共查询到20条相似文献,搜索用时 15 毫秒
1.
S Kimura E Bill E Bothe T Weyhermüller K Wieghardt 《Journal of the American Chemical Society》2001,123(25):6025-6039
Three hexadentate, asymmetric pendent arm macrocycles containing a 1,4,7-triazacyclononane-1,4-diacetate backbone and a third, N-bound phenolate or thiophenolate arm have been synthesized. In [L(1)](3)(-) the third arm is 3,5-di-tert-butyl-2-hydroxybenzyl, in [L(2)](3)(-) it is 2-mercaptobenzyl, and in [L(3)](3)(-) it is 3,5-di-tert-butyl-2-mercaptobenzyl. With trivalent metal ions these ligands form very stable neutral mononuclear complexes [M(III)L(1)] (M = Ga, Fe, Co), [M(III)L(2)] (M = Ga, Fe, Co), and [M(III)L(3)] (M = Ga, Co) where the gallium and cobalt complexes possess an S = 0 and the iron complexes an S = (5)/(2) ground state. Complexes [CoL(1)].CH(3)OH.1.5H(2)O, [CoL(3)].1.17H(2)O, [FeL(1)].H(2)O, and [FeL(2)] have been characterized by X-ray crystallography. Cyclic voltammetry shows that all three [M(III)L(1)] complexes undergo a reversible, ligand-based, one-electron oxidation generating the monocations [M(III)L(1)(*)](+) which contain a coordinated phenoxyl radical as was unambiguously established by their electronic absorption, EPR, and M?ssbauer spectra. In contrast, [M(III)L(2)] complexes in CH(3)CN solution undergo an irreversible one-electron oxidation where the putative thiyl radical monocationic intermediates dimerize with S-S bond formation yielding dinuclear disulfide species [M(III)L(2)-L(2)M(III)](2+). [GaL(3)] behaves similarly despite the steric bulk of two tertiary butyl groups at the 3,5-positions of the thiophenolate, but [Co(III)L(3)] in CH(2)Cl(2) at -20 to -61 degrees C displays a reversible one-electron oxidation yielding a relatively stable monocation [Co(III)L(3)(*)](+). Its electronic spectrum displays intense transitions in the visible at 509 nm (epsilon = 2.6 x 10(3) M(-)(1) cm(-)(1)) and 670sh, 784 (1.03 x 10(3)) typical of a phenylthiyl radical. The EPR spectrum of this species at 90 K proves the thiyl radical to be coordinated to a diamagnetic cobalt(III) ion (g(iso) = 2.0226; A(iso)((59)Co) = 10.7 G). 相似文献
2.
García-Montalvo V Cea-Olivares R Williams DJ Espinosa-Pérez G 《Inorganic chemistry》1996,35(13):3948-3953
The tetraphenylimidodiphosphinate [N-(P,P-diphenylphosphinoyl)-P,P-diphenylphosphinimidate] ion forms stable tris-chelates with the Bi(III), In(III), and Ga(III) cations. The crystal and molecular structures of [M{(OPPh(2))(2)N}(3)] (M = Ga, In, Bi) were determined by X-ray diffractometry. The geometry around the bismuth atom in compound 3 displays an approximately C(3)(v)() symmetry. This arrangement suggests the presence of a stereoactive lone pair of electrons, which is located in one of the triangular octahedral faces. Derivative 3 crystallizes in the triclinic space group P&onemacr; with Z = 2, a = 14.006(6) ?, b = 14.185(4) ?, c = 17.609(8) ?, alpha = 88.45(2) degrees, beta = 79.34(2) degrees, and gamma = 78.23(2) degrees. The structures of the gallium(III) and indium(III) tris-chelate oxygen-based complexes (1 and 2, respectively) were compared with the bismuth analogue in order to determine the ligand steric bulk influence on the coordination sphere in the absence of the electron lone pair. Complex 1 crystallizes as the [Ga{(OPPh(2))(2)N}(3)].CH(2)Cl(2) solvate in the triclinic space group P&onemacr;; Z = 2, a = 13.534(4) ?, b = 13.855(4) ?, c = 18.732(7) ?, alpha = 95.48(2) degrees, beta = 98.26(2) degrees, and gamma = 97.84(2) degrees. Crystal data for the benzene solvate of 2, [In{(OPPh(2))(2)N}(3)].C(6)H(6): triclinic space group P&onemacr;, Z = 2, a = 13.542(9) ?, b = 15.622(3) ?, c = 18.063(5) ?, alpha = 98.21(1) degrees, beta = 104.77(0) degrees, and gamma = 92.260(0) degrees. 相似文献
3.
Photolysis of a series of octahedral monoazido complexes of the type [LM(III)(didentate ligand)(N(3))](n)(+)X(n) of vanadium(III), chromium(III), and manganese(III) in the solid state or in solution yields quantitatively the corresponding six-coordinate nitrido complexes [LM(V)(didentate ligand)(N)](n)(+)X(n) and 1 equiv of dinitrogen. L represents the macrocycle 1,4,7-triazacyclononane or its N-methylated derivative (L'), the didentate ligands are pentane-2,4-dionate (acac), 2,2,6,6-tetramethylheptane-3,5-dionate (tacac), picolinate (pic), phenanthroline (phen), and oxalate (ox), and X(-) represents perchlorate or hexafluorophosphate. The following nitrido complexes were prepared: [LV(V)(N)(acac)](ClO(4)) (6), [LCr(V)(N)(acac)](ClO(4)) (13), [LCr(V)(N)(tacac)](ClO(4)) (14), [LCr(V)(N)(pic)](ClO(4)) (15), [LCr(V)(N)(phen)](ClO(4))(2) (16), [LCr(V)(N)(ox)] (19), [L'Mn(V)(N)(acac)]PF(6) (21). Photolysis of [LCr(III)(N(3))(ox)] (17) in the solid state produces the &mgr;-nitrido-bridged mixed-valent species [L(2)Cr(2)(ox)(2)(&mgr;-N)](N(3)) (18). The structures of the precursor complex [L'Mn(acac)(N(3))]BPh(4) (20), of 13, and of [L'Mn(V)(N)(acac)]BPh(4) (21) have been determined by X-ray crystallography. Complex 13 crystallizes in the orthorhombic space group Pnma, with cell constants a = 27.187(5) ?, b = 9.228(2) ?, c = 7.070(1) ?, V = 1773.7(6) ?(3), and Z = 4; complex 20 crystallizes in the triclinic space group P&onemacr; with a = 14.769(5) ?, b = 16.83(1) ?, c = 16.96(1) ?, alpha = 108.19(5) degrees, beta = 105.06(4) degrees, gamma = 99.78(4) degrees, V = 3719(2) ?(3), and Z = 4; and complex 21 crystallizes in the monoclinic space group P2(1)/n with a = 10.443(3) ?, b = 16.035(4) ?, c = 21.463(5) ?, beta = 95.76(1) degrees, V = 3575.9(14) ?(3), and Z = 4. The Cr(V)&tbd1;N and Mn(V)&tbd1;N distances are short at 1.575(9) and 1.518(4) ?, respectively, and indicate a metal-to-nitrogen triple bond. 相似文献
4.
Novel Fe(III)Fe(III) and Fe(II)Fe(III) complexes [Fe(2)(BBPMP)(&mgr;-OAc)(&mgr;-X)](n)() (1, X = OAc(-), n = 1+; 2, X = OH(-), n = 1+; 3, X = OAc(-), n = 0; 4, X = OH(-), n = 0), where BBPMP(3)(-) is the anion of 2,6-bis[(2-hydroxybenzyl)(2-pyridylmethyl)aminomethyl]-4-methylphenol, and OAc(-) is acetate, were prepared in order to provide models for the active site of purple acid phosphatases (PAPs). Complex 1 was obtained by the reaction of H(3)BBPMP with Fe(ClO(4))(2).6H(2)O in methanol and sodium acetate trihydrate under ambient conditions, while complex 3 was synthesized as described for 1, under an argon atmosphere with low levels of dioxygen. 2 was isolated from 1in acetonitrile by a substitution of the bridging acetate group by hydroxide, while 4 was generated in solution during a spectropotentiostatic experiment on 2, under argon. Complex 1, [Fe(III)(2)(BBPMP)(&mgr;-OAc)(2)]ClO(4).H(2)O, has been characterized by X-ray crystallography. Crystal data: monoclinic, space group P2(1)/n, a = 14.863(5) ?, b = 12.315(3) ?, c = 20.872(8) ?, beta = 90.83(3) degrees, Z = 4. IR, M?ssbauer, magnetic, electronic absorption, and electrochemical properties of 1-3 have been investigated, and some of these properties represent a contribution to the understanding of the dinuclear iron center of PAPs. Complexes 2, [Fe(III)(2)(BBPMP)(&mgr;-OAc)(&mgr;-OH)]ClO(4) (lambda(max) = 568 nm/epsilon = 4760 M(-)(1) cm(-)(1)), and 4 [Fe(II)Fe(III)(BBPMP)(&mgr;-OAc)(&mgr;-OH)] (lambda(max) = 516 nm/epsilon = 4560 M(-)(1) cm(-)(1)), constitute good synthetic analogues for the chromophoric site for the oxidized and reduced forms, respectively, of the enzyme. 相似文献
5.
Donzello MP Agostinetto R Ivanova SS Fujimori M Suzuki Y Yoshikawa H Shen J Awaga K Ercolani C Kadish KM Stuzhin PA 《Inorganic chemistry》2005,44(23):8539-8551
Monometallic derivatives of tetrakis(1,2,5-thiadiazole)porphyrazine, [TTDPzH2], with main group tervalent metal ions having the formulae [TTDPzMX] (TTDPz = tetrakis(1,2,5-thiadiazole)porphyrazinato dianion; M = Al(III), X = Cl-, Br-, OH-; M = Ga(III), X = Cl-, OH-; M = In(III), X = AcO-) were prepared and investigated by single-crystal X-ray analysis and IR and UV-vis spectroscopy as well as cyclic voltammetry and spectroelectrochemistry. The complexes [TTDPzMX] (M = Al(III), X = Cl-, Br-; M = Ga(III), X = Cl-) were obtained by direct autocyclotetramerization of the precursor 3,4-dicyano-1,2,5-thiadiazole in hot quinoline in the presence of MX3 salts (M = Al(III), Ga(III); X = Cl-, Br-) and were hydrolized to form the corresponding hydroxide derivatives, [TTDPzMOH]. The In(III) complex, [TTDPzIn(OAc)], was obtained from the free-base macrocycle [TTDPzH2] with In(OH)(OAc)2 in CH3COOH. A single-crystal X-ray study was made at 173 K on the two isostructural species [TTDPzMCl] (M = Al(III), Ga(III)), which have space group P, with a = 12.470(14), b = 12.464(13), and c = 13.947(12) angstroms, alpha = 70.72(3), beta = 79.76(3), and gamma = 90.06(3) degrees, V = 2009.3(3) angstroms3, and Z = 4 for [TTDPzAlCl] and a = 12.429(3), b = 12.430(3), and c = 13.851(3) angstroms, alpha = 70.663(6), beta = 79.788(8), and gamma = 89.991(9) degrees, V = 1983.3(7) angstroms3, and Z = 4 for [TTDPzGaCl]. Square pyramidal coordination exists about the M(III) centers, with Cl- occupying the apical position (Al-Cl = 2.171(5) and Ga-Cl = 2.193(1) angstroms). Al(III) and Ga(III) are located at distances of 0.416(6) and 0.444(2) angstroms from the center of the N4 system. The molecular packing consists of stacked double layers with internal and external average interlayer distances of 3.2 and 3.3 angstroms, respectively. IR spectra show nu(Al-Cl) at 345 cm(-1) for [TTDPzAlCl], nu(Al-Br) at 330 cm(-1) for [TTDPzAlBr], and nu(Ga-Cl) at 382 cm(-1) for [TTDPzGaCl]. The UV-vis spectra in weakly basic (pyridine, DMF, DMSO) and acidic solvents (CF3COOH, H2SO4) show the typical intense pi --> pi transition bands in the Soret (300-400 nm) and Q-band regions (640-660 nm), the bands evidencing some dependence on the nature of the solvent, particularly in acidic solutions. Cyclic voltammetry, differential pulse voltammetry, and thin-layer spectroelectrochemical measurements in pyridine and dimethylformamide of the species [TTDPzMX] indicate reversible first and second one-electron reductions, whereas additional ill-defined reductions are observed at more negative potentials. The examined species are much easier to reduce than their phthalocyanine or porphyrin analogues as a result of the remarkable electron-attracting properties of the TTDPz macrocycle which contains annulated strongly electron-deficient thiadiazole rings. 相似文献
6.
Keramidas AD Papaioannou AB Vlahos A Kabanos TA Bonas G Makriyannis A Rapropoulou CP Terzis A 《Inorganic chemistry》1996,35(2):357-367
Reaction of the amide ligand N-[2-((2-pyridylmethylene)amino)phenyl]pyridine-2-carboxamide (Hcapca) with VCl(3) affords the compound trans-[VCl(2)(capca)] (1), the first example of a vanadium(III) complex containing a vanadium-deprotonated amide nitrogen bond, while reaction of bis(pentane-2,4-dionato)oxovanadium(IV) with the related ligands N-[2-((2-phenolylmethylene)amino)phenyl]pyridine-2-carboxamide (H(2)phepca), 1-(2-hydroxybenzamido)-2-(2-pyridinecarboxamido)benzene (H(3)hypyb), and 1,2-bis(2-hydroxybenzamido)benzene (H(4)hybeb) yields the complexes [VO(phepca)] (2), Na[VO(hypyb)].2CH(3)OH (4.2CH(3)OH), and Na(2)[VO(hybeb)].3CH(3)OH (5.3CH(3)OH) respectively. The preparation of the complex {N-[2-((2-thiophenoylmethylene)amino)phenyl]pyridine-2-carboxamido}oxovanadium(IV) (3) has been achieved by reaction of N-(2-aminophenyl)pyridine-2-carboxamide and 2-mercaptobenzaldehyde with [VO(CH(3)COO)(2)](x)(). Oxidation of complex 5.3CH(3)OH with silver nitrate gives its vanadium(V) analogue (8.CH(3)OH), which is readily converted to its corresponding tetraethylammonium salt (10.CH(2)Cl(2)) by a reaction with Et(4)NCl. The crystal structures of the octahedral 1.CH(3)CN, and the square-pyramidal complexes 3, 4.CH(3)CN, 5.2CH(3)OH, and 10 were demonstrated by X-ray diffraction analysis. Crystal data are as follows: 1.CH(3)CN, C(18)H(13)Cl(2)N(4)OV.CH(3)CN M(r) = 464.23, monoclinic, P2(1)/n, a = 10.5991(7) ?, b = 13.9981(7) ?, c = 14.4021(7) ?, beta = 98.649(2)(o), V = 2112.5(3) A(3), Z = 4, R = 0.0323, and R(w) 0.0335; 3, C(19)H(13)N(3)O(2)SV, M(r) = 398.34, monoclinic, P2(1)/n, a = 12.1108(10) ?, b = 19.4439(18) ?, c = 7.2351(7) ?, beta = 103.012(3) degrees, V = 1660.0(4) ?(3), Z = 4, R = 0.0355, and R(w) = 0.0376; 4.CH(3)CN, C(19)H(12)N(3)O(4)VNa.CH(3)CN, M(r) = 461.31, monoclinic, P2(1)/c, a = 11.528(1) ?, b = 11.209(1) ?, c = 16.512(2) ?, beta = 103.928(4)(o), V = 2071.0(5) ?(3), Z = 4, R = 0.0649, and R(w) = 0.0806; 5.2CH(3)OH, C(20)H(10)N(2)O(5)VNa(2).2CH(3)OH, M(r) = 519.31, triclinic, P1, a = 12.839(1) ?, b = 8.334(1) ?, c = 12.201(1) ?, alpha = 106.492(2) degrees, beta = 105.408(2) degrees, gamma = 73.465(2) degrees, V = 1175.6(3) ?(3), Z = 2, R = 0.0894, and R(w) = 0.1043; 10, C(28)H(32)N(3)O(5)V M(r) = 541.52, monoclinic, P2(1)/c, a = 11.711(3) ?, b = 18.554(5) ?, c = 12.335(3) ?, beta = 95.947(9) degrees, V = 2666(2) ?(3), Z = 4, R = 0.0904, and R(w) = 0.0879. In addition to the synthesis and crystallographic studies, we report the optical, infrared, magnetic, and electrochemical properties of these complexes. Electron paramagnetic resonance [of oxovanadium(IV) species] and (1)H, (13)C{(1)H}, and (51)V nuclear magnetic resonance [of oxovanadium(V) complex] properties are reported as well. This study represents the first systematic study of vanadium(III), V(IV)O(2+), and V(V)O(3+) species containing a vanadium-deprotonated amide nitrogen bond. 相似文献
7.
Hydrogen abstraction by aluminum(III)-oxo intermediates via reaction pathways reminiscent of late transition metal chemistry has been observed. Oxidation of M(+)[(IP(2-))(2)Al](-) (IP = iminopyridine, M = Na, Bu(4)N) yielded [Na(THF)(DME)][(IP(-))(IP(2-))Al(OH)] (3) or [(IP(-))(2)Al(OH)] (4), via O-atom transfer and subsequent C-H activation or proton abstraction, respectively. 相似文献
8.
The extraction of gallium(III) with newly prepared 5-alkyloxymethyl-8-quinolinol derivatives with alkyl substituent at the 2-position in 8-quinolinol moiety has been studied. The Ga(III)-5-octyloxymethyl-8-quinolinol (HO(8)Q), Ga(III)-2-methyl-5-octyloxymethyl-8-quinolinol (HMO(8)Q), Ga(III)-2-methyl-5-hexyloxymethyl-8-quinolinol (HM-O(6)Q), and Ga(HI)-2-n-butyl-5-hexyloxymethyl-8-quinolinol (HNBO(6)Q) complexes extracted in heptane from a perchloric acid medium were Ga(O(8)Q)(3), Ga(OH)(H(2)O)(MO(8)Q)(2), Ga(OH)(H(2)O)(MO(6)Q)(2) and Ga(OH)H(2)O)(NBO(6)Q)(2), respectively. The 2-tert-butyl-5-hexyloxymethyl-8-quinolinol did not exhibit any reactivity toward gallium(III). The extraction constants for Ga(O(8)Q)(3) (K(ex) = [Ga(O(8)Q)(3)](org) [H(+)](3)/[Ga(3+)][HO(8)Q](org)(3)), Ga(OH)(H(2)O)(MO(8)Q)(2) (K(ex) = [Ga(OH) (H(2)O)(MO(8)Q)(2)](org) [H(+)](3)/[Ga(3+)][HMO(8)Q](org)(2)), Ga(OH)(H(2)O)(2)(MO(6)Q)(2) and Ga(OH)(H(2)O)(NBO(6)Q)(2), which were extracted in heptane from an acidic solution, are 10(3.21 +/- 0.12), 10(-4.24 +/- 0.16), 10(-3.84 +/- 0.16) and 10(-4.07 +/- 0.07), respectively at I = 0.1 M and 25 degrees C. HNBO(6)Q exhibited very high selectivity toward gallium(III) in the presence of aluminum(III). Even in the presence of a 100 fold excess of aluminum(III) to gallium(III) (1.43 x 10(-5) M), gallium(III) was completely extracted and the distribution ratio of aluminum(III) was found to be less than 2.0 x 10(-3). 相似文献
9.
The coordination chemistry of 2,2'-dipyridyl diselenide (PySeSePy) (2) (C(10)H(8)N(2)Se(2)) has been investigated and its crystal structure has been determined (monoclinic, P2(1)/c, a = 10.129(2) ?, b = 5.7332(12) ?, c = 19.173(3) ?, beta = 101.493(8) degrees, Z = 4). In metal complexes the ligand was found to coordinate in three different modes, as also confirmed by X-ray structure determination. N,N'-coordination was found in the zinc complex [Zn(PySeSePy)Cl(2)] (3) (C(10)H(8)Cl(2)N(2)Se(2)Zn, triclinic, P&onemacr;, a = 7.9430(10) ?, b = 8.147(2) ?, c = 11.999(2) ?, alpha = 93.685(10) degrees, beta = 107.763(10) degrees, gamma = 115.440(10) degrees, Z = 2) and Se,Se'-coordination in the adduct of the ligand with bis(pentafluorophenyl)mercury(II) [PySeSePyHg(C(6)F(5))(2)] (5) (C(10)H(8)F(10)HgN(2)Se(2), monoclinic, P2(1)/n, a = 7.7325(10) ?, b = 5.9974(14) ?, c = 25.573, beta = 98.037(10) degrees, Z = 2), which however displays only weak interactions between selenium and mercury. The reaction of the ligand with norbornadiene carbonyl complexes of molybdenum and tungsten leads to reductive cleavage of the selenium-selenium bond with oxidation of the metal center and concomitant addition of the resulting selenolate to the metal carbonyl fragment. Thus the 7-coordinate complexes [Mo(SePy)(2)(CO)(3)] (6) (C(13)H(8)MoN(2)O(3)Se(2), monoclinic, P2(1)/n, a = 9.319(3) ?, b = 12.886(5) ?, c = 13.231(6) ?, beta = 109.23(3) degrees, Z = 4) and [W(SePy)(2)(CO)(3)] (7) (C(13)H(8)N(2)O(3)Se(2)W, monoclinic, P2(1)/n, a = 9.303(2) ?, b = 12.853(2) ?, c = 13.232(2) ?, beta = 109.270(10) degrees, Z = 4) were obtained. The same N,Se-coordination pattern emerges from the reaction of [Fe(2)(CO)(9)] with (2) leading to [Fe(SePy)(2)(CO)(2)] (8) (C(12)H(8)FeN(2)O(2)Se(2), monoclinic, P&onemacr;, a = 8.6691(14) ?, b = 12.443(2) ?, c = 14.085(2) ?, alpha = 105.811(10) degrees, beta = 107.533(8) degrees, gamma = 92.075(10) degrees, Z = 4). 相似文献
10.
《Journal of Coordination Chemistry》2012,65(20):3351-3365
4-Hydroxyacridine (HAcr) is an O,N-chelating ligand whose coordination chemistry toward group 13 M(III) ions has received little attention. The molecular structure of HAcr consists of a 2,3-disubstituted-8-hydroxyquinoline; thus, in order to compare 8-hydroxyquinoline (HQ), 2-methyl-8-hydroxyquinoline (HMeQ′), and 2,3-disubstituted-8-hydroxyquinoline (HAcr) for steric and/or electronic influence, HAcr chelating ability toward the Al(III), Ga(III), and In(III) triad has been investigated. Irrespective of the nature of M(III), only complexes containing two equivalents of deprotonated HAcr are obtained. This article describes the synthesis and characterization of different series of bis-chelated pentacoordinated (Acr)2MY (M = Al, Ga, In; Y = Cl, Br, I, NCS, N3) or (Acr)2MZ (M = Ga or In; HZ = C6H5OH, C6H13OC6H4OH, C6H5COOH, or C6H13OC6H4COOH) six-coordinate neutral (Acr)2In(acac) (H(acac) =acetylacetone), or ionic [(Acr)2In(N,N)][CF3SO3] (N,N = 2,2′-bipyridine or 1,10-phenanthroline) complexes. These results significantly contribute to elucidating the complexation capability of HAcr. 相似文献
11.
Ogo S Yamahara R Roach M Suenobu T Aki M Ogura T Kitagawa T Masuda H Fukuzumi S Watanabe Y 《Inorganic chemistry》2002,41(21):5513-5520
In our preliminary communication (Ogo, S.; Wada, S.; Watanabe, Y.; Iwase, M.; Wada, A.; Harata, M.; Jitsukawa, K.; Masuda, H.; Einaga, H. Angew. Chem., Int. Ed. 1998, 37, 2102-2104), we reported the first example of X-ray analysis of a mononuclear six-coordinate (hydroxo)iron(III) non-heme complex, [Fe(III)(tnpa)(OH)(RCO(2))]ClO(4) [tnpa = tris(6-neopentylamino-2-pyridylmethyl)amine; for 1, R = C(6)H(5)], which has a characteristic cis (hydroxo)-Fe(III)-(carboxylato) configuration that models the cis (hydroxo)-Fe(III)-(carboxylato) moiety of the proposed (hydroxo)iron(III) species of lipoxygenases. In this full account, we report structural and spectroscopic characterization of the cis (hydroxo)-Fe(III)-(carboxylato) configuration by extending the model complexes from 1 to [Fe(III)(tnpa)(OH)(RCO(2))]ClO(4) (2, R = CH(3); 3, R = H) whose cis (hydroxo)-Fe(III)-(carboxylato) moieties are isotopically labeled by (18)OH(-), (16)OD(-), (18)OD(-), (12)CH(3)(12)C(18)O(2)(-), (12)CH(3)(13)C(16)O(2)(-), (13)CH(3)(12)C(16)O(2)(-), (13)CH(3)(13)C(16)O(2)(-), and H(13)C(16)O(2)(-). Complexes 1-3 are characterized by X-ray analysis, IR, EPR, and UV-vis spectroscopy, and electrospray ionization mass spectrometry (ESI-MS). 相似文献
12.
Sanz JL Ruiz R Gleizes A Lloret F Faus J Julve M Borrás-Almenar JJ Journaux Y 《Inorganic chemistry》1996,35(25):7384-7393
The first pentanuclear complexes of formula {Dy[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (1), {Ho[Cu(apox)][Cu(apox)(H(2)O)](3)}[PF(6)](3).4.5H(2)O (2), {Gd[Cu(apox)](2)[Cu(apox)(H(2)O)](2)}[ClO(4)](3).7H(2)O (3) and {Gd[Cu(apox)][Cu(apox) (H(2)O)](3)}[PF(6)](3).4.5H(2)O (4) (H(2)apox = N,N'-bis(3-aminopropyl)oxamide) have been synthesized. The crystal structures of complexes 1 and 2 have been determined by X-ray diffraction methods. Complexes 3 and 4 are isostructural with 1 and 2, respectively. Crystallographic data are as follows: 1 and 3, monoclinic, space group C2/c and Z = 4, with a = 14.646(6) ?, b = 29.496(7) ?, c = 16.002(7) ?, and beta = 111.76(2) degrees for 1 and a = 14.523(6) ?, b = 29.441(6) ?, c = 15.925(8) ?, and beta = 111.90(4) degrees for 3; 2 and 4, triclinic, P&onemacr;, and Z = 2, with a = 14.346(2) ?, b = 14.454(2) ?, c = 18.107(4) ?, alpha = 90.95(2) degrees, beta = 110.75(2) degrees, and gamma = 106.77(2) degrees for 2 and a = 14.365(6) ?, b = 14.496(5) ?, c = 18.172(7) ?, alpha = 91.27(3) degrees, beta = 110.74(3) degrees, and gamma = 106.67(3) degrees for 4. A tripositive ion is present in these structures, the electroneutrality being achieved by three uncoordinated perchlorate (1) or hexafluorophosphate (2) anions. The lanthanide cations are eight-coordinate with a pseudo-square-antiprismatic environment formed by carbonyl oxygen atoms from two [Cu(apox)] and two Cu(apox)(H(2)O)] (1) and one [Cu(apox)] and three [Cu(apox)(H(2)O)] (2) bidentate ligands. The temperature dependence of the magnetic susceptibility of complexes 1-4 was investigated in the range 1.8-300 K. The ligand-field effect, as well as the mixing of the free-ion states in Dy(III) and Ho(III), make extremely difficult the analysis of the overall antiferromagnetic interaction which is observed for complexes 1 and 2. The magnetic susceptibility data for complexes 3 and 4 have shown that the ground-state spin for the [Gd(III)Cu(II)(4)] unit is S = 11/2, the Gd(III)-Cu(II) interaction being ferromagnetic with an interaction parameter J(GdCu) = 0.85 cm(-)(1) (the interaction Hamiltonian is of the form H = -JS(A).S(B)). The field dependence of the magnetization at 2 K of 3 and 4 confirms the nature of the ground state and of the Gd(III)-Cu(II) interaction. The influence of the topology and of the type of bridging ligand on the nature and magnitude of the magnetic interaction in the Gd(III)-Cu(II) pair is analyzed and discussed in light of available magnetostructural data. 相似文献
13.
M. G. Abd El-Wahed S. M. El-Megharbel M. Y. El-Sayed Y. M. Zahran M. S. Refat M. A. Al-Omar A. M. Naglah 《Russian Journal of General Chemistry》2016,86(2):391-399
The complexation between the lanthanide metal ions Ce(III), Gd(III), Nd(III), Tb(III), and Er(III) and gliclazide produced 1 : 1 molar ratio metal: gliclazide (Glz) complexes coordinated in a monodentate fashion via the OH group and having the general formulas [M(Glz)Cl3(H2O)]·xH2O (M = Ce, Gd, Nd and x = 1, 3, 4, respectively) and [M(Glz)(H2O)4]Cl3·yH2O (M = Tb, Er and y = 1, 2, respectively). The structure of the synthesized lanthanide gliclazide complexes was assigned by IR, 1HNMR, and UV-Vis spectroscopy. Thermal analysis and kinetic and thermodynamic parameters gave evidence for the thermal stability of the Glz complexes. The latter showed a significant antimicrobial effect against some bacteria and fungi. 相似文献
14.
The identification of various species present in aqueous solutions of M(III)-Catechol system [M(III) = Ga(III) or In(III)] has been made through conductometric and electrometric studies. With a view to confirm the results suggested by physico-chemical methods, several hexa coordinated complexes of the type K[M(R) (H2O)2 (OH)2]. × H2O, K2[M(R)2(H2O) (OH)]. × H2O, K3[M(R)3]. × H2O (M = Ga(III), In(III)R = C6H4O2?) have been isolated. 相似文献
15.
The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1. 相似文献
16.
Cockrell GM Zhang G VanDerveer DG Thummel RP Hancock RD 《Journal of the American Chemical Society》2008,130(4):1420-1430
The metal ion complexing properties of the ligand DPP (2,9-di-(pyrid-2-yl)-1,10-phenanthroline) were studied by crystallography, fluorimetry, and UV-visible spectroscopy. Because DPP forms five-membered chelate rings, it will favor complexation with metal ions of an ionic radius close to 1.0 A. Metal ion complexation and accompanying selectivity of DPP is enhanced by the rigidity of the aromatic backbone of the ligand. Cd2+, with an ionic radius of 0.96 A, exhibits a strong CHEF (chelation enhanced fluorescence) effect with 10(-8) M DPP, and Cd2+ concentrations down to 10(-9) M can be detected. Other metal ions that cause a significant CHEF effect with DPP are Ca2+ (10(-3) M) and Na+ (1.0 M), whereas metal ions such as Zn2+, Pb2+, and Hg2+ cause no CHEF effect with DPP. The lack of a CHEF effect for Zn2+ relates to the inability of this small ion to contact all four donor atoms of DPP. The structures of [Cd(DPP)2](ClO4)2 (1), [Pb(DPP)(ClO4)2H2O] (2), and [Hg(DPP)(ClO4)2] (3) are reported. The Cd(II) in 1 is 8-coordinate with the Cd-N bonds to the outer pyridyl groups stretched by steric clashes between the o-hydrogens on these outer pyridyl groups and the central aromatic ring of the second DPP ligand. The 8-coordinate Pb(II) in 2 has two short Pb-N bonds to the two central nitrogens of DPP, with longer bonds to the outer N-donors. The coordination sphere around the Pb(II) is completed by a coordinated water molecule, and two coordinated ClO4(-) ions, with long Pb-O bonds to ClO4(-) oxygens, typical of a sterically active lone pair on Pb(II). The Hg(II) in 3 shows an 8-coordinate structure with the Hg(II) forming short Hg-N bonds to the outer pyridyl groups of DPP, whereas the other Hg-N and Hg-O bonds are rather long. The structures are discussed in terms of the fit of large metal ions to DPP with minimal steric strain. The UV-visible studies of the equilibria involving DPP and metal ions gave formation constants that show that DPP has a higher affinity for metal ions with an ionic radius close to 1.0 A, particularly Cd(II), Gd(III), and Bi(III), and low affinity for small metal ions such as Ni(II) and Zn(II). The complexes of several metal ions, such as Cd(II), Gd(III), and Pb(II), showed an equilibrium involving deprotonation of the complex at remarkably low pH values, which was attributed to deprotonation of coordinated water molecules according to: [M(DPP)(H2O)]n+ <==> [M(DPP)(OH)](n-1)+ + H+. The tendency to deprotonation of these DPP complexes at low pH is discussed in terms of the large hydrophobic surface of the coordinated DPP ligand destabilizing the hydration of coordinated water molecules and the build-up of charge on the metal ion in its DPP complex because of the inability of the coordinated DPP ligand to hydrogen bond with the solvent. 相似文献
17.
The second method for the synthesis of cis-[Ru(III)Cl(2)(cyclam)]Cl (1) (cyclam = 1,4,8,11-tetraazacyclotetradecane), with use of cis-Ru(II)Cl(2)(DMSO)(4) (DMSO = dimethyl sulfoxide) as a starting complex, is reported together with the synthesis of [Ru(II)(cyclam)(bpy)](BF(4))(2).H(2)O (2) (bpy = 2,2'-bipyridine) from 1. The syntheses of Ru complexes of tris(2-aminoethyl)amine (tren) are also reported. A reaction between K(3)[Ru(III)(ox)(3)] (ox = oxalate) and tren affords fac-[Ru(III)Cl(3)(trenH)]Cl.(1)/(2)H(2)O (3) (trenH = bis(2-aminoethyl)(2-ammonioethyl)amine = monoprotonated tren) and (H(5)O(2))(2)[K(tren)][Ru(III)Cl(6)] (4) as major products and gives fac-[Ru(III)Cl(ox)(trenH)]Cl.(3)/(2)H(2)O (5) in very low reproducibility. A reaction between 3 and bpy affords [Ru(II)(baia)(bpy)](BF(4))(2) (6) (baia = bis(2-aminoethyl)(iminomethyl)amine), in which tren undergoes a selective dehydrogenation into baia. The crystal structures of 2-6 have been determined by X-ray diffraction, and their structural features are discussed in detail. Crystallographic data are as follows: 2, RuF(8)ON(6)C(20)B(2)H(34), monoclinic, space group P2(1)/c with a = 12.448(3) ?, b = 13.200(7) ?, c = 17.973(4) ?, beta = 104.28(2) degrees, V = 2862(2) ?(3), and Z = 4; 3, RuCl(4)O(0.5)N(4)C(6)H(20), monoclinic, space group P2(1)/a with a = 13.731(2) ?, b = 14.319(4) ?, c = 13.949(2) ?, beta = 90.77(1) degrees, V = 2742(1) ?(3), and Z = 8; 4, RuKCl(6)O(4)N(4)C(6)H(28), trigonal, space group R&thremacr; with a = 10.254(4), c = 35.03(1) ?, V = 3190(2) ?(3), and Z = 6; 5, RuCl(2)O(5.5)N(4)C(8)H(22), triclinic, space group P&onemacr; with a = 10.336(2) ?, b = 14.835(2) ?, c = 10.234(1) ?, alpha = 90.28(1) degrees, beta = 90.99(1) degrees, gamma = 92.07(1) degrees, V = 1567.9(4) ?(3), and Z = 4; 6, RuF(8)N(6)C(16)B(2)H(24), monoclinic, space group P2(1)/c, a = 10.779(2) ?, b = 14.416(3) ?, c = 14.190(2) ?, beta = 93.75(2) degrees, V = 2200.3(7) ?(3), and Z = 4. Compound 4 possesses a very unique layered structure made up of both anionic and cationic slabs, {[K(tren)](2)[Ru(III)Cl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[Ru(III)Cl(6)]}(n)()(n)()(+) (n = infinity), in which both sheets {[K(tren)](2)}(n)()(2)(n)()(+) and {(H(5)O(2))(4)}(n)()(4)(n)()(+) offer cylindrical pores that are occupied with the [Ru(III)Cl(6)](3)(-) anions. The presence of a C=N double bond of baia in 6 is judged from the C-N distance of 1.28(2) ?. It is suggested that the structural restraint enhanced by the attachment of alkylene chelates at the nitrogen donors of amines results in either the mislocation or misdirection of the donors, leading to the elongation of the Ru-N(amine) distances and to the weakening of their trans influence. Such structural strain is also discussed as related to the spectroscopic and electrochemical properties of the cis-[Ru(II)L(4)(bpy)](2+) complexes (L(4) = (NH(3))(4), (ethylenediamine)(2), and cyclam). 相似文献
18.
Crystal and molecular structures of three Al(III) complexes of the tripod ligand 2,2′,2″-nitrilotriphenolate ( I ) are presented. They all show 5-coordinate Al in approximately trigonal bipyramidal geometry, with an external nucleophile X occupying the second axial position. X is OH? in[Al( I )(OH)]?[Hquin]+ (quin = quinuclidine), N in [Al( I )(py)] (py = pyridine), and one of the O-atoms of a second molecule in the dimeric [(Al( I ))2]. Correlated variations in the axial bond lengths of the trigonal bipyramid are observed: [(Al( I ))2]: Al–Nint. = 2.094 Å, Al–Oext. = 1.850 Å; [Al( I )(py)]: Al–Nint. = 2.153 Å, Al–Next., = 1.992 Å; [Al( I )(OH)]?: Al–Nint. = 2.278 Å, Al–Oext. = 1.765 Å. They are interpreted in terms of a dissociative reaction path at the Al(III) centre. 相似文献
19.
Hamilton JM Anhorn MJ Oscarson KA Reibenspies JH Hancock RD 《Inorganic chemistry》2011,50(7):2764-2770
Some metal-ion-complexing properties of the ligand 2,2',6',2'-terpyridyl (terpy) in aqueous solution are determined by following the π-π* transitions of 2 × 10(-5) M terpy by UV-visible spectroscopy. It is found that terpy forms precipitates when present as the neutral ligand above pH ~5, in the presence of electrolytes such as NaClO(4) or NaCl added to control the ionic strength, as evidenced by large light-scattering peaks. The protonation constants of terpy are thus determined at the ionic strength (μ) = 0 to avoid precipitation and found to be 4.32(3) and 3.27(3). The log K(1) values were determined for terpy with alkali-earth metal ions Mg(II), Ca(II), Sr(II), and Ba(II) and Ln(III) (Ln = lanthanide) ions La(III), Gd(III), and Lu(III) by titration of 2 × 10(-5) M free terpy at pH >5.0 with solutions of the metal ion. Log K(1)(terpy) was determined for Zn(II), Cd(II), and Pb(II) by following the competition between the metal ions and protons as a function of the pH. Complex formation for all of these metal ions was accompanied by marked sharpening of the broad π-π* transitions of free terpy, which was attributed to complex formation affecting ligand vibrations, which in the free ligand are coupled to the π-π* transitions and thus broaden them. It is shown that log K(1)(terpy) for a wide variety of metal ions correlates well with log K(1)(NH(3)) values for the metal ions. The latter include both experimental log K(1)(NH(3)) values and log K(1)(NH(3)) values predicted previously by density functional theory calculation. The structure of [Ni(terpy)(2)][Ni(CN)(4)]·CH(3)CH(2)OH·H(2)O (1) is reported as follows: triclinic, P1, a = 8.644(3) ?, b = 9.840(3) ?, c = 20.162(6) ?, α = 97.355(5)°, β = 97.100(5)°, γ = 98.606(5)°, V = 1663.8(9) ?(3), Z = 4, and final R = 0.0319. The two Ni-N bonds to the central N donors of the terpy ligands in 1 average 1.990(2) ?, while the four peripheral Ni-N bonds average 2.107(10) ?. This difference in the M-N bond length for terpy complexes is typical of the complexes of smaller metal ions, while for larger metal ions, the difference is reversed. The significance of the metal-ion size dependence of the selectivity of polypyridyl ligands, and the greater rigidity of ligands based on aromatic groups such as pyridyl groups, is discussed. 相似文献
20.
Tangoulis V Malamatari DA Soulti K Stergiou V Raptopoulou CP Terzis A Kabanos TA Kessissoglou DP 《Inorganic chemistry》1996,35(17):4974-4983
Two mixed-valence Mn(III)Mn(II) complexes and a homo-valence Mn(II) trinuclear manganese complex of stoichiometry Mn(III)Mn(II)Mn(III)(5-Cl-Hsaladhp)(2)(AcO)(4)(MeOH)(2).4CH(3)OH (1a), Mn(III)Mn(II)Mn(III) (Hsaladhp)(2)(AcO)(2)(5-Cl-Sal)(2)(thf)(2) (3a) and Mn(II)Mn(II)Mn(II) (AcO)(6)(pybim)(2) (1b) where H(3)saladhp is a tridentate Schiff base ligand and pybim a neutral bidentate donor ligand, have been structurally characterized by using X-ray crystallography. The structurally characterized mixed-valence complexes have strictly 180 degrees Mn(III)-Mn(II)-Mn(III) angles as required by crystallographic inversion symmetry. The complexes are valence trapped with two terminal Mn(III) ions showing Jahn-Teller distortion along the acetate or salicylate-Mn(III)-X axis. The Mn.Mn separation is 3.511 ? and 3.507 ? respectively. The mixed-valence complexes have S = (3)/(2) ground state and the homovalence complex S = (5)/(2), with small antiferromagnetic exchange J couplings, -5.6 and -1.8 cm(-1), respectively, while the powder ESR spectra at 4 K show a broad low field signal with g approximately 4.3 for Mn(III)Mn(II)Mn(III) and a broad temperature-dependent signal at g = 2 for Mn(II)Mn(II)Mn(II). Crystal data for 1a: [C(36)H(60)O(20)N(2)Cl(2)Mn(3)], triclinic, space group P&onemacr;, a = 9.272(7) ?, b = 11.046(8) ?, c = 12.635(9) ?, alpha = 76.78(2) degrees, beta = 81.84(2) degrees, gamma = 85.90(2) degrees, Z = 1. Crystal data for 3a: [C(48)H(56)O(18)N(2)Cl(2)Mn(3)], monoclinic, space group P2(1)/n, a = 8.776(3) ?, b = 22.182(7) ?, c = 13.575(4) ?, beta = 94.44(1) degrees, Z = 2. Crystal data for 1b: [C(36)H(36)O(12)N(6)Mn(3)], triclinic, space group P&onemacr;, a = 13.345(6) ?, b = 8.514(4) ?, c = 9.494(4) ?, alpha = 75.48(1) degrees, beta = 75.83(1) degrees, gamma = 76.42(1) degrees, Z = 1. 相似文献