A new cyclic borazine species B(8)(NH)(4)(NMe(2))(8) containing a twelve-membered B(8)N(4) ring

The reaction between B(2)(NMe(2))(4) and two equivalents of [NH(4)][PF(6)] in thf at room temperature affords the new cyclic borazine B(8)(NH)(4)(NMe(2))(8) containing a non-planar twelve-membered ring with alternating B(2)(NMe(2))(2) and NH units.     

Further evidence for the tetraoxoiodate(V) anion,IO(4)(3-): hydrothermal syntheses and structures of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O and Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O

The hydrothermal reaction of MoO(3) with BaH(3)IO(6) at 180 degrees C for 3 days results in the formation of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O (1). Under similar conditions, the reaction of Ba(OH)(2) x 8H(2)O with MoO(3) and Ba(IO(4))(2) x 6H(2)O yields Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O (2). The structure of 1, determined by single-crystal X-ray diffraction, consists of corner- and edge-sharing distorted MoO(6) octahedra that create two-dimensional slabs. Contained within this molybdenum oxide framework are approximately C(2v) tetraoxoiodate(V) anions, IO(4)(3-), that are involved in bonding with five Mo(VI) centers. The two equatorial oxygen atoms of the IO(4)(3-) anion chelate a single Mo(VI) center, whereas the axial atoms are mu(3)-oxo groups and complete the octahedra of four MoO(6) units. The coordination of the tetraoxoiodate(V) anion to these five highly electropositive centers is probably responsible for stabilizing the substantial anionic charge of this anion. The Ba(2+) cations separate the layers from one another and form long ionic contacts with neighboring oxygen atoms and a water molecule. Compound 2 also contains distorted MoO(6) octahedra. However, these solely edge-share with octahedral hexaoxoiodate(VII), IO(6)(5-), anions to form zigzagging one-dimensional, (1)(infinity)[(MoO(2))(IO(6))](3-), chains that are polar. These chains are separated from one another by Ba(2+) cations that are coordinated by additional water molecules. Bond valence sums for the iodine atoms in 1 and 2 are 5.01 and 7.03, respectively. Crystallographic data: 1, monoclinic, space group C2/c, a = 13.584(1) A, b = 7.3977(7) A, c = 20.736(2) A, beta = 108.244(2) degrees, Z = 4; 2, orthorhombic, space group Fdd2, a = 13.356(7) A, b = 45.54(2) A, c = 4.867(3) A, Z = 8.     

Cation ordering in natural and synthetic (Cu(1-x)Zn(x))(2)CO(3)(OH)(2) and (Cu(1-x)Zn(x))(5)(CO(3))(2)(OH)(6)

In the present paper we report combined experimental and theoretical studies of the UV-vis-NIR spectra of the mineral compounds malachite, rosasite, and aurichalcite and of the precursor compounds for Cu/ZnO catalysts. For the copper species in the minerals the crystal field splitting and the vibronic coupling constants are estimated using the exchange charge model of the crystal field accounting for the exchange and covalence effects. On this basis the transitions responsible for the formation of the optical bands arising from the copper centers in minerals are determined and the profiles of the absorption bands corresponding to these centers are calculated. The profiles of the absorption bands calculated as a sum of bands of their respective Cu species are in quite good agreement with the experimental data. In agreement with crystal chemical considerations, the Zn ions were found to be preferentially located on the more regular, i.e., less distorted, octahedral sites in zincian malachite and rosasite, suggesting a high degree of metal ordering in these phases. This concept also applies for the mineral aurichalcite, but not for synthetic aurichalcite, which seems to exhibit a lower degree of metal ordering. The catalyst precursor was found to be a mixture of zincian malachite and a minor amount of aurichalcite. The best fit of the optical spectrum is obtained assuming a mixture of contributions from malachite (0% Zn) and rosasite (38% Zn of [Zn + Cu]), which is probably due to the intermediate Zn content of the precursor (30%).     

Tuning intermolecular magnetic exchange interactions in the solids C(x)F(2)(x)(CNSSS)(2)(AsF(6))(2): structural, EPR, and magnetic characterization of dimeric (x = 2, 4) diradicals

A series of diradical containing salts CxF2x(CNSSS)2(**2+0(AsF6-)2 {x = 2, 1[AsF6]2; x = 3, 3[AsF6]2; x = 4, 2[AsF6]2} have been prepared. 1[AsF6]2 and 2[AsF6]2 were fully characterized by X-ray, variable-temperature magnetic susceptibility, and solid-state EPR measurements, further allowing us to extend the number of examples of the family of rare 7pi RCNSSS(*+) radical cations. 1[AsF6]2: a = 6.5314(7) A, b = 7.5658(9) A, c = 9.6048(11) A, alpha = 100.962(2) degrees , beta = 96.885(2) degrees , gamma = 107.436(2) degrees , triclinic, space group P, Z = 1, T = 173 K. 2[AsF6]2: a = 10.6398(16) A, b = 7.9680(11) A, c = 12.7468(19) A, beta = 99.758(2) degrees , monoclinic, space group P21/c, Z = 2, T = 173 K. In the solid-state, CxF2x(CNSSS)2(**2+) (x = 2, 4) formed one-dimensional polymeric chains of dications containing discrete centrosymmetric radical pairs in which radicals were linked by four centered two-electron pi*-pi* bonds [12+, d(S...S) = 3.455(1) A; 22+, d(S...S) = 3.306(2) A]. The exchange interactions in these bonds were determined to be -500 +/- 30 and -900 +/- 90 cm-1, by variable temperature magnetic susceptibility measurements, respectively, providing rare experimental data on the singlet-triplet gaps in the field of thiazyl radicals. For 2[AsF6]2, the thermally excited triplet state was unambiguously characterized by EPR techniques [/D/ = 0.0254(8) cm(-1), /E/ = 0.0013(8) cm(-1)]. These experimental data implied a weakly associated nature of the radical moieties contained in the solids 1[AsF6]2 and 2[AsF6]2. Computational analysis of the dimerization process is presented, and we show that the 2c 4 electron pi*-pi* bonds in 1[AsF6]2 and 2[AsF6]2 have ca. 50% and 40% diradical character, respectively. In contrast, 3[AsF6]2.SO2, containing diradical C3F6(CNSSS)2(**2+) with an odd number of CF2 spacers, showed magnetic behavior that was consistent with the presence of monomeric radical centers in the solid state.     

Characterization of Ti(6)O(4)(O(2)C(4)H(5))(8)(OCH(2)CH(3))(8) by electrospray time of flight mass spectrometry

A titanium oxide molecular cluster prepared by hydrolysis of titanium tetraethoxide in the presence of methacrylic acid, can be characterized by electrospray time of flight mass spectrometry (ESMS-TOF). The chemistry of such systems is not well known and ESMS is a powerful technique for studying the reactions of clusters in solution. The fingerprint of the cluster fragmentation suggests formation of Ti(x)O(y) core fragments that represent commonly observed structural constructs in bulk titanium oxide metallates. The fragmentation steps provide insight into the hydrolytic conversion of this molecular sol gel intermediate into bulk TiO(2). While MS has been applied to the study of metal alkoxide hydrolysis mechanisms, mass spectra of isolated individual titanium oxide clusters have not previously been reported.     

Rb(3)Ti(3)(P(4)S(13))(PS(4))(3) and Cs(2)Ti(2)(P(2)S(8))(PS(4))(2): two polar titanium thiophosphates with complex one-dimensional tunnels

The reactions of Ti with in situ formed polythiophosphate fluxes of A(2)S(3) (A = Rb, Cs), P(2)S(5), and S at 500 degrees C result in the formation of two new quaternary titanium thiophosphates with compositions Rb(3)Ti(3)(P(4)S(13))(PS(4))(3) (1) and Cs(2)Ti(2)(P(2)S(8))(PS(4))(2) (2). Rb(3)Ti(3)(P(4)S(13))(PS(4))(3) (1) crystallizes in the chiral hexagonal space group P6(3) (No. 173) with lattice parameters a = 18.2475(9) Angstrom, c = 6.8687(3) Angstrom, V = 1980.7(2) Angstrom(3), Z = 2. Cs(2)Ti(2)(P(2)S(8))(PS(4))(2) (2) crystallizes in the noncentrosymmetric monoclinic space group Cc (No. 9) with a = 21.9709(14) Angstrom, b = 6.9093(3) Angstrom, c = 17.1489(10) Angstrom, beta = 98.79(1) degrees, V = 2572.7(2) Angstrom(3), Z = 4. In the structure of 1 TiS(6) octahedra, three [PS(4)] tetrahedra, and the hitherto unknown [P(4)S(13)](6-) anion are joined to form two different types of helical chains. These chains are connected yielding two different helical tunnels being directed along [001]. The tunnels are occupied by the Rb+ ions. The [P(4)S(13)](6-) anion is generated by three [PS(4)] tetrahedra sharing corners with one [PS(4)] group in the center of the starlike anion. The P atoms of the three [PS(4)] tetrahedra attached to the central [PS(4)] group define an equilateral triangle. The [P(4)S(13)](6-) anion may be regarded as a new member of the [P(n)S(3n+1)]((n+2)-) series. The structure of Cs(2)Ti(2)(P(2)S(8))(PS(4))(2) (2) consists of the one-dimensional polar tunnels containing the Cs(+) cations. The rare [P(2)S(8)](4-) anion which is composed of two [PS(4)] tetrahedra joined by a S(2)(2-) anion is a fundamental building unit in the structure of 2. One-dimensional undulated chains being directed along [100] are joined by [PS(4)] tetrahedra to form the three-dimensional network with polar tunnels running along [010]. The compounds are characterized with IR, Raman spectroscopy, and UV/vis diffuse reflectance spectroscopy.     

Thiophosphate phase diagrams developed in conjunction with the synthesis of the new compounds KLaP(2)S(6), K(2)La(P(2)S(6))(1/2)(PS(4)), K(3)La(PS(4))(2), K(4)La(0.67)(PS(4))(2), K(9-)(x)La(1+x/3)(Ps(4))(4) (x = 0.5), K(4)Eu(PS(4))(2), and KEuPS(4)

An alkali-metal sulfur reactive flux has been used to synthesize a series of quaternary rare-earth metal compounds. These include KLaP(2)S(6) (I), K(2)La(P(2)S(6))(1/2)(PS(4)) (II), K(3)La(PS(4))(2) (III), K(4)La(0.67)(PS(4))(2) (IV), K(9-x)La(1+x/3)(PS(4))(4) (x = 0.5) (V), K(4)Eu(PS(4))(2) (VI), and KEuPS(4) (VII). Compound I crystallizes in the monoclinic space group P2(1)/c with the cell parameters a = 11.963(12) A, b = 7.525(10) A, c = 11.389(14) A, beta = 109.88(4) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/n with a = 9.066(6) A, b = 6.793(3) A, c = 20.112(7) A, beta = 97.54(3) degrees, and Z = 4. Compound III crystallizes in the monoclinic space group P2(1)/c with a= 9.141(2) A, b = 17.056(4) A, c = 9.470(2) A, beta = 90.29(2) degrees, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ibam with a = 18.202(2) A, b = 8.7596(7) A, c = 9.7699(8) A, and Z = 4. Compound V crystallizes in the orthorhombic space group Ccca with a = 17.529(9) A, b = 36.43(3) A, c = 9.782(4) A, and Z = 8. Compound VI crystallizes in the orthorhombic space group Ibam with a = 18.29(5) A, b = 8.81(2) A, c= 9.741(10) A, and Z = 4. Compound VII crystallizes in the orthorhombic space group Pnma with a = 16.782(2) A, b = 6.6141(6) A, c = 6.5142(6) A, and Z = 4. The sulfur compounds are in most cases isostructural to their selenium counterparts. By controlling experimental conditions, these structures can be placed in quasi-quaternary phase diagrams, which show the reaction conditions necessary to obtain a particular thiophosphate anionic unit in the crystalline product. These structures have been characterized by Raman and IR spectroscopy and UV-vis diffuse reflectance optical band gap analysis.     

Synthesis and characterization of six new quaternary actinide thiophosphate compounds: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6)(,) K(10)Th(3)(P(2)S(7))(4)(PS(4))(2), and A(5)An(PS(4))(3), (A = K, Rb, Cs; An = U, Th)

Six new actinide metal thiophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6) (I), K(10)Th(3)(P(2)S(7))(4)(PS(4))(2) (II), K(5)U(PS(4))(3) (III), K(5)Th(PS(4))(3) (IV), Rb(5)Th(PS(4))(3) (V), and Cs(5)Th(PS(4))(3) (VI). Compound I crystallizes in the monoclinic space group P2(1)/c with a = 33.2897(1) A, b = 14.9295(1) A, c = 17.3528(2) A, beta = 115.478(1) degrees, Z = 8. Compound II crystallizes in the monoclinic space group C2/c with a = 32.8085(6) A, b = 9.0482(2) A, c = 27.2972(3) A, beta = 125.720(1) degrees, Z = 8. Compound III crystallizes in the monoclinic space group P2(1)/c with a = 14.6132(1) A, b = 17.0884(2) A, c = 9.7082(2) A, beta = 108.63(1) degrees, Z = 4. Compound IV crystallizes in the monoclinic space group P2(1)/n with a = 9.7436(1) A, b = 11.3894(2) A, c = 20.0163(3) A, beta = 90.041(1) degrees, Z = 4, as a pseudo-merohedrally twinned cell. Compound V crystallizes in the monoclinic space group P2(1)/c with a = 13.197(4) A, b = 9.997(4) A, c = 18.189(7) A, beta = 100.77(1) degrees, Z = 4. Compound VI crystallizes in the monoclinic space group P2(1)/c with a = 13.5624(1) A, b = 10.3007(1) A, c = 18.6738(1) A, beta = 100.670(1) degrees, Z = 4. Optical band-gap measurements by diffuse reflectance show that compounds I and III contain tetravalent uranium as part of an extended electronic system. Thorium-containing compounds are large-gap materials. Raman spectroscopy on single crystals displays the vibrational characteristics expected for [PS(4)](3)(-), [P(2)S(7)](4-), and the new [P(3)S(10)](5)(-) building blocks. This new thiophosphate building block has not been observed except in the structure of the uranium-containing compound Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6).     

Nanoscale Hemispheres in Novel Mixed-Valent Uranyl Chromate(V,VI), (C(3)NH(10))(10)[(UO(2))(13)(Cr(12)(5+)O(42))(Cr(6+)O(4))(6)(H(2)O)(6)](H(2)O)(6)

The structure of a novel mixed-valent chromium uranyl compound, (C(3)NH(10))(10)[(UO(2))(13)(Cr(12)(5+)O(42))(Cr(6+)O(4))(6)(H(2)O)(6)](H(2)O)(6) (1), obtained by the combination of a hydrothermal method and evaporation from aqueous solutions with isopropylammonium, contains uranyl chromate hemispheres with lateral dimensions of 18.9 × 18.5 ?(2) and a height of about 8 ?. The hemispheres are centered by a UO(8) hexagonal bipyramid surrounded by six dimers of Cr(5+)O(5) square pyramids, UO(7) pentagonal bipyramids, and Cr(6+)O(4) tetrahedra. The hemispheres are linked into two-dimensional layers so that two adjacent hemispheres are oriented in opposite directions relative to the plane of the layer. From a topological point of view, the hemispheres have the formula U(21)Cr(23) and can be considered as derivatives of nanospherical cluster U(26)Cr(36) composed of three-, four-, and five-membered rings.     

New class of ruthenium sulfide clusters: Ru(4)S(6)(PPh(3))(4), Ru(5)S(6)(PPh(3))(5), and Ru(6)S(8)(PPh(3))(6)

Reaction of RuCl(2)(PPh(3))(3) with S(2)(-) sources yields a family of phosphine-containing Ru-S clusters which have been characterized crystallographically and by MALDI-MS. Ru(4)S(6)(PPh(3))(4) (Ru-Ru(av) = 2.94 A) has idealized T(d)() symmetry whereas Ru(6)S(8)(PPh(3))(6) (Ru-Ru(av) = 2.82 A) adopts the idealized O(h)() symmetry characteristic of Chevrel clusters. Ru(5)S(6)(PPh(3))(5) is formally derived by the addition of Ru(PPh(3)) to one face of Ru(4)S(6)(PPh(3))(4). In terms of its M-S connectivity, the Ru(5)S(6) cluster resembles a fragment of the FeMo cluster in nitrogenase.     

Metal(II) hexafluorophosphates(V) (M = Sr, Pb) containing XeF(2)-coordinated metal ions [M(XeF(2))(3)](PF(6))(2), [Pb(3)(XeF(2))(11)](PF(6))(6), and [Sr(3)(XeF(2))(10)](PF(6))(6)

From the system MF(2)/PF(5)/XeF(2)/anhydrous hydrogen fluoride (aHF), four compounds [Sr(XeF(2))(3)](PF(6))(2), [Pb(XeF(2))(3)](PF(6))(2), [Sr(3)(XeF(2))(10)](PF(6))(6), and [Pb(3)(XeF(2))(11)](PF(6))(6) were isolated and characterized by Raman spectroscopy and X-ray single-crystal diffraction. The [M(XeF(2))(3)](PF(6))(2) (M = Sr, Pb) compounds are isostructural with the previously reported [Sr(XeF(2))(3)](AsF(6))(2). The structure of [Sr(3)(XeF(2))(10)](PF(6))(6) (space group C2/c; a = 11.778(6) Angstrom, b = 12.497(6) Angstrom, c = 34.60(2) Angstrom, beta = 95.574(4) degrees, V = 5069(4) Angstrom(3), Z = 4) contains two crystallographically independent metal centers with a coordination number of 10 and rather unusual coordination spheres in the shape of tetracapped trigonal prisms. The bridging XeF(2) molecules and one bridging PF(6)- anion, which connect the metal centers, form complicated 3D structures. The structure of [Pb(3)(XeF(2))(11)](PF(6))(6) (space group C2/m; a = 13.01(3) Angstrom, b = 11.437(4) Angstrom, c = 18.487(7) Angstrom, beta = 104.374(9) degrees, V = 2665(6) Angstrom(3), Z = 2) consists of a 3D network of the general formula {[Pb(3)(XeF(2))(10)](PF(6))(6)}n and a noncoordinated XeF(2) molecule fixed in the crystal structure only by weak electrostatic interactions. This structure also contains two crystallographically independent Pb atoms. One of them possesses a unique homoleptic environment built up by eight F atoms from eight XeF(2) molecules in the shape of a cube, whereas the second Pb atom with a coordination number of 9 adopts the shape of a tricapped trigonal prism common for lead compounds. [Pb(3)(XeF(2))(11)](PF(6))(6) and [Sr(3)(XeF(2))(10)](PF(6))(6) are formed when an excess of XeF(2) is used during the process of the crystallization of [M(XeF(2))(3)](PF(6))(2) from their aHF solutions.     

Selenophosphate phase diagrams developed in conjunction with the synthesis of the new compounds K(2)La(P(2)Se(6))(1/2)(PSe(4)), K(3)La(PSe(4))(2), K(4)La(0.67)(PSe(4))(2), K(9-x)La(1+x/3)(PSe(4))(4) (x = 0.5), and KEuPSe(4)

Five new rare-earth metal polyselenophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: K(2)La(P(2)Se(6))(1/2)(PSe(4)) (I), K(3)La(PSe(4))(2) (II), K(4)La(0.67)(PSe(4))(2) (III), K(9-x)()La(1+)(x/3)(PSe(4))(4) (x = 0.5) (IV), and KEuPSe(4) (V). Compound I crystallizes in the monoclinic space group P2(1)/n with a = 9.4269(1) A, b = 7.2054(1) A, c = 21.0276(5) A, beta = 97.484(1) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/c with a = 9.5782(2) A, b = 17.6623(4) A, c = 9.9869(3) A, beta = 90.120(1) degrees, and Z = 4. Compound III crystallizes in the orthorhombic space group Ibam with a = 19.0962(2) A, b = 9.1408(1) A, c = 10.2588(2) A, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ccca with a = 18.2133(1) A, b = 38.0914(4) A, c = 10.2665(1) A, and Z = 8. Compound V crystallizes in the orthorhombic space group Pnma with a = 17.5156(11) A, b = 7.0126(5) A, c = 6.9015(4) A, and Z = 4. Optical band gap measurements show that compound V has an optical band gap of 1.88 eV. Solid-state Raman spectroscopy of compounds II-V shows the four normal vibrations expected for the (PSe(4))(3-) unit. The observation of compounds I-V in several reactions has allowed the creation of a quasi-quaternary phase diagram for potassium rare-earth-metal polyselenophosphates. This phase diagram can qualitatively be separated into three regions on the basis of the oxidation state of phosphorus in the crystalline products observed and takes the next step in designing solid-state compounds.     

Crystal structure and spectroscopic properties of Na(2)K(6)(VO)(2)(SO(4))(7)

Red-brown crystals of a new mixed alkali oxo sulfato vanadium(V) compound Na(2)K(6)(VO)(2)(SO(4))(7), suitable for X-ray determination, have been obtained from the catalytically important binary molten salt system M(2)S(2)O(7)-V(2)O(5) (M = 80% K and 20% Na). By slow cooling of a mixture with the mole fraction X(V(2)O(5)) = 0.24 from 325 degrees C, i.e., just below the liquidus temperature, to the solidus temperature of around 300 degrees C, a dark reddish amorphous phase was obtained containing crystals of the earlier described V(V)-V(IV) mixed valence compound K(6)(VO)(4)(SO(4))(8) and Na(2)K(6)(VO)(2)(SO(4))(7) described here. This compound crystallizes in the tetragonal space group P4(3)2(1)2 (No. 96) with a = 9.540(3) A, c = 29.551(5) A at 20 degrees C and Z = 4. It contains a distorted VO(6) octahedron with a short V-O bond of 1.552(6) A, a long one of 2.276(5) A trans to this, and four equatorial V-O bonds in the range 1.881(6)-1.960(6) A. The deformation of the VO(6) octahedron is less pronounced compared to that of the known oxo sulfato V(V) compounds. Each VO(3+) group is coordinated to five sulfate groups of which two are unidentately coordinated and three are bidentate bridging to neighboring VO(3+) groups. The length of the S-O bonds in the S-O-V bridges of the two unidentately coordinated sulfato groups are 1.551(6) A and 1.568(6) A, respectively, which are unusually long compared to our earlier measurements of sulfate groups in other V(III), V(IV), and V(V) compounds.     

Mixed-metal uranium(VI) iodates: hydrothermal syntheses,structures, and reactivity of Rb[UO(2)(CrO(4))(IO(3))(H(2)O)], A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K,Rb, Cs), and K(2)[UO(2)(MoO(4))(IO(3))(2)

The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4.     

New dirhenium(III) compounds bridged by carboxylate ligands: N(C(4)H(9))(4)[Re(2)(OOCCF(3))Cl(6)] and Re(2)(OOCCCHCo(2)(CO)(6))(4)Cl(2)

The solvothermal reaction of (N(C(4)H(9))(4))(2)[Re(2)Cl(8)] with trifluoroacetic acid and acetic anhydride leads to the new rhenium trifluoroacetate dimer N(C(4)H(9))(4)[Re(2)(OOCCF(3))Cl(6)] (1) and to the rhenium carbonyl dimer Re(2)(mu(2)-Cl)(2)(CO)(8) as the rhenium-reduced byproduct. The reaction of the precursor complex, N(C(4)H(9))(4)[Re(2)(OOCCF(3))Cl(6)] (1), with the organometallic carboxylic acid (CO)(6)Co(2)HCCCOOH leads to the cluster of clusters compound Re(2)(OOCCCHCo(2)(CO)(6))(4)Cl(2) (2), which has the dimer structure of Re(2)(OOCR)(4)Cl(2). Cyclic voltammetric measurements show that Re(2)(OOCCCHCo(2)(CO)(6))(4)Cl(2) (2) has one reduction centered on the dirhenium core and a reduction centered on the cobalt atoms. DFT calculations have been used to rationalize the observed displacements of the voltammetric signals in Re(2)(OOCCCHCo(2)(CO)(6))(4)Cl(2) (2) compared to the parent ligand (CO)(6)Co(2)HCCCOOH and rhenium pivalate.     

DFT investigation of the tri(amino)amine N(NH(2))(3)(2+) and the tri(azido)amine N(N(3))(3)(2+) dications and related mixed amino(azido)ammonium ions (N(3))(x)N(NH(2))(4-x)(+) (x = 0-4)(1)

Structures of the tri(amino)amine N(NH(2))(3)(2+) and the tri(azido)amine N(N(3))(3)(2+) dications were calculated at the density functional theory (DFT) B3LYP/6-311+G level. The tri(amino)amine dication (NH(2))(3)N(2+) (1) was found to be highly resonance stabilized with a high kinetic barrier for deprotonation. The structures of diamino(azido)amine dication (NH(2))(2)N(N(3))(2+) (2), amino(diazido)amine dication (NH(2))N(N(3))(2)(2+) (3), and tri(azido)amine dication (N(3))(3)N(2+) (4) were also found to be highly resonance stabilized. The structures and energetics of the related mixed amino(azido)ammonium ions (N(3))(x)N(NH(2))(4-x)(+) (x = 0-4) were also calculated.