共查询到20条相似文献,搜索用时 796 毫秒
1.
A single crystal of Li3Ba2Ho3(WO4)8 was obtained from a flux of Li2WO4 under an air atmosphere. The structure of the pure crystal was determined by single-crystal X-ray diffraction method. It crystallizes in the monoclinic system, space group C2/c with a = 5.240(4), b = 12.790(10), c = 19.247(15), β = 91.921(15)°, V = 1289.1(18)3, Z = 2, Mr = 2773.09, Dc = 7.144 g/cm3, μ = 47.732 mm-1, Rint = 0.0693, F(000) = 2340, the final R = 0.0472 and wR = 0.1221 for 1535 observed reflections (I > 2σ(I)). The Li3Ba2Ho3(WO4)8 has a high structure disorder with one 8f site shared by Li(1) and Ho ions with occupancy of 0.25 and 0.75, respectively. The fundamental structure is constituted by distorted square antiprisms Ho/Li(1)O8 with C1 symmetry, distorted Li(2)O6 octahedra and BaO10 polyhedra. The optical properties were investigated by IR and absorption spectroscopy, and the emission cross sections and gain cross sections of 5I7 → 5I8 of Ho3+ were calculated. 相似文献
2.
Ben Yahia H Shikano M Koike S Tatsumi K Kobayashi H 《Dalton transactions (Cambridge, England : 2003)》2012,41(19):5838-5847
The new compounds Li(2-x)Na(x)Ni[PO(4)]F (x = 0.7, 1, and 2) have been synthesized by a solid state reaction route. Their crystal structures were determined from single-crystal X-ray diffraction data. Li(1.3)Na(0.7)Ni[PO(4)]F crystallizes with the orthorhombic Li(2)Ni[PO(4)]F structure, space group Pnma, a = 10.7874(3), b = 6.2196(5), c = 11.1780(4) ? and Z = 8, LiNaNi[PO(4)]F crystallizes with a monoclinic pseudomerohedrally twinned structure, space group P2(1)/c, a = 6.772(4), b = 11.154(6), c = 5.021(3) ?, β = 90° and Z = 4, and Na(2)Ni[PO(4)]F crystallizes with a monoclinic twinned structure, space group P2(1)/c, a = 13.4581(8), b = 5.1991(3), c = 13.6978(16) ?, β = 120.58(1)° and Z = 8. For x = 0.7 and 1, the structures contain NiFO(3) chains made up of edge-sharing NiO(4)F(2) octahedra, whereas for x = 2 the chains are formed of dimer units (face-sharing octahedra) sharing corners. These chains are interlinked by PO(4) tetrahedra forming a 3D framework for x = 0.7 and different Ni[PO(4)]F layers for x = 1 and 2. A sodium/lithium disorder over three atomic positions is observed in Li(1.3)Na(0.7)Ni[PO(4)]F structure, whereas the alkali metal atoms are well ordered in between the layers in the LiNaNi[PO(4)]F and Na(2)Ni[PO(4)]F structures, which makes both compounds of great interest as potential positive electrodes for sodium cells. 相似文献
3.
The reaction of the chelating ligand tBuNTe(mu-NtBu)2TeNtBu (L) with LiI in THF yields [Li(THF)2L](mu 3-I)[LiI(L)] (3). This complex is also formed by the attempted oxidation of [Li2Te(NtBu)3]2 with I2. An X-ray analysis of 3 reveals that the tellurium diimide dimer acts as a chelating ligand toward (a) [Li(THF)2]+ cations and (b) a molecule of LiI. An extended structure is formed via weak Te...I interactions [3.8296(7)-3.9632(7) A] involving both mu 3-iodide counterions and the iodine atoms of the coordinated LiI molecules. Crystal data: 3, triclinic, space group P1, a = 10.1233(9) A, b = 15.7234(14) A, c = 18.8962(17) A, alpha = 86.1567(16) degrees, beta = 84.3266(16) degrees, gamma = 82.9461(16) degrees, V = 2965.8(5) A3, Z = 2. The oxidation by air of [Li2Te(NtBu)3]2 in toluene produces the radical (Li3[Te(NtBu)3]2), which exhibits an ESR spectrum consisting of a septet of decuplets (g = 2.00506, a(14N) = 5.26 G, a(7Li) = 0.69 G). The complexes [(THF)3Li3(mu 3-X)(Te(NtBu)3)] (4a, X = Cl; 4b, X = Br; 4c, X = I) are obtained from the reaction of [Li2Te(NtBu)3]2 with lithium halides in THF. The iodide complex, 4c, has a highly distorted, cubic structure comprised of the pyramidal [Te(NtBu)3]2- dianion which is linked through three [Li(THF)]+ cations to I- Crystal data: 4c, triclinic, space group P1, a = 12.611(8) A, b = 16.295(6) A, c = 10.180(3) A, alpha = 98.35(3) degrees, beta = 107.37(4) degrees, gamma = 108.26(4) degrees, V = 1829(2) A3, Z = 2. 相似文献
4.
Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials. 相似文献
5.
The crystal structure of Li7[Mn(V)N4] was re-determined. Isolated tetrahedral [Mn(V)N4](7-) ions are arranged with lithium cations to form a superstructure of the CaF2 anti-type (P4bar3n, No. 218, a = 956.0(1) pm, Z = 8). According to measurements of the magnetic susceptibility, the manganese (tetrahedral coordination) is in a d(2) S = 1 state. Thermal treatment of Li7[Mn(V)N4] under argon in the presence of elemental lithium at various temperatures leads to Li24[Mn(III)N3]3N2, Li5[(Li1-xMnx)N]3, and Li2[(Li1-xMn(I)x)N], respectively. Li24[Mn(III)N3]3N2 (P3bar1c, No. 163, a = 582.58(6) pm, c = 1784.1(3) pm, Z = 4/3) crystallizes in a trigonal unit cell, containing slightly, but significantly nonplanar trigonal [MnN3](6-) units with C3v symmetry. Measurements of the magnetic susceptibility reveal a d(4) S = 1 spin-state for the manganese (trigonal coordination). Nonrelativistic spin-polarized DFT calculations with different molecular models lead to the conclusion that restrictions in the Li-N substructure are responsible for the distortion from planarity of the [Mn(III)N3](6-). Li5[(Li1-xMnx)N]3 (x = 0.59(1), P6bar2m, No. 189, a = 635.9(3) pm, c = 381.7(2) pm, Z = 1) is an isotype of Li5[(Li1-xNix)N]3 with manganese in an average oxidation state of about +1.6. The crystal structure is a defect variant of the alpha-Li3N structure type with the transition metal in linear coordination by nitrogen. Li2[(Li1-xMn(I)x)N] (x = 0.67(1), P6/mmm, No. 191, a = 371.25(4) pm, c = 382.12(6) pm, Z = 1) crystallizes in the alpha-Li3N = Li2[LiN] structure with partial substitution of the linearly nitrogen-coordinated Li-species by manganese(I). Measurements of the magnetic susceptibility are consistent with manganese (linear coordination) in a low-spin d(6) S = 1 state. 相似文献
6.
The lithiation of N,N'-di-tert-butylethylenediamine by MeLi in benzene has been shown by (1)H NMR spectroscopy to proceed via the partially lithiated species [cis-{Li[&mgr;-N(t-Bu)CH(2)CH(2)N(H)t-Bu]}(2)], 2, and [{Li[N(t-Bu)CH(2)CH(2)N(H)t-Bu]}(2)Li{N(t-Bu)CH(2)CH(2)Nt-Bu}Li], 3, prior to the formation of the dilithiated species {Li[N(t-Bu)CH(2)CH(2)Nt-Bu]Li}, 4. The solid state structures of 2, 3, and a dimeric form of 4 (4a) have been determined. A sparingly soluble form of 4 (4b) has also been isolated which has a proposed polymeric ladder structure. These structures are discussed with respect to the alternatives available for the aggregation of the dilithiated species; stacking to form dimeric Li(4)N(4) cages and laddering to form Li(n)()N(n)() ladders. Ab initio molecular orbital calculations give insight into the energetics of these aggregates and the possible structures adopted by solvated and unsolvated dilithium ethylenediamide complexes. Crystals of 2 are monoclinic, of space group C2/c (No. 15), a = 19.222(7), b = 8.734(2), c = 17.149(5) ?, beta = 119.40(1) degrees, Z = 4. Crystals of 3are monoclinic, of space group P2(1)/c (No. 14), a = 9.836(8), b = 17.821(3), c = 21.78(2) ?, beta = 101.57(4) degrees, Z = 4. Crystals of 4a are monoclinic, of space group P2(1)/c (No. 14), a = 15.990(7), b = 10.0162(9), c = 16.42(1) ?, beta = 104.49(2) degrees, Z = 4. Crystals of 6 are monoclinic, of space group P2(1)/c (No. 14), a = 10.124(8), b = 17.861(3), c = 22.21(2) ?, beta = 102.05(4) degrees, Z = 4. 相似文献
7.
Dark-red crystals of the new compound Li(4)[(UO(2))(10)O10(Mo(2)O(8))] (1) have been obtained by high-temperature solid-state reactions. The structure of 1 (monoclinic, P2(1)/c, a = 7.9426(4) A, b = 19.9895(9) A, c = 10.0796(5) A, beta = 90.575(2) degrees, V = 1600.24(13) A(3), Z = 4) consists of a framework of U and Mo polyhedra with Li+ cations in the channels. The framework contains seven-polyhedra-wide uranium oxide tapes interlinked by dimers of edge-sharing [4 + 1]-distorted MoO(5) polyhedra. The U-O tapes are parallel to the a axis, and their planes are oriented parallel to (021) and (02) so that they are cross-linked within the framework. The core of the tapes consists of unprecedented one-dimensional arrays of cation-cation-bonded uranyl ions. The arrays are constructed from eight-membered cycles with uranyl ions linked through two- and three-center cation-cation interactions. 相似文献
8.
LiEuPSe4, the first quaternary lithium-containing selenophosphate, was synthesized as red polyhedra by reacting Eu with a molten mixture of Li2Se/P2Se5/Se at 750 degrees C. Similarly, the reaction of Eu with a molten mixture of K2Se/P2Se5/Se at 495 degrees C produced red polyhedral crystals of KEuPSe4. Both compounds are unstable in moist air. In addition, both compounds were plagued with crystal twinning. Acceptable crystal structure refinements could only be obtained by identifying the type of twinning and taking it into account in the final refinement. LiEuPSe4 crystallizes in the noncentrosymmetric space group Ama2 (no. 40) with a = 10.5592 (9) A, b = 10.415 (1) A, c = 6.4924(7) A, and Z = 4. The structure is three-dimensional and composed of EuSe8 distorted square antiprisms and PSe4 tetrahedral building blocks that create tunnels, running down the a axis, in which the Li ions reside. The Li ions are in a highly distorted tetrahedral coordination. KEuPSe4 crystallizes in the space group P2(1)/m (no. 11) with a = 6.8469(6) A, b = 6.9521(6) A, c = 9.0436(8) A, beta = 107.677(2) degrees, and Z = 2. The structure has two-dimensional character with layers composed of EuSe6 trigonal prisms and PSe4 tetrahedral units. Between the [EuPSe4]nn- layers the K ions reside in a bicapped trigonal prism of Se atoms. The structure of the [EuPSe4]nn- framework is similar to that found in CsPbPSe4. Both compounds are semiconductors with band gaps of 2.00 and 1.88 eV, respectively. Differential thermal analysis and infrared spectroscopic characterization are also reported. 相似文献
9.
The crystal structure of Li80Ba39N9, a new representative of alkali-alkaline-earth metal subnitrides prepared from the metals and barium azide, was investigated based on single-crystal X-ray diffraction data. The compound has a novel crystal structure with a tetragonal unit cell, space group I(-)42m, a = 16.0763(8) A, c = 32.267(2) A, Z = 2, and V = 8330.0(8) A3. The structure can be described in terms of subnitride clusters with internal ionic bonding and metallic bonding in the rest of the space. The compound contains a new cluster Li12Ba5N6 and polytetrahedral Li clusters based on centered Li13 icosahedra, which are typical for Li-rich intermetallic compounds. 相似文献
10.
The synthesis and crystal structures of new ternary aluminum chalcogenides, LiAlSe2, alpha-LiAlTe2, and beta-LiAlTe2, are reported. These compounds are synthesized by solid-state reaction at 800 degrees C. The single-crystal X-ray structures of these compounds have been determined. LiAlSe2: a = 68228(9) A, b = 8266(1) A, c = 65236(7) A, Pna2(1) (No 33, Z = 4) alpha-LiAlTe2: a = 65317(4) A, c = 116904(9) A, I42d (No 122, Z = 4) beta-LiAlTe2: a = 44810(6) A, c = 7096(1) A, P3m1 (No 156, Z = 1). These ternary compounds are formed by fusion of AlQ4 (Q = Se, Te) tetrahedra. LiAlSe2 shows beta-NaFeO2 structure type, which can be viewed as a wurtzite superstructure. alpha-LiAlTe2 adopts chalcopyrite structure type. In LiAlSe2 and alpha-LiAlTe2, AlQ4 (Q = Se, Te) tetrahedra share four corners to build three-dimensional structures and Li atoms are located in the tetrahedral sites between the chalcogen layers. beta-LiAlTe2 has polar layers formed by three-corner shared AlTe4 tetrahedra, and Li cations are in the distorted antiprisms between the layers. 7Li MAS NMR studies show that chemical shifts of Li in these ternary chalcogenides are nearly identical regardless of different chemical environments. 相似文献
11.
1. The system Li? Cu? P was investigated by phase analysis. The samples were prepared at 500–600°C. The resulting ternary phases were characterized mainly by x-ray investigation. 2. At 560°C the range of homogeneity of Cu 3 P lies between 25.6–26.7 atomic % P. Cu3P forms a high-temperature (HT) modifikation, which crystallizes in a hexagonal subcell of the low-temperature (TT) modification (Z = 6): a = 4.09, c = 7.19 Å, c/a = 1.76; Z = 2 at 560°C. The intensities of the HT-powder pattern could be explained by a model in the space group P3 ml—D33d, which was deduced from TT-Cu3P. 3. Li 2 CuP , which can be derived from Li3P, crystallizes hexagonally with a = 16.18, c = 7.724 Å; c/a = 0.477; Z = 32. In the structure, copper occupies the Li position with lowest number and coordination. 4. LiCu 2 P also crystallizes hexagonally with a = 12.08, c = 7.39 Å; c/a = 0.71; Z = 18. In the direction [001] there is a disordered superlattice. The lattice constants of the high-temperature modification of LiCu2P, which are related to those of HT-Cu3P, at 520°C are: a = 4.08, c = 7.44 Å; c/a = 1.82; Z = 2. The interpretation of the intensities of the powder patterns did not result in a plain model related to HT-Cu3P when calculated for the space group P3 m1—D33d. 5. LiCu 2 P 2 crystallizes tetragonally with a = 3.887, c = 9.554 Å; c/a = 2.46; Z = 2. The structure determination gave the D13-type lattice. The space group is No. 139 I4/mmm—D174h, the atoms occupy the following positions: 2 Li in (2a), 4 Cu in (4d) and 4 P in (4e) with z = 0.388. The compound shows P2 groups parallel to [001] with a P? P distance of 2.14 Å. 6. Li 1,75 Cu 1,25 P 2 crystallizes orthorhombically with a = 3.874, b = 12.668, c = 8.743 Å; Z = 6. The crystal structure has been determined. The atoms occupy the following positions within the space group No. 71 Immm—D152h: 2 Li in (2a), 4 Li in (4g) with y = 0.27, 4 Li in (4j) with z = 0.33, 7.5 Cu in (8l) with y = 0.127 and z = 0.267, 8 P in (8l) with y = 0.352 and z = 0.377, and 4 P in (4h) with y = 0.085. This structure, too, is dominated by the occurence of P2 groups, which are oriented as well parallel [001] as parallel [010]. 相似文献
12.
The "anti-crown" B-hexamethyl 9-mercuracarborand-3 (1) was shown to complex halide ions (I-, Br-, Cl-) in an eta(3)-sandwich fashion. Symmetry-allowed interactions of the filled halide ion p-orbitals and the corresponding empty mercury p-orbitals result in three equivalent p(Hg)-p(halide)-p(Hg) three-center two-electron bonds and a sandwich structure. The molecular structures of [Li.(H(2)O)(4)][1(2).I].2CH(3)CN, MePPh(3)[1(2).Br].((CH(3))(2)CO)(2).(H(2)O)(2), and PPN[1(2).Cl] were determined by single-crystal X-ray diffraction studies. Compound [Li.(H(2)O)(4)][1(2).I].2CH(3)CN crystallized in the triclinic space group P-1, a = 13.312(8) A, b = 13.983(9) A, c = 13.996(9) A, alpha = 61.16(2) degrees, beta = 82.34(2) degrees, gamma = 86.58(2) degrees, V = 4365(2) A(3), Z = 1, R = 0.063, and R(w) = 0.171. Compound MePPh(3)[1(2).Br].((CH(3))(2)CO)(2).(H(2)O)(2) crystallized in the monoclinic space group C2/c, a = 24.671(8) A, b = 17.576(6) A, c = 26.079(8) A, beta = 106.424(6) degrees, V = 10847(6) A(3), Z = 8, R = 0.0607, and R(w) = 0.1506. Compound PPN[1(2).Cl] crystallized in the monoclinic space group C2/m, a = 37.27(2) A, b = 29.25(1) A, c = 10.990(4) A, beta = 100.659(7) degrees, V = 11774(8) A(3), Z = 4, R = 0.0911, and R(w) = 0.2369. 相似文献
13.
The structures of two novel Zintl phases, Ba6Mg5.2Li2.8Si12 and BaMg0.1Li0.9Si2, are presented. Both compounds contain chains in cis-trans conformation. The silicon partial structure of Ba6Mg5.2Li2.8Si12 (C2/m; a = 1212.0(1), b = 459.78(4), c = 1129.10(9) pm; beta = 91.77(2) degrees; Z = 1) is built of unbranched, planar Si6 chains while BaMg0.1Li0.9Si2 (Pnma; a = 725.92(5), b = 461.36(3), c = 1169.08(8) pm; Z = 4) consists of infinite Si(n) chains. The compounds show all electronic and structural characteristics that are typical for the special subset of Zintl phases with highly charged planar anions. The structures of the new compounds, as well as that of Ba2Mg3Si4, can be derived from the common parent type BaMg2Si2. It is shown that a comprehensive picture of a chemical twinning based on BaMg2Si2 can be derived. 相似文献
14.
<正> The crystal structure of Nd3+: Li6Y(BO3)3 is monoclinic, belonging to space group P21/c with the following cell constants:a =7. 157(5),b=16. 378(8),c = 6. 623(4)A.B=105. 32(5) ,Z=4,F =748. 8A3,Dc=2.747g/cm3. Mr (Li6Nd0.027 Y0.973(BO3)3) = 308. 47. The structure unit Li6Y(BO3)3 contains three B-O triangle planes,a distorted Y-O tetragonal prism,and five distorted Li-O trigonal bipyramids and one Li-O tetrahedron. 相似文献
15.
Single crystals of Sr3Li6M2O11 (M = Nb, Ta) were grown out of a high-temperature Sr(OH)2/LiOH/KOH flux. The single crystal X-ray diffraction data were indexed to the orthorhombic Pmma system, with a = 10.5834(15) A, b = 8.3103(13) A, c = 5.8277(8) A, V = 512.55(13) A(3), and Z = 2 for Sr3Li6Nb2O11 and a = 10.5936(6) A, b = 8.3452(5) A, c = 5.8271(4) A, V = 515.15(6) A(3), and Z = 2 for Sr3Li6Ta2O11. The crystal structure consists of sheets of interconnected SrO8 polyhedra that are separated by M-O layers and an intervening LiO(x) polyhedral framework, representing a new structural type. The M-O layers exhibit a rare occurrence of both five- and six-coordinated M(5+) ions in the same structure. The oxides, upon excitation at 250 nm, exhibit violet emission at room temperature. 相似文献
16.
The construction of two unique, high-nuclearity Cu(II) supramolecular aggregates with tetrahedral or octahedral cage units, [(mu(3)-Cl)[Li subset Cu(4)(mu-L(1))(3)](3)](ClO(4))(8)(H(2)O)(4.5) (1) and [[Na(2) subset Cu(12)(mu-L(2))(8)(mu-Cl)(4)](ClO(4))(8)(H(2)O)(10)(H(3)O(+))(2)](infinity) (2) by alkali-metal-templated (Li(+) or Na(+)) self-assembly, was achieved by the use of two newly designed carboxylic-functionalized diazamesocyclic ligands, N,N'-bis(3-propionyloxy)-1,4-diazacycloheptane (H(2)L(1)) or 1,5-diazacyclooctane-N,N'-diacetate acid (H(2)L(2)). Complex 1 crystallizes in the trigonal R3c space group (a = b = 20.866(3), c = 126.26(4) A and Z = 12), and 2 in the triclinic P1 space group (a = 13.632(4), b = 14.754(4), c = 19.517(6) A, alpha = 99.836(6), beta = 95.793(5), gamma = 116.124(5) degrees and Z = 1). By subtle variation of the ligand structures and the alkali-metal templates, different polymeric motifs were obtained: a dodecanuclear architecture 1 consisting of three Cu(4) tetrahedral cage units with a Li(+) template, and a supramolecular chain 2 consisting of two crystallographically nonequivalent octahedral Cu(6) polyhedra with a Na(+) template. The effects of ligand functionality and alkali metal template ions on the self-assembly processes of both coordination supramolecular aggregates, and their magnetic behaviors are discussed in detail. 相似文献
17.
The ternary imide Li(2)Ca(NH)2 was successfully synthesized by dehydrogenating a mixture of LiNH(2) and CaH(2) at a molar ratio of 2:1 in a stream of purified argon at 300 degrees C. A powder X-ray diffraction measurement revealed that Li(2)Ca(NH)2 was of the trigonal anti-La(2)O(3) structure (space group Pm1) with lattice constants of a = 3.5664(3)A and c = 5.9540(8) A. Ca occupied the 1b site (0, 0, 1/2), Li occupied the 2d site (1/3, 2/3, 0.8841(22)), and N occupied the 2d site (1/3, 2/3, 0.2565(15)). Nuclear magnetic resonance and X-ray absorption fine structure analyses demonstrated that each Li ion was coordinated with four imide ions and each Ca ion was coordinated with six imide ions. 相似文献
18.
A new rubidium zinc hydrogen phosphate, Rb2Zn2(HPO4)3, is prepared by an unusual method utilizing long nucleation times. This material is crystallized from a gel with an initial composition of 1.0 ZnO/0.94 P2O5/0.96 Rb2O/0.04 Li2O/41 H2O, while the phosphate concentration equals 1.6 M and pH = 3.5. The gel is placed in a sealed Pyrex flask at 52 degrees C, and after 4.5 months crystallization of Rb2Zn2(HPO4)3 is noticed. This new crystalline compound has a three-dimensional framework structure built from spiral chains of alternating PO4 and ZnO4 tetrahedra connected pairwise and assembled by other PO4 tetrahedra, rubidium ions, and hydrogen bonds. The two rubidium ions, Rb(1) and Rb(2), have an exceptionally low number of oxygen contacts in the first coordination sphere, five and seven, respectively. Crystal data: monoclinic, P2(1)/c (no. 14), a = 12.5880(4), b = 12.7170(8), c = 7.5827(8) A, beta = 96.100(1) degrees, Z = 4. A single-crystal 31P NMR investigation of Rb2Zn2(HPO4)3 was performed employing a two-axis goniometer probe and reveals the presence of three chemically and six magnetically nonequivalent phosphorus sites, in accordance with the crystal structure. 31P chemical shielding anisotropies and isotropic chemical shifts (-3.3(3), -2.6(3), and 2.0(3) ppm) have been determined for the three phosphorus sites. 相似文献
19.
Two Np(5+) silicates, Li(6)(NpO(2))(4)(H(2)Si(2)O(7))(HSiO(4))(2)(H(2)O)(4) (LiNpSi1) and K(3)(NpO(2))(3)(SiO(3)OH)(2) (KNpSi1), were synthesized by hydrothermal methods. The crystal structures were determined using direct methods and refined on the basis of F(2) for all unique data collected with Mo Kalpha radation and an APEX II CCD detector. LiNpSi1 crystallizes in orthorhombic space group Pnma with a =13.189(6) A, b = 7.917(3) A, c = 10.708(5) A, V = 1118.1(8) A3, and Z = 2. KNpSi1 is hexagonal, P62m, a = 9.734(1) A, c = 3.8817(7) A, V = 318.50(8) A3, and Z = 1. LiNpSi1 contains chains of edge-sharing neptunyl pentagonal bipyramids linked into two-dimensional sheets through direct linkages between the neptunyl polyhedra and the vertex sharing of the silicate tetrahedra. The structure contains both sorosilicate and nesosilicate units, resulting in a new complex neptunyl silicate sheet. KNpSi1 contains edge-sharing neptunyl square bipyramids linked into a framework structure through the sharing of vertices with the silicate tetrahedra. The neptunyl silicate framework contains channels approximately 6.0 A in diameter. These structures exhibit significant departures from other reported Np(5+) and U(6+) compounds and represent the first reported Np(5+) silicate structures. 相似文献
20.
Unverfehrt L Ströbele M Glaser J Langer T Hoffmann RD Pöttgen R Meyer HJ 《Inorganic chemistry》2011,50(13):6010-6018
The new europium fluoride carbodiimide Eu(4)F(5)(CN(2))(2) was synthesized by solid state reaction from mixtures of EuF(3) and Li(2)(CN(2)) at 700 °C. The crystal structure as refined by single crystal X-ray diffraction (P ?42(1)c, no. 114, a = 16.053(1) ?, c = 6.5150(6) ?, Z = 8) reveals three crystallographically distinct [N═C═N](2-) ions in the structure of mixed-valent Eu(4)F(5)(CN(2))(2). The presence of one Eu(3+) and three Eu(2+) per formula unit Eu(4)F(5)(CN(2))(2) is confirmed by magnetic measurements and (151)Eu-Mo?ssbauer spectroscopy. The arrangement of Eu ions and gravity centers of [NCN](2-) ions in the structure of Eu(4)F(5)(CN(2))(2) follow the motif formed by atoms in the CuAl(2)-type structure. A possible high-symmetry structure of Eu(4)F(5)(CN(2))(2) is discussed on the basis of a group-subgroup scheme. 相似文献