X-ray crystal structures of [XF(6)][Sb(2)F(11)] (X = Cl, Br, I); (35,37)Cl, (79,81)Br, and (127)I NMR studies and electronic structure calculations of the XF(6)(+) cations

The single-crystal X-ray structures of [XF(6)][Sb(2)F(11)] (X = Cl, Br, I) have been determined and represent the first detailed crystallographic study of salts containing the XF(6)(+) cations. The three salts are isomorphous and crystallize in the monoclinic space group P2(1)/n with Z = 4: [ClF(6)][Sb(2)F(11)], a = 11.824(2) A, b = 8.434(2) A, c = 12.088(2) A, beta = 97.783(6) degrees , V = 1194.3(4) A(3), R(1) = 0.0488 at -130 degrees C; [BrF(6)][Sb(2)F(11)], a = 11.931(2) A, b = 8.492(2) A, c = 12.103(2) A, beta = 97.558(4) degrees , V = 1215.5(4) A(3), R(1) = 0.0707 at -130 degrees C; [IF(6)][Sb(2)F(11)], a = 11.844(1) A, b = 8.617(1) A, c = 11.979(2) A, beta = 98.915(2) degrees , V = 1207.8(3) A(3), R(1) = 0.0219 at -173 degrees C. The crystal structure of [IF(6)][Sb(2)F(11)] was also determined at -100 degrees C and was found to crystallize in the monoclinic space group P2(1)/m with Z = 4, a = 11.885(1) A, b = 8.626(1) A, c = 12.000(1) A, beta = 98.44(1), V = 1216.9(2) A(3), R(1) = 0.0635. The XF(6)(+) cations have octahedral geometries with average Cl-F, Br-F, and I-F bond lengths of 1.550(4), 1.666(11) and 1.779(6) [-173 degrees C]/1.774(8) [-100 degrees C] A, respectively. The chemical shifts of the central quadrupolar nuclei, (35,37)Cl, (79,81)Br, and (127)I, were determined for [ClF(6)][AsF(6)] (814 ppm), [BrF(6)][AsF(6)] (2080 ppm), and [IF(6)][Sb(3)F(16)] (3381 ppm) in anhydrous HF solution at 27 degrees C, and spin-inversion-recovery experiments were used to determine the T(1)-relaxation times of (35)Cl (1.32(3) s), (37)Cl (2.58(6) s), (79)Br (24.6(4) ms), (81)Br (35.4(5) ms), and (127)I (6.53(1) ms). Trends among the central halogen chemical shifts and T(1)-relaxation times of XF(6)(+), XO(4)(-), and X(-) are discussed. The isotropic (1)J-coupling constants and reduced coupling constants for the XF(6)(+) cations and isoelectronic hexafluoro species of rows 3-6 are empirically assessed in terms of the relative contributions of the Fermi-contact, spin-dipolar, and spin-orbit mechanisms. Electronic structure calculations using Hartree-Fock, MP2, and local density functional methods were used to determine the energy-minimized gas-phase geometries, atomic charges, and Mayer bond orders of the XF(6)(+) cations. The calculated vibrational frequencies are in accord with the previously published assignments and experimental vibrational frequencies of the XF(6)(+) cations. Bonding trends within the XF(6)(+) cation series have been discussed in terms of natural bond orbital (NBO) analyses, the ligand close-packed (LCP) model, and the electron localization function (ELF).     

Study of the coordination and solution structures for the interaction systems between diperoxidovanadate complexes and 4-(pyridin-2-yl)pyrimidine-like ligands

To understand the substitution effects of 4-(pyridin-2-yl)pyrimidine (pprd) on the coordination reaction equilibria, the interactions between a series of the pprd-like ligands and [OV(O(2))(2)(H(2)O)](-) or [OV(O(2))(2)(HOD)](-) or [OV(O(2))(2)(D(2)O)](-) (bpV) have been explored by a combination of multinuclear ((1)H, (13)C, and (51)V) magnetic resonance, heteronuclear single quantum coherence (HSQC) and variable temperature NMR in a 0.15 mol L(-1) NaCl D(2)O solution that mimics physiological conditions. The direct NMR data are reported for the first time. Competitive coordination interactions result in a series of new hepta-coordinated peroxidovanadate species [OV(O(2))(2)LL'](-) (LL' = pprd-like chelating ligands). The equilibrium constants for the products between bpV and the pprd-like ligands show that the relative affinity of the ligands is pprd ≈ 2-NH(2)-pprd > 2-Me-pprd > 2-Et-pprd > 4-(6-methylpyridin-2-yl)pyrimidine (abbr. 6'-Me-pprd). When the ligand is pprd, a pair of isomers (Isomer A and B) are observed in aqueous solution, which are attributed to the different types of coordination modes between the metal and the ligands, while the crystal structure of NH(4)[OV(O(2))(2)(pprd)]·2H(2)O has the same coordination structure as Isomer A. For substituted pprd ligands, however, only one type of structure (Isomer A or B ) is observed in solution. These results demonstrate that, when the aromatic ring has a substitution group, both the steric effect (from the alkyl) and hydrogen bonding (from the amine) can affect the coordination reaction equilibrium to prevent the appearance of either Isomer B in solution for the ligands 2-Me-pprd, 2-NH(2)-pprd, 2-Et-pprd, or Isomer A in solution for 6'-Me-pprd.     

Novel 1D Cu(I) coordination polymers formed by the combination of Cu(I) halides and 4-(2-pyridyl)pyrimidine

Three novel 1D Cu(I) coordination polymers [Cu₄X₄(pprd)₂]_n (X = Cl(1), Br(2) and I(3); pprd = 4-(2-pyridyl)pyrimidine) were systematically synthesized by Cu(I) halides and the pprd ligand, and they have been characterized by X-ray, IR, and TG-DTA analyses. The molecular structure of complex 1 essentially resembles to that of complex 2. In complexes 1 and 2, four Cu(I) atoms are bridged by four Cl or Br anions to form an eight-membered Cu₄X₄ framework in the twist-chair form. Furthermore, the Cu₄X₄ frameworks are coordinated by the chelate and bridging sites of two pprd ligands to form a unique 1D two-stepped Cu(I) coordination polymer, in which two stairs are formed by the Cu₄X₄ core and two heteroaromatic planes of pprd. In the crystal packing structures, it is interesting that two heteroaromatic planes of pprd are stacking along the b-axis for complex 1 and the a-axis for complex 2. In contrast, four Cu(I) atoms in complex 3 are bridged by four I atoms to form a Cu₄I₄ stepped cubane tetramer. Additionally, the Cu₄I₄ stepped cubane cores are linked by the chelate and bridging sites of two pprd ligands to form an infinite 1D zigzag-chain Cu(I) coordination polymer. The thermal decomposition behaviors for Cu(I)–X/pprd complexes 1, 2 and 3 were determined by thermogravimetric analysis (TG-DTA). Although the thermal decomposition behaviors of complex 1 were unidentified, those of complexes 2 and 3 were assigned. The mass loss at the first stage of thermal decomposition for polymeric [Cu₄X₄(pprd)₂]_n was identical to the formation of oligomeric [Cu₄X₄(pprd)] by the elimination of one pprd molecule. The mass loss at the next stage was decided to the formation of Cu₄X₄ by the elimination of another pprd molecule.     

Two enantiomers of [Cu(3)(mnt)(3)](3-) as ligands to Cu(i) or Ag(i) in building [Cu(6)M(2)(mnt)(6)](4-) complexes (M = Cu or Ag) with the reversal of the reaction by X(-) (X = Cl, Br)

Two enantiomers of [Bu(4)N](3)[Cu(3)(mnt)(3)] () formed by Na(2)(mnt) (mnt = maleonitriledithiolate, [S(2)C(2)(CN)(2)](2-)) and CuCl in a 1 : 1 molar ratio react further with MCl (M = Cu or Ag) involving both the enantiomers of to produce the larger complex, [Bu(4)N](4)[Cu(6)M(2)(mnt)(6)] (M = Cu (2), Ag (3)) from which the capped Cu(+) or Ag(+) ion can readily be removed by Bu(4)NX (X = Cl, Br), reverting or back to . Such reversal does not work with non-coordinating anions like BF(4)(-), ClO(4)(-) and PF(6)(-).     

New structural features in triphenylphosphinesilver(I) sulfanylcarboxylates

We investigated the reactions of 1.5 : 1 : 1 mole ratio mixtures of triphenylphosphine, silver nitrate and 3-(aryl)-2-sulfanylpropenoic acids H(2)xspa in chloroform/water, where in the acid nomenclature, spa = 2-sulfanylpropenoato and x = p, Clp, mp, diBr-o-hp or f with p = 3-phenyl-, Clp = 3-(2-chlorophenyl)-, mp = 3-methoxyphenyl-, diBr-o-hp = 3-(3,5-dibromo-2-hydroxyphenyl)- and f = 3-(2-furyl)-. The compounds [Ag(PPh(3))(Hpspa)](1), [(AgPPh3)2(xspa)][x = Clp (2), o-mp (3), p-mp (4), diBr-o-hp (5) and f (6)] and [Ag(PPh3)3(Hfspa)](7) were isolated and all except 7 were characterized by IR, Raman and FAB mass spectrometry and by 1H, 13C and 31P NMR spectroscopy. Compound 6 was also characterized by (13)C CP/MAS, and compounds 1 and 6 by (109)Ag NMR spectroscopy. The crystal structures of 1, 2, 3, 4.(CH3)2CO, 5, 6.(CH3)2CO and 7 were determined by X-ray diffraction. has a supramolecular structure based on hydrogen bonding between dinuclear units, and all the other complexes adopt discrete structures. 2, 3, 4.(CH3)2CO, 5, and 6.(CH3)2CO are tetranuclear, and 7 mononuclear. The tetranuclear complexes contain the eight-membered coordination ring Ag4S2O2 (2, 3, 4.(CH3)2CO, 6.(CH3)2CO) or the twelve-membered ring Ag4(CO2)2S2 (5).     

Ring-opening polymerization of coordination complexes: silver(I) complexes with bis(amidopyridine) ligands derived from thiophene

The thiophene-based bis(N-methylamido-pyridine) ligand SC4H2-2,5-{C(=O)N(Me)-4-C5H4N}2 reacts with silver(I) salts AgX to give 1 : 1 complexes, which are characterized in the solid state as the macrocyclic complexes [Ag(2){SC4H2-2,5-(CONMe-4-C5H4N)2}2][X]2, which have the cis conformation of the C(=O)N(Me) group, when X = CF3CO2, NO3, or CF3SO3 but as the polymeric complex [Ag(n){SC4H2-2,5-(CONMe-4-C5H4N)2}n][X]n, with the unusual trans conformation of the C(=O)N(Me) group, when X = PF6. The bis(amido-pyridine) ligand SC4H2-2,5-{C(=O)NHCH2-3-C5H4N}2 reacts with silver(I) trifluoroacetate to give the polymeric complex [Ag(n){SC4H2-2,5-(CONHCH2-3-C5H4N)2}n][X]n, X = CF3CO2. The macrocyclic complexes contain transannular argentophilic secondary bonds. The polymers self assemble into sheet structures through interchain C=O...Ag and S...Ag bonds in [Ag(n){SC4H2-2,5-(CONMe-4-C5H4N)2}n][PF6]n and through Ag...Ag, C=O...Ag and Ag...O(trifluoroacetate)...HN secondary bonds in [Ag(n){SC4H2-2,5-(CONHCH2-3-C5H4N)2}n][CF3CO2]n.     

Synthesis and characterization of new coordination polymers generated from bent bis(cyanophenyl)oxadiazole ligands and Ag(I) salts

Two new bent bis(cyanophenyl)oxadiazole ligands, 2,5-bis(4-cyanophenyl)-1,3,4-oxadiazole (L7) and 2,5-bis(3-cyanophenyl)-1,3,4-oxadiazole (L8), were synthesized. The coordination chemistry of these ligands with various Ag(I) salts has been investigated. Seven new coordination polymers, namely, {[Ag(L7)(H2O)]ClO4}n) (1) (triclinic, P1, a = 9.342(4) A, b = 9.889(4) A, c = 10.512(4) A, alpha = 68.978(6) degrees, beta = 78.217(6) degrees, gamma = 81.851(7) degrees, Z = 2), {[Ag(L7)]SO3CF3}n (2) (monoclinic, P2(1)/n, a = 7.559(2) A, b = 23.739(6) A, c = 10.426(3) A, beta = 108.071(4) degrees, Z = 4), {[Ag(L8)]BF4 x 0.5(C6H6) x H2O}n (3) (triclinic, P1, a = 7.498(3) A, b = 10.649(4) A, c = 13.673(5) A, alpha = 98.602(5) degrees, beta = 100.004(5) degrees, gamma =110.232(5) degrees, Z = 2), {[Ag(L8)SbF6] x H2O}n (4) (triclinic, P1, a = 8.2621(9) A, b = 10.6127(12) A, c = 13.3685(15) A, alpha = 98.012(2) degrees, beta = 106.259(2) degrees, gamma = 112.362(2) degrees, Z = 2), {[Ag2(L8)2(SO3CF3)] x H2O}n (5) (triclinic, P1, a = 10.713(4) A, b = 13.449(5) A, c = 15.423(5) A, alpha = 65.908(5) degrees, beta = 74.231(5) degrees, gamma = 83.255(5) degrees, Z = 2), {[Ag2(L8)(C6H6)(ClO4)] x ClO4}n (6) (monoclinic, P2(1)/n, a = 6.9681(17) A, b = 20.627(5) A, c = 17.437(4) A, beta = 95.880(4) degrees, Z = 4), and {[Ag2(L8)(H2PO4)2]}n (7) (triclinic, P1, a = 7.956(2) A, b = 9.938(3) A, c = 14.242(4) A, alpha = 106.191(4) degrees, beta = 97.322(4) degrees, gamma = 107.392(4) degrees, Z = 1), were obtained by the combination of L7 and L8 with Ag(I) salts in a benzene/methylene chloride mixed-solvent system and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescence and electrical conductance properties of compounds 1-6 and the host-guest chemistry of compound 3 were investigated.     

Organometallic coordination polymers generated from bent Bis(acetylenylphenyl)oxadiazole ligands and Ag(I) salts

Two new bent oxadiazole bridging benzoacetylene ligands 2,5-bis(4-ethynylphenyl)-1,3,4-oxadiazole (L9) and 2,5-bis(3-ethynylphenyl)-1,3,4-oxadiazole (L10) were synthesized. The coordination chemistry of them with various inorganic Ag(I) salts has been investigated. Seven new coordination polymers were prepared by solution reactions and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. [Ag2(L9)](SO3CF3)2 (1) (triclinic, P; a =10.292(4), b = 10.794(4), c = 11.399(5) A; alpha = 98.894(5), beta = 102.360(6), gamma = 90.319(5) degrees ; Z = 2), [Ag(L9)]SbF6 (2) (orthorhombic, Cmca; a = 19.059(9), b = 12.922(6), c = 15.609(7) A; Z = 8), [Ag(L9)]BF4 (3) (orthorhombic, Cmca; a = 19.128(3), b = 12.6042(18), c = 28.003(4) A; Z = 16), [Ag(L9)]ClO4 (4) (monoclinic, P2(1)/c; a = 8.5153(16), b = 19.722(4), c = 10.320(2) A; beta = 105.307(3) degrees ; Z = 4), [Ag(L10)]SO3CF3 (5) (triclinic, P; a = 9.0605(13), b = 10.4956(15), c = 10.8085(16) A; alpha = 101.666(2), beta = 109.269(2), gamma = 100.944(2) degrees ; Z = 2), [Ag(L10)(H2O)(0.5)]BF4.0.5H2O (6) (monoclinic, C2/m; a = 32.180(6), b = 17.027(3), c = 8.1453(15) A; beta = 102.541(3) degrees ; Z = 8), and {[Ag2(L10)2(H2O)](ClO4)2}.o-xylene (7) (monoclinic, P2(1)/c; a = 8.1460(10), b = 17.326(2), c = 30.345(4) A; beta = 97.71 degrees ; Z = 4) were obtained by the combination of L9 and L10 with various Ag(I) salts in a benzene/methylene chloride mixed solvent system. In addition, the luminescent and electrical conductive properties of these new compounds were investigated.     

Silver(I) Complexes of the Derivatized Crown Thioether Ligands 3,6,9,12,15,18-Hexathianonadecanol and 3,6,9,13,16,19-Hexathiaicosanol. Determination of Stability Constants and the Crystal Structures of [Ag(19-aneS6-OH)][CF(3)SO(3)] and [Ag(20-aneS6-OH)][BF(4)

The derivatized 19- and 20-membered macrocyclic thio crowns 3,6,9,12,15,18-hexathianonadecanol C(13)H(26)OS(6) (19-aneS6-OH) (1) and 3,6,9,13,16,19-hexathiacycloicosanol C(14)H(28)OS(6) (20-aneS6-OH) (2) have been synthesized by [1 + 1] cyclization in about 30% yield. The ligands 1 and 2 react readily at room temperature with different silver(I) salts in water and in organic solvents to form in quantitative yields the complexes [Ag(19-aneS6-OH)](+) (3) and [Ag(20-aneS6-OH)](+) (4) for which crystals of X-ray quality were grown by slow diffusion of diethylether into methanol. [Ag(19-aneS6-OH)][CF(3)SO(3)] crystallizes in the triclinic space group P&onemacr; with Z = 2, a = 10.760(1), b = 10.853(2) and c = 11.326(2)?, and alpha = 78.73(1), beta = 73.47(1), and gamma = 74.99(1) degrees. [Ag(20-aneS6-OH)][BF(4)] also crystallizes in the triclinic space group P&onemacr; with Z = 4. The unit cell constants were determined with a = 10.076(4), b = 10.525(3), and c = 22.135(8)?, alpha = 93.32(2), beta = 102.43(2), and gamma = 100.32(2) degrees. The complex cations [Ag(19-aneS6-OH)](+) and [Ag(20-aneS6-OH)](+) are coordinated through only four sulfur atoms; thus, a distorted tetrahedral coordination geometry is exhibited. In addition we found a highly asymmetric Ag-S bond lengths distribution throughout all complex cations. The stability constants of [Ag](+) with 1 and 2 and, for comparison with [18-aneS6] (5), have been determined in methanol by potentiometric [Ag](+) measurements. Log K values for the formation of 3, 4, and [Ag(18-aneS6](+) (6) are 12.04 +/- 0.19, 11.49 +/- 0.15, and 12.67 +/- 0.13 respectively. Owing to a comparable macrocyclic effect, the similar log K values are reasonable but, since 6 coordinates octahedrally, not expected. (1)H and (13)C NMR investigations at various temperatures give evidence for fluxional coordinative behavior between all six sulfur atoms in solution. Consequently [Ag(19-aneS6-OH)](+), [Ag(20-aneS6-OH)](+), and [Ag(18-aneS6](+) seem to exhibit principally the same solution structures although the solid structures are very different.     

Subtle role of polyatomic anions in molecular construction: structures and properties of AgX bearing 2,4'-thiobis(pyridine) (X(-) = NO(3)(-), BF(4)(-), ClO(4)(-), PF(6)(-), CF(3)CO(2)(-), and CF(3)SO(3)(-))

Studies on the subtle effects and roles of polyatomic anions in the self-assembly of a series of AgX complexes with 2,4'-Py(2)S (X(-) = NO(3)(-), BF(4)(-), ClO(4)(-), PF(6)(-), CF(3)CO(2)(-), and CF(3)SO(3)(-); 2,4'-Py(2)S = 2,4'-thiobis(pyridine)) have been carried out. The formation of products appears to be primarily associated with a suitable combination of the skewed conformers of 2,4'-Py(2)S and a variety of coordination geometries of Ag(I) ions. The molecular construction via self-assembly is delicately dependent upon the nature of the anions. Coordinating anions afford the 1:1 adducts [Ag(2,4'-Py(2)S)X] (X(-) = NO(3)(-) and CF(3)CO(2)(-)), whereas noncoordinating anions form the 3:4 adducts [Ag(3)(2,4'-Py(2)S)(4)]X(3) (X(-) = ClO(4)(-) and PF(6)(-)). Each structure seems to be constructed by competition between pi-pi interactions of 2,4'-Py(2)S spacers vs Ag.X interactions. For ClO(4)(-) and PF(6)(-), an anion-free network consisting of linear Ag(I) and trigonal Ag(I) in a 1:2 ratio has been obtained whereas, for the coordinating anions NO(3)(-) and CF(3)CO(2)(-), an anion-bridged helix sheet and an anion-bridged cyclic dimer chain, respectively, have been assembled. For a moderately coordinating anion, CF(3)SO(3)(-), the 3:4 adduct [Ag(3)(2,4'-Py(2)S)(4)](CF(3)SO(3))(3) has been obtained similarly to the noncoordinating anions, but its structure is a double strand via both face-to-face (pi-pi) stackings and Ag.Ag interactions, in contrast to the noncoordinating anions. The anion exchanges of [Ag(3)(2,4'-Py(2)S)(4)]X(3) (X(-) = BF(4)(-), ClO(4)(-), and PF(6)(-)) with BF(4)(-), ClO(4)(-), and PF(6)(-) in aqueous media indicate that a [BF(4)(-)] analogue is isostructural with [Ag(3)(2,4'-Py(2)S)(4)]X(3) (X(-) = ClO(4)(-) and PF(6)(-)). Furthermore, the anion exchangeability for the noncoordinating anion compounds and the X-ray data for the coordinating anion compounds establish the coordinating order to be NO(3)(-) > CF(3)CO(2)(-) > CF(3)SO(3)(-) > PF(6)(-) > ClO(4)(-) > BF(4)(-).     

Coordination chemistry of silver(I) with the nitrogen-bridged ligands (C(6)H(5))(2)PN(H)P(C(6)H(5))(2) and (C(6)H(5))(2)PN(CH(3))P(C(6)H(5))(2): the effect of alkylating the nitrogen bridge on ligand bridging versus chelating behavior

The coordination chemistry of silver(I) with the nitrogen-bridged ligands (C(6)H(5))(2)PN(R)P(C(6)H(5))(2) [R = H (dppa); R = CH(3) (dppma)] has been investigated by (31)P NMR and electrospray mass spectrometry (ESMS). Species observed by (31)P NMR include Ag(2)(mu-dppa)(2+), Ag(2)(mu-dppa)(2)(2+), Ag(2)(mu-dppa)(3)(2+), Ag(2)(mu-dppma)(2+), Ag(2)(mu-dppma)(2)(2+), and Ag(eta(2)-dppma)(2)(+). Species observed by ESMS at low cone voltages were Ag(2)(dppa)(2)(2+), Ag(2)(dppa)(3)(2+), Ag(2)(dppma)(2)(2+), and Ag(dppma)(2)(+). (C(6)H(5))(2)PN(CH(3))P(C(6)H(5))(2) showed a strong tendency to chelate, while (C(6)H(5))(2)PN(H)P(C(6)H(5))(2) preferred to bridge. Differences in the bridging versus chelating behavior of the ligands are assigned to the Thorpe-Ingold effect, where the methyl group on nitrogen sterically interacts with the phenyl groups on phosphorus. The crystal structure of the three-coordinate dinuclear silver(I) complex (Ag(2)[(C(6)H(5))(2)PN(H)P(C(6)H(5))(2)](3))(BF(4))(2) has been determined. Bond distances include Ag-Ag = 2.812(1) A, Ag(1)-P(av) = 2.492(3) A, and Ag(2)-P(av) = 2.509(3) A. The compound crystallizes in the monoclinic space group Cc at 294 K, with a = 18.102(4)(o), Z = 4, V = 7261(3) A(3), R = 0.0503, and R(W) = 0.0670.     

Spin-crossover behavior in cyanide-bridged iron(II)-silver(I) bimetallic 2D Hofmann-like metal-organic frameworks

Two new series of compounds formulated {Fe(3-Xpyridine)2[Ag(CN)2]2} (X = F (1), Cl (2), Br (3), I (4)) and {Fe(3-Xpyridine)2[Ag(CN)2][Ag(3-Xpyridine)(CN)2]}.3-Xpy (X = Br (5), I (6)) have been synthesized and characterized. The six compounds are made up of stacking of slightly corrugated two-dimensional coordination polymers defined by sharing {Fe4[Ag(CN)2]4}n motifs. The stacking is different for the two families. In compounds 1-4 the layers are organized by pairs displaying argentophilic interactions; the Ag...Ag distance was found to be in the interval 3.0-3.3 A, while the Ag...Ag separation between two consecutive layers belonging to different pairs was found to be around 6 A. Compounds 5 and 6 are isostructural with a crystal packing defined by an almost homogeneous distribution of layers separated by around 8.3 A (referred to the Fe...Fe interlayer distance). Between the layers an uncoordinated 3-Xpyridine molecule is included. Another 3-Xpyridine molecule, which remains in the plane defined by the {Fe4[Ag(CN)2]4}n windows, coordinates one silver atom. Both series display quite different properties; at 300 K, 1-4 are pale-yellow and display similar distorted [FeN6] octahedron cores characteristic of the iron(II) ion in the high-spin state. 1 and 2 undergo a two-step (T(1)1/2 = 96 K and T(2)1/2 = 162 K) and a 50% spin transition (T1/2 = 106 K), respectively. Compounds 3 and 4 are high-spin compounds at ambient pressure. 5 and 6 are deep red in color at 300 K and undergo spin-crossover behavior at significantly higher temperatures T1/2 = 306 and 261 K, respectively.     

New Ag(I)-containing coordination polymers generated from multidentate Schiff-base ligands

The coordination chemistry of the multidentate Schiff-base ligands 2,5-bis(3-methylpyrazinyl)-3,4-diaza-2,4-hexadiene (L5) and 2,5-bis(pyrazinyl)-3,4-diaza-2,4-hexadiene (L6) with inorganic Ag(I) salts has been investigated. Six new Ag(I)-coordination polymers were prepared by solution reactions and fully characterized by infrared spectroscopy, elemental analysis, thermogravimetric analysis, and single-crystal X-ray diffraction. [Ag(L5)]ClO(4).0.5CH(3)OH (1, orthorhombic, Fdd2; a = 20.0896(11) A, b = 48.224(3) A, c = 7.8432(4) A, Z = 16), [Ag(L5)]PF(6).0.5CH(3)OH (2, orthorhombic, Fdd2; a = 20.7255(11) A, b = 46.166(2) A, c = 8.4332(4) A, Z = 16), [Ag(L5)]SbF(6).0.5CH(3)OH (3, orthorhombic, Fdd2; a = 21.5481(11) A, b = 45.196(2) A, c = 8.7331(4) A, Z = 16), and [Ag(L5)](BF(4)).0.5CH(3)OH (4, orthorhombic, Fdd2; a = 19.8897(11) A, b = 48.358(3) A, c = 7.7491(5) A, Z = 16) were obtained by combination of L5 with AgClO(4).xH(2)O, AgPF(6), AgSbF(6), and AgBF(4), respectively, in a methylene chloride/methanol mixed solvent system. Compounds 1-4 are isostructural and feature noninterpenetrating three-dimensional zeolite-like networks. [Ag(4)(L6)(4)](PF(6))(4).CHCl(3) (5, tetragonal, Pc2; a = 16.1067(3) A, b = 16.1067(3) A, c = 14.4935(5) A, Z = 2) was generated from the reaction of L6 with AgPF(6) in a chloroform/ethanol mixed solvent system. It forms with a unique one-dimensional nanometer-tube that can be considered a new polymeric motif based on the [AgN5] coordination sphere. The tubes are square with crystallographic dimensions of 10.3 x 10.0 A. The tubes are further linked together through weak interpolymer C-H...F hydrogen bonding interactions into a novel H-bonded three-dimensional network containing square tubes, in which uncoordinated PF(6)(-) counterions and chloroform guest molecules are located. Compound 6 ([Ag(mu-C(6)H(6)N(2)O)](SO(3)CF(3)), monoclinic, P2(1)/c; a = 12.3435(6) A, b = 20.3548(10) A, c = 9.0861(5) A, Z = 8) was obtained by combination of AgSO(3)CF(3) and L6 in a methylene chloride/benzene mixed solvent system. In 6, 2-acetylpyrazine, which was generated from the hydrolysis reaction of L6 in the presence of CF(3)SO(3)(-) and a small quantity of water in solvent, chelates the Ag(I) centers through the carbonyl O-donor, and the vicinal pyrazine N-donor, furthermore, uses the para-N atoms to link other Ag(I) centers into one-dimensional zigzag chains. The triflate anions link the chains into a three-dimensional network by somewhat long Ag.O contacts.     

Tetraphosphinitoresorcinarene complexes: cationic silver(I) and copper(I) halide complexes as mercurate(II) anion receptors

The reactions of mercury(II) halides with the tetraphosphinitoresorcinarene complexes [P4M5X5], where M=Cu or Ag, X=Cl, Br, or I, and P4=(PhCH2CH2CHC6H2)4(O2CR)4(OPPh2)4 with R=C6H11, 4-C6H4Me, C4H3S, OCH2CCH, or OCH2Ph, have been studied. The reactions of the complexes with HgX2 when M=Ag and X=Cl or Br occur with elimination of silver(I) halide and formation of [P4Ag2X(HgX3)], but when M=Ag and X=I, the complexes [P4Ag4I5(HgI)] are formed. When M=Cu and X=I, the products were the remarkable capsule complexes [(P4Cu2I)2(Hg2X6)]. When M=Ag and X=I, the reaction with both CuI and HgI2 gave the complexes [P4Cu2I(Hg2I5)]. Many of these complexes are structurally characterized as containing mercurate anions weakly bonded to cationic tetraphosphinitoresorcinarene complexes of copper(I) or silver(I) in an unusual form of host-guest interaction. In contrast, the complex [P4Ag4I5(HgI)] is considered to be derived from an anionic silver cluster with an iodomercury(II) cation. Fluxionality of the complexes in solution is interpreted in terms of easy, reversible making and breaking of secondary bonds between the copper(I) or silver(I) cations and the mercurate anions.     

Luminescent heteronuclear Au(I)5Ag(I)8 complexes of [1,2,3-C6(C6H4R-4)3]3- (R = H, CH3, But) by cyclotrimerization of arylacetylides

Unusual AuI-AgI heterometallic complexes [Au5Ag8(mu-dppm)4{1,2,3-C6(C6H4R-4)3}(CCC6H4R-4)7]3+ (R = H 1, CH3 2, But 3) were isolated by reactions of polymeric silver arylacetylides (AgCCC6H4R-4)n with binuclear gold component [Au2(mu-dppm)2(MeCN)2]2+ (dppm = bis(diphenylphosphino)methane), in which cyclotrimerization of arylacetylide -CCC6H4R-4 affords trianion {1,2,3-C6(C6H4R-4)3}3- with an unprecedented mu5-bonding mode. Compounds 1(SbF6)3-3(SbF6)3 exhibit intense photoluminescence derived from an MLCT (Au5Ag8 --> CCC6H4R-4) transition, mixed with a metal cluster-centered excited states.     

Silver(I) complexes of 9-anthracenecarboxylic acid and imidazoles: synthesis, structure and antimicrobial activity

[Ag(2)(9-aca)(2)] (1) (9-acaH = 9-anthracenecarboxylic acid) reacts with a series of imidazoles to give [Ag(imidH)(2.3)(CH(3)CN)(0.7)](9-aca) (3), [Ag(6)(imidH)(4)(9-aca)(6)(MeOH)(2)] (4), {[Ag(1-Me-imid)(2)](2)[Ag(4)(9-aca)(6)]} (5), {[Ag(1-Bu-imid)(2)](2)[Ag(4)(9-aca)(6)]} (6) and [Ag(apim)](9-aca)·H(2)O (7) (imidH = imidazole; 1-Me-imid = 1-methylimidazole; 1-Bu-imid = 1-butylimidazole; apim = 1-(3-aminopropyl)imidazole). The mononuclear complex 3, hexanuclear 4-6, and polymeric 7, were all characterised using X-ray crystallography. While many of the complexes possess excellent in vitro antifungal and antibacterial activities they are, unanimously, more effective against fungal cells. The insect, Galleria mellonella, can survive high doses of the Ag(i) complexes administered in vivo, and a number of the complexes offer significant protection to larvae infected with a lethal dose of pathogenic Candida albicans cells.     

Experimental and theoretical studies of the interaction of silver cluster cations Ag(n)+ (n = 1-4) with ethylene

Reactions of silver cluster cations Ag(n)+ with ethylene have been studied using a reflectron time-of-flight mass spectrometer. Chemisorbed Ag(n)(C2H4)(m)+ (n = 1-3, m = 1-6) complexes were observed. For a given value of n, the abundances of Ag(n)(C2H4)(m)+ (n = 1-3, m = 1-6) species first increase and then decrease, with the maximum of the intensity distribution usually at m = 4. This maximum does not change with the ethylene concentration in the mixed gas, the stagnation pressure of the mixed gas, or the size of Ag(n) + (n = 1-3). A complementary extensive theoretical study on the structure and binding of Ag(n)(C2H4)(m)+ (n = 1-4, m = 1-4) is also reported. Preferred binding sites, binding energies, geometries, vibrational frequencies, and ionization potentials are determined using density functional theory.     

Organometallic silver(I) supramolecular complexes generated from multidentate furan-containing symmetric and unsymmetric fulvene ligands and silver(I) salts

One new conjugated symmetric fulvene ligand L1 and two new unsymmetric fulvene ligands L2 and L3 were synthesized. Five new supramolecular complexes, namely Ag2(L1)3(SO3CF3)3 (1) (1, monoclinic, P2(1)/c; a = 12.702(3) A, b = 26.118(7) A, c = 13.998(4) A, beta = 96.063(4) degrees, Z = 4), [Ag(L1)]ClO4 (2) (monoclinic, C2/c; a = 17.363(2) A, b = 13.2794(18) A, c = 13.4884(18) A, beta = 100.292(2) degrees, Z = 8), [Ag(L1)(C6H6)SbF6] x 0.5C6H6 x H2O (3) (monoclinic, P2(1)/c; a = 6.8839(11) A, b = 20.242(3) A, c = 18.934(3) A, beta = 91.994(3) degrees, Z = 4), Ag(L2)(SO3CF3) (4) (triclinic, P1; a = 8.629(3) A, b = 10.915(3) A, c = 11.178(3) A, alpha = 100.978(4) degrees, beta = 91.994(3) degrees, gamma = 105.652(4) degrees, Z = 2), and Ag(L3)(H2O)(SO3CF3) (5) (triclinic, P1; a = 8.914(5) A, b = 10.809(6) A, c = 11.283(6) A, alpha = 69.255(8) degrees, beta = 87.163(9) degrees, gamma = 84.993(8) degrees, Z = 2) were obtained through self-assembly based on these three new fulvene ligands in a benzene/toluene mixed-solvent system. Compounds 1-5 have been fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. The results indicate that the coordination chemistry of new fulvene ligands is versatile. They can adopt either cis- or trans-conformation to bind soft acid Ag(I) ion through not only the terminal -CN and furan functional groups but also the fulvene carbon atoms into organometallic coordination polymers or discrete complexes. In addition, the luminescent properties of L1-L3 and their Ag(I) complexes were investigated preliminarily in EtOH and solid state.     

Hydrothermal Synthesis and X-ray Characterization of Silver(I) Complex:Diacetylthiocarbamide Silver(I) Nitrate,[Ag(CH3CONHC(S)NH2)2](NO3)

1 INTRODUCTION As a thiolate ligand with potential S and N donors, thiourea is interesting due to its multifunctional coor-diation modes (unidentate-N, unidentate-S or biden- tate-N, S)[1]. As a good extracting agent for nobelme-tals[2], thiourea has…     

Preparation and characterization of the argentates: [Ag[P(CF(3))(2)](2)](-), [Ag[(micro-P(CF(3))(2))M(CO)(5)](2)](-) (M = Cr, W), and [Ag[(micro-P(C(6)F(5))(2))W(CO)(5)](2)](-): X-ray crystal structure of [K(18-crown-6)][Ag[(micro-P(CF(3))(2))Cr(CO)(5)](2)

The first example of a mononuclear diphosphanidoargentate, bis[bis(trifluoromethyl)phosphanido]argentate, [Ag[P(CF(3))(2)](2)](-), is obtained via the reaction of HP(CF(3))(2) with [Ag(CN)(2)](-) and isolated as its [K(18-crown-6)] salt. When the cyclic phosphane (PCF(3))(4) is reacted with a slight excess of [K(18-crown-6)][Ag[P(CF(3))(2)](2)], selective insertion of one PCF(3) unit into each silver phosphorus bond is observed, which on the basis of NMR spectroscopic evidence suggests the [Ag[P(CF(3))P(CF(3))(2)](2)](-) ion. On treatment of the phosphane complexes [M(CO)(5)PH(CF(3))(2)] (M = Cr, W) with [K(18-crown-6)][Ag(CN)(2)], the analogous trinuclear argentates, [Ag[(micro-P(CF(3))(2))M(CO)(5)](2)](-), are formed. The chromium compound [K(18-crown-6)][Ag[(micro-P(CF(3))(2))Cr(CO)(5)](2)] crystallizes in a noncentrosymmetric space group Fdd2 (No. 43), a = 2970.2(6) pm, b = 1584.5(3) pm, c = 1787.0(4), V = 8.410(3) nm(3), Z = 8. The C(2) symmetric anion, [Ag[(micro-P(CF(3))(2))Cr(CO)(5)](2)](-), shows a nearly linear arrangement of the P-Ag-P unit. Although the bis(pentafluorophenyl)phosphanido compound [Ag[P(C(6)F(5))(2)](2)](-) has not been obtained so far, the synthesis of its trinuclear counterpart, [K(18-crown-6)][Ag[(micro-P(C(6)F(5))(2))W(CO)(5)](2)], was successful.