共查询到20条相似文献,搜索用时 31 毫秒
1.
《Solid State Sciences》2007,9(11):1012-1019
Two novel inorganic–organic hybrid compounds composed of Keggin tungstocobaltate framework and cobalt(II)–N coordination complexes, K[Co(phen)2(H2O)]2[HCoW12O40]·2H2O (1) (phen = 1,10-phenanthroline) and [Co(2,2′-bipy)3]1.5{[Co(2,2′-bipy)2(H2O)][HCoW12O40]·0.5H2O (2) (bipy = bipyridine), have been synthesized under hydrothermal conditions by directly using Keggin POMs as starting materials, which were characterized by elemental analyses, IR, TG analyses and X-ray single crystal diffraction. Crystal data for compound 1: C48H41Co3KN8O44W12, triclinic, space group P-1, a = 10.918(5) Å, b = 13.401(5) Å, c = 13.693(5) Å, α = 69.291(5)°, β = 71.568(5)°, γ = 78.421(5)°, V = 1768.9(12) Å3, Z = 1; for compound 2: C130H104Co7N26O83W24, orthorhombic, space group, C2/c, a = 46.839(9) Å, b = 14.347(3) Å, c = 26.147(5) Å, α = β = γ = 90°, V = 17,570(6) Å3, Z = 4. Compound 1 exhibits a pseudo-1D chainlike structure, in which potassium ions act as linkages of Keggin unit doubly grafted by [Co(phen)2(H2O)] complex. Compound 2 represents a [Co(2,2′-bipy)2(H2O)]2+ mono-grafted Keggin tungstocobaltate derivative with 1.5[Co(2,2′-bipy)3]2+ countercations. The cyclic voltammetric behavior of 1-CPE is similar to the parent 3-CPE, but the cyclic voltammetric behavior of CoII shows a little difference. Variable-temperature magnetic susceptibility measurement of compound 1 demonstrates the presence of antiferromagnetic interactions. 相似文献
2.
Two manganese coordination polymers, [Mn2(ip)2(dmf)]·dmf (1) and [Mn4(ip)4(dmf)6]·2dmf (2) (ip=isophthalate; dmf=N,N-dimethylformamide), have been synthesized and characterized. X-ray crystal structural data reveal that compound 1 crystallizes in triclinic space group P?1, a=9.716(3) Å, b=12.193(3) Å, c=12.576(3) Å, α=62.19(2)°, β=66.423(17)°, γ=72.72(2)°, Z=2, while compound 2 crystallizes in monoclinic space group Cc, a=19.80(3) Å, b=20.20(2) Å, c=18.01(3) Å, β=108.40(4)°, Z=4. Variable-temperature magnetic susceptibilities of compounds 1 and 2 exhibit overall weak antiferromagnetic coupling between the adjacent Mn(II) ions. 相似文献
3.
Hüseyin Ünver Zeliha Hayvali 《Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy》2010,75(2):782-788
Two new nickel(II) [Ni(L)2] and copper(II) [Cu(L)2] complexes have been synthesized with bidentate NO donor Schiff base ligand (2-{(Z)-[furan-2-ylmethyl]imino]methyl}-6-methoxyphenol) (HL) and both complexes Ni(L)2 and Cu(L)2 have been characterized by elemental analyses, IR, UV–vis, 1H, 13C NMR, mass spectroscopy and room temperature magnetic susceptibility measurement. The tautomeric equilibria (phenol-imine, O–H?N and keto-amine, O?H–N forms) have been systemetically studied by using UV–vis absorption spectra for the ligand HL. The UV–vis spectra of this ligand HL were recorded and commented in polar, non-polar, acidic and basic media. The crystal structures of these complexes have also been determined by using X-ray crystallographic techniques. The complexes Ni(L)2 and Cu(L)2 crystallize in the monoclinic space group P21/n and P21/c with unit cell parameters: a = 10.4552(3) Å and 12.1667(4) Å, b = 8.0121(3) Å and 10.4792(3) Å, c = 13.9625(4) Å and 129.6616(3)Å, V = 1155.22(6) Å3 and 1155.22(6) Å3, Dx = 1.493 and 1.476 g cm?3 and Z = 2 and 2, respectively. The crystal structures were solved by direct methods and refined by full-matrix least squares to a find R = 0.0377 and 0.0336 of for 2340 and 2402 observed reflections, respectively. 相似文献
4.
F.Y. Bai X.T. Li G.S. Zhu Y.H. Xing 《Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy》2010,75(5):1388-1393
A new complex of oxovanadium(IV), V2O2[(HB(pz)3)2(pyrro)2 (1) and a dimer-dithio carboxyl compound (C5H8NS2)2 (2) have been synthesized by the reaction of VOSO4·nH2O with NaHB(pz)3 and pyrrolidine dithio carboxylic acid ammonium salt. They were characterized by element analysis, IR spectra, UV–vis spectra and X-ray diffraction. Structural analyses of 1 and 2 gave the following parameters: 1, triclinic, P-1, a = 7.732(4) Å, b = 14.285(8) Å, c = 17.802(9) Å, α = 101.314(8)°, β = 92.682(9)°, γ = 92.228(9)°, V = 1923.6(18) Å3, and Z = 4; 2, monoclinic, C2/c, a = 13.857(2) Å, b = 10.4213(18) Å, c = 9.436(2) Å, β = 97.099(2), V = 1352.1(4) Å3, and Z = 4. In complex 1, vanadium atom adopts a distorted tetragonal bipyramid structure, which is typical for oxovanadium(IV) complexes. Compound 2 is a dimer-dithio carboxyl compound with S–S bond. In addition, thermal analysis was performed for analyzing the stabilization of the complexes. 相似文献
5.
Jorge Pasán Joaquín Sanchiz Laura Cañadillas-Delgado Oscar Fabelo Mariadel Déniz Francesc Lloret Miguel Julve Catalina Ruiz-Pérez 《Polyhedron》2009,28(9-10):1802-1807
Two new methylmalonate-bridged copper(II) complexes with the formulas [Cu(3-Ipy)(Memal)(H2O)] (1) and [Cu(2,4′-bpy)(Memal)(H2O)] · 3H2O (2) [Memal = methylmalonate dianion, 3-Ipy = 3-iodopyridine, 2,4′-bpy = 2,4′-bipyridine] have been synthesized and characterized by X-ray diffraction. Both compounds crystallize in the monoclinic space group P21/n and Z = 4, with unit cell parameters a = 8.5874(13) Å, b = 7.1738(14) Å, c = 19.093(5) Å, β = 99.509(15)° in 1 and a = 17.375(4) Å, b = 7.3305(14) Å, c = 14.247(3) Å, β = 111.409(15)° in 2. The structures of 1 and 2 consist of zigzag chains of anti-syn carboxylate-bridged copper(II) ions running along the b direction. The pyridine-like ligands occupy one equatorial position of the copper environment avoiding the formation of the sheet-like arrangement observed in previously reported Memal complexes. The chains are grouped together in hydrophilic layers through hydrogen bonds and the layers are pillared through the 3-Ipy (1) and 2,4′-bpy (2) ligands which are stacked through π–π interactions involving alternatively aromatic ligands from two adjacent chains. Magnetic susceptibility measurements of both compounds in the temperature range 2–290 K show the occurrence of intrachain ferromagnetic interactions between the copper(II) ions [J = +2.66(2) cm?1 (1) and J = +2.62(2) cm?1 (2)]. 相似文献
6.
Anne Carton Adel Mesbah Lionel Aranda Pierre Rabu Michel François 《Solid State Sciences》2009,11(4):818-823
The metastable phase (phase 1) Zn(OH)2(tp)2 (tp = C8H4O42?) was found to be an intermediate forming during the hydrothermal synthesis of Zn3(OH)4tp (phase 2). Its structure has been determined ab initio from synchrotron powder diffraction data and refined with the Rietveld method: space group P21/c, a = 3.48856(2) Å, b = 5.84645(2) Å, c = 22.1331(1) Å, β = 103.46(1)°, Dx = 2.488 g/cm3, Rp = 0.10, RB = 0.095 (402 independent reflections). The structures of the two analogues were compared. Whereas a mixed coordination of the zinc atoms was found in phase 2, phase 1 exhibits only penta-coordinated Zn(II). Moreover, different optical properties were observed, Zn2(OH)2(tp) showing photoluminescence at 378 nm under λex = 316 nm. 相似文献
7.
《Solid State Sciences》2007,9(8):686-692
Hydrothermal reactions of 2-quinolinephosphonic acid (1) and CuSO4 or CdSO4 result in two new compounds with formula Cu(2-C9H6NPO3) (2) and Cd(2-C9H6NPO3)(H2O) (3). Compound 2 has a layer structure in which dimers of edge-sharing {CuO4N} square-pyramids are linked by {CPO3} tetrahedra through corner sharing. Compound 3 shows a new type of layer structure where chains of corner sharing {CdO5N} octahedra are connected by {CPO3} tetrahedra into an inorganic layer. The quinoline groups fill in the inter-layer spaces in both cases. Crystal data for 1: monoclinic, space group P21/c, a = 10.270(2) Å, b = 13.566(3) Å, c = 6.9818(16) Å, β = 101.916(4)°, V = 951.8(4) Å3, Z = 4. For 2: monoclinic, space group P21/c, a = 13.976(3) Å, b = 7.9398(18) Å, c = 7.8687(18) Å, β = 101.150(5)°, V = 856.7(3) Å3, Z = 4. For 3: monoclinic, space group P21/c, a = 17.164(4) Å, b = 5.4870(12) Å, c = 10.850(2) Å, β = 101.557(4)°, V = 1001.1(4) Å3, Z = 4. The magnetic measurement on 2 reveals a dominant antiferromagnetic exchange coupling between the Cu(II) centers. A quasi-reversible electrochemical reaction is observed for complex 2 immobilized on the surface of GC electrode, corresponding to the redox couple Cu2+/Cu+. The fluorescent properties of 1–3 are also investigated. 相似文献
8.
The structures of tin(II)-oxalate, tin(IV)Na–EDTA and tin(IV)Na8-inositol hexaphosphate were investigated using XRD analysis. Samples were identified using the Mössbauer study, thermal analysis and FTIR spectrometry. The Mössbauer study determined two different oxidation states of tin atoms, and consequently two different tin surroundings in the end products. The tin oxalate was found to be orthorhombic with space group Pnma, a=9.2066(3) Å, b=9.7590(1) Å, c=13.1848(5) Å, V=1184.62 Å3 and Z=8. SnNa–EDTA was found to be monoclinic with space group P21/c1, a=10.7544(3) Å, b=10.1455(3) Å, c=16.5130(6) Å, β=98.59(2)°, V=1781.50(4) Å3 and Z=4. Sn(C6H6Na8O24P6) was found to be amorphous. 相似文献
9.
《Polyhedron》2005,24(6):723-729
The mixed ligand complex [La(hfa)3(Phen)2] (I) was obtained by the interaction of La(hfa)3 and Phen; its composition does not depend on the stoichiometry of the reagents. According to the X-ray single crystal analysis data, complex I crystallizes in the monoclinic space group P21/n, with a = 13.583(3) Å, b = 16.959(3) Å, c = 18.860(4) Å, β = 94.71(3)° and Z = 4. The structure of I consists of isolated mononuclear molecules, the coordination number of La being 10. Thermal behaviour and composition of the vapor phase have been studied for I by thermal analysis and mass-spectrometry using a Knudsen cell. The mixed ligand complex I was found to sublime congruently in the temperature range 370–460 K: [La(hfa)3(Phen)2](s) = [La(hfa)3(Phen)](g) + Phen(g), ΔrH0(T) = 316.2 ± 1.8 kJ/mol. 相似文献
10.
11.
《Journal of organometallic chemistry》2007,692(1-3):122-128
A photoresponsive rhodium dinuclear complex having phenyltetramethylcyclopentadienyl (CpPh = η5-C5Me4Ph) and photosensitive dithionite (μ-O2SSO2) ligands, [(CpPhRh)2(μ-CH2)2(μ-O2SSO2)] (1), has been synthesized. The crystal of complex 1 (monoclinic, C2/m (No. 12), a = 24.805(2) Å, b = 29.111(2) Å, c = 10.8475(11) Å, β = 105.9830(7)°, V = 7530.0(12) Å3, Z = 8) consists of two independent molecules, 1-cis and 1-trans, with different arrangement of the CpPh ligands. The flexibility, volume, and shape of the reaction cavities around the dithionite unit of 1-cis and 1-trans in the crystal are discussed. The crystal structures of the precursors of 1, trans-[(CpPhRh)2(μ-Cl)2Cl2] and trans-[(CpPhRh)2(μ-CH2)2Me2], are also reported. 相似文献
12.
《Polyhedron》2005,24(16-17):2215-2221
The reaction of MnX2 · 4H2O (X = Cl or Br) with 2,6-bis(hydroxymethyl)-4-methylphenol (H3L) and NaOH in methanol solution yielded two tetranuclear manganese complexes, [Mn4(HL)4(MeOH)4Cl2] (1) and [Mn4(HL)4(MeOH)4Br2] (2). Both compounds crystallize in the monoclinic space group C2/c with cell parameters: a = 26.0945(19) Å, b = 11.4999(8) Å, c = 21.2188(16) Å, β = 121.050(1)° and z = 4 for 1 · 2Et2O; a = 25.8145(3) Å, b = 11.6734(2) Å, c = 21.3956(3) Å, β = 120.1277(6)° and z = 4 for 2 · 2Et2O. Both complexes consist of a mixed-valence dicubane structure, which comprises two MnII and two MnIII ions. Magnetic susceptibilities and magnetization of complexes 1 and 2 in the solid state indicate that two clusters have an S = 9 ground state. Frequency-dependent out-of-phase signals of alternating current magnetic susceptibilities were observed in the low temperature range (<3 K) for both complexes indicating a slow magnetic relaxation. 相似文献
13.
Two new hybrid materials, (C4H14N2)[MII(H2O)6](SO4)2·4H2O (MII: Co (I), Ni (II)), have been synthesised by slow evaporation method at room temperature and crystallographically characterized. They crystallise isotypically in the monoclinic system, space group P21/n, with the following unit-cell parameters a = 9.2285(3), b = 11.3333(4), c = 10.6693(4) Å, β = 109.004(2)°, Z = 2 and V = 1055.07(6) Å3 for I and a = 9.2127(2), b = 11.3182(2), c = 10.6434(2) Å, β = 109.094(1)°, Z = 2 and V = 1048.74(4) Å3 for II. The structure of the two supramolecular compounds consists of metallic cation octahedrally coordinated to six water molecules, sulfate anions, 1,4-butanediammonium cation and water molecules linked together via two types of hydrogen bonds, O–H?O and N–H?O. The two compounds are not stable at room temperature and their partial dehydration depends on the humidity of the environment. The thermal decomposition of precursors, studied by thermogravimetric analysis (TG) and temperature-dependent X-ray diffraction (TDXD), shows successive intermediate hydrates and crystalline anhydrous compounds upon dehydration. 相似文献
14.
Ce(H2O)(PO4)3/2(H3O)1/2(H2O)1/2, a second entry in the structural chemistry of cerium(IV) phosphates
《Solid State Sciences》2007,9(8):672-677
A cerium(IV) phosphate has been prepared using precipitation methods and its structure has been solved by single crystal X-ray diffraction (R1 = 0.0292 for 3092 reflections with I>2σ(I) and wR2 = 0.0540). Ce(H2O)(PO4)3/2(H3O)1/2(H2O)1/2 crystallises in the monoclinic space group C2/c (a = 15.7058(17) Å, b = 9.6261(9) Å, c = 10.1632(4) Å, ß = 121.623(7)°, and V = 1308.4 (2) Å3). Its structure is based on a negatively charged 3D framework, made of cerium atoms connected by PO4 tetrahedra. There are two types of PO4 units; one shares only corners with the cerium coordination polyhedra while the other one shares edges and corners. This structure also includes hydronium cations, to balance the framework charge, and water molecules. One special feature of this 3D framework is the formation of interconnected tunnels which extend along the c axis and contain the hydronium cations and the water molecules. This open framework and the presence of cationic species in the tunnels are in perfect agreement with the previously reported ion exchange properties. 相似文献
15.
《Solid State Sciences》2007,9(2):137-143
Four new magnesium containing metal–organic hybrid compounds have been synthesized in an effort to prepare low-density materials for hydrogen storage. The compounds were prepared hydrothermally and characterized using single crystal X-ray diffraction. Three of these compounds are analogs of known transition metal structures with squarate (I, Pn-3n, a = 16.276(5) Å), diglycolate (II, P212121, a = 6.860(1) Å, b = 9.993(1) Å, c = 10.884(1) Å, R1 = 0.0341), and glutarate (III, R-3, a = 10.744(2) Å, c = 28.677(5) Å, R1 = 0.0554) ligands; the fourth is a novel structure using cyclobutanetetracarboxylate (IV, Pccn, a = 9.382(1) Å, b = 14.410(2) Å, c = 8.725(1) Å, R1 = 0.0465) which contains potassium as well as magnesium cations. 相似文献
16.
A new polyoxomolybdophosphate 1, formulated as [Cu(phen)2][Cu(phen)H2O]2[Mo5P2O23]·3.5H2O (phen = 1,10-phenanthroline) has been synthesized under hydrothermal conditions. Compound 1 crystallizes in the triclinic space group P-1 with a = 12.2429(5) Å, b = 14.3543(5) Å, c = 20.0814(8) Å, α = 80.023 (1)°, β = 74.283 (1)°, γ = 66.452(1)°, V = 3105.8(2) Å3, R1 = 0.0375, wR2 = 0.0885, Z = 2 and GOF = 1.009. Compound 1 is constructed from diphosphopentamolybdate clusters coordinated to Cu(II)-phen units, and free water molecules, which are connected to a three-dimensional framework via π–π stacking interactions from the phen ligands. The single-crystal X-ray diffraction, FT-IR, TG-DTA, XPS, EPR and fluorescent spectra for this compound were determined. The electrochemical properties of compound 1 are studied using cyclic voltammogram, the results indicated that the compound 1 shows good electrocatalytic activity to NO2?. 相似文献
17.
《Journal of solid state chemistry》2004,177(4-5):1352-1358
Two fumarato-bridged Co(II) coordination polymers Co(H2O)4L 1 and [Co3(H2O)4(OH)2L2]·2H2O 2 with H2LHOOCCH CHCOOH were prepared. Complex 1 consists of polymeric chains ∞1[Co(H2O)4(C4H2O4)2/2], which result from octahedrally coordinated Co atoms bridged by bis-monodentate fumarate anions and are assembled by interchain hydrogen bonds. Within 2, the edge-shared Co2O10 bi-octahedra are connected to the CoO6 octahedra to form 1D cobalt oxide chains and 3D open framework generated from the chains inter-linked by bis-bidentate fumarate anions displays rhombic tunnels, which are filled with the lattice H2O molecules. Thermal and magnetic behaviors of both the title coordination polymers are discussed. Crystal data: (1) monoclinic, P21/c, Z=4, a=7.493(1) Å, b=14.377(1) Å, c=7.708(1) Å, β=99.54(1)°, V=818.9(2) Å3, R1=0.0304, and wR2=0.0669 for 1487 observed reflections (I⩾2σ(I)) out of 1877 unique reflections; (2) monoclinic, P21/c, Z=2, a=6.618(1) Å, b=8.172(2) Å, c=15.578(3) Å, β=96.30(3)°, V=837.4(3) Å3, R1=0.0360 and wR2=0.0663 for 1442 observed reflections (I⩾2σ(I)) out of 1927 unique reflections. 相似文献
18.
《Solid State Sciences》2007,9(9):804-811
Hydrothermal combination of CuSO4, MoO3, and 4-phenylpyridine (4-phpyr) in a 1:4:4.5 ratio under basic conditions afforded purple crystals of {[Cu(4-phpyr)4]2(Mo8O26)·4-phpyr} (1), which were analyzed by spectroscopy and single crystal X-ray diffraction. The asymmetric octamolybdate clusters in 1 adopt an intermediate structural variant between the known α and δ isomeric forms, with four octahedral and three tetrahedral molybdenum coordination spheres, along with one molybdenum atom in a highly distorted square pyramidal environment. Paddle-wheel shaped [Cu(4-phpyr)4]2+ cations link adjacent {α/δ-Mo8O26}4− clusters into a 2-D layered rhomboid grid coordination polymer. Uncoordinated 4-phpyr molecules lie in incipient voids in the interlamellar regions. The structure of 1 illustrates the utility of sterically bulky coordination complexes in the stabilization of intermediate conformations during energetically facile polyoxometallate isomer interconversion. Crystallographic data: triclinic, P1, a = 13.717(3) Å, b = 13.728(3) Å, c = 14.809(3) Å, α = 109.251(4)°, β = 107.670(4)°, γ = 92.005(4)°, V = 2480.0(9) Å3, R1 = 0.0637, wR2 = 0.1054. 相似文献
19.
S. Kaoua P. Gravereau J.P. Chaminade S. Pechev S. Krimi A. El Jazouli 《Solid State Sciences》2009,11(3):628-634
We have extended our research interest on titanium oxyphosphates (MII(TiO)2(PO4)2, with MII = Mg, Fe, Co, Ni, Cu, Zn) to vanadium oxyphosphates MII(VIVO)2(PO4)2 (MII = Co, Ni). For each compound two phases, named α and β according to synthesis conditions, have been stabilized at room temperature, then characterized. The four crystal structures M(VO)2(PO4)2 (α and β for M = Co, Ni) have been determined in monoclinic P21/c space group using X-ray single crystals diffraction data. Structure of the α phase is derived from the Li(TiO)(PO4) (orthorhombic Pnma) and LiNi0.50(TiO)2(PO4)2 (monoclinic P21/c) types, with cell parameters: a = 6.310(1) Å, b = 7.273(1) Å, c = 7.432(1) Å, β = 90.43(1)° for M = Co, and a = 6.297(2) Å, b = 7.230(2) Å, c = 7.421(2) Å, β = 90.36(2)° for M = Ni. Structure of the β phase is derived from the Ni(TiO)2(PO4)2-type (monoclinic P21/c) with cell parameters: a = 7.2742(2) Å, b = 7.2802(2) Å, c = 7.4550(2) Å, β = 120.171(2)° for M = Co, and a = 7.2691(2) Å, b = 7.2366(2) Å, c = 7.4453(2) Å, β = 120.231(2)° for M = Ni. All these structures consist of a three dimensional (3D) framework built up of infinite chains of tilted corner-sharing [VO6] octahedra, cross-linked by corner-sharing [PO4] tetrahedra. The M2+ ion (M = Co, Ni) is located in a triangular based antiprism which shares faces with two [VO6] octahedra. Structural filiation is discussed based on a common structural unit, a sheet where divalent cations M2+ (M = Co, Ni) are inserted. A thermal study of the α ? β transition is also presented. 相似文献
20.
Masaki Kakeya Makoto Tanabe Yoshiyuki Nakamura Kohtaro Osakada 《Journal of organometallic chemistry》2009,694(14):2270-2278
Alkyl and arylplatinum complexes with 1,5-cyclooctadiene ligand, [PtR2(cod)] (R = Me, Ph, C6H4-p-CF3, C6F5), react with secondary phosphines, PHR′2 (R′ = i-Bu, t-Bu, Ph), to afford the mononuclear platinum complexes, cis-[PtR2(PHR′2)2] (1a: R = Me, R′ = i-Bu; 1b: R = Me, R′ = t-Bu; 1c: R = Me, R′ = Ph; 2a: R = Ph, R′ = i-Bu; 2b: R = Ph, R′ = t-Bu; 2c: R = R′ = Ph; 3a: R = C6H4-p-CF3, R′ = i-Bu; 3b: R = C6H4-p-CF3, R′ = t-Bu; 3c: R = C6H4-p-CF3, R′ = Ph; 4a: R = C6F5, R′ = i-Bu; 4c: R = C6F5, R′ = Ph) in 81–98% yields. Molecular structures of the complexes except for 1a, 1c and 2a were determined by X-ray crystallography. Complex 1b has a square-planar structure with Pt–C(methyl) bonds of 2.083(8) and 2.109(8) Å, while the Pt–C(aryl) bonds of 2b–c, 3a–c, 4a and 4c (2.055(1)–2.073(8) Å) are shorter than them. Thermal decomposition of 1b, 2a–c, and 3a–c releases methane, biphenyl or 4,4′-bis(trifluoromethyl)biphenyl as the organic products, which are characterized by NMR spectroscopy. The solid product of the thermal reactions of 2b and 2c were characterized as the metallopolymers formulated as [Pt(PR′2)2]n (5b: R′ = tBu; 5c: R′ = Ph), based on the solid-state NMR and elemental analyses. 相似文献