共查询到20条相似文献,搜索用时 46 毫秒
1.
Kadish KM Shao J Ou Z Zhan R Burdet F Barbe JM Gros CP Guilard R 《Inorganic chemistry》2005,44(24):9023-9038
Combined electrochemical and UV-visible spectroelectrochemical methods were utilized to elucidate the prevailing mechanisms for electroreduction of previously synthesized porphyrin-corrole dyads of the form (PCY)H2Co and (PCY)MClCoCl where M = Fe(III) or Mn(III), PC = porphyrin-corrole, and Y is a bridging group, either biphenylenyl (B), 9,9-dimethylxanthenyl (X), anthracenyl (A), or dibenzofuranyl (O). These studies were carried out in pyridine, conditions under which the cobalt(IV) corrole in (PCY)MClCoCl is immediately reduced to its Co(III) form, thus enabling direct comparisons with the free-base porphyrin dyad, (PCY)H2Co(III) under the same solution conditions. The compounds are all reduced in multiple one-electron-transfer steps, the first of which involves the M(III)/M(II) process of the porphyrin in the case of (PCY)MClCoCl and the Co(III)/Co(II) process of the corrole in the case of (PCY)H2Co. Each metal-centered redox reaction may be accompanied by the gain or loss of pyridine axial ligands, with the exact stoichiometry of the exchange process depending upon the specific combination of metal ions in the dyad, their oxidation states, and the particular spacer in the complex. Before this study was started, it was expected that the porphyrin-corrole dyads with the largest spacers, namely, O and A, would readily accommodate the formation of cobalt(III) bis-pyridine adducts because of the larger size of the cavity while dyads with the smallest B spacer would seem to have insufficient room to add even a single pyridine within the cavity, as was structurally seen in the case of (PCB)H2Co(py). This is clearly not the case, as shown in the present study. A reversible Co(III)/Co(II) reaction is seen for (PCB)MnClCoCl at -0.62 V, which when combined with spectroscopic data, leads to the assignment of (PCB)Mn(III)(py)2Co(III)(py) as the species in pyridine. The reduction of (PCB)Mn(III)(py)2Co(III)(py) to (PCB)Mn(II)(py)Co(III)(py) is accompanied on the slower spectroelectrochemical time scale by the appearance of a 603 nm band in the UV-vis spectra and is consistent with the addition of a second pyridine ligand to the Co(III)(py) unit of the dyad as one ligand is lost from the electrogenerated manganese(II) porphyrin, thus maintaining one pyridine ligand within the cavity. A different change in the coordination number is observed in the case of (PCB)FeClCoCl. Here the initial Fe(III) complex can be assigned as (PCB)Fe(III)ClCo(III)(py), which has no pyridine molecule within the cavity and the singly reduced form is characterized as (PCB)Fe(II)(py)2Co(III)(py)2, which contains two pyridine ligands inside the cavity. A following one-electron reduction of the Fe(II)/Co(III) complex then gives [(PCB)Fe(II)(py)2Co(II)]-. 相似文献
2.
Guilard R Gros CP Barbe JM Espinosa E Jérôme F Tabard A Latour JM Shao J Ou Z Kadish KM 《Inorganic chemistry》2004,43(23):7441-7455
The synthesis and characterization of cofacial copper biscorroles and porphyrin-corroles linked by a biphenylenyl or anthracenyl spacer are described. The investigated compounds are represented as (BCA)Cu(2) and (BCB)Cu(2) in the case of the biscorrole (BC) derivatives and (PCA)Cu(2) and (PCB)Cu(2) in the case of porphyrin (P)-corrole (C) dyads, where A and B represent the anthracenyl and biphenylenyl bridges, respectively. A related monomeric corrole (Me(4)Ph(5)Cor)Cu and monomeric porphyrin (Me(2)Et(6)PhP)Cu that comprise the two halves of the porphyrin-corrole dyads were also studied. Electron spin resonance (ESR), (1)H NMR, and magnetic measurements data demonstrate that the copper corrole macrocycle, when linked to another copper corrole or copper(II) porphyrin, can be considered to be a Cu(III) complex in equilibrium with a Cu(II) radical species, copper(III) corrole being the main oxidation state of the corrole species at all temperatures. The cofacial orientation of (BCB)Cu(2), (BCA)Cu(2), and (PCB)Cu(2) was confirmed by X-ray crystallography. Structural data: (BCB)Cu(2)(C(110)H(82)N(8)Cu(2).3CDCl(3)), triclinic, space group P, a = 10.2550(2) A, b = 16.3890(3) A, c = 29.7910(8) A, alpha = 74.792(1) degrees , beta = 81.681(1) degrees , gamma = 72.504(2) degrees , Z = 2; (BCA)Cu(2)(C(112)H(84)N(8)Cu(2).C(7)H(8).1.5H(2)O), monoclinic, space group P 2(1)/c, a = 16.0870(4) A, b = 35.109(2) A, c = 19.1390(8) A, beta = 95.183(3) degrees , Z = 4; (PCB)Cu(2)(C(89)H(71)N(8)Cu(2).CHCl(3)), monoclinic, space group P2(1)/n, a = 16.7071(3) A, b = 10.6719(2) A, c = 40.8555(8) A, beta = 100.870(1) degrees , Z = 4. The two cofacial biscorroles, (BCA)Cu(2) and (BCB)Cu(2), both show three electrooxidations under the same solution conditions. The reduction of (BCA)Cu(2) involves a reversible electron addition to each macrocycle at the same potential of E(1/2) = -0.20 V although (BCB)Cu(2) is reversibly reduced in two steps to give first [(BCB)Cu(2)](-) and then [(BCB)Cu(2)](2)(-), each of which was characterized by ESR spectroscopy as containing a Cu(II) center. These latter electrode reactions occur at E(1/2) = -0.36 and -0.51 V versus a saturated calomel reference electrode. The half-reduced and fully reduced (BCB)Cu(2) show similar Cu(II) ESR spectra, and no evidence of a triplet signal is observed. The two well-separated reductions of (BCB)Cu(2) to give [(BCB)Cu(2)](2)(-) can be attributed to a stronger pi-pi interaction between the two macrocycles of this dimer as compared to those of (BCA)Cu(2). The copper porphyrin-corrole dyads, (PCA)Cu(2) and (PCB)Cu(2), show five reversible oxidations and two reversible reductions, and these potentials are compared with corresponding values for electrochemical reactions of the porphyrin and corrole monomers under the same solution conditions. 相似文献
3.
Kadish KM Shao J Ou Z Frémond L Zhan R Burdet F Barbe JM Gros CP Guilard R 《Inorganic chemistry》2005,44(19):6744-6754
Three face-to-face linked porphyrin-corrole dyads were investigated as to their electrochemistry, spectroelectrochemistry, and chloride-binding properties in dichloromethane or benzonitrile. The same three compounds were also investigated as to their ability to catalyze the electroreduction of dioxygen in aqueous 1 M HClO4 or HCl when adsorbed on a graphite electrode. The characterized compounds are represented as (PCY)H2Co, where P = a porphyrin dianion; C = a corrole trianion; and Y = a biphenylenyl, 9,9-dimethylxanthenyl, or anthracenyl spacer, which links the two macrocycles in a face-to-face arrangement. An axial binding of one or two Cl- ligands to the cobalt center of the corrole is observed for singly and doubly oxidized (PCY)H2Co, with the exact stoichiometry of the reaction depending upon the spacer size and the concentration of Cl- added to solution. No Cl- binding occurs for the neutral or reduced forms of the dyad, which contrasts with what is seen for the monocorrole, (Me4Ph5Cor)Co, where a single Cl- ligand is added to the Co(III) corrole in PhCN. The Co(III) form of the corrole in (PCY)H2Co also appears to be the catalytically active species in the electroreduction of dioxygen, which occurs at potentials associated with the Co(IV)/Co(III) reaction, that is, 0.35 V in 1 M HClO4 as compared to 0.31-0.42 V for the same three dyads in PhCN and 0.1 M TBAP. The potential for the catalytic electroreduction of O2 in HCl shifts negatively by 60 to 70 mV as compared to E(1/2) values in 1 M HClO4, consistent with the binding of Cl- to the Co(IV) form of the corrole and its rapid dissociation after electroreduction to Co(III) at the electrode surface. 相似文献
4.
Kadish KM Ou Z Shao J Gros CP Barbe JM Jérôme F Bolze F Burdet F Guilard R 《Inorganic chemistry》2002,41(15):3990-4005
The synthesis and characterization of three new cofacial biscorroles and three new linked Co(II) porphyrins and Co(III) corroles with the same face to face orientation are described. The biscorroles are represented as (BCS)Co(2), (BCO)Co(2), (BCX)Co(2) while the porphyrin-corrole dyads are represented as (PCA)Co(2), (PCB)Co(2), (PCO)Co(2) where BC represents the Co(III) cofacial biscorroles and PC represents the porphyrin-corrole complexes which are linked to each other by a dibenzothiophene (S), dibenzofuran (O), or 9,9-dimethylxanthene (X) bridge in the case of the corroles and an anthracene (A), biphenylene (B), or dibenzofuran (O) bridge in the case of the mixed macrocycle derivatives. The electrochemical and spectroscopic data on these new bismacrocycles are compared to those of previously reported biscorroles of the type (BCA)Co(2) and (BCB)Co(2). The CO and/or pyridine binding properties of each biscorrole and porphyrin-corrole in CH(2)Cl(2) are also presented. Only one CO ligand is bound axially to each corrole unit of the bismacrocycle but five- and six-coordinate pyridine complexes can be generated for the same compounds, with the exact stoichiometry depending upon the concentration of pyridine in solution. In all cases, the six-coordinate bispyridine corrole complex can be unambiguously identified by a strong diagnostic marker band located at 598-601 nm. The formation constants for pyridine binding to the biscorroles range from log K(1) = 3.14 to 5.08 while log K(2) ranges from 1.10 to 2.61 depending upon the specific spacer. Carbon monoxide binding constants range from log K = 3.6 to 4.0 in the case of the biscorroles and from log K = 3.4 to 4.1 in the case of the porphyrin-corrole dyads. These values also depend on the specific spacer in the complex and, like the pyridine binding constants, decrease in the order BCO > BCA > BCB for the biscorroles and PCO > PCA > PCB for the porphyrin-corrole complexes. 相似文献
5.
Kadish KM Frémond L Ou Z Shao J Shi C Anson FC Burdet F Gros CP Barbe JM Guilard R 《Journal of the American Chemical Society》2005,127(15):5625-5631
Three series of cobalt(III) corroles were tested as catalysts for the electroreduction of dioxygen to water. One was a simple monocorrole represented as (Me(4)Ph(5)Cor)Co, one a face-to-face biscorrole linked by an anthracene (A), biphenylene (B), 9,9-dimethylxanthene (X), dibenzofuran (O) or dibenzothiophene (S) bridge, (BCY)Co(2) (with Y = A, B, X, O or S), and one a face-to-face bismacrocyclic complex, (PCY)Co(2), containing a Co(II) porphyrin and a Co(III) corrole also linked by one of the above rigid spacers (Y = A, B, X, or O). Cyclic voltammetry and rotating ring-disk electrode voltammetry were both used to examine the catalytic activity of the cobalt complexes in acid media. The mixed valent Co(II)/Co(III) complexes, (PCY)Co(2), and the biscorrole complexes, (BCY)Co(2), which contain two Co(III) ions in their air-stable forms, all provide a direct four-electron pathway for the reduction of O(2) to H(2)O in aqueous acidic electrolyte when adsorbed on a graphite electrode, with the most efficient process being observed in the case of the complexes having an anthracene spacer. A relatively small amount of hydrogen peroxide was detected at the ring electrode in the vicinity of E(1/2) which was located at 0.47 V vs SCE for (PCA)Co(2) and 0.39 V vs SCE for (BCA)Co(2). The cobalt(III) monocorrole (Me(4)Ph(5)Cor)Co also catalyzes the electroreduction of dioxygen at E(1/2) = 0.38 V with the final products being an approximate 50% mixture of H(2)O(2) and H(2)O. 相似文献
6.
Three cobalt(III) complexes of the macrocyclic tetraamine [3(5)]adamanzane (1,5,9,13-tetraazabicyclo[7.7.3]nonadecane) were isolated as salts. The X-ray crystal structures were solved for the compounds [Co([3(5)]adz)(CO(3))]AsF(6) (1b), [Co([3(5)]adz)(HCO(3))]ZnBr(4).H(2)O (2a), and [Co([3(5)]adz)(SO(4))]AsF(6).H(2)O (3a). The coordination geometry around the cobalt(III) ion is a distorted octahedron with the inorganic ligands at cis-positions. Complex 2 is the second example of a cobalt(III) complex for which the X-ray structure shows a chelate binding mode of the hydrogen carbonate entity. The pK(a) value of the [Co([3(5)]adz)(HCO(3))](2+) ion (2) was determined spectrophotometrically to be 0.27 (25 degrees C, I = 5.0 M). The protonation appears to occur at the noncoordinated carbonyl oxygen atom of the carbonate group, with hydrogen bonding to the crystal water molecule. Evidence is presented for this oxygen atom as the site of protonation in solution as well. In 5.0 M CF(3)SO(3)H a slow reaction of the carbonato complex, quantitatively yielding the [Co([3(5)]adz)(H(2)O)(2)](3+) ion, was observed. k(obs) = 7.9(1) x 10(-)(6) s(-)(1) at 25 degrees C. 相似文献
7.
Chen P El Ojaimi M Gros CP Richard P Barbe JM Guilard R Shen J Kadish KM 《Inorganic chemistry》2011,50(8):3479-3489
A series of homobimetallic manganese cofacial porphyrin-corrole dyads were synthesized and investigated as to their electrochemistry, spectroelectrochemistry, and ligand binding properties in nonaqueous media. Four dyads were investigated, each of which contained a Mn(III) corrole linked in a face-to-face arrangement with a Mn(III) porphyrin. The main difference between compounds in the series is the type of spacer, 9,9-dimethylxanthene, anthracene, dibenzofuran, or diphenylether, which determines the distance and interaction between the metallomacrocycles. Each redox process of the porphyrin-corrole dyads was assigned on the basis of spectroscopic and electrochemical data and by comparison with reactions and properties of the monocorrole and the monoporphyrin which were examined under the same solution conditions. The Mn(III) porphyrin part of the dyad undergoes two major one-electron reductions in pyridine and benzonitrile, the first of which involves a Mn(III)/Mn(II) process and the second the addition of an electron to the conjugated π-ring system of the macrocycle. The Mn(III) corrole part of the dyads also exhibits two major redox processes, one involving Mn(III)/Mn(II) and the other Mn(III) to Mn(IV) under the same solution conditions. The potentials and reversibility of each electron transfer reaction were shown to depend upon the solvent, type of spacer separating the two macrocycles, and the presence or absence of axial ligation, the latter of which was investigated in detail for the case of acetate ion which was found to bind within the cavity of the dyad to both manganese centers, both before and after the stepwise electroreduction to the Mn(II) forms of the two macrocycles. An intramolecular chloride ion exchange between the porphyrin part of the dyads which contain Mn(III)Cl and the singly oxidized corrole in the dyad is observed after the Mn(III)/Mn(IV) reaction of the corrole, suggesting that chloride is coordinated inside the cavity in the neutral compound. 相似文献
8.
Guilard R Gros CP Bolze F Jérôme F Ou Z Shao J Fischer J Weiss R Kadish KM 《Inorganic chemistry》2001,40(19):4845-4855
The synthesis, spectroscopic properties, and electrochemistry of six different alkyl- and aryl-substituted Co(III) corroles are presented. The investigated compounds contain methyl, ethyl, phenyl, or substituted phenyl groups at the eight beta-positions of the corrole macrocycle and four derivatives also contain a phenyl group at the 10-meso position of the macrocycle. Each cobalt corrole undergoes four reversible oxidations in CH(2)Cl(2) containing 0.1 M tetra-n-butylammonium perchlorate and exists as a dimer in its singly and doubly oxidized forms. The difference in potential between the first two oxidations is associated with the degree of interaction between the two corrole units of the dimer and ranges from an upper value of 0.62 V, in the case of (Me(6)Et(2)Cor)Co, to a lower value of about 0.17 V, in the case of four compounds which have a phenyl group located at the 10-meso position of the macrocycle. These Co(III) corroles strongly coordinate two pyridine molecules or one carbon monoxide molecule in CH(2)Cl(2) media, and ligand binding constants were evaluated using spectroscopic and electrochemical methods. The structure of (Me(4)Ph(5)Cor)Co(py)(2) was also determined by X-ray diffraction. Crystal data: (Me(4)Ph(5)Cor)Co(py)(2).3CH(2)Cl(2).H(2)O, orthorhombic, a = 19.5690(4) A, b = 17.1070(6) A, c = 15.9160(6) A, V = 5328.2(5) A(3), space group Pna2(1), Z = 2, 35 460 observations, R(F) = 0.069. 相似文献
9.
Caemelbecke EV Will S Autret M Adamian VA Lex J Gisselbrecht JP Gross M Vogel E Kadish KM 《Inorganic chemistry》1996,35(1):184-192
The electrochemistry and spectroscopic properties of three iron corroles were examined in benzonitrile, dichloromethane, and pyridine containing 0.1 M tetra-n-butylammonium perchlorate or tetra-n-ethylammonium hexafluorophosphate as supporting electrolyte. The investigated compounds are represented as (OEC)Fe(IV)(C(6)H(5)), (OEC)Fe(IV)Cl, and (OEC)Fe(III)(py), where OEC is the trianion of 2,3,7,8,12,13,17,18-octaethylcorrole. Each iron(IV) corrole undergoes two one-electron reductions and two or three one-electron oxidations depending upon the solvent. Under the same solution conditions, the iron(III) corrole undergoes a single one-electron reduction and one or two one-electron oxidations. Each singly oxidized and singly reduced product was characterized by UV-vis and/or EPR spectroscopy. The data indicate a conversion of (OEC)Fe(IV)(C(6)H(5)) and (OEC)Fe(IV)Cl to their iron(III) forms upon a one-electron reduction and to iron(IV) corrole pi cation radicals upon a one-electron oxidation. The metal center in [(OEC)Fe(III)(C(6)H(5))](-) is low spin (S = (1)/(2)) as compared to electrogenerated [(OEC)Fe(III)Cl](-), which contains an intermediate-spin (S = (3)/(2)) iron(III). (OEC)Fe(III)(py) also contains an intermediate-spin-state iron(III) and, unlike previously characterized (OEC)Fe(III)(NO), is converted to an iron(IV) corrole upon oxidation rather than to an iron(III) pi cation radical. Singly oxidized [(OEC)Fe(IV)(C(6)H(5))](*)(+) is the first iron(IV) tetrapyrrole pi cation radical to be isolated and was structurally characterized as a perchlorate salt. It crystallizes in the triclinic space group P&onemacr; with a = 10.783(3) ?, b = 13.826(3) ?, c = 14.151(3) ?, alpha = 78.95(2) degrees, beta = 89.59(2) degrees, and gamma = 72.98(2) degrees at 293 K with Z = 2. Refinement of 8400 reflections and 670 parameters against F(o)(2) yields R1 = 0.0864 and wR2 = 0.2293. The complex contains a five-coordinated iron with average Fe-N bond lengths of 1.871(3) ?. The formulation of the electron distribution in this compound was confirmed by M?ssbauer, X-ray crystallographic, and magnetic susceptibility data as well as by EPR spectroscopy, which gives evidence for strong antiferromagnetic coupling between the iron(IV) center and the singly oxidized corrole macrocycle. 相似文献
10.
A convenient six-step procedure is developed to routinely prepare the hexadentate ligand cis,cis-1,3,5-triaminocyclohexane-N,N',N"-triacetic acid (H3tachta) as an HCl salt. Complexes of gallium(III) and indium(III), [Ga(tachta)] and [In(tachta)], are synthesized from the reactions of the ligand and the corresponding metal precursors. Copper(II), palladium(II), and cobalt(II) complexes, [Cu(Htachta)], [Pd(Htachta)], and [Co(Htachta)], are obtained from the reactions of H3tachta with the corresponding metal chlorides. The structures of H3tachta.3HCl.2H2O (C12H28Cl3N3O8) and [Ga(tachta)] (C12H18GaN3O6) are characterized. The crystal of H3tachta.3HCl.2H2O is monoclinic, of the space group P2(1)/c, with a = 15.1688(4) A, b = 8.4708(2) A, c = 15.9408(2) A, beta = 108.058(1) degrees, and Z = 4; that of [Ga(tachta)] is cubic, of space group Pa3, with a = 14.0762(1) A and Z = 8. The gallium atom of [Ga(tachta)] is six-coordinated in the solid state, and the complex assumes a pseudooctahedronal geometry with the completely deprotonated hexadentate ligand encapsulating the metal ion. 相似文献
11.
D Stoilova V Koleva 《Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy》2001,57(13):2629-2636
The infrared (IR) spectra of Co(HCOO)2 x 2H2O, Ni(HCOO)2 x 2H2O and Cu2Co(Ni)1-x (HCOO)2 x 2H2O mixed crystals (0 < x < or = 0.5) have been recorded and the internal modes of the formate groups and the water molecules are discussed. The analysis of the spectra of the mixed crystals reveals that when copper ions replace cobalt and nickel ions in Co(HCOO) x 2H2O and Ni(HCOO)2 x 2H2O, the Cu2+ ions are localized at the two available positions. However, the occupancy degree of the Me(1) and Me(2) sites by the different cations needs X-ray diffraction (XRD) studies of the single crystals. The new crystal phase Co0.17Cu0.83(HCOO)2 x 2H2O obtained from the Co(HCOO)2 x 2H2O-Cu(HCOO)2 x 2H2O-H2O system at 50 degrees C crystallizes in the monoclinic system with lattice parameters: a = 12.329(4); b = 7.241(2); c = 8.707(5) A and beta = 103.13(3) degrees (SG probably P2/c). The number of the bands corresponding to the uncoupled OD vibrations and the water librations shows that probably more than two water molecules are expected to exist in the structure. Furthermore, it is assumed that the water molecules bonded to the copper ions form stronger hydrogen bonds (stronger Cu-OH2 interaction) than those bonded to the cobalt ions. 相似文献
12.
The reaction of nickel, cobalt, and manganese with 1,2-ethylenediphosphonic acid or 1,2-ethylenediphosphonic acid and 1,10-phenanthroline under hydrothermal conditions resulted in the pillared layered structures Co2(H2O)2(O3PC2H4PO3) (I) and Ni2(H2O)2(O3PC2H4PO3) (II), which are isostructural to a zinc phase that has previously been characterized by X-ray powder methods. In addition, a 1D chain structure, Mn(HO3P(CH2)2PO3H)(H2O)2(C12H8N2) (III), and a pillared layered structure, Mn(HO3P(CH2)2PO3H) (IV), were obtained. The structures of these phases were solved by single-crystal X-ray diffraction methods. The crystallographic data are as follows: compound I P21/n (No. 14), a = 5.6500(11) A, b = 4.7800(10) A, c = 15.330(3) A, beta = 98.50(3) degrees, V = 409.47(14) A3, Z = 2; compound II P21/n (No. 14), a = 5.5807(11) A, b = 4.7205(9) A, c = 15.250(3) A, beta = 98.55(3) degrees, V = 397.28(13) A3, Z = 2; compound III C2/c (No. 15), a = 12.109(2) A, b = 15.328(3) A, c = 9.848(2) A, beta = 108.88(3) degrees, V = 1729.5(6) A3, Z = 4; compound IV P (No. 2), a = 5.498(5) A, b = 7.715(6) A, c = 8.093(7) A, alpha = 82.986(12) degrees, beta = 75.565(12) degrees, gamma = 80.582(12)degrees, V = 326.7(5) A3, Z = 2. Magnetic measurements show antiferromagnetic behavior below TN = 7 K for I and 13 K for II. 相似文献
13.
Copper(II) complexes of a novel pyrazole containing porphyrinogen and cobalt(III) and zinc(II) complexes of a pyrazole containing tripodal ligand having N-donor atoms have been investigated. 5-Methyl-3-formylpyrazole (MPA) on reaction with copper(II) nitrate or perchlorate in the presence of tris(2-aminoethyl)amine (tren) forms novel pyrazole-based porphyrinogen complexes [Cu(T(3)-porphyrinogen)(H(2)O)](NO(3))(2) (1a) and [Cu(T(3)-porphyrinogen)(H(2)O)](ClO(4))(2) (1b) where T(3)-porphyrinogen is 1,6,11,16-tetraaza-5,10,15,20-tetrahydroxy-2,7,12,17-tetramethylporphyrinogen. The same products are also obtained when tren is replaced by triethylamine. By contrast, the reaction between MPA, tren, and cobalt(II) perchlorate produces the cobalt(III) complex [Co(HMPz(3)tren)]ClO(4) (2) derived from the tripodal Schiff base tris[4-(3-(5-methyl-pyrazolyl)-3-aza-3-butenyl]amine (H(3)MPz(3)tren). The X-ray crystal structures of the copper(II) complexes (1a and 1b) and the cobalt(III) complex (2) have been determined. The structures show distorted square pyramidal coordination environments for 1a and 1b with the water molecule occupying the apical site, while for complex 2 a distorted octahedral geometry is obtained. Data for 1a follow: a = 19.476(3) A, b = 9.4116(8) A, c = 14.204(3) A; alpha = 90 degrees = gamma, beta = 107.58(2) degrees; V = 2482.0(7) A(3), Z = 4. Data for 1b follow: a = 20.967(3) A, b = 9.1563(18) A, c = 14.858(4) A; alpha = 90 degrees = gamma, beta = 108.44(3) degrees; V = 2706.0(10) A(3), Z = 4. Data for 2 follow: a = 21.293(3) A, b = 12.724(2) A, c = 19.777(4) A; alpha = 90 degrees = gamma, beta = 93.03(2) degrees; V = 5350.6(15) A(3), Z = 8. All three complexes crystallize in the monoclinic crystal system with the C2/c space group. The complexes are further characterized by UV-vis, IR, EPR, and electrochemical studies. 相似文献
14.
Zhao L Xu Z Grove H Milway VA Dawe LN Abedin TS Thompson LK Kelly TL Harvey RG Miller DO Weeks L Shapter JG Pope KJ 《Inorganic chemistry》2004,43(13):3812-3824
A series of [3 x 3] Mn(II)(9), antiferromagnetically coupled, alkoxide-bridged, square grid complexes, derived from a group of "tritopic" dihydrazide ligands, is described. The outer ring of eight Mn(II) centers in the grids is isolated magnetically from the central Mn(II) ion, leading to an S = 0 ground state for the ring, and an S = 5/2 ground state overall in each case. Exchange in the Mn(II)(8) ring can be represented by a 1D chain exchange model. Rich electrochemistry displayed by these systems has led to the production of Mn(II)/Mn(III) mixed-oxidation-state grids by both electrochemical and chemical means. Structures are reported for [Mn(9)(2poap)(6)](C(2)N(3))(6).10H(2)O (1), [Mn(9)(2poap)(6)](2)[Mn(NCS)(4)(H(2)O)](2)(NCS)(8).10H(2)O (2), [Mn(9)(2poapz)(6)](NO(3))(6).14.5H(2)O (3), [Mn(9)(2popp)(6)](NO(3))(6).12H(2)O (4), [Mn(9)(2pomp)(6)](MnCl(4))(2)Cl(2).2CH(3)OH.7H(2)O (5), and [Mn(9)(Cl2poap)(6)](ClO(4))(9).7H(2)O (6). Compound 1 crystallized in the tetragonal system, space group P4(2)/n, with a = 21.568(1) A, c = 16.275(1) A, and Z = 2. Compound 2 crystallized in the triclinic system, space group P, with a = 25.043(1) A, b = 27.413(1) A, c = 27.538(2) A, alpha = 91.586(2) degrees, beta = 113.9200(9) degrees, gamma = 111.9470(8) degrees, and Z = 2. Compound 3 crystallized in the triclinic system, space group P, with a = 18.1578(12) A, b = 18.2887(12) A, c = 26.764(2) A, alpha = 105.7880(12) degrees, beta = 101.547(2) degrees, gamma = 91.1250(11) degrees, and Z = 2. Compound 4 crystallized in the tetragonal system, space group P4(1)2(1)2, with a = 20.279(1) A, c = 54.873(6) A, and Z = 4. Compound 5 crystallized in the tetragonal system, space group I, with a = 18.2700(2) A, c = 26.753(2) A, and Z = 2. Compound 6 crystallized in the triclinic system, space group P, with a = 19.044(2) A, b = 19.457(2) A, c = 23.978(3) A, alpha = 84.518(3) degrees, beta = 81.227(3) degrees, gamma = 60.954(2) degrees, and Z = 2. Preliminary surface studies on Au(111), with a Mn(II) grid complex derived from a sulfur-derivatized ligand, indicate monolayer coverage via gold-sulfur interactions, and the potential for information storage at high-density levels. 相似文献
15.
Tonei DM Ware DC Brothers PJ Plieger PG Clark GR 《Dalton transactions (Cambridge, England : 2003)》2006,(1):152-158
Zinc metal reduction of the cobalt(III) complex [Co(1,4-bcc)](+) (1,4-bcc = 1,4-bis-carboxymethylcyclam) produces the corresponding cobalt(II) complex which crystallises as the coordination polymer {[Co(1,4-bcc)]ZnCl(2)}(n). A method has been developed for removal of the cobalt(III) ion from [Co(1,4-bcc)](+) and isolation of the free ligand as its hydrochloride salt, H(2)(1,4-bcc).4HCl. This has been used for the preparation of new metal complexes, and the syntheses and characterisation of the copper(ii), nickel(ii), zinc(ii) and chromium(iii) complexes containing the 1,4-bcc ligand are described. X-Ray crystal structures of {[Co(1,4-bcc)]ZnCl(2)}(n).2.5H(2)O, {[Cu(1,4-bcc)]CuCl(2)}(n).0.25MeOH.H(2)O and [Cu(1,4-bcc)H]ClO(4) show the complexes to have the trans(O) geometry of the 1,4-bcc ligand, while the structure of [Cr(1,4-bcc)H(0.5)](ClO(4))(1.5).EtOH exhibits the cis(O) configuration. 相似文献
16.
Daiguebonne C Kerbellec N Bernot K Gérault Y Deluzet A Guillou O 《Inorganic chemistry》2006,45(14):5399-5406
The reaction of the Er3+ ion with polycarboxylate ligands in gel media leads to coordination polymers exhibiting various structural types and dimensionalities. Five Er3+/1,4-benzenedicarboxylate-based coordination polymers have been obtained in such conditions. Four out of the five are new. Their crystal structures are reported and compared herein. Compound 1, namely, Er2Ter3(H2O)6, where H2Ter symbolizes the terephthalic acid, crystallizes in the space group P1 (No. 2) with a = 7.8373(10) A, b = 9.5854(2) A, c = 10.6931(2) A, alpha = 68.7770(8) degrees, beta = 70.8710(8) degrees, and gamma = 75.3330(12) degrees. It has already been reported elsewhere. The last four compounds are new. Compound 2, namely, Er2Ter3(H2O)6 x 2 H2O, crystallizes in the space group P121/a1 (No. 14) with a = 6.7429(2) A, b = 22.4913(7) A, c = 9.6575(3) A, and beta = 91.6400(18) degrees. Compound 3, namely Er2Ter3(H2O)8 x 2 H2O crystallizes in the space group P1 (No. 2) with a = 7.5391(2) A, b = 10.0533(3) A, c = 10.4578(3) A, alpha = 87.7870(10) degrees, beta = 82.5510(11) degrees, and gamma = 86.2800(16) degrees. Compound 4, namely, Er2Ter3(H2O)6 x 2 H2O crystallizes in the space group C2/c (No. 15) with a = 38.5123(13) A, b = 11.1241(4) A, c = 7.0122(2) A, and beta = 98.634(2) degrees. Compound 5, namely, Er2Ter3(H2O)6 x H2O, crystallizes in the space group P1 (No. 2) with a = 6.8776(10) A, b = 11.0420(2) A, c = 18.5675(3) A, alpha = 84.7240(6) degrees, beta = 81.8380(6) degrees, and gamma = 84.1770(8) degrees. A computational method has also been developed to evaluate the potential porosity of the coordination polymers. This method is described and then applied to the different Er2Ter3(H2O)n coordination polymers previously described. 相似文献
17.
A series of heterodinuclear bis(mu-hydroxo)chromium(III)nickel(II) complexes was newly prepared: [(phen)(2)Cr(mu-OH)(2)Ni(tpa)](ClO(4))(3) x 0.5H(2)O (1), [(phen)(2)Cr(mu-OH)(2)Ni(Me-tpa)](ClO(4))(3) x 2H(2)O (2), [(phen)(2)Cr(mu-OH)(2)Ni(Me(2)-tpa)](ClO(4))(3) x 2H(2)O (3), and [(phen)(2)Cr(mu-OH)(2)Ni(Me(3)-tpa)](ClO(4))(3) x 3H(2)O (4), where phen is 1,10-phenanthroline and tpa, Me-tpa, Me(2)-tpa, and Me(3)-tpa are tris(2-pyridylmethyl)amine, [(6-methyl-2-pyridyl)methyl]bis(2-pyridylmethyl)amine, bis[(6-methyl-2-pyridyl)methyl](2-pyridylmethyl)amine, and tris[(6-methyl-2-pyridyl)methyl]amine, respectively. X-ray crystallography revealed that the structures of 1-4 resemble one another having an edge-shared bioctahedral structure with a Cr(mu -OH)(2)Ni unit (crystal data: 1 x C(2)H(5)OH, triclinic, P1, a = 13.179(4) A, b = 13.685(4) A, c = 14.260(4) A, alpha = 84.95(2) degrees, beta = 77.65(1) degrees, gamma = 90.21(2) degrees, V = 2502(1) A(3), Z = 2, R = 0.103, R(w) = 0.097; 2 x C(2)H(5)OH, triclinic, P1, a = 13.214(2) A, b = 13.657(2) A, c = 14.417(3) A, alpha = 95.205(5) degrees, beta = 102.583(4) degrees, gamma =90.720(3) degrees, V = 2527.3(8) A(3), Z = 2, R = 0.090, R(w) = 0.122; 3 x C(2)H(5)OH, triclinic, P1, a = 13.276(2) A, b =13.696(2) A, c = 14.454(2) A, alpha = 95.640(3) degrees, beta = 102.821(4) degrees, gamma = 90.174(3) degrees, V = 2549.5(6) A(3), Z = 2, R= 0.087, R(w)= 0.119; 4, triclinic, P1, a = 10.8916(9) A, b = 14.268(2) A, c = 17.522(2) A, alpha = 84.498(9) degrees, beta = 74.313(7) degrees, gamma = 72.402(7) degrees, V = 2498.6(5) A(3), Z = 2, R = 0.060, R(w)= 0.088). Chromium and nickel ions are coordinated by two phen's and Me(n)-tpa, respectively, to complete a distorted octahedral coordination sphere. Introduction of the 6-methyl group(s) onto the pyridyl group(s) results in the elongation of the Ni-N bond distances due to an unfavorable steric interaction between the methyl group and the bridging hydroxide group: systematic elongation of the Ni-N bond distances and the Cr ...Ni separations accompanied by an increase in the Cr-O-Ni angles was observed as the number of the methyl groups increases. Variable-temperature magnetic susceptibility measurements of 1-4 (4.2-300 K) indicated that magnetic interactions between Cr(III) and Ni(II) ions are systematically modulated from a very weak antiferromagnetic interaction to a ferromagnetic interaction as the number of the methyl groups increases; the exchange integrals J's for 1-4 are estimated to be -1.4, +0.0, +4.1, and +7.4 cm(-1), respectively. The magneto-structural relationship is discussed in terms of the change in the magnetic orbital energies of nickel(II) centers arising from the change in the Ni-N bond distances. 相似文献
18.
Interaction of the lacunary [alpha-XW(9)O(33)](9-) (X = As(III), Sb(III)) with Fe(3+) ions in acidic, aqueous medium leads to the formation of dimeric polyoxoanions, [Fe(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](6-) (X = As(III), Sb(III)) in high yield. X-ray single-crystal analyses were carried out on Na(6)[Fe(4)(H(2)O)(10)(beta-AsW(9)O(33))(2)] x 32H(2)O, which crystallizes in the monoclinic system, space group C2/m, with a = 20.2493(18) A, b = 15.2678(13) A, c = 16.0689(14) A, beta = 95.766(2) degrees, and Z = 2; Na(6)[Fe(4)(H(2)O)(10)(beta-SbW(9)O(33))(2)] x 32H(2)O is isomorphous with a = 20.1542(18) A, b = 15.2204(13) A, c = 16.1469(14) A, and beta = 95.795(2) degrees. The selenium and tellurium analogues are also reported, [Fe(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](4-) (X = Se(IV), Te(IV)). They are synthesized from sodium tungstate and a source of the heteroatom as precursors. X-ray single-crystal analysis was carried out on Cs(4)[Fe(4)(H(2)O)(10)(beta-SeW(9)O(33))(2)] x 21H(2)O, which crystallizes in the triclinic system, space group P macro 1, with a = 12.6648(10) A, b = 12.8247(10) A, c = 16.1588(13) A, alpha = 75.6540(10) degrees, beta = 87.9550(10) degrees, gamma = 64.3610(10) gamma, and Z = 1. All title polyanions consist of two (beta-XW(9)O(33)) units joined by a central pair and a peripheral pair of Fe(3+) ions leading to a structure with idealized C(2h) symmetry. It was also possible to synthesize the Cr(III) derivatives [Cr(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](6-) (X = As(III), Sb(III)), the tungstoselenates(IV) [M(4)(H(2)O)(10)(beta-SeW(9)O(33))(2)]((16)(-)(4n)-) (M(n+) = Cr(3+), Mn(2+), Co(2+), Ni(2+), Zn(2+), Cd(2+), and Hg(2+)), and the tungstotellurates(IV) [M(4)(H(2)O)(10)(beta-TeW(9)O(33))(2)]((16-4n)-) (M(n+) = Cr(3+), Mn(2+), Co(2+), Ni(2+), Cu(2+), Zn(2+), Cd(2+), and Hg(2+)), as determined by FTIR. The electrochemical properties of the iron-containing species were also studied. Cyclic voltammetry and controlled potential coulometry aided in distinguishing between Fe(3+) and W(6+) waves. By variation of pH and scan rate, it was possible to observe the stepwise reduction of the Fe(3+) centers. 相似文献
19.
Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials. 相似文献
20.
Ramdhanie B Telser J Caneschi A Zakharov LN Rheingold AL Goldberg DP 《Journal of the American Chemical Society》2004,126(8):2515-2525
The novel cobalt corrolazine (Cz) complexes (TBP)(8)CzCoCN (1) and (TBP)(8)CzCo(CCSiPh(3)) (2) have been synthesized and examined in light of the recent intense interest regarding the role of corrole ligands in stabilizing high oxidation states. In the case of 2, the molecular structure has been determined by X-ray crystallography, revealing a short Co[bond]C distance of 1.831(4) A and an intermolecular pi-stacking interaction between Cz ring planes, and this structure has been analyzed in regards to the electronic configuration. By a combination of spectroscopic techniques it has been shown that 1 is best described as a cobalt(III)[bond]pi-cation-radical complex, whereas 2 is likely best represented as the resonance hybrid (Cz)Co(IV)(CCSiPh(3)) <--> (Cz+*)Co(III)(CCSiPh(3)). The reduced cobalt(II) complex, [(TBP)(8)CzCo(II)(py)](-), has been generated in situ and shown to bind dioxygen at low temperature to give [(TBP)(8)CzCo(III)(py)(O(2))](-). For the reduced complex [(TBP)(8)CzCo(II)(py)](-), the EPR spectrum in frozen solution is indicative of a low-spin cobalt(II) complex with a d(z)2 ground state. Exposure of [(TBP)(8)CzCo(II)(py)](-) to O(2) leads to the reversible formation of the cobalt(III)-superoxo complex [(TBP)(8)CzCo(III)(py)(O(2))](-), which has been characterized by EPR spectroscopy. VT-EPR measurements show that the dioxygen adduct is stable up to T approximately 240 K. This work is the first observation, to our knowledge, of O(2) binding to a cobalt(II) corrole. 相似文献