Salts of methylated 5-aminotetrazoles with energetic anions

1-methyl-5-aminotetrazole (4, MAT) can easily be protonated by strong acids, yielding known but largely uninvestigated 1-methyl-5-aminotetrazolium nitrate (4a) and perchlorate (4b). Methylation, rather than protonation, of 4 with iodomethane followed by the exchange of the iodide (5a) for nitrate (5b), perchlorate (5c), azide (5d), and dinitramide (5e) yields a new family of energetic methylated aminotetrazole salts. In all cases, stable salts were obtained and fully characterized by vibrational (IR, Raman) spectroscopy, multinuclear NMR spectroscopy, mass spectrometry, elemental analysis, and X-ray structure determination. Compounds 4a, 4b, and 5c crystallize in the monoclinic space group P2(1)/n, whereas compounds 5b and 5e crystallize in the orthorhombic space group P2(1)2(1)2(1) and 5d in the orthorhombic Fddd. Initial safety testing (impact, friction, and electrostatic sensitivity) and thermal stability measurements (DSC) were also carried out. The MAT salts all exhibit good thermal stabilities (decomposition above 150 degrees C). The constant volume energies of combustion (DeltacU) of 4a, 5b, 5d, and 5e were determined to be -2510(10) cal/g, -3190(30) cal/g, -4500(100) cal/g, and -2570(70) cal/g, respectively, experimentally using oxygen bomb calorimetry. From the experimentally determined density, chemical composition and energies of formation (back calculated from the heats of combustion), the detonation pressures and velocities of 4a (8100 m/s, 25.6 GPa), 5b (7500 m/s, 20.2 GPa), 5d (8200 m/s, 21.7 GPa), and 5e (7500 m/s, 21.2 GPa) were predicted using the EXPLO5 code.     

Synthesis and characterization of new coordination polymers generated from bent bis(cyanophenyl)oxadiazole ligands and Ag(I) salts

Two new bent bis(cyanophenyl)oxadiazole ligands, 2,5-bis(4-cyanophenyl)-1,3,4-oxadiazole (L7) and 2,5-bis(3-cyanophenyl)-1,3,4-oxadiazole (L8), were synthesized. The coordination chemistry of these ligands with various Ag(I) salts has been investigated. Seven new coordination polymers, namely, {[Ag(L7)(H2O)]ClO4}n) (1) (triclinic, P1, a = 9.342(4) A, b = 9.889(4) A, c = 10.512(4) A, alpha = 68.978(6) degrees, beta = 78.217(6) degrees, gamma = 81.851(7) degrees, Z = 2), {[Ag(L7)]SO3CF3}n (2) (monoclinic, P2(1)/n, a = 7.559(2) A, b = 23.739(6) A, c = 10.426(3) A, beta = 108.071(4) degrees, Z = 4), {[Ag(L8)]BF4 x 0.5(C6H6) x H2O}n (3) (triclinic, P1, a = 7.498(3) A, b = 10.649(4) A, c = 13.673(5) A, alpha = 98.602(5) degrees, beta = 100.004(5) degrees, gamma =110.232(5) degrees, Z = 2), {[Ag(L8)SbF6] x H2O}n (4) (triclinic, P1, a = 8.2621(9) A, b = 10.6127(12) A, c = 13.3685(15) A, alpha = 98.012(2) degrees, beta = 106.259(2) degrees, gamma = 112.362(2) degrees, Z = 2), {[Ag2(L8)2(SO3CF3)] x H2O}n (5) (triclinic, P1, a = 10.713(4) A, b = 13.449(5) A, c = 15.423(5) A, alpha = 65.908(5) degrees, beta = 74.231(5) degrees, gamma = 83.255(5) degrees, Z = 2), {[Ag2(L8)(C6H6)(ClO4)] x ClO4}n (6) (monoclinic, P2(1)/n, a = 6.9681(17) A, b = 20.627(5) A, c = 17.437(4) A, beta = 95.880(4) degrees, Z = 4), and {[Ag2(L8)(H2PO4)2]}n (7) (triclinic, P1, a = 7.956(2) A, b = 9.938(3) A, c = 14.242(4) A, alpha = 106.191(4) degrees, beta = 97.322(4) degrees, gamma = 107.392(4) degrees, Z = 1), were obtained by the combination of L7 and L8 with Ag(I) salts in a benzene/methylene chloride mixed-solvent system and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescence and electrical conductance properties of compounds 1-6 and the host-guest chemistry of compound 3 were investigated.     

Structure and reactivity of bis(silyl) dihydride complexes (PMe(3))(3)Ru(SiR(3))(2)(H)(2): model compounds and real intermediates in a dehydrogenative C-Si bond forming reaction

A series of stable complexes, (PMe(3))(3)Ru(SiR(3))(2)(H)(2) ((SiR(3))(2) = (SiH(2)Ph)(2), 3a; (SiHPh(2))(2), 3b; (SiMe(2)CH(2)CH(2)SiMe(2)), 3c), has been synthesized by the reaction of hydridosilanes with (PMe(3))(3)Ru(SiMe(3))H(3) or (PMe(3))(4)Ru(SiMe(3))H. Compounds 3a and 3c adopt overall pentagonal bipyramidal geometries in solution and the solid state, with phosphine and silyl ligands defining trigonal bipyramids and ruthenium hydrides arranged in the equatorial plane. Compound 3a exhibits meridional phosphines, with both silyl ligands equatorial, whereas the constraints of the chelate in 3c result in both axial and equatorial silyl environments and facial phosphines. Although there is no evidence for agostic Si-H interactions in 3a and 3b, the equatorial silyl group in 3c is in close contact with one hydride (1.81(4) A) and is moderately close to the other hydride (2.15(3) A) in the solid state and solution (nu(Ru.H.Si) = 1740 cm(-)(1) and nu(RuH) = 1940 cm(-)(1)). The analogous bis(silyl) dihydride, (PMe(3))(3)Ru(SiMe(3))(2)(H)(2) (3d), is not stable at room temperature, but can be generated in situ at low temperature from the 16e(-) complex (PMe(3))(3)Ru(SiMe(3))H (1) and HSiMe(3). Complexes 3b and 3d have been characterized by multinuclear, variable temperature NMR and appear to be isostructural with 3a. All four complexes exhibit dynamic NMR spectra, but the slow exchange limit could not be observed for 3c. Treatment of 1 with HSiMe(3) at room temperature leads to formation of (PMe(3))(3)Ru(SiMe(2)CH(2)SiMe(3))H(3) (4b) via a CH functionalization process critical to catalytic dehydrocoupling of HSiMe(3) at higher temperatures. Closer inspection of this reaction between -110 and -10 degrees C by NMR reveals a plethora of silyl hydride phosphine complexes formed by ligand redistribution prior to CH activation. Above ca. 0 degrees C this mixture converts cleanly via silane dehydrogenation to the very stable tris(phosphine) trihydride carbosilyl complex 4b. The structure of 4b was determined crystallographically and exhibits a tetrahedral P(3)Si environment around the metal with the three hydrides adjacent to silicon and capping the P(2)Si faces. Although strong Si.HRu interactions are not indicated in the structure or by IR, the HSi distances (2.00(4) - 2.09(4) A) and average coupling constant (J(SiH) = 25 Hz) suggest some degree of nonclassical SiH bonding in the RuH(3)Si moiety. The least hindered complex, 3a, reacts with carbon monoxide principally via an H(2) elimination pathway to yield mer-(PMe(3))(3)(CO)Ru(SiH(2)Ph)(2), with SiH elimination as a minor process. However, only SiH elimination and formation of (PMe(3))(3)(CO)Ru(SiR(3))H is observed for 3b-d. The most hindered bis(silyl) complex, 3d, is extremely labile and even in the absence of CO undergoes SiH reductive elimination to generate the 16e(-) species 1 (DeltaH(SiH)(-)(elim) = 11.0 +/- 0.6 kcal x mol(-)(1) and DeltaS(SiH)(-)(elim) = 40 +/- 2 cal x mol(-)(1) x K(-)(1); Delta = 9.2 +/- 0.8 kcal x mol(-)(1) and Delta = 9 +/- 3 cal x mol(-)(1).K(-)(1)). The minimum barrier for the H(2) reductive elimination can be estimated, and is higher than that for silane elimination at temperatures above ca. -50 degrees C. The thermodynamic preferences for oxidative additions to 1 are dominated by entropy contributions and steric effects. Addition of H(2) is by far most favorable, whereas the relative aptitudes for intramolecular silyl CH activation and intermolecular SiH addition are strongly dependent on temperature (DeltaH(SiH)(-)(add) = -11.0 +/- 0.6 kcal x mol(-)(1) and DeltaS(SiH)(-)(add) = -40 +/- 2 cal.mol(-)(1) x K(-)(1); DeltaH(beta)(-CH)(-)(add) = -2.7 +/- 0.3 kcal x mol(-)(1) and DeltaS(beta)(-CH)(-)(add) = -6 +/- 1 cal x mol(-)(1) x K(-)(1)). Kinetic preferences for oxidative additions to 1 - intermolecular SiH and intramolecular CH - have been also quantified: Delta = -1.8 +/- 0.8 kcal x mol(-)(1) and Delta = -31 +/- 3 cal x mol(-)(1).K(-)(1); Delta = 16.4 +/- 0.6 kcal x mol(-)(1) and Delta = -13 +/- 6 cal x mol(-)(1).K(-)(1). The relative enthalpies of activation (-)(1) x K(-)(1)). Kinetic preferences for oxidative additions to 1 - intermolecular SiH and intramolecular CH - have been also quantified: Delta (H)SiH(add) = 1.8 +/- 0.8 kcal x mol(-)(1) and Delta S((SiH-add) =31+/- 3 cal x mol(-)(1) x K(-)(1); Delta S (SiH -add) = 16.4 +/- 0.6 kcal x mol(-)(1) and =Delta S (SiH -CH -add) =13+/- 6 cal x mol(-)(1) x K(-)(1). The relative enthalpies of activation are interpreted in terms of strong SiH sigma-complex formation - and much weaker CH coordination - in the transition state for oxidative addition.     

Special effects of ortho-isopropylphenyl groups. Diastereoisomerism in platinum(II) and palladium(II) complexes of helically chiral PAr3 ligands

The coordination chemistry of the four phosphines, P{C6H3(o-CH3)(p-Z)}3 where Z = H (1a) or OMe (1b) and P{C6H3(o-CHMe2)(p-Z)}3 Z = H (1c) or OMe (1d) with platinum(II) and palladium(II) is reported. Mononuclear complexes trans-[PdCl2L2](L = 1a,b) and trans-[PtCl2L2](L = 1a-c) have been prepared and the crystal structures of trans-[PdCl2(1b)2] and trans-[PtCl2(1c)2] as their dichloromethane solvates have been determined. The structures show that in these complexes, the ligands adopt g+ g+ a conformations. Examination of the Cambridge Structural Database confirms this to be one of only two conformer types that tri-o-tolylphosphines adopt and the only viable conformer in 4 and 6 coordinate complexes. The binuclear complexes trans-[Pd2Cl4L2](L = 1c,d) are formed even when an excess of the bulky 1c,d is used in the synthesis and the crystal structure of trans-[Pd2Cl4(1c)2] as its chloroform solvate is reported. Reaction of [PtCl2(NCBu(t))2] with 1b-d in refluxing toluene gave the cycloplatinated species [Pt2Cl2(L - H)2] where L - H is phosphine 1b-d deprotonated at one of the ortho-methyl carbon atoms. Variable temperature 31P and 1H NMR spectroscopy reveals that all the complexes reported are fluxional. The processes are analysed in terms of restricted P-C and P-M rotations that give rise to diastereoisomeric rotamers because of the helically chiral orientations of the aryl substituents. For the complexes of the bulky ligands 1c,d, rotation about the P-C bond is slow on the NMR timescale even up to 75 degrees C. The crystal structure of the cyclometallated complex [Pt2Cl2(1d - H)2] has been determined.     

Novel metal-organic frameworks with specific topology from new tripodal ligands: 1,3,5-tris(1-imidazolyl)benzene and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene

Reactions of two new tripodal ligands 1,3,5-tris(1-imidazolyl)benzene (4) and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene (5) with metal [Ag(I), Cu(II), Zn(II), Ni(II)] salts lead to the formation of novel two-dimensional (2D) metal-organic frameworks [Ag(2)(4)(2)][p-C(6)H(4)(COO)(2)].H(2)O (6), [Ag(4)]ClO(4) (7), [Cu(4)(2)(H(2)O)(2)](CH(3)COO)(2).2H(2)O (8), [Zn(4)(2)(H(2)O)(2)](NO(3))(2) (9), [Ni(4)(2)(N(3))(2)].2H(2)O (10), and [Ag(5)]ClO(4) (11). All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 6: monoclinic, C2/c, a = 23.766(3) A, b = 12.0475(10) A, c = 13.5160(13) A, beta = 117.827(3) degrees, Z = 4. For compound 7: orthorhombic, P2(1)2(1)2(1), a = 7.2495(4) A, b = 12.0763(7) A, c = 19.2196(13) A, Z = 4. For compound 8: monoclinic, P2(1)/n, a = 8.2969(5) A, b = 12.2834(5) A, c = 17.4667(12) A, beta = 96.5740(10) degrees, Z = 2. For compound 9: monoclinic, P2(1)/n, a =10.5699(3) A, b = 11.5037(3) A, c = 13.5194(4) A, beta = 110.2779(10) degrees, Z = 2. For compound 10: monoclinic, P2(1)/n, a = 9.8033(3) A, b = 12.1369(5) A, c = 13.5215(5) A, beta = 107.3280(10) degrees, Z = 2. For compound 11: monoclinic C2/c, a = 18.947(2) A, b = 9.7593(10) A, c = 19.761(2) A, beta = 97.967(2) degrees, Z = 8. Both complexes 6 and 7 are noninterpenetrating frameworks based on the (6, 3) nets, and 8, 9 and 10 are based on the (4, 4) nets while complex 11 has a twofold parallel interpenetrated network with 4.8(2) topology. It is interesting that, in complexes 6,7, and 11 with three-coordinated planar silver(I) atoms, each ligand 4 or 5 connects three metal atoms, while in the case of complexes 8, 9, and 10 with six-coordinated octahedral metal atoms, each ligand 4 only links two metal atoms, and another imidazole nitrogen atom of 4 did not participate in the coordination with the metal atoms in these complexes. The results show that the nature of organic ligand and geometric needs of metal atoms have great influence on the structure of metal-organic frameworks.     

Coordination of lanthanide triflates and perchlorates with N,N,N',N'-tetramethylsuccinamide

Compounds formed from the reaction of N,N,N',N'-tetramethylsuccinamide (TMSA) with trivalent lanthanide salts possessing the poorly coordinating counteranions triflate (CF3SO3-) and perchlorate (ClO4-) have been prepared and examined. Structural features of these Ln-TMSA compounds have been studied in the solid phase by thermogravimetric analysis, infrared spectroscopy, and, in selected cases, by single-crystal X-ray diffraction and in solution by infrared spectroscopy. Eight-coordinate compounds, [Ln(TMSA)4]3+, derived from coordination of four succinamide ligands to the metal ion could be formed with all lanthanides examined (Ln = La, Pr, Nd, Eu, Yb, Lu). Structural analyses by single-crystal X-ray diffraction were performed for the lanthanide triflate salts Ln(C8H16N2O2)4(CF3SO3)3: Ln = La, compound 1, monoclinic, P2(1)/n, a = 11.0952(2) A, b = 19.2672(2) A, c = 24.9759(3) A, beta = 90.637(1) degrees, Z = 4, Dcalcd = 1.586 g cm-3; Ln = Nd, compound 2, monoclinic, C2/c, a = 24.6586(10) A, b = 19.3078(7) A, c = 11.1429(4) A, beta = 90.450(1) degrees, Z = 4, Dcalcd = 1.603 g cm-3; Ln = Eu, compound 3, monoclinic, C2/c, a = 24.4934(2) A, b = 19.3702(1) A, c = 11.1542(1) A, beta = 90.229(1) degrees, Z = 4, Dcalcd = 1.617 g cm-3; Ln = Lu, compound 5, monoclinic, C2/c, a = 24.2435(4) A, b = 19.6141(2) A, c = 11.2635(1) A, beta = 90.049(1) degrees, Z = 4, Dcalcd = 1.626 g cm-3. X-ray analysis was also carried out for the perchlorate salt: Ln = Eu, compound 4, triclinic, P1, a = 10.9611(2) A, b = 14.6144(3) A, c = 15.7992(2) A, alpha = 106.594(1) degrees, beta = 91.538(1) degrees, gamma = 90.311(1) degrees, Z = 2, Dcalcd = 1.561 g cm-3. In the presence of significant amounts of water, 7-coordinate compounds with mixed aquo-TMSA cation structures [Ln(TMSA)3(H2O)]3+ (Ln = Yb) and [Ln(TMSA)2(H2O)3]3+ (Ln = La, Pr, Nd, Eu, Yb) have been isolated with structural determinations by single-crystal X-ray diffraction obtained for the following species: Yb(C8H16N2O2)3(H2O)(CF3SO3)3, compound 6, monoclinic, P2(1)/n, a = 8.9443(3) A, b = 11.1924(4) A, c = 44.2517(13) A, beta = 93.264(1) degrees, Z = 4, Dcalcd = 1.735 g cm-3; Yb(C8H16N2O2)3(H2O)(ClO4)3, compound 7, monoclinic, Cc, a = 19.2312(6) A, b = 11.1552(3) A, c = 19.8016(4) A, beta = 111.4260(1) degrees, Z = 4, Dcalcd = 1.690 g cm-3; Yb(C8H16N2O2)2(H2O)3(CF3SO3)3, compound 8, triclinic, P1, a = 8.6719(1) A, b = 12.2683(2) A, c = 19.8094(3) A, alpha = 75.815(1) degrees, beta = 86.805(1) degrees, gamma = 72.607(1) degrees, Z = 2, Dcalcd = 1.736 g cm-3. Unlike in the analogous nitrate salts, only bidentate binding of the succinamide ligand to the lanthanide metal is observed. IR spectroscopy studies in anhydrous acetonitrile suggest that the solid-state structures of these Ln-TMSA compounds are maintained in solution.     

The effect of pH on the dimensionality of coordination polymers

Hydrothermal reactions of simple alkaline salts or their hydroxides with 3,5-pyrazoledicarboxylic acid (H(3)pdc) yielded seven new compounds. At a lower pH level three one-dimensional structures [Ca(Hpdc)(H(2)O)(4)].2H(2)O (1), [Ca(Hpdc)(H(2)O)(4)].H(2)O (2), and [Ba(H(2)pdc)(2)(H(2)O)(4)].2H(2)O (6) were obtained by evaporation of the solutions resulting from hydro(solvo)thermal reactions of MCl(2) (M = Ca, Ba) with H(3)pdc in water (1, 6) or in water/Et(3)N (2) at 150 degrees C for 3 days. Crystal structures of 1 and 2 contain zigzag chains of metal centers bridged by a single Hpdc(2-) ligand, whereas structure 6 consists of linear chains of metal centers bridged by two H(2)pdc(-) ligands. A dimer molecule [Sr(H(3)pdc)(H(2)pdc)(2)(H(2)O)(3)](2).2(H(3)pdc).4H(2)O (4) was obtained from a similar hydrothermal reaction using Sr(ClO(4))(2).6H(2)O instead of MCl(2). This compound contains [2+2] metallomacrocycles. At higher pH levels (pH = 4-6), the three-dimensional polymers [M(Hpdc)(H(2)O)] (Ca 3, Sr 5, Ba 7 ) were isolated by reactions of MCl(2) (M = Ca, Sr, Ba) with H(3)pdc in water/Et(3)N or in M(OH)(2) (M = Ca, Sr, Ba) with H(3)pdc in water under hydro(solvo)thermal conditions (150 degrees C, 3 days). Calcium and strontium are seven- and nine-coordinated in 3 and 5, respectively; barium is nine- and ten-coordinated in 7. It was observed that the increase in pH resulted in a higher connectivity level of ligands, which in turn leads to a higher dimensionality of the crystal structures. The correlation between the structures and pH values will be discussed. Crystal data: for 1, monoclinic, space group P2(1)/n (No. 14), with a = 8.382(2), b = 12.621(3), c = 11.767(2) A, beta = 98.91(3) degrees, Z = 4; for 2, 3, and 5, monoclinic, space group P2(1)/c (No. 14), Z = 4, a = 7.711(2), b = 15.574(3), c = 9.341(2) A, beta = 96.73(3) degrees, Z = 4 (2), a = 6.616(1), b = 12.654(3), c = 8.782(2) A, beta = 103.65(3) degrees, Z = 4 (3), a = 9.213(2), b = 12.088(3), c = 6.196(2) A, beta = 98.96(3) degrees (5); for 4 and 7, triclinic, space group P1 (No. 2), with a = 11.263(2), b = 11.460(3), c = 12.904(2) A, alpha = 71.54(3), beta = 98.96(3), gamma = 89.03(3) degrees, Z = 1 (4), a = 7.107(1), b = 9.780(2), c = 11.431(2) A, alpha = 74.69(3), beta = 73.39(3), gamma = 85.29(3) degrees, Z = 2 (7); for 6, monoclinic, space group C2/c (No. 15), with a = 20.493(4), b = 6.708(1), c = 15.939(3) A, beta = 123.56(3) degrees, Z = 4.     

A solid-state spectral effect in eclipsed tetracyanonickelates: X-ray crystal structure, polarized specular reflectance spectroscopy, and ZINDO modeling of Sr[Ni(CN)4].5H2O, Rb2[Ni(CN)4].H2O, and Na2[Ni(CN)4].3H2O

Crystal structures of three Ni(CN)(4)(2)(-) salts all with eclipsed ligands and varying axial stacking arrangements are presented. The absorption spectra of all three salts show a slight red shift in the x,y-polarizations and a large red shift in their z-polarizations upon crystallization from solution. Semiempirical ZINDO calculations provide a good model of the solid state, even with only a three-molecule segment, allowing reproduction of the red-shifting and intensity increase upon crystallization found experimentally. The modified nickel beta(s,p) bonding parameter of -5 found appropriate for Ni coordination in our previous studies of single Ni(CN)(4)(2-) planes and a helically stacked Cs(2)[Ni(CN)(4)].H(2)O crystal was changed to -3 for the more parallel-stacked Ni(CN)(4)(2-) planes in this case, while beta(d) was retained at -41. Crystal data are as follows: Na(2)[Ni(CN)(4)].3H(2)O, triclinic space group P1, a = 7.2980(10) A, b = 8.8620(10) A, c = 15.132(2) A, alpha = 89.311(5) degrees, beta = 87.326(5) degrees, gamma = 83.772(6) degrees, V = 971.8(2) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.064; Sr[Ni(CN)(4)].5H(2)O, monoclinic space group C2/m, a = 10.356(2) A, b = 15.272(3) A, c = 7.1331(10) A, beta = 98.548(12) degrees, V = 1115.6(3) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.059; Rb(2)[Ni(CN)(4)].1.05H(2)O, triclinic space group P1, a = 8.6020(10) A, b = 9.6930(10) A, c = 12.006(2) A, alpha = 92.621(6) degrees, beta = 94.263(6) degrees, gamma = 111.795(10) degrees, V = 924.0(2) A(3), T = 100 K, Z = 4, R = 0.034, R(w) = 0.067.     

Factors relevant for the ruthenium-benzylidene-catalyzed cyclopolymerization of 1,6-heptadyines

Fourteen metathesis initiators that had been designed for use in the living polymerization of diethyl dipropargylmalonate (DEDPM), including the Hoveyda catalyst [RuCl(2)(IMesH(2))([double bond]CH-2-(2-PrO)[bond]C(6)H(4))] (1 a), as well as [Ru(CF(3)COO)(2)(IMesH(2))([double bond]CH-2-(2-PrO)[bond]C(6)H(4))] (1 b), [Ru(CF(3)CF(2)COO)(2)(IMesH(2))([double bond]CH-2-(2-PrO)[bond]C(6)H(4))] (1 c), [Ru(CF(3)CF(2)CF(2)COO)(2)(IMesH(2))([double bond]CH-2-(2-PrO)[bond]C(6)H(4))] (1 d), [RuCl(2)(IMesH(2))([double bond]CH-2,4,5-(MeO)(3)[bond]C(6)H(2))] (2 a), [Ru(CF(3)COO)(2)(IMesH(2))([double bond]CH-2,4,5-(MeO)(3)[bond]C(6)H(2))] (2 b), [Ru(CF(3)CF(2)COO)(2)(IMesH(2))([double bond]CH-2,4,5-(MeO)(3)[bond]C(6)H(2))] (2 c), [Ru(CF(3)CF(2)CF(2)COO)(2)(IMesH(2))([double bond]CH-2,4,5-(MeO)(3)[bond]C(6)H(2))] (2 d), [RuCl(2)(IMes)([double bond]CH-2-(2-PrO)[bond]C(6)H(4))] (3 a), [Ru(CF(3)COO)(2)(IMes)([double bond]CH-2-(2-PrO)[bond]C(6)H(4))] (3 b), [RuCl(2)(IMesH(2))([double bond]CH-2-(2-PrO)-5-NO(2)[bond]C(6)H(3))] (4 a), [Ru(CF(3)COO)(2)(IMesH(2))([double bond]CH-2-(2-PrO)-5-NO(2)[bond]C(6)H(3))] (4 b), [Ru(CF(3)CF(2)COO)(2)(IMesH(2))([double bond]CH-2-(2-PrO)-5-NO(2)[bond]C(6)H(3))] (4 c), and [Ru(CF(3)CF(2)CF(2)COO)(2)(IMesH(2))([double bond]CH-2-(2-PrO)-5-NO(2)[bond]C(6)H(3))] (4 d) (IMes=1,3-dimesitylimidazol-2-ylidene; IMesH(2)=1,3-dimesityl-4,5-dihydroimidazol-2-ylidene) were prepared. Living polymerization systems could be generated with DEDPM by careful tuning of the electronic nature and steric placement of the ligands. Although 1 a, 2 a, 3 a, 3 b, and 4 a were inactive in the cyclopolymerization of DEDPM, and initiators 1 b-d did not allow any control over molecular weight, initiators 2 b-d and 4 b-d offered access to class VI living polymerization systems. In particular, compounds 2 b and 4 d were superior. The livingness of the systems was demonstrated by linear plots of M(n) versus the number of equivalents of monomer added (N). For initiators 2 b-d and 4 b-d, values for k(p)/k(i) were in the range of 3-7, while 1 b, 1 c, and 1 d showed a k(p)/k(i) ratio of >1000, 80, and 40, respectively. The use of non-degassed solvents did not affect these measurements and underlined the high stability of these initiators. The effective conjugation length (N(eff)) was calculated from the UV/Vis absorption maximum (lambda(max)). The final ruthenium content in the polymers was determined to be 3 ppm.     

Novel mixed-valence heteropolyoxometalates: a molybdenum diphosphonate anion [MoV7MoVIO16(O3PPhPO3H)4]3- and its one- and two-dimensional assemblies

A novel mixed-valence polyoxomolybdenum anion, [Mo(V)(7)Mo(VI)O(16)(O(3)PPhPO(3)H)(4)](3)(-), was synthesized hydrothermally from molybdenum oxide, molybdenum metal, boric and phosphoric acids, 1,2-phenyldiphosphonic acid, and imidazole (ImH) and was structurally characterized as an imidazolium salt (orthorhombic, Aba2; a = 16.674(4), b = 17.238(1), and c = 24.81(2) A). One- and two-dimensional structures of this anion and additional molybdenum diphosphonate linkers were assembled as well. They were structurally characterized as their pyridinium (pyH) salts (pyH)(4)[[Mo(V)(7)Mo(VI)O(16)(O(3)PPhPO(3))(2)(O(3)PPhPO(3)H)(2)][Mo(2)O(4)(OH)(HO(3)PPhPO(3)H)]].5H(2)O (monoclinic, P2(1)/c; a = 20.8506(9), b = 22.866(1), and c = 21.1403(9) A; beta = 118.7087(8) degrees ) and (pyH)(3)[[Mo(V)(7)Mo(VI)O(16)(O(3)PPhPO(3))(4)][Mo(2)O(2)(OH)(2)(HO(3)PPhPO(3)H)]].3H(2)O (orthorhombic, Pca2(1); a = 19.057(1), b = 20.402(2), and c = 20.660(2) A). The compounds were also characterized by IR spectroscopy and magnetic measurements.     

Metal Complexes of Dithiolate Ligands: 5,6-Dihydro-1,4-dithiin-2,3-dithiolato (dddt(2-)), 5,7-Dihydro-1,4,6-trithiin-2,3-dithiolato (dtdt(2-)), and 2-Thioxo-1,3-dithiole-4,5-dithiolato (dmit(2-)). Synthesis, Electrochemical Studies, Crystal and Electronic Structures, and Conducting Properties

New precursors to potentially conductive noninteger oxidation state (NIOS) compounds based on metal complexes [ML(2)](n)()(-) [M = Ni, Pd, Pt; L = 5,6-dihydro-1,4-dithiin-2,3-dithiolato (dddt(2)(-)), 5,7-dihydro-1,4,6-trithiin-2,3-dithiolato (dtdt(2)(-)), and 2-thioxo-1,3-dithiole-4,5-dithiolato (dmit(2)(-)); n = 2, 1, 0] have been investigated. Complexes of the series (NR(4))[ML(2)] (R = Me, Et, Bu; L = dddt(2)(-), dtdt(2)(-)) have been isolated and characterized, and the crystal structure of (NBu(4))[Pt(dtdt)(2)] (1) has been determined {1 = C(24)H(44)NPtS(10), a = 12.064(2) ?, b = 17.201(3) ?, c = 16.878(2) ?, beta = 102.22(2) degrees, V = 3423(1) ?(3), monoclinic, P2(1)/n, Z = 4}. Oxidation of these complexes affords the corresponding neutral species [ML(2)](0). Another series of general formula (cation)(n)()[M(dmit)(2)] [cation = PPN(+), BTP(+), and (SMe(y)()Et(3)(-)(y)())(+) with y = 0, 1, 2, and 3, n = 2, 1, M = Ni, Pd] has also been studied. All of these (cation)(n)()[M(dmit)(2)] complexes have been isolated and characterized [with the exception of (cation)[Pd(dmit)(2)] for cation = (SMe(y)()Et(3)(-)(y)())(+)]. The crystal structures of (PPN)[Ni(dmit)(2)].(CH(3))(2)CO (2) and (SMeEt(2))[Ni(dmit)(2)] (3) have been determined {2 = C(45)H(36)NNiS(10)P(2)O, a = 12.310(2) ?, b = 13.328(3) ?, c = 15.850(3) ?, alpha = 108.19(3) degrees, beta = 96.64(2) degrees, gamma = 99.67(2) degrees, V = 2373(1) ?(3), triclinic, P&onemacr;, Z = 2; 3 = C(11)H(13)NiS(11), a = 7.171(9) ?, b = 17.802(3) ?, c = 16.251(3) ?, beta = 94.39(4) degrees, V = 2068(2) ?(3), monoclinic, P2(1)/n, Z = 4} NIOS salts derived from the preceding precursors were obtained by electrochemical oxidation. Electrochemical studies of the [M(dddt)(2)] complexes show that they may be used for the preparation of NIOS radical cation salts and [M(dddt)(2)][M'(dmit)(2)](x)() compounds, but not for the preparation of (cation)[M(dddt)(2)](z)() NIOS radical anion salts. The electrochemical oxidation of the [M(dtdt)(2)](-) complexes always yields the neutral [M(dtdt)(2)](0) species. The crystal structure of [Pt(dddt)(2)][Ni(dmit)(2)](2) (4) has been determined and is consistent with the low compaction powder conductivity (5 x 10(-)(5) S cm(-)(1) at room temperature) {4 = C(20)H(8)Ni(2)PtS(28), a = 20.336(4) ?, b = 7.189(2) ?, c = 14.181(2) ?, beta = 97.16(2) degrees, V = 2057(1) ?(3), monoclinic, C2/m, Z = 2}. The crystal structures of the semiconducting NIOS compounds (BTP)[Ni(dmit)(2)](3) (5) and (SMe(3))[Ni(dmit)(2)](2) (6) have been determined {5 = C(43)H(22)PNi(3)S(30), a = 11.927(2) ?, b = 24.919(2) ?, c = 11.829(3) ?, alpha = 93.11(1) degrees, beta = 110.22(1) degrees, gamma = 83.94(1) degrees, V = 3284(1) ?(3), triclinic, P&onemacr;, Z = 2; 6 = C(15)H(9)Ni(2)S(21), a = 7.882(1) ?, b = 11.603(2) ?, c = 17.731(2) ?, alpha = 77.44(1) degrees, beta = 94.39(1) degrees, gamma = 81.27(1) degrees, V = 1563(1) ?(3), triclinic, P&onemacr;, Z = 2}. The parent compound (SEt(3))[Ni(dmit)(2)](z) (unknown stoichiometry) is also a semiconductor with a single-crystal conductivity at room temperature of 10 S cm(-)(1). By contrast, the single-crystal conductivity at room temperature of (SMeEt(2))[Pd(dmit)(2)](2) (7) is rather high (100 S cm(-)(1)). 7 behaves as a pseudometal down to 150 K and undergoes an irreversible metal-insulator transition below this temperature. The crystal structure of 7 has been determined {7 = C(17)H(13)NPd(2)S(21), a = 7.804(4) ?, b = 36.171(18) ?, c = 6.284(2) ?, alpha = 91.68(4) degrees, beta = 112.08(4) degrees, gamma = 88.79(5) degrees, V = 1643(1) ?(3), triclinic, P&onemacr;, Z = 2}. The electronic structure of (SMeEt(2))[Pd(dmit)(2)](2) (7) and the possible origin of the metal-insulator transition at 150 K are discussed on the basis of tight-binding band structure calculations.     

Reactions of [(eta(6)-arene)RuCl(2)](2) with Aromatic Phosphines Containing Methoxy Groups in 2,6-Positions

Reactions of [(eta(6)-arene)RuCl(2)](2) 1 (arene = p-cymene (a), 1,2,3,4-Me(4)C(6)H(2) (b), 1,2,3-Me(3)C(6)H(2) (c)) with tris(2,6-dimethoxyphenyl)phosphine (TDMPP) led to loss of two molecules of CH(3)Cl to give (eta(6)-arene)Ru[{2-O-C(6)H(3)-6-OMe}(2){C(6)H(3)(OMe)(2)-2,6}], 2a-c, which contains a trihapto ligand (eta(3)-P,O,O) derived from TDMPP, whereas the 1,3,5-Me(3)C(6)H(3) (1d), 1,2,3,5-Me(4)C(6)H(2) (1e), and C(6)Me(6) (1f) complexes did not react with TDMPP. The structures of 2a and 2b were confirmed by X-ray analyses: for 2a, a = 11.691(2) ?, b = 15.228(2) ?, c = 10.320(1) ?, alpha = 95.93(1) degrees, beta = 113.783(9) degrees, gamma = 83.86(1) degrees, triclinic, P&onemacr;, Z = 2, R = 0.051; for 2b, a = 17.79(2) ?, b = 15.43(1) ?, c = 20.93(1) ?, beta = 91.25(8) degrees, monoclinic, P2(1)/n, Z = 8, R = 0.056. Bis(2,6-dimethoxyphenyl)phenylphosphine (BDMPP) reacted with 1a, 1b, and 1d at room temperature to give (eta(6)-arene)RuCl[PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}], 3a,b,d, which contains a dihapto (eta(2)-P,O) ligand derived from BDMPP by an X-ray analysis of 3a: a = 12.33(1) ?, b = 14.246(8) ?, c = 11.236(9) ?, alpha = 91.47(8) degrees, beta = 117.28(6) degrees, gamma = 111.70(6) degrees, triclinic, P&onemacr;, Z = 2, R = 0.040. A similar reaction with 1f recovered the starting materials, but that in refluxing MeCN produced [(eta(6)-C(6)Me(6))Ru[PPh(2-O-C(6)H(3)-6-OMe}(2)], 4f, containing a trihapto (eta(3)-P,O,O) ligand derived from BDMPP. Complex 1d reacted with BDMPP at reflux in MeCN/CH(2)Cl(2) and resulted in a loss of an arene ring to give a five-coordinate complex, Ru[eta(2)-P,O-PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}](2)(MeCN), 5. Treatment of (2,6-dimethoxyphenyl)diphenylphosphine (MDMPP) with 1f gave (eta(6)-C(6)Me(6))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe)],6f, and that with 1b gave (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe}], 6b, and (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl(2)[eta(1)-P-PPh(2){C(6)H(3)(OMe)(2)-2,6}],7b. The phosphine ligand of 6b acted as a bidentate ligand derived from MDMPP: a = 8.074(4) ?, b = 16.816(3) ?, c = 18.916(4) ?, beta = 94.05(3) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.051. Transformation of 7b to 6b readily occurred accompanying an elimination of MeCl. Reaction of 1a with MDMPP eliminated an arene ring to give the octahedral compound RuCl(2)[eta(2)-P,OMe-PPh(2){C(6)H(3)(MeO)(2)-2,6}](2), 8. An X-ray analysis of 8 showed that two MDMPP ligands were in a cis-position: a = 10.596(14) ?, b = 27.586(12) ?, c = 13.036(8) ?, beta = 108.17(7) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.035.     

Study of intramolecular competition between carboxylate and phosphonate for Pt(II) with the aid of a novel tridentate carboxylato-thioether-phosphonato ligand

The tridentate dianionic ligand 2-[2'-(hydroxyisopropoxyphosphoryl)phenylsulfanyl]benzoate (L(2-)) reacts with cis-[Pt(NH(3))(2)(H(2)O)(2)](2+) to form an S,O-chelate in which the O-coordinated group is either carboxylate or phosphonate, depending on the degree of protonation of the complex. Carboxylate appears to be the stronger ligand, and the stoichiometric reaction between cis-[Pt(NH(3))(2)(H(2)O)(2)](2+) and L(2-) yields the neutral species [Pt(L)(NH(3))(2)], with L bound by sulfanyl and carboxylate groups, both in solution and in the solid state. Upon protonation of [Pt(L)(NH(3))(2)], the stronger basicity of the carboxylate causes the Pt coordination to switch from carboxylate to phosphonate, and the uncoordinated carboxylate group becomes protonated. In methanolic solution, the first-order kinetics of this rearrangement could be observed by (31)P NMR spectroscopy. Both complexes-the carboxylate-bound neutral complex [Pt(L)(NH(3))(2)].H(2)O (triclinic, P1 (no. 2), a=9.529(6), b=9.766(6), c=12.299(7) angstroms, alpha=106.91(2), beta=101.71(2), gamma=102.05(2) degrees, Z=2) and the perchlorate salt of the phosphonate-bound complex [Pt(LH)(NH(3))(2)]ClO(4).H(2)O (monoclinic, P2(1)/c (no. 14), a=12.095(2), b=14.046(2), c=14.448(2) angstroms, beta=95.55(2) degrees, Z=4)-were characterized by X-ray crystallography.     

Metal-oxygen-metal arrays in lamellar hybrid materials: cobalt and manganese 4-cyclohexene-1,2-dicarboxylates

We have obtained three layered hybrid materials from the hydrothermal reaction of 4-cyclohexene-1,2-dicarboxylic acid with Co and Mn salts: Co(C(8)H(8)O(4))[1], Mn(H(2)O)(C(8)H(8)O(4))[2], and Mn(4)(H(2)O)(C(8)H(8)O(4))(4).0.3(H(2)O)[3]. The structures for all materials were solved by single-crystal XRD ([1]P1, a=4.805(2) A, b=6.650(3) A, c=12.960(6) A, alpha=98.285(7) degrees, beta=98.986(7) degrees, gamma=95.689(7) degrees, V= 401.6(3) A(3), R(1)= 0.0438; [2] P2(1)/c, a=11.151(2) A, b=11.330(2) A, c=7.6560(15) A, beta=108.813(3) degrees , V=915.6(3) A(3), R(1)=0.0412; [3] P1, a= 11.412(3) A, b=12.136(4) A, c=13.809(4) A, alpha=104.703(6) degrees, beta=103.207(6) degrees, gamma=92.468(5) degrees, V=1790.6(9) A(3), R(1)=0.1056). While all three structures are two-dimensional overall, the metal-oxygen-metal dimensionality within the layers varies from isolated metal atoms in the case of [1] to 1D ribbons of vertex sharing MnO(6) octahedra [2] and 2D arrays of edge- and vertex-sharing polyhedra in [3].     

Characterization of 2,3-dihydroxyterephthalamides as M(IV) chelators

The ligand N,N'-diethyl-2,3-dihydroxyterephthalamide (ETAM) has been characterized as a chelator for Zr(IV), Ce(IV), and Th(IV). The K(+) salts of the complexes [Zr(ETAM)(4)](4)(-), [Ce(ETAM)(4)](4)(-), and [Th(ETAM)(4)](4)(-) were prepared in a MeOH solution containing H(2)ETAM, the corresponding M(acac)(4), and 4 equiv of KOH. Single-crystal X-ray diffraction analyses are reported for K(4)[Zr(ETAM)(4)] (C2/c, Z = 8, a = 27.576(3) A, b = 29.345(3) A, c = 15.266(2) A, alpha = 90 degrees, beta = 118.688(4) degrees, gamma = 90 degrees ), [Me(3)BnN](4)[Th(ETAM)(4)] (P, Z = 2, a = 13.7570(3) A, b = 13.9293(3) A, c = 26.9124(6) A, alpha = 99.941(1) degrees, beta = 94.972(1) degrees, gamma = 103.160(1) degrees ), and the dimeric (NMe(4))(4)[Th(ETAM)(3)MeOH](2) (P2(1)/c, Z = 4, a = 18.2603(9) A, b = 18.5002(9) A, c = 19.675(1) A, beta = 117.298(1) degrees ). Solution thermodynamic studies were used to determine formation constants (log K(f) and esd) for Th(IV)-ETAM log K(110) =17.47(1), log K(120) = 13.23(1), log K(130) = 8.28(3), log K(140) = 6.57(6), and log beta(140) = 45.54(5). These results support the hypothesis that the terephthalamides are high-affinity chelators for the actinide(IV) ions and thus promising ligands for use in nuclear waste remediation.     

Crystal structures and solution behavior of paramagnetic divalent transition metal complexes (Fe, Co) of the sterically encumbered tridentate macrocycles 1,4,7-R3-1,4,7-triazacyclononane: coordination numbers 5 (R = i-Pr) and 6 (R = i-Bu)

The coordination chemistry of the sterically hindered macrocyclic triamines, 1,4,7-R3-1,4,7-triazacyclononane (R = i-Pr, i-Pr3tacn, and R = i-Bu, i-Bu3tacn) with divalent transition metals has been investigated. These ligands form a series of stable novel complexes with the triflate salts MII(CF3SO3)2 (M = Fe, Co, or Zn) under anaerobic conditions. The complexes Fe(i-Pr3tacn)(CF3SO3)2 (2), [Co(i-Pr3tacn)(SO3CF3)(H2O)](CF3SO3) (3), [Co(i-Pr3tacn)(CH3CN)2](BPh4)2 (4), Zn(i-Pr3tacn)(CF3SO3)2 (5), [Fe(i-Bu3tacn)(CH3CN)2(CF3SO3)](CF3SO3) (6), Fe(i-Bu3tacn)-(H2O)(CF3SO3)2 (7), and Co(i-Bu3tacn)(CF3SO3)2 (8) have been isolated. The behavior of these paramagnetic complexes in solution is explored by their 1H NMR spectra. The solid-state structures of four complexes have been determined by X-ray single-crystal crystallography. Crystallographic parameters are as follows. 2: C17H33F6FeN3O6S2, monoclinic, P2(1)/n, a = 10.895(1) A, b = 14.669(1) A, c = 16.617(1) A, beta = 101.37(1) degrees, Z = 4. 3: C17H35CoF6N3O7S2, monoclinic, P2(1)/c, a = 8.669(2) A, b = 25.538(3) A, c = 12.4349(12) A, beta = 103.132(13) degrees, Z = 4. 6: C24H45F6FeN5O6S2, monoclinic, P2(1)/c, a = 12.953(6) A, b = 16.780(6) A, c = 15.790(5) A, beta = 96.32(2) degrees, Z = 4. 7: C20H41F6FeN3O7S2, monoclinic, C2/c, a = 22.990(2) A, b = 15.768(2) A, c = 17.564(2) A, beta = 107.65(1) degrees, Z = 8. The ligand i-Pr3tacn leads to complexes in which the metal ions are five-coordinate, while it's isobutyl homologue affords six-coordinate complexes. This difference in the stereochemistries around the metal center is attributed to steric interactions involving the bulky alkyl appendages of the macrocycles.     

Utility of Arylamido Ligands in Yttrium and Lanthanide Chemistry(1)

The reactivity of KNHAr reagents (Ar = C(6)H(5), C(6)H(3)Me(2)-2,6, C(6)H(3)(i)Pr(2)-2,6) with lanthanide and yttrium trichlorides has been investigated. With the larger metals Nd and Sm and the smaller 2,6-dimethyl-substituted ligand, the bimetallic dianionic complexes [K(THF)(6)](2)[Ln(&mgr;-NHC(6)H(3)Me(2)-2,6)(NHC(6)H(3)Me(2)-2,6)(3)](2) (Ln: Sm, 1a; Nd, 1b) are isolated as the potassium salts. Under the same reaction conditions YCl(3) forms a bimetallic anion which retains chloride: [K(DME)(2)(THF)(3)][Y(2)(&mgr;-NHC(6)H(3)Me(2)-2,6)(2)(&mgr;-Cl)(NHC(6)H(3)Me(2)-2,6)(4)(THF)(2)], 2. With the larger 2,6-diisopropyl ligands, neutral complexes are isolated in both solvated monometallic and unsolvated bimetallic forms. With Nd, a distorted octahedral trisolvate, Nd(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(3), 3, was obtained, whereas with Yb and Y the trigonal bipyramidal disolvates, Ln(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(2) (Ln: Yb, 4a; Y, 4b), were isolated. THF-free complexes of the NHC(6)H(3)(i)Pr(2)-2,6 ligand are available by reacting the amine NH(2)C(6)H(3)(i)Pr(2)-2,6 with Ln[N(SiMe(3))(2)](3) complexes. By this route, the dimers [Ln(&mgr;-NHC(6)H(3)(i)Pr(2)-2,6)(NHC(6)H(3)(i)Pr(2)-2,6)(2)](2) (Ln: Yb, 5a; Y, 5b) were isolated. The reaction of the unsubstituted arylamido salt KNHC(6)H(5) with NdCl(3) produced an insoluble material which was characterized as [Nd(NHC(6)H(5))(3)(KCl)(3)], 6. 6 reacted with Al(2)Me(6) in hexanes and produced a heteroleptic mixed-metal complex {[Me(2)Al(&mgr;-Me(2))](2)Nd(&mgr;(3)-NC(6)H(5))(&mgr;-Me)AlMe}(2), 7, and the trimeric aluminum arylamido complex [Me(2)Al(&mgr;-NHC(6)H(5))](3), 8. The solvent of crystallization and relevant crystallographic data for the compounds identified by X-ray analysis follow: 1a,THF, 156 K, P2(1)/n, a = 12.985(2) ?, b = 27.122(5) ?, c = 17.935(3) ?, beta = 100.19(1) degrees, V = 6216(1) ?(3), Z = 2, 6148 reflections (I > 3sigma(I)), R(F)() = 7.1%; 1b,THF, 156 K, P2(1)/n, a = 12.998(2) ?, b = 27.058(3) ?, c = 17.962(2) ?, beta = 99.74(1) degrees, V = 6225(1) ?(3), Z = 2; 2,DME/hexanes, P2(1)/n, a = 23.335(2) ?, b = 12.649(1) ?, c = 27.175(3) ?, beta = 96.36(1) degrees, V = 7971(1) ?(3), Z = 4, 2788 reflections (I > 3sigma(I)), R(F)() = 9.5%; 3, THF, P2(1), a = 12.898(1) ?, b = 16.945(1) ?, c = 13.290(1) ?, beta = 118.64(2) degrees, V = 2549.3(3) ?(3), Z = 2, 3414 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4a, hexanes, P2(1), a = 9.718(2) ?, b = 19.119(3) ?, c = 12.640(2) ?, beta = 112.08(1) degrees, V = 2176.3(6) ?(3), Z = 2, 2933 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4b, hexanes, 158 K, a = 9.729(2) ?, b = 19.095(5) ?, c = 12.744(1) ?, beta = 112.11(1) degrees, V = 2193.4(6) ?(3); 5b, hot toluene, 158 K, P2(1), a =19.218(9) ?, b = 9.375(3) ?, c = 19.820(5) ?, beta = 110.25(2) degrees, V = 3350(2)?(3), Z = 2, 1718 reflections (I > 2sigma (I)), R1 = 9.7%; 7, hexanes, 156 K, P&onemacr;, a = 9.618(3) ?, b = 12.738(4) ?, c = 9.608(3) ?, alpha = 99.32(1) degrees, beta = 108.87(1) degrees, gamma = 94.23(1) degrees, V = 1089.1(6) ?(3), Z = 2, 2976 reflections (I > 3sigma(I)), R(F)() = 3.9%; 8, hexanes, 156 K, Pcab, a = 23.510(5) ?, b = 25.462(5) ?, c = 8.668(2) ?, V = 5188(1) ?(3), Z = 8, 1386 reflections (I > 3sigma(I)), R(F)() = 5.7%.     

Synthesis, Characterization, and Single-Crystal EPR Studies of Three Dinuclear Copper(II) Complexes and One Mixed-Valence Tetranuclear Copper(I)-Copper(II) Cluster with an Asymmetric Imidazole-Containing Tripodal Ligand with Copper(II)-Copper(II) Distances between 3.35 and 3.63 Å

The synthesis and characterization of three dinuclear copper(II) complexes and one mixed-valence tetranuclear cluster with the asymmetric imidazole-containing ligand bis(1,1'-imidazole-2-yl)(4-imidazole-4(5)-yl)-2-azabutane (biib) are described. X-ray crystallographic parameters for the copper complexes are as follows. [Cu(2)(biib)(2)(BF(4))(2)](BF(4))(2)(H(2)O)(4): triclinic, space group P&onemacr;, a = 10.178(1) ?, b = 9.4881(9) ?, c = 11.037(1) ?, alpha = 95.130(10) degrees, beta = 112.20(1) degrees, gamma = 92.142(9) degrees, and Z = 1. [Cu(2)(biib)(2)(NO(3))(2)](NO(3))(2)(H(2)O)(4): monoclinic, space group &Pmacr;2(1)/n, a = 9.207(6) ?, b = 17.0516(6) ?, c = 12.6107(7) ?, beta = 109.82(1) degrees, and Z = 2. [Cu(2)(biib)(2)(CuBr(3))(2)]: monoclinic, space group P2(1)/c, a = 11.583(2) ?, b = 11.864(2) ?, c = 16.070(2) ?, beta = 112.459(12) degrees, and Z = 2. The two Cu(II) ions in all four complexes are coordinated in a square-pyramidal geometry by three imidazole nitrogens and one amine nitrogen donor in the equatorial plane, and each copper ion is weakly coordinated at the axial position by respectively a tetrafluoroborate, a perchlorate, a nitrate, or a tribromocuprate(I) anion. By comparison of the structural data of the four complexes a relationship has been established between the donor strength of the anion and some structural features, like the Cu(II)-Cu(II) distance, of the dinuclear Cu(II)-Cu(II) unit in the four complexes. Single-crystal EPR spectra of [Cu(2)(biib)(2)(BF(4))(2)](BF(4))(2)(H(2)O)(4) were recorded at room temperature at X-band frequencies. The triplet spectra have been fit with nonparallel g and D tensors, whose principle values are as follows: g(xx)() = 2.022(8), g(yy)() = 2.060(7), g(zz)() = 2.211(8), D(x)()(')(x)()(') = -0.0182(9) cm(-)(1), D(y)()(')(y)()(') = -0.081(6) cm(-)(1), D(z)()(')(z)()(') = 0.0264(7) cm(-)(1). The compounds were further characterized and studied by ligand field and by frozen-solution and polycrystalline powder EPR spectroscopy. EPR spectra recorded at 77 K of frozen solutions of the perchlorate complex show that upon dilution in methanol the dinuclear complex reacts to form a mononuclear species.     

Reaction of bis(phosphine)(hydrotris(3,5-dimethylpyrazolyl)borato)rhodium(I) with phenylacetylene,p-nitrobenzaldehyde,and triphenyltin hydride: structures of [Rh(Tp)(PPh(3))(2)], [Rh(Tp)(H)(C(2)Ph)(P(4-C(6)H(4)F)(3))], [Rh(Tp)(H)(COC(6)H(4)-4-NO(2))(PPh(3))], and [Rh(Tp)(H)(SnPh(3))(PPh(3))

The complexes [Rh(Tp)(PPh(3))(2)] (1a) and [Rh(Tp)(P(4-C(6)H(4)F)(3))(2)] (1b) combine with PhC(2)H, 4-NO(2)-C(6)H(4)CHO and Ph(3)SnH to give [Rh(Tp)(H)(C(2)Ph)(PR(3))] (R = Ph, 2a; R = 4-C(6)H(4)F, 2b), [Rh(Tp)(H)(COC(6)H(4)-4-NO(2))(PR(3))] (R = Ph, 3a), and [Rh(Tp)(H)(SnPh(3))(PR(3))] (R = Ph, 4a; R = 4-C(6)H(4)F, 4b) in moderate to good yield. Complexes 1a, 2b, 3a, and 4a have been structurally characterized. In 1a the Tp ligand is bidentate, in 2b, 3a, and 4a it is tridentate. Crystal data for 1a: space group P2(1)/c; a = 11.9664(19), b = 21.355(3), c = 20.685(3) A; beta = 112.576(7) degrees; V = 4880.8(12) A(3); Z = 4; R = 0.0441. Data for 2b: space group P(-)1; a = 10.130(3), b = 12.869(4), c = 17.038(5) A; alpha = 78.641(6), beta = 76.040(5), gamma = 81.210(6) degrees; V = 2100.3(11) A(3); Z = 2; R = 0.0493. Data for 3a: space group P(-)1; a = 10.0073(11), b = 10.5116(12), c = 19.874(2) A; alpha = 83.728(2), beta = 88.759(2), gamma = 65.756(2) degrees; V =1894.2(4) A(3); Z = 2; R = 0.0253. Data for 4a: space group P2(1)/c; a = 15.545(2), b = 18.110(2), c = 17.810(2) A; beta = 95.094(3) degrees; V = 4994.1(10) A(3); Z = 4; R = 0.0256. NMR data ((1)H, (31)P, (103)Rh, (119)Sn) are also reported.     

Synthesis, Structure, and Reactivity of [Zr(6)Cl(18)H(5)](2)(-), the First Paramagnetic Species of Its Class

Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4.