. The tin oxalate was found to be orthorhombic with space group Pnma, a=9.2066(3) Å, b=9.7590(1) Å, c=13.1848(5) Å, V=1184.62 Å3 and Z=8. SnNa–EDTA was found to be monoclinic with space group P21/c1, a=10.7544(3) Å, b=10.1455(3) Å, c=16.5130(6) Å, β=98.59(2)°, V=1781.50(4) Å3 and Z=4. Sn(C6H6Na8O24P6) was found to be amorphous. 相似文献
5.
《Journal of solid state chemistry》2004,177(4-5):1352-1358
Two fumarato-bridged Co(II) coordination polymers Co(H2O)4L 1 and [Co3(H2O)4(OH)2L2]·2H2O 2 with H2LHOOCCH CHCOOH were prepared. Complex 1 consists of polymeric chains ∞1[Co(H2O)4(C4H2O4)2/2], which result from octahedrally coordinated Co atoms bridged by bis-monodentate fumarate anions and are assembled by interchain hydrogen bonds. Within 2, the edge-shared Co2O10 bi-octahedra are connected to the CoO6 octahedra to form 1D cobalt oxide chains and 3D open framework generated from the chains inter-linked by bis-bidentate fumarate anions displays rhombic tunnels, which are filled with the lattice H2O molecules. Thermal and magnetic behaviors of both the title coordination polymers are discussed. Crystal data: (1) monoclinic, P21/c, Z=4, a=7.493(1) Å, b=14.377(1) Å, c=7.708(1) Å, β=99.54(1)°, V=818.9(2) Å3, R1=0.0304, and wR2=0.0669 for 1487 observed reflections (I⩾2σ(I)) out of 1877 unique reflections; (2) monoclinic, P21/c, Z=2, a=6.618(1) Å, b=8.172(2) Å, c=15.578(3) Å, β=96.30(3)°, V=837.4(3) Å3, R1=0.0360 and wR2=0.0663 for 1442 observed reflections (I⩾2σ(I)) out of 1927 unique reflections. 相似文献
6.
《Solid State Sciences》2007,9(6):531-534
The most condensed crystalline fluoride that appears in the Al(OH)3-tren-HFaq.-ethanol system at 190 °C is found to be [H4tren]3/2·(Al6F24)·3H2O. The structure is monoclinic, P21/c, with a = 21.939(1) Å, b = 6.7180(2) Å, c = 23.329(1) Å, β = 111.324(2)°. ∞(Al6F24) chains result from the connection of (Al7F30)9− polyanions by opposite AlF6 octahedra. Hydrogen bonds are established between the ∞(Al6F24) chains and ordered or disordered [H4tren]4+ cations and water molecules. 相似文献
7.
《Solid State Sciences》2007,9(11):1012-1019
Two novel inorganic–organic hybrid compounds composed of Keggin tungstocobaltate framework and cobalt(II)–N coordination complexes, K[Co(phen)2(H2O)]2[HCoW12O40]·2H2O (1) (phen = 1,10-phenanthroline) and [Co(2,2′-bipy)3]1.5{[Co(2,2′-bipy)2(H2O)][HCoW12O40]·0.5H2O (2) (bipy = bipyridine), have been synthesized under hydrothermal conditions by directly using Keggin POMs as starting materials, which were characterized by elemental analyses, IR, TG analyses and X-ray single crystal diffraction. Crystal data for compound 1: C48H41Co3KN8O44W12, triclinic, space group P-1, a = 10.918(5) Å, b = 13.401(5) Å, c = 13.693(5) Å, α = 69.291(5)°, β = 71.568(5)°, γ = 78.421(5)°, V = 1768.9(12) Å3, Z = 1; for compound 2: C130H104Co7N26O83W24, orthorhombic, space group, C2/c, a = 46.839(9) Å, b = 14.347(3) Å, c = 26.147(5) Å, α = β = γ = 90°, V = 17,570(6) Å3, Z = 4. Compound 1 exhibits a pseudo-1D chainlike structure, in which potassium ions act as linkages of Keggin unit doubly grafted by [Co(phen)2(H2O)] complex. Compound 2 represents a [Co(2,2′-bipy)2(H2O)]2+ mono-grafted Keggin tungstocobaltate derivative with 1.5[Co(2,2′-bipy)3]2+ countercations. The cyclic voltammetric behavior of 1-CPE is similar to the parent 3-CPE, but the cyclic voltammetric behavior of CoII shows a little difference. Variable-temperature magnetic susceptibility measurement of compound 1 demonstrates the presence of antiferromagnetic interactions. 相似文献
8.
《Solid State Sciences》2007,9(3-4):322-328
Electrochemical measurements demonstrate that magnesium surfaces can be protected by alkyl carboxylate. In a nearly neutral pH solution of sodium decanoate, the reduced corrosion rate and a passivation behaviour are attributed to the formation of Mg(C10H19O2)2(H2O)3 (Mg(C10)2) at the magnesium surface whereas heptanoate Mg(C7H13O2)2(H2O)3 (Mg(C7)2) is not efficient in such media. The crystal structures of the two metal carboxylates Mg(C7)2 and Mg(C10)2 are determined by X-ray diffraction. Single crystal data: Mg(C7)2, P21/a, a = 9.130(5) Å, b = 8.152(5) Å, c = 24.195(5) Å, β = 91.476(5)°, V = 1800.3(15) Å3, Dx = 1.242 g cm−3, Z = 4. Synchrotron powder data: Mg(C10)2, P21/a, a = 9.070(3) Å, b = 8.165(1) Å, c = 32.124(1) Å, β = 98.39(1)°, V = 2353.85(8) Å3, Dx = 1.188 g cm−3, Z = 4. Their layered structures are quite similar and differ mainly by the length of the hydrophobic chains. They consist of two planes of O-octahedra centred by Mg atoms, parallel to (001). The distorted octahedra are constituted by three oxygen atoms from carboxylate groups and by three oxygen atoms coming from water molecules. The layers are connected by hydrogen bonds. The carboxylate chains are located perpendicularly and on both sides of these planes. One carboxylate chain is bridging the Mg atom along [010] while the other is monodendate. The presence of structural water is confirmed by thermal analyses. 相似文献
9.
《Solid State Sciences》2007,9(8):686-692
Hydrothermal reactions of 2-quinolinephosphonic acid (1) and CuSO4 or CdSO4 result in two new compounds with formula Cu(2-C9H6NPO3) (2) and Cd(2-C9H6NPO3)(H2O) (3). Compound 2 has a layer structure in which dimers of edge-sharing {CuO4N} square-pyramids are linked by {CPO3} tetrahedra through corner sharing. Compound 3 shows a new type of layer structure where chains of corner sharing {CdO5N} octahedra are connected by {CPO3} tetrahedra into an inorganic layer. The quinoline groups fill in the inter-layer spaces in both cases. Crystal data for 1: monoclinic, space group P21/c, a = 10.270(2) Å, b = 13.566(3) Å, c = 6.9818(16) Å, β = 101.916(4)°, V = 951.8(4) Å3, Z = 4. For 2: monoclinic, space group P21/c, a = 13.976(3) Å, b = 7.9398(18) Å, c = 7.8687(18) Å, β = 101.150(5)°, V = 856.7(3) Å3, Z = 4. For 3: monoclinic, space group P21/c, a = 17.164(4) Å, b = 5.4870(12) Å, c = 10.850(2) Å, β = 101.557(4)°, V = 1001.1(4) Å3, Z = 4. The magnetic measurement on 2 reveals a dominant antiferromagnetic exchange coupling between the Cu(II) centers. A quasi-reversible electrochemical reaction is observed for complex 2 immobilized on the surface of GC electrode, corresponding to the redox couple Cu2+/Cu+. The fluorescent properties of 1–3 are also investigated. 相似文献
10.
《Solid State Sciences》2007,9(6):455-458
The calcium trimellitate, Ca(H2O)[(O2C)2–C6H3–CO2H], was hydrothermally synthesized from a mixture of calcium hydroxide, 1,2,4-benzenetricarboxylic (or trimellitic) acid and water at 180 °C for 24 h (under autogenous pressure). Its crystal structure has been determined by single-crystal X-ray diffraction analysis using synchrotron radiation (station 9.8, SRS Daresbury, UK). It consists of infinite chains of calcium bicapped trigonal prismatic polyhedra connected to each other through the 1,2,4-benzenetricarboxylate ligand. The eight-fold coordinated calcium cation is bonded to one terminal water molecule, two carboxylate groups with a chelating conformation and three carboxylate groups in a monodentating mode. One of the monodentate carboxylate is terminal with the occurrence of protonated C–OH bonding.Triclinic space group P-1 with a = 6.9073(4) Å, b = 6.9917(4) Å, c = 10.3561(6) Å, α = 87.178(1)°, β = 83.233(1)°, γ = 69.576(1)°, V = 465.41(5) Å3. 相似文献
11.
Xianzhu Xu Peng Wang Rong Hao Meina Gan Fuxing Sun Guang-shan Zhu 《Solid State Sciences》2009,11(1):68-71
A novel zinc diphosphonate, Zn[HO3PCH2(C6H4)CH2PO3H] (1) was synthesized from tetraethyl para-xylylenediphosphonate, Et2O3PCH2C6H4CH2PO3Et2, and Zn (AcO)2·2H2O under solvothermal conditions. The structure of compound 1 was determined by single-crystal X-ray diffraction, which reveals that the structure crystallizes in the monoclinic space group C2/c (No. 15), with a = 22.4844(19) Å, b = 6.4361(5) Å, c = 8.1194(7) Å, β = 102.595(2)°, V = 1146.70(16) Å3, T = 298(2) K, Z = 8. The novel three-dimensional (3D) construction is simply built up from linear inorganic chains of corner-sharing four-rings of tetrahedral [ZnO4] and [PO3C] which connected adjacent chains by the organophosphorus ligand para-xylylenediphosphonate. The framework has 10 Å × 4 Å (containing the van der Waals radii of atoms) channels running along the b-axis. 相似文献
12.
Anne Guesdon Francesca Romero Sarria Christophe Tenailleau Bernard Raveau 《Solid State Sciences》2009,11(2):349-357
A new indium hydroxyphosphate containing silver, AgIn[PO3(OH)]2, has been synthesized using hydrothermal method. It crystallizes in the P21/c space group with the cell parameters a = 6.6400(2) Å, b = 14.6269(6) Å, c = 6.6616(4) Å, β = 95.681(5)°, V = 643.82(6) Å3, Z = 4. Its three-dimensional framework, built up of corner-sharing PO3(OH) tetrahedra and InO6 octahedra, presents intersecting tunnels running along <111> and [100] directions, in which the Ag+ cations are located. The presence of hydroxyl groups has been confirmed from IR spectroscopy studies and hydrogen atoms were located from the single crystal X-ray diffraction study. The structural relationships with the other compounds of general formula AIMIII[PO3(OH)]2 are analyzed. 相似文献
13.
Ce(H2O)(PO4)3/2(H3O)1/2(H2O)1/2, a second entry in the structural chemistry of cerium(IV) phosphates
《Solid State Sciences》2007,9(8):672-677
A cerium(IV) phosphate has been prepared using precipitation methods and its structure has been solved by single crystal X-ray diffraction (R1 = 0.0292 for 3092 reflections with I>2σ(I) and wR2 = 0.0540). Ce(H2O)(PO4)3/2(H3O)1/2(H2O)1/2 crystallises in the monoclinic space group C2/c (a = 15.7058(17) Å, b = 9.6261(9) Å, c = 10.1632(4) Å, ß = 121.623(7)°, and V = 1308.4 (2) Å3). Its structure is based on a negatively charged 3D framework, made of cerium atoms connected by PO4 tetrahedra. There are two types of PO4 units; one shares only corners with the cerium coordination polyhedra while the other one shares edges and corners. This structure also includes hydronium cations, to balance the framework charge, and water molecules. One special feature of this 3D framework is the formation of interconnected tunnels which extend along the c axis and contain the hydronium cations and the water molecules. This open framework and the presence of cationic species in the tunnels are in perfect agreement with the previously reported ion exchange properties. 相似文献
14.
The solubilities in the three-component systems MIO3–Be(IO3)2–H2O (M = K, NH4+, Rb, Cs) were studied at 25 °C by the method of isothermal decrease of supersaturation. It has been established that double salts, K2Be(IO3)4·2H2O, (NH4)2Be(IO3)4·2H2O, and Rb2Be(IO3)4·2H2O, crystallize from the ternary solutions within wide concentration ranges. Both the X-ray powder diffraction and the spectroscopic studies (infrared and Raman) reveal that the title compounds are isostructural. They crystallize in the monoclinic space group P2/m with lattice parameters: K2Be(IO3)4·2H2O – a = 14.218(5) Å, b = 6.747(2) Å, c = 5.765(2) Å, β = 98.74(4)°, V = 546.6(2) Å3; (NH4)2Be(IO3)4·2H2O – a = 14.414(4) Å, b = 6.838(2) Å, c = 5.947(2) Å, β = 99.52(4)°, V = 578.0(2) Å3; Rb2Be(IO3)4·2H2O – a = 14.423(4) Å, b = 6.867(2) Å, c = 5.743(3) Å, β = 98.15(3)°, V = 562.9(3) Å3.Infrared spectroscopic experiments show that comparatively strong hydrogen bonds are formed in the potassium and rubidium salts as deduced from the wavenumbers of νOD of matrix-isolated HDO molecules (isotopically dilute samples) owing to the strong Be–OH2 interactions (synergetic effect). However, the IO3− ions in the ammonium compound are involved in hydrogen bonds with NH4+ ions additionally to those with water molecules and as a result of these intermolecular interactions the proton acceptor strength of the iodate ions decreases (anti-cooperative effect), thus leading to the formation of weaker hydrogen bonds in this compound (bonds of moderate strength) as compared to those formed in the potassium and rubidium ones. The normal vibrations of other entities (IO3− ions and BeO4 tetrahedra (skeleton vibrations)) are also discussed. 相似文献
15.
《Solid State Sciences》2007,9(1):16-20
A new molybdenum complex (C4H12N2)2[(MoV2O4)(MoVIO4)(C2O4)2]·2H2O, was solvothermally synthesized and characterized by single-crystal X-ray diffraction. The structure of the compound consists of oxalate acid-coordinated mixed-valent [MoV2O4][MoVIO4] helical chains and protonated piperazine cations. The helical chains are built up from the [MoV2O4] units and [MoVIO4] tetrahedral. The central axis about helical chain is a 2-fold screw axis. The compound crystallizes in the space group P21/n of monoclinic system with a = 11.396(2) Å, b = 14.107(3) Å, c = 15.805(3) Å, β = 102.09(3)°, V = 2484.6(9) Å3, Z = 4. Other characterizations by elemental analysis, IR, and thermal analysis for this compound are also given. 相似文献
16.
F.Y. Bai X.T. Li G.S. Zhu Y.H. Xing 《Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy》2010,75(5):1388-1393
A new complex of oxovanadium(IV), V2O2[(HB(pz)3)2(pyrro)2 (1) and a dimer-dithio carboxyl compound (C5H8NS2)2 (2) have been synthesized by the reaction of VOSO4·nH2O with NaHB(pz)3 and pyrrolidine dithio carboxylic acid ammonium salt. They were characterized by element analysis, IR spectra, UV–vis spectra and X-ray diffraction. Structural analyses of 1 and 2 gave the following parameters: 1, triclinic, P-1, a = 7.732(4) Å, b = 14.285(8) Å, c = 17.802(9) Å, α = 101.314(8)°, β = 92.682(9)°, γ = 92.228(9)°, V = 1923.6(18) Å3, and Z = 4; 2, monoclinic, C2/c, a = 13.857(2) Å, b = 10.4213(18) Å, c = 9.436(2) Å, β = 97.099(2), V = 1352.1(4) Å3, and Z = 4. In complex 1, vanadium atom adopts a distorted tetragonal bipyramid structure, which is typical for oxovanadium(IV) complexes. Compound 2 is a dimer-dithio carboxyl compound with S–S bond. In addition, thermal analysis was performed for analyzing the stabilization of the complexes. 相似文献
17.
《Polyhedron》2005,24(16-17):2215-2221
The reaction of MnX2 · 4H2O (X = Cl or Br) with 2,6-bis(hydroxymethyl)-4-methylphenol (H3L) and NaOH in methanol solution yielded two tetranuclear manganese complexes, [Mn4(HL)4(MeOH)4Cl2] (1) and [Mn4(HL)4(MeOH)4Br2] (2). Both compounds crystallize in the monoclinic space group C2/c with cell parameters: a = 26.0945(19) Å, b = 11.4999(8) Å, c = 21.2188(16) Å, β = 121.050(1)° and z = 4 for 1 · 2Et2O; a = 25.8145(3) Å, b = 11.6734(2) Å, c = 21.3956(3) Å, β = 120.1277(6)° and z = 4 for 2 · 2Et2O. Both complexes consist of a mixed-valence dicubane structure, which comprises two MnII and two MnIII ions. Magnetic susceptibilities and magnetization of complexes 1 and 2 in the solid state indicate that two clusters have an S = 9 ground state. Frequency-dependent out-of-phase signals of alternating current magnetic susceptibilities were observed in the low temperature range (<3 K) for both complexes indicating a slow magnetic relaxation. 相似文献
18.
《Journal of solid state chemistry》2004,177(4-5):1297-1301
Compound Cu2(H2O)2{O3PCH2N(C2H4)2NCH2PO3} (1) has a pillared layered structure in which the organic groups of N,N′-piperazinebis(methylenephosphonate) are sandwiched between the inorganic layers. Compared with other copper phosphonates with layered or pillared layered structures, the inorganic layer in 1 is unique in that each {CPO3} tetrahedron is corner-shared with three {CuO4N} square pyramids through three oxygen donors. Ferromagnetic interactions are mediated between the metal centers. Crystal data: Pbca, a=10.0830(16) Å, b=9.4517(15) Å, c=13.218(2) Å, V=1259.7(3) Å3, Z=4. 相似文献
19.
20.
S. Kaoua P. Gravereau J.P. Chaminade S. Pechev S. Krimi A. El Jazouli 《Solid State Sciences》2009,11(3):628-634
We have extended our research interest on titanium oxyphosphates (MII(TiO)2(PO4)2, with MII = Mg, Fe, Co, Ni, Cu, Zn) to vanadium oxyphosphates MII(VIVO)2(PO4)2 (MII = Co, Ni). For each compound two phases, named α and β according to synthesis conditions, have been stabilized at room temperature, then characterized. The four crystal structures M(VO)2(PO4)2 (α and β for M = Co, Ni) have been determined in monoclinic P21/c space group using X-ray single crystals diffraction data. Structure of the α phase is derived from the Li(TiO)(PO4) (orthorhombic Pnma) and LiNi0.50(TiO)2(PO4)2 (monoclinic P21/c) types, with cell parameters: a = 6.310(1) Å, b = 7.273(1) Å, c = 7.432(1) Å, β = 90.43(1)° for M = Co, and a = 6.297(2) Å, b = 7.230(2) Å, c = 7.421(2) Å, β = 90.36(2)° for M = Ni. Structure of the β phase is derived from the Ni(TiO)2(PO4)2-type (monoclinic P21/c) with cell parameters: a = 7.2742(2) Å, b = 7.2802(2) Å, c = 7.4550(2) Å, β = 120.171(2)° for M = Co, and a = 7.2691(2) Å, b = 7.2366(2) Å, c = 7.4453(2) Å, β = 120.231(2)° for M = Ni. All these structures consist of a three dimensional (3D) framework built up of infinite chains of tilted corner-sharing [VO6] octahedra, cross-linked by corner-sharing [PO4] tetrahedra. The M2+ ion (M = Co, Ni) is located in a triangular based antiprism which shares faces with two [VO6] octahedra. Structural filiation is discussed based on a common structural unit, a sheet where divalent cations M2+ (M = Co, Ni) are inserted. A thermal study of the α ? β transition is also presented. 相似文献