共查询到20条相似文献,搜索用时 31 毫秒
1.
The preparation and characterization of the beta-oxochlorin derivative [3,3,7,8,12,13,17,18-octaethyl-(3H)-porphin-2-onato(2-)]iron(III) chloride, [Fe(oxoOEC)(Cl)], and its pi-cation radical derivative [Fe(oxoOEC.)(Cl)]SbCl6 is described. Both compounds have been characterized by single-crystal X-ray structure determinations, IR, UV/vis/near-IR, and M?ssbauer spectroscopies, and temperature-dependent magnetic susceptibility measurements. The macrocycles of [Fe(oxoOEC)(Cl)] and [Fe(oxoOEC.)(Cl)]SbCl6 are both saddled, and [Fe(oxoOEC.)(Cl)]-SbCl6 is slightly ruffled as well. [Fe(oxoOEC)(Cl)] shows a laterally shifted dimeric unit in the solid state, with a mean plane separation of 3.39 A and a lateral shift of 7.39 A. Crystal data for [Fe(oxoOEC)(Cl)]: triclinic, space group P1, Z = 2, a = 9.174(2) A, b = 13.522(3) A, c = 14.838(3) A, alpha = 95.79(3) degrees, beta = 101.46(2) degrees, gamma = 104.84(3) degrees. Upon oxidation, the inter-ring geometric parameters increase; the mean plane separation and the lateral shift of the dimeric unit of [Fe(oxoOEC.)(Cl)]SbCl6 are 4.82 and 8.79 A, respectively. Crystal data for [Fe(oxoOEC.)(Cl)]SbCl6: monoclinic, space group Cc, Z = 4, a = 19.8419(13) A, b = 10.027(2) A, c = 22.417(4) A, beta = 96.13(2) degrees. A broad near-IR absorption band appears at 1415 nm for the pi-cation radical, [Fe(oxoOEC.)(Cl)]SbCl6. Zero-field M?ssbauer measurements at 4.2 K for both [Fe(oxoOEC)(Cl)] and [Fe(oxoOEC.)(Cl)]SbCl6 confirmed that the oxidation state of the iron atom did not change upon chemical oxidation. Solid-state magnetic susceptibility measurements for [Fe(oxoOEC.)(Cl)]SbCl6 resulted in a large temperature dependence of the magnetic moment that can best be fit with a model that includes a zero-field splitting parameter of D = 6 cm-1, antiferromagnetic intermolecular iron-iron coupling (2JFe-Fe = -0.14 cm-1), antiferromagnetic intramolecular iron-radical coupling (2JFe-r = -76 cm-1), and antiferromagnetic radical-radical coupling (2Jr-r = -13 cm-1). 相似文献
2.
The symmetric rhenium(V) oxo Schiff base complexes trans-[ReO(OH2)(acac2en)]Cl and trans-[ReOCl(acac2pn)], where acac2en and acac2pn are the tetradentate Schiff base ligands N,N'-ethylenebis(acetylacetone) diimine and N,N'-propylenebis(acetylacetone) diimine, respectively, were reacted with monodentate phosphine ligands to yield one of two unique cationic phosphine complexes depending on the ligand backbone length (en vs pn) and the identity of the phosphine ligand. Reduction of the Re(V) oxo core to Re(III) resulted on reaction of trans-[ReO(OH2)(acac2en)]Cl with triphenylphosphine or diethylphenylphosphine to yield a single reduced, disubstituted product of the general type trans-[Re(III)(PR3)2(acac2en)]+. Rather unexpectedly, a similar reaction with the stronger reducing agent triethylphosphine yielded the intramolecularly rearranged, asymmetric cis-[Re(V)O(PEt3)(acac2en)]+ complex. Reactions of trans-[Re(V)O(acac2pn)Cl] with the same phosphine ligands yielded only the rearranged asymmetric cis-[Re(V)O(PR3)(acac2pn)]+ complexes in quantitative yield. The compounds were characterized using standard spectroscopic methods, elemental analyses, cyclic voltammetry, and single-crystal X-ray diffraction. The crystallographic data for the structures reported are as follows: trans-[Re(III)(PPh3)2(acac2en)]PF6 (H48C48N2O2P2Re.PF6), 1, triclinic (P), a = 18.8261(12) A, b = 16.2517(10) A, c = 15.4556(10) A, alpha = 95.522(1) degrees , beta = 97.130(1) degrees , gamma = 91.350(1) degrees , V = 4667.4(5) A(3), Z = 4; trans-[Re(III)(PEt2Ph)2(acac2en)]PF6 (H48C32N2O2P2Re.PF6), 2, orthorhombic (Pccn), a = 10.4753(6) A, b =18.4315(10) A, c = 18.9245(11) A, V = 3653.9(4) A3, Z = 4; cis-[Re(V)O(PEt3)(acac2en)]PF6 (H33C18N2O3PRe.1.25PF6, 3, monoclinic (C2/c), a = 39.8194(15) A, b = 13.6187(5) A, c = 20.1777(8) A, beta = 107.7730(10) degrees , V = 10419.9(7) A3, Z = 16; cis-[Re(V)O(PPh3)(acac2pn)]PF6 (H35C31N2O3PRe.PF6), 4, triclinic (P), a = 10.3094(10) A, b =12.1196(12) A, c = 14.8146(15) A, alpha = 105.939(2) degrees , beta = 105.383(2) degrees , gamma = 93.525(2) degrees , V = 1698.0(3) A3, Z = 2; cis-[Re(V)O(PEt2Ph)(acac2pn)]PF6 (H35C23N2O3PRe.PF6), 5, monoclinic (P2(1)/n), a = 18.1183(18) A, b = 11.580(1) A, c = 28.519(3) A, beta = 101.861(2) degrees , V = 5855.9(10) A(3), Z = 4. 相似文献
3.
Angaridis PA Baran P Boca R Cervantes-Lee F Haase W Mezei G Raptis RG Werner R 《Inorganic chemistry》2002,41(8):2219-2228
The nine-membered [-Cu(II)-N-N-](3) ring of trimeric copper-pyrazolato complexes provides a sturdy framework on which water is twice deprotonated in consecutive steps, forming mu(3)-OH and mu(3)-O species. In the presence of excess chlorides the mu(3)-O(H) ligand is replaced by two mu(3)-Cl ions. The interconversion of mu(3)-OH and mu(3)-O and the exchange of mu(3)-O(H) and mu(3)-Cl are reversible, and the three species involved have been structurally characterized: [PPN][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(thf)].CH(2)Cl(2) (1a), monoclinic P2(1)/n, a = 10.055(2) A, b = 35.428(5) A, c = 15.153(2) A, beta = 93.802(3) degrees, V = 5386(1) A(3), Z = 4; [Bu(4)N][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)] (1b), triclinic P-1, a = 9.135(2) A, b = 13.631(2) A, c = 14.510(2) A, alpha = 67.393(2) degrees, beta = 87.979(2) degrees, gamma = 80.268(3) degrees, V = 1643.2(4) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-O)(mu-pz)(3)Cl(3)] (2), monoclinic P2/c, a = 12.807(2) A, b = 13.093(2) A, c = 23.139(4) A, beta = 105.391(3) degrees, V = 3741(1) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)].0.75H(2)O.0.5CH(2)Cl(2) (3a), triclinic P-1, a = 14.042(2) A, b = 23.978(4) A, c = 25.195(4) A, alpha = 76.796(3) degrees, beta = 79.506(3) degrees, gamma = 77.629(3) degrees, V = 7988(2) A(3), Z = 4; [Bu(4)N](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)] (3b), monoclinic C2/c, a = 17.220(2) A, b = 15.606(2) A, c = 20.133(2) A, beta = 103.057(2) degrees, V = 5270(1) A(3), Z = 4; [Et(3)NH][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(pzH)] (4), triclinic P-1, a = 11.498(2) A, b = 11.499(2) A, c = 12.186(2) A, alpha = 66.475(3) degrees, beta = 64.279(3) degrees, gamma = 80.183(3) degrees, V = 1331.0(5) A(3), Z = 2. Magnetic susceptibility measurements show that the three copper centers of 2 are strongly antiferromagnetically coupled with J(Cu-Cu) = -500 cm(-1). 相似文献
4.
Schatz M Becker M Thaler F Hampel F Schindler S Jacobson RR Tyeklár Z Murthy NN Ghosh P Chen Q Zubieta J Karlin KD 《Inorganic chemistry》2001,40(10):2312-2322
Copper(I) and copper(II) complexes possessing a series of related ligands with pyridyl-containing donors have been investigated. The ligands are tris(2-pyridylmethyl)amine (tmpa), bis[(2-pyridyl)methyl]-2-(2-pyridyl)ethylamine (pmea), bis[2-(2-pyridyl)ethyl]-(2-pyridyl)methylamine (pmap), and tris[2-(2-pyridyl)ethyl]amine (tepa). The crystal structures of the protonated ligand H(tepa)ClO(4), the copper(I) complexes [Cu(pmea)]PF(6) (1b-PF(6)), [Cu(pmap)]PF(6) (1c-PF(6)), and copper(II) complexes [Cu(pmea)Cl]ClO(4).H(2)O (2b-ClO(4).H(2)O), [Cu(pmap)Cl]ClO(4).H(2)O (2c-ClO(4).H(2)O), [Cu(pmap)Cl]ClO(4) (2c-ClO(4)), and [Cu(pmea)F](2)(PF(6))(2) (3b-PF(6)) were determined. Crystal data: H(tepa)ClO(4), formula C(21)H(25)ClN(4)O(4), triclinic space group P1, Z = 2, a = 10.386(2) A, b = 10.723(2) A, c = 11.663(2) A, alpha = 108.77(3) degrees, beta = 113.81(3) degrees, gamma = 90.39(3) degrees; 1b-PF(6), formula C(19)H(20)CuF(6)N(4)P, orthorhombic space group Pbca, Z = 8, a = 14.413(3) A, b = 16.043(3) A, c = 18.288(4) A, alpha = beta = gamma = 90 degrees; (1c-PF(6)), formula C(20)H(22)CuF(6)N(4)P, orthorhombic space group Pbca, Z = 8, a = 13.306(3) A, b = 16.936(3) A, c = 19.163(4) A, alpha = beta = gamma = 90 degrees; 2b-ClO(4).H(2)O, formula C(19)H(22)Cl(2)CuN(4)O(5), triclinic space group P1, Z = 4, a = 11.967(2) A, b = 12.445(3) A, c = 15.668(3) A, alpha = 84.65(3) degrees, beta = 68.57(3) degrees, gamma = 87.33(3) degrees; 2c-ClO(4).H(2)O, formula C(20)H(24)Cl(2)CuN(4)O(5), monoclinic space group P2(1)/c, Z = 4, a = 11.2927(5) A, b = 13.2389(4) A, c = 15.0939(8) A, alpha = gamma = 90 degrees, beta = 97.397(2) degrees; 2c-ClO(4), formula C(20)H(22)Cl(2)CuN(4)O(4), monoclinic space group P2(1)/c, Z = 4, a = 8.7682(4) A, b = 18.4968(10) A, c = 13.2575(8) A, alpha = gamma = 90 degrees, beta = 94.219(4) degrees; 3b-PF(6), formula [C(19)H(20)CuF(7)N(4)P](2), monoclinic space group P2(1)/n, Z = 2, a = 11.620(5) A, b = 12.752(5) A, c = 15.424(6) A, alpha = gamma = 90 degrees, beta = 109.56(3) degrees. The oxidation of the copper(I) complexes with dioxygen was studied. [Cu(tmpa)(CH(3)CN)](+) (1a) reacts with dioxygen to form a dinuclear peroxo complex that is stable at low temperatures. In contrast, only a very labile peroxo complex was observed spectroscopically when 1b was reacted with dioxygen at low temperatures using stopped-flow kinetic techniques. No dioxygen adduct was detected spectroscopically during the oxidation of 1c, and 1d was found to be unreactive toward dioxygen. Reaction of dioxygen with 1a-PF(6), 1b-PF(6), and 1c-PF(6) at ambient temperatures leads to fluoride-bridged dinuclear copper(II) complexes as products. All copper(II) complexes were characterized by UV-vis, EPR, and electrochemical measurements. The results manifest the dramatic effects of ligand variations and particularly chelate ring size on structure and reactivity. 相似文献
5.
The molecular structure of the previously reported species "[Fe(bdtbpza)Cl]" has been revealed by X-ray structure determination to be a ferrous dimer [Fe(bdtbpza)Cl](2) (2c) [bdtbpza = bis(3,5-di-tert-butylpyrazol-1-yl)acetate]. The syntheses of ferrous 2:1 complexes [Fe(bpza)(2)] (3a) and [Fe(bdtbpza)(2)] (3c) as well as ferric 1:1 complexes [NEt(4)][Fe(bpza)Cl(3)] (4a) and [NEt(4)][Fe(bdmpza)Cl(3)] (4b) [bpza = bis(pyrazol-1-yl)acetate, bdmpza = bis(3,5-dimethylpyrazol-1-yl)acetate] are reported. Complexes 3a, previously reported [Fe(bdmpza)(2)] (3b), and 3c are high-spin. No spin crossover to the low-spin state was observed in the temperature range of 5-350 K. 4a and 4b are synthesized in one step and in high yield from [NEt(4)](2)[Cl(3)FeOFeCl(3)]. 4a and 4b are iron(III) high-spin complexes. Crystallographic information: 2c (C(24)H(39)ClFeN(4)O(2).CH(2)Cl(2).CH(3)CN) is triclinic, P1, a = 12.171(16) A, b = 12.851(14) A, c = 13.390(13) A, alpha = 98.61(9) degrees, beta = 113.51(11) degrees, gamma = 108.10(5) degrees, Z = 2; 3a (C(8)H(7)Fe(0.5)N(4)O(2)) is monoclinic, P2(1)/n, a = 7.4784(19) A, b = 7.604(3) A, c = 16.196(4) A, beta = 95.397(9) degrees, Z = 4; 3c (C(24)H(39)Fe(0.5)N(4)O(2)) is monoclinic, P2(1)/n, a = 9.939(6) A, b = 18.161(10) A, c = 13.722(8) A, beta = 97.67(7) degrees, Z = 4; 4b (C(20)H(35)Cl(3)FeN(5)O(2)) is monoclinic, C2/c, a = 30.45(6) A, b = 12.33(2) A, c = 16.17(3) A, beta = 118.47(5) degrees, Z = 8. 相似文献
6.
A series of oxorhenium(V) complexes with 2-aminoethanethiolate (aet), [ReO(aet-N,S)(D-pen-N,O,S)] (2), [[ReO(aet-N,S)(2)](2)O] (3), [ReO(Cl)(aet-N,S)(2)] (4), and [ReO(aet-N,S)(Haet-S)(2)]Cl(2) ([5]Cl(2)) was newly prepared starting from ReO(4)(-). The reaction of NH(4)ReO(4) with a 1:1 mixture of Haet.HCl and D-H(2)pen (D-penicillamine) in the presence of SnCl(2).2H(2)O in water gave 2, 3, and the known complex [ReO(D-Hpen-N,S)(D-pen-N,O,S)] (1). These complexes were fractionally precipitated by controlling the pH of the reaction solution. The complex 2 was also prepared in a higher yield by a similar reaction using methanol as a solvent. The crystal structure of 2 was determined by X-ray crystallography; 2 crystallizes in the tetragonal space group P4(3) with a = 9.621(1), c = 12.911(1) A, V = 1195.0(3) A(3), and Z = 4. The oxorhenium(V) core in 2 is coordinated by a bidentate-N,S aet ligand and a tridentate-N,O,S D-pen ligand, having a distorted octahedral geometry with a cis-N cis-S configuration in the equatorial plane perpendicular to the O-Re-O axis. The 1:2 reaction of NH(4)ReO(4) with Haet.HCl in the presence of SnCl(2).2H(2)O in methanol produced 4, which is interconvertible with 3, while the corresponding 1:3 reaction resulted in the isolation of [5]Cl(2). The complexes 4 and 5 were also structurally characterized; 4 crystallizes in the monoclinic space group P2(1)/c with a = 6.839(1), b = 10.0704(6), c = 14.1075(8) A, beta = 91.729(8) degrees, V = 971.2(2) A(3), and Z = 4, while [5]Cl(2) crystallizes in the triclinic space group P1 with a = 11.938(3), b = 12.366(3), c = 5.819(1) A, alpha = 102.71(2), beta = 101.28(2), gamma = 75.41(2) degrees, V = 802.0(3) A(3), and Z = 2. In 4, the oxorhenium(V) core is octahedrally coordinated by two bidentate-N,S aet ligands, which form a cis-N cis-S configurational equatorial plane with a Cl(-) ion trans to the oxo ligand. On the other hand, the oxorhenium(V) core in [5](2+) is coordinated by one bidenate-N,S aet and two monodentate-S Haet ligands, having a distorted trigonal-bipyramidal geometry with S and N donors at the apical positions. 相似文献
7.
A series of linear-type Co(III)Pt(II)Co(III) trinuclear complexes composed of C(2)-cis(S)-[Co(aet)(2)(en)](+) (aet = 2-aminoethanethiolate) and/or Lambda(D)-trans(N)-[Co(D-pen-N,O,S)(2)](-) (D-pen = D-penicillaminate) were newly prepared, and their chiral behavior, which is markedly different from that of the corresponding Co(III)Pd(II)Co(III) complexes, is reported. The 1:1 reaction of an S-bridged Co(III)Ni(II)Co(III) trinuclear complex, [Ni[Co(aet)(2)(en)](2)]Cl(4), with K(2)[PtCl(4)] in water gave an S-bridged Co(III)Pt(II)Co(III) trinuclear complex, [Pt[Co(aet)(2)(en)](2)]Cl(4) ([1]Cl(4)), while the corresponding 1:2 reaction produced an S-bridged Co(III)Pt(II) dinuclear complex, [PtCl(2)[Co(aet)(2)(en)]]Cl ([2]Cl). Complex [1](4+) formed both racemic (DeltaDelta/LambdaLambda) and meso (DeltaLambda) forms, which were separated and optically resolved by cation-exchange column chromatography. An optically active S-bridged Co(III)Pt(II)Co(III) trinuclear complex having the pseudo LambdaLambda configuration, Lambda(D)Lambda(D)-[Pt[Co(D-pen-N,O,S)(2)](2)](0) (Lambda(D)Lambda(D)-[3]), was also prepared by reacting Lambda(D)-trans(N)-K[Co(D-pen-N,O,S)(2)] with K(2)[PtCl(4)] in a ratio of 2:1 in water. Treatment of the racemic Delta/Lambda-[2]Cl with Lambda(D)-trans(N)-K[Co(D-pen-N,O,S)(2)] in a ratio of 1:1 in water led to the formation of LambdaLambda(D)- and DeltaLambda(D)-[Pt[Co(aet)(2)(en)][Co(D-pen-N,O,S)(2)]](2+) (LambdaLambda(D)- and DeltaLambda(D)-[4](2+)) and DeltaDelta(D)-[Pt[Co(aet)(2)(en)][Co(D-pen-N,S)(2)(H(2)O)(2)]](2+) (DeltaDelta(D)-[4'](2+)), besides trace amounts of Lambda(D)Lambda(D)-[3] and DeltaDelta- and DeltaLambda-[1](4+). These Co(III)Pt(II)Co(III) complexes were characterized on the basis of electronic absorption, CD, and NMR spectra, along with single-crystal X-ray analyses for DeltaDelta/LambdaLambda-[1]Cl(4), DeltaLambda-[1]Cl(4), and DeltaLambda(D)-[4]Cl(2). Crystal data: DeltaDelta/LambdaLambda-[1]Cl(4).6H(2)O, monoclinic, space group C2/c with a = 14.983(3) A, b = 19.857(4) A, c = 12.949(3) A, beta = 113.51(2) degrees, V = 3532(1) A(3), Z = 4; DeltaLambda-[1]Cl(4).3H(2)O, orthorhombic, space group Pbca with a = 14.872(3) A, b = 14.533(3) A, c = 14.347(2) A, V = 3100(1) A(3), Z = 4; DeltaLambda(D)-[4]Cl(2).6H(2)O, monoclinic, space group P2(1) with a = 7.3836(2) A, b = 20.214(1) A, c = 10.622(2) A, beta = 91.45(1) degrees V = 1682.0(4) A(3), Z = 2. 相似文献
8.
Two new bent bis(cyanophenyl)oxadiazole ligands, 2,5-bis(4-cyanophenyl)-1,3,4-oxadiazole (L7) and 2,5-bis(3-cyanophenyl)-1,3,4-oxadiazole (L8), were synthesized. The coordination chemistry of these ligands with various Ag(I) salts has been investigated. Seven new coordination polymers, namely, {[Ag(L7)(H2O)]ClO4}n) (1) (triclinic, P1, a = 9.342(4) A, b = 9.889(4) A, c = 10.512(4) A, alpha = 68.978(6) degrees, beta = 78.217(6) degrees, gamma = 81.851(7) degrees, Z = 2), {[Ag(L7)]SO3CF3}n (2) (monoclinic, P2(1)/n, a = 7.559(2) A, b = 23.739(6) A, c = 10.426(3) A, beta = 108.071(4) degrees, Z = 4), {[Ag(L8)]BF4 x 0.5(C6H6) x H2O}n (3) (triclinic, P1, a = 7.498(3) A, b = 10.649(4) A, c = 13.673(5) A, alpha = 98.602(5) degrees, beta = 100.004(5) degrees, gamma =110.232(5) degrees, Z = 2), {[Ag(L8)SbF6] x H2O}n (4) (triclinic, P1, a = 8.2621(9) A, b = 10.6127(12) A, c = 13.3685(15) A, alpha = 98.012(2) degrees, beta = 106.259(2) degrees, gamma = 112.362(2) degrees, Z = 2), {[Ag2(L8)2(SO3CF3)] x H2O}n (5) (triclinic, P1, a = 10.713(4) A, b = 13.449(5) A, c = 15.423(5) A, alpha = 65.908(5) degrees, beta = 74.231(5) degrees, gamma = 83.255(5) degrees, Z = 2), {[Ag2(L8)(C6H6)(ClO4)] x ClO4}n (6) (monoclinic, P2(1)/n, a = 6.9681(17) A, b = 20.627(5) A, c = 17.437(4) A, beta = 95.880(4) degrees, Z = 4), and {[Ag2(L8)(H2PO4)2]}n (7) (triclinic, P1, a = 7.956(2) A, b = 9.938(3) A, c = 14.242(4) A, alpha = 106.191(4) degrees, beta = 97.322(4) degrees, gamma = 107.392(4) degrees, Z = 1), were obtained by the combination of L7 and L8 with Ag(I) salts in a benzene/methylene chloride mixed-solvent system and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescence and electrical conductance properties of compounds 1-6 and the host-guest chemistry of compound 3 were investigated. 相似文献
9.
cis-[Ru(NO)Cl(pyca)(2)] (pyca = 2-pyridinecarboxylato), in which the two pyridyl nitrogen atoms of the two pyca ligands coordinate at the trans position to each other and the two carboxylic oxygen atoms at the trans position to the nitrosyl ligand and the chloro ligand, respectively (type I shown as in Chart 1), reacted with NaOCH(3) to generate cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I). The geometry of this complex was confirmed to be the same as the starting complex by X-ray crystallography: C(13.5)H(13)N(3)O(6.5)Ru; monoclinic, P2(1)/n; a = 8.120(1), b = 16.650(1), c = 11.510(1) A; beta = 99.07(1) degrees; V = 1536.7(2) A(3); Z = 4. The cis-trans geometrical change reaction occurred in the reactions of cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I) in water and alcohol (ROH, R = CH(3), C(2)H(5)) to form [[trans-Ru(NO)(pyca)(2)](2)(H(3)O(2))](+) (type V) and trans-[Ru(NO)(OR)(pyca)(2)] (type V). The reactions of the trans-form complexes, trans-[Ru(NO)(H(2)O)(pyca)(2)](+) (type V) and trans-[Ru(NO)(OCH(3))(pyca)(2)] (type V), with Cl(-) in hydrochloric acid solution afforded the cis-form complex, cis-[Ru(NO)Cl(pyca)(2)] (type I). The favorable geometry of [Ru(NO)X(pyca)(2)](n)(+) depended on the nature of the coexisting ligand X. This conclusion was confirmed by theoretical, synthetic, and structural studies. The mono-pyca-containing nitrosylruthenium complex (C(2)H(5))(4)N[Ru(NO)Cl(3)(pyca)] was synthesized by the reaction of [Ru(NO)Cl(5)](2)(-) with Hpyca and characterized by X-ray structural analysis: C(14)H(24)N(3)O(3)Cl(3)Ru; triclinic, Ponemacr;, a = 7.631(1), b = 9.669(1), c = 13.627(1) A; alpha = 83.05(2), beta = 82.23(1), gamma = 81.94(1) degrees; V = 981.1(1) A(3); Z = 2. The type II complex of cis-[Ru(NO)Cl(pyca)(2)] was synthesized by the reaction of [Ru(NO)Cl(3)(pyca)](-) or [Ru(NO)Cl(5)](2)(-) with Hpyca and isolated by column chromatography. The structure was determined by X-ray structural analysis: C(12)H(8)N(3)O(5)ClRu; monoclinic, P2(1)/n; a = 10.010(1), b = 13.280(1), c = 11.335(1) A; beta = 113.45(1) degrees; V = 1382.4(2) A(3); Z = 4. 相似文献
10.
Bernhardt PV 《Inorganic chemistry》2001,40(6):1086-1092
Mono- and dicopper(II) complexes of a series of potentially bridging hexaamine ligands have been prepared and characterized in the solid state by X-ray crystallography. The crystal structures of the following Cu(II) complexes are reported: [Cu(HL3)](ClO4)(3), C11H31Cl3CuN6O12, monoclinic, P2(1)/n, a = 8.294(2) A, b = 18.364(3) A, c = 15.674(3) A, beta = 94.73(2) degrees, Z = 4; ([Cu2(L4)(CO3)](2))(ClO4)(4).4H2O, C40H100Cl4Cu4N12O26, triclinic, P1, a = 9.4888(8) A, b = 13.353(1) A, c = 15.329(1) A, alpha = 111.250(7) degrees, beta = 90.068(8) degrees, gamma = 105.081(8) degrees, Z = 1; [Cu2(L5)(OH2)(2)](ClO4)(4), C13H36Cl4Cu2N6O18, monoclinic, P2(1)/c, a = 7.225(2) A, b = 8.5555(5) A, c = 23.134(8) A, beta = 92.37(1) degrees, Z = 2; [Cu2(L6)(OH2)(2)](ClO4)(4).3H2O, C14H44Cl4Cu2N6O21, monoclinic, P2(1)/a, a = 15.204(5) A, b = 7.6810(7) A, c = 29.370(1) A, beta = 100.42(2) degrees, Z = 4. Solution spectroscopic properties of the bimetallic complexes indicate that significant conformational changes occur upon dissolution, and this has been probed with EPR spectroscopy and molecular mechanics calculations. 相似文献
11.
Hagen H Bezemer C Boersma J Kooijman H Lutz M Spek AL van Koten G 《Inorganic chemistry》2000,39(18):3970-3977
Two different monoanionic O,N-chelating ligand systems, i.e., [OC6H2(CH2NMe2)-2-Me2-4,6]- (1) and [OCMe2([2]-Py)]- (2), have been applied in the synthesis of vanadium(V) complexes. The tertiary amine functionality in 1 caused reduction of the vanadium nucleus to the 4+ oxidation state with either [VOCl3], [V(=NR)Cl3], or [V(=NR)(NEt2)3] (R = Ph, (3a, 5a), R = p-Tol (3b, 5b)), and applying 1 as a reducing agent resulted in the synthesis of the vanadium(IV) complexes [VO(OC6H2(CH2NMe2)-2-Me2-4,6)2] (4) and [V(=NPh)(OC6H2(CH2NMe2)-2-Me2-4,6)2] (6). In the case of [V(=N-p-Tol)(NEt2)(OC6H2(CH2NMe2)-2-Me2-4,6)2] (7b), the reduction was sufficiently slow to allow its characterization by 1H NMR and variable-temperature studies showed it to be a five-coordinate species in solution. Although the reaction of 1 with [V(=N-p-Tol)(O-i-Pr)3] (9b) did not result in reduction of the vanadium nucleus, vanadium(V) compounds could not be isolated. Mixtures of the vanadium(V) (mono)phenolate, [V(=N-p-Tol)(O-i-Pr)2(OC6H2(CH2NMe2)-2-Me2-4,6)] (10), and the vanadium(V) (bis)phenolate, [V(=N-p-Tol)(O-i-Pr)(OC6H2(CH2NMe2)-2-Me2-4,6)2] (11), were obtained. With the pyridylalkoxide 2, no reduction was observed and the vanadium(V) compounds [VOCl2(OCMe2([2]-Py))] (12) and [V(=N-p-Tol)Cl2(OCMe2([2]-Py)] (13) were obtained. 51V NMR showed 7b and 12 to be five-coordinate in solution, whereas for 10, 11, and 13 a coordination number of 6 was found. Compounds 12 and 13 showed decreased activity compared to their nonchelated vanadium(V) analogues when applied as catalysts in ethene polymerization. Two polymorphic forms with a difference in the V-N-C angle of 12.5 degrees have been found for 6. Crystal data: 6.Et2O, triclinic, P1, a = 11.1557(6) A, b = 12.5744(12) A, c = 13.1051(14) A, alpha = 64.244(8) degrees, beta = 70.472(7) degrees, gamma = 87.950(6) degrees, V = 1547(3) A3, Z = 2; 6.C6H6, triclinic, P1, a = 8.6034(3) A, b = 13.3614(4) A, c = 15.1044(5) A, alpha = 98.182(3) degrees, beta = 105.618(2) degrees, gamma = 107.130(2) degrees, V = 1551.00(10) A3, Z = 2; 12, orthorhombic, Pbca, a = 11.8576(12) A, b = 12.6710(13) A, c = 14.722(2) A, V = 2211.9(4) A3, Z = 8. 相似文献
12.
Grove H Kelly TL Thompson LK Zhao L Xu Z Abedin TS Miller DO Goeta AE Wilson C Howard JA 《Inorganic chemistry》2004,43(14):4278-4288
Picolyl hydrazide ligands have two potentially bridging functional groups (micro-O, micro-N-N) and consequently can exist in different coordination conformers, both of which form spin-coupled polynuclear coordination complexes, with quite different magnetic properties. The complex [Cu(2)(POAP-H)Br(3)(H(2)O)] (1) involves a micro-N-N bridge (Cu-N-N-Cu 150.6 degrees ) and exhibits quite strong antiferromagnetic coupling (-2J = 246(1) cm(-)(1)). [Cu(2)(PZOAPZ-H)Br(3)(H(2)O)(2)] (2) has two Cu(II) centers bridged by an alkoxide group with a very large Cu-O-Cu angle of 141.7 degrees but unexpectedly exhibits quite weak antiferromagnetic exchange (-2J = 91.5 cm(-)(1)). This is much weaker than anticipated, despite direct overlap of the copper magnetic orbitals. Density functional calculations have been carried out on compound 2, yielding a similar singlet-triplet splitting energy. Structural details are reported for [Cu(2)(POAP-H)Br(3)(H(2)O)] (1), [Cu(2)(PZOAPZ-H)Br(3)(H(2)O)(2)] (2), [Cu(2)(PAOPF-2H)Br(2)(DMSO)(H(2)O)].H(2)O (3), [Cu(4)(POMP-H))(4)](NO(3))(4).2H(2)O (4), and PPOCCO (5) (a picolyl hydrazide ligand with a terminal oxime group) and its mononuclear complexes [Cu(PPOCCO-H)(NO(3))] (6) and [Cu(PPOCCO-H)Cl] (7). Compound 1 (C(12)H(13)Br(3)Cu(2)N(5)O(4)) crystallizes in the monoclinic system, space group P2(1)/c, with a = 15.1465(3) A, b = 18.1848(12) A, c = 6.8557(5) A, beta = 92.751(4) degrees, and Z = 4. Compound 2 (C(10)H(13)Br(3)Cu(2)N(7)O(4)) crystallizes in the triclinic system, space group P, with a = 9.14130(1) A, b = 10.4723(1) A, c = 10.9411(1) A, alpha = 100.769(1), beta = 106.271(1) degrees, gamma = 103.447(1) degrees, and Z = 2. Compound 3 (C(23)H(22)Br(2)Cu(2)N(7)O(5.5)S) crystallizes in the monoclinic system, space group P2(1)/c, with a = 12.406(2) A, b = 22.157(3) A, c = 10.704(2) A, beta = 106.21(1) degrees, and Z = 4. Compound 4(C(52)H(48)Cu(4)N(20)O(18)) crystallizes in the monoclinic system, space group P2(1)/n, with a = 14.4439(6) A, b = 12.8079(5) A, c = 16.4240(7) A, beta = 105.199(1) degrees, and Z = 4. Compound 5 (C(15)H(14)N(4)O(2)) crystallizes in the orthorhombic system, space group Pna2(1), with a = 7.834(3) A, b = 11.797(4) A, c = 15.281(3) A, and Z = 4. Compound 6(C(15)H(13)CuN(5)O(5)) crystallizes in the monoclinic system, space group P2(1)/c, with a = 8.2818(9) A, b = 17.886(2) A, c = 10.828(1) A, beta = 92.734(2) degrees, and Z = 4. Compound 7 (C(15)H(13)CuClN(4)O(2)) crystallizes in the orthorhombic system, space group Pna2(1), with a = 7.9487(6) A, b = 14.3336(10) A, c = 13.0014(9) A, and Z = 4. Density functional calculations on PPOCCO are examined in relation to the anti-eclipsed conformational change that occurs on coordination to copper(II). 相似文献
13.
Cationic Re(V) oxo complexes with poly(pyrazolyl)borates: synthesis, characterization, and stability
Cationic Re(V) oxo compounds of the type [ReO(OSiMe3)(eta 2-B(pz)4)(L)2]X [X = Cl, L = 4-(NMe2)C5H4N (1), 1-Meimz (1-methylimidazole; 2), 1/2 dmpe (1,2-bis(dimethylphosphino)ethane; 3), py (4a); X = I, L = py (4b)] can be prepared by reacting trans-[ReO2(eta 2-B(pz)4)(L)2] with XSiMe3. In solution, cations 1-4 are reactive species, and those with unidentate nitrogen donor ligands (1, 2, and 4) rearrange into the neutral derivatives [ReO(Cl)(OSiMe3)(eta 2-B(pz)4)(L)] [L = py (5), 4-(NMe2)C5H4N (6), 1-Meimz (7)], which are also reported herein. Compounds 1-3 and 5-7 have been fully characterized by the usual spectroscopic techniques, which in some cases includes X-ray crystallographic analysis (3, 6, and 7). Compound 3 crystallizes from CH2Cl2/n-hexane as yellow crystals with one molecule of CH2Cl2 solvent, and compounds 6 and 7 crystallize from THF/n-hexane as violet and red crystals, respectively, with one molecule of THF solvent in the case of 6. Crystallographic data: 3, orthorhombic space group Pn2(1)a, a = 11.311(2) A, b = 19.135(2) A, c = 15.443(2) A, V = 3342.4(8) A3, Z = 4; 6, triclinic space group P1, a = 8.7179(11) A, b = 12.5724(8) A, c = 17.750(2) A, alpha = 70.454(7) degrees, beta = 77.935(9) degrees, gamma = 77.129(8) degrees, V = 1768.1(3) A3, Z = 2; 7, monoclinic space group P2(1)/c, a = 16.356(2) A, b = 20.384(3) A, c = 17.360(3) A, beta = 106.971(12) degrees, V = 5535.8(14) A3, Z = 8. 相似文献
14.
The second method for the synthesis of cis-[Ru(III)Cl(2)(cyclam)]Cl (1) (cyclam = 1,4,8,11-tetraazacyclotetradecane), with use of cis-Ru(II)Cl(2)(DMSO)(4) (DMSO = dimethyl sulfoxide) as a starting complex, is reported together with the synthesis of [Ru(II)(cyclam)(bpy)](BF(4))(2).H(2)O (2) (bpy = 2,2'-bipyridine) from 1. The syntheses of Ru complexes of tris(2-aminoethyl)amine (tren) are also reported. A reaction between K(3)[Ru(III)(ox)(3)] (ox = oxalate) and tren affords fac-[Ru(III)Cl(3)(trenH)]Cl.(1)/(2)H(2)O (3) (trenH = bis(2-aminoethyl)(2-ammonioethyl)amine = monoprotonated tren) and (H(5)O(2))(2)[K(tren)][Ru(III)Cl(6)] (4) as major products and gives fac-[Ru(III)Cl(ox)(trenH)]Cl.(3)/(2)H(2)O (5) in very low reproducibility. A reaction between 3 and bpy affords [Ru(II)(baia)(bpy)](BF(4))(2) (6) (baia = bis(2-aminoethyl)(iminomethyl)amine), in which tren undergoes a selective dehydrogenation into baia. The crystal structures of 2-6 have been determined by X-ray diffraction, and their structural features are discussed in detail. Crystallographic data are as follows: 2, RuF(8)ON(6)C(20)B(2)H(34), monoclinic, space group P2(1)/c with a = 12.448(3) ?, b = 13.200(7) ?, c = 17.973(4) ?, beta = 104.28(2) degrees, V = 2862(2) ?(3), and Z = 4; 3, RuCl(4)O(0.5)N(4)C(6)H(20), monoclinic, space group P2(1)/a with a = 13.731(2) ?, b = 14.319(4) ?, c = 13.949(2) ?, beta = 90.77(1) degrees, V = 2742(1) ?(3), and Z = 8; 4, RuKCl(6)O(4)N(4)C(6)H(28), trigonal, space group R&thremacr; with a = 10.254(4), c = 35.03(1) ?, V = 3190(2) ?(3), and Z = 6; 5, RuCl(2)O(5.5)N(4)C(8)H(22), triclinic, space group P&onemacr; with a = 10.336(2) ?, b = 14.835(2) ?, c = 10.234(1) ?, alpha = 90.28(1) degrees, beta = 90.99(1) degrees, gamma = 92.07(1) degrees, V = 1567.9(4) ?(3), and Z = 4; 6, RuF(8)N(6)C(16)B(2)H(24), monoclinic, space group P2(1)/c, a = 10.779(2) ?, b = 14.416(3) ?, c = 14.190(2) ?, beta = 93.75(2) degrees, V = 2200.3(7) ?(3), and Z = 4. Compound 4 possesses a very unique layered structure made up of both anionic and cationic slabs, {[K(tren)](2)[Ru(III)Cl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[Ru(III)Cl(6)]}(n)()(n)()(+) (n = infinity), in which both sheets {[K(tren)](2)}(n)()(2)(n)()(+) and {(H(5)O(2))(4)}(n)()(4)(n)()(+) offer cylindrical pores that are occupied with the [Ru(III)Cl(6)](3)(-) anions. The presence of a C=N double bond of baia in 6 is judged from the C-N distance of 1.28(2) ?. It is suggested that the structural restraint enhanced by the attachment of alkylene chelates at the nitrogen donors of amines results in either the mislocation or misdirection of the donors, leading to the elongation of the Ru-N(amine) distances and to the weakening of their trans influence. Such structural strain is also discussed as related to the spectroscopic and electrochemical properties of the cis-[Ru(II)L(4)(bpy)](2+) complexes (L(4) = (NH(3))(4), (ethylenediamine)(2), and cyclam). 相似文献
15.
Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4. 相似文献
16.
2,4,6-Tris(2-pyridyl)-1,3,5-triazine (TPT) bridged dinuclear rhenium(I) tricarbonyl halide complexes with the composition (mu-TPT)[ReX(CO)(3)](2) (3, X = Cl; 4, X = Br) can be made either by one-pot reaction of TPT with 2 equiv of [ReX(CO)(5)] (X = Cl and Br) in chloroform or by reacting mononuclear [ReX(CO)(3)(TPT)] (2) (1, X = Cl; 2, X = Br) with an excess amount of [ReX(CO)(5)]. Crystal data are as follows. 1: monoclinic, P2(1)/c, a = 11.751(1) A, b = 11.376(1) A, c = 15.562(2) A, beta = 103.584(2) degrees, V = 2022.0(4) A(3), Z = 4. 2: monoclinic, P2(1)/c, a = 11.896(1) A, b = 11.396(1) A, c = 15.655(1) A, beta = 104.474(2) degrees, V = 2054.9(3) A(3), Z = 4. 3: triclinic, P1, a = 11.541(2) A, b = 12.119(2) A, c = 13.199(2) A, alpha = 80.377(2) degrees, beta = 76.204(3) degrees, gamma = 66.826(2) degrees, V = 1642.5(4) A(3), Z = 2. Crystals of 4 crystallized from acetone: triclinic, P1, a = 11.586(5) A, b = 12.144(5) A, c = 13.364(6) A, alpha = 80.599(7) degrees, beta = 76.271(8) degrees, gamma = 67.158(8) degrees, V = 1678.0(12) A(3), Z = 2. Crystals of 4' are obtained from CH(2)Cl(2)-pentane solution: monoclinic, C2/c, a = 17.555(4) A, b = 15.277(3) A, c = 13.093(3) A, beta = 111.179(3) degrees, V = 3274.0(12) A(3), Z = 4. By contrast, similar reactions in the presence of methanol yielded complexes with the composition [mu-C(3)N(3)(OMe)(py)(2)(pyH)][ReX(CO)(3)](2) (5, X = Cl; 6, X = Br). Crystal data for 5: monoclinic, C2/c, a = 26.952(2) A, b = 16.602(1) A, c = 14.641(1) A, beta = 116.147(1) degrees, V = 5880.5(8) A(3), Z = 8. 6: monoclinic, C2/c, a = 27.513(3) A, b = 16.740(2) A, c = 14.837(2) A, beta = 116.925(2) degrees, V = 6092.8(10) A(3), Z = 8. An unusual metal-induced methoxylation at the carbon atom of the triazine ring of the bridging TPT ligand was observed. The nucleophilic attack of MeO(-) on C(3) results in a tetrahedral geometry around the carbon atom. Concomitantly, the uncoordinated pyridyl ring is protonated and rotated into a perpendicular orientation relative to the central C(3)N(3) ring. Reaction of TPT with [NEt(4)](2)[ReBr(3)(CO)(3)] in benzene-methanol resulted in an unexpected dinuclear complex 7, with formulation [mu-C(3)N(3)(OMe)(py)(3)][Re(CO)(3)][ReBr(CO)(3)]. The methoxylated TPT ligand functions simultaneously as a tridentate and bidentate ligand with two fac-Re(CO)(3)(+) cores. Crystal data for 7: monoclinic, P2(1)/n, a = 12.114(1) A, b = 14.878(1) A, c = 15.807(1) A, beta = 104.601(1) degrees, V = 2756.9(3) A(3), Z = 4. 相似文献
17.
Yoshimura T Chen ZN Itasaka A Abe M Sasaki Y Ishizaka S Kitamura N Yarovoi SS Solodovnikov SF Fedorov VE 《Inorganic chemistry》2003,42(16):4857-4863
Hexarhenium(III) complexes with terminal isothiocyanate ligands, [(n-C(4)H(9))(4)N](4)[Re(6)(mu(3)-S)(8)(NCS)(6)] (1) and (L)(4)[Re(6)(mu(3)-Se)(8)(NCS)(6)] (L(+) = PPN(+) (2a), (n-C(4)H(9))(4)N(+) (2b)), have been prepared by three different methods. Complex 1 was prepared by the reaction of [(n-C(4)H(9))(4)N](4)[Re(6)(mu(3)-S)(8)Cl(6)] with molten KSCN at 200 degrees C, while 2b was obtained by refluxing the chlorobenzene-DMF (2:1 v/v) solution of [Re(6)(mu(3)-Se)(8)(CH(3)CN)(6)](SbF(6))(2) and [(n-C(4)H(9))(4)N]SCN. The [Re(6)(mu(3)-Se)(8)(NCS)(6)](4)(-) anion was also obtained from a mixture of Cs(2)[Re(6)(mu(3)-Se)(8)Br(4)] and KSCN in C(2)H(5)OH by a mechanochemical activation at room temperature for 20 h and isolated as 2a. The X-ray structures of 1 and 2a.4DMF have been determined (1, C(70)H(144)N(10)S(14)Re(6), monoclinic, space group P2(1)/n (No. 14), a = 14.464(7) A, b = 22.059(6) A, c = 16.642(8) A, beta = 113.62(3) degrees, V = 4864(3) A(3), Z = 2; 2a.4DMF, C(162)H(144)N(14)O(4)P(8)S(6)Se(8)Re(6), triclinic, space group P1 (No. 2), a = 15.263(2) A, b = 16.429(2) A, c = 17.111(3) A, alpha = 84.07(1) degrees, beta = 84.95(1) degrees, gamma = 74.21(1) degrees, V = 4098.3(8) A(3), Z = 1). All the NCS(-) ligands in both complexes are coordinated to the metal center via nitrogen site with the Re-N distances in the range of 2.07-2.13 A. The redox potentials of the reversible Re(III)(6)/Re(III)(5)Re(IV) process in acetonitrile are +0.84 and +0.70 V vs. Ag/AgCl for [Re(6)(mu(3)-S)(8)(NCS)(6)](4)(-) and [Re(6)(mu(3)-Se)(8)(NCS)(6)](4)(-), respectively, which are the most positive among the known hexarhenium complexes with six terminal anionic ligands. The complexes show strong red luminescence with the emission maxima (lambda(max)/nm), lifetimes (tau(em)/micros), and quantum yields (phi(em)) being 745 and 715, 10.4 and 11.8, and 0.091 and 0.15 for 1 and 2b, respectively, in acetonitrile. The data reasonably well fit in the energy-gap plots of other hexarhenium(III) complexes. The temperature dependence of the emission spectra and tau(em) of 1 and [(n-C(4)H(9))(4)N](4)[Re(6)(mu(3)-S)(8)Cl(6)] are also reported. 相似文献
18.
The reaction between alkyl or aryl aldehydes and macrocyclic ligands with pendant amine groups produced imidazolidine-containing bi- or tricyclic ligands. The copper complexes of three of these ligands were structurally characterized: [CuL3Cl].3H2O (triclinic, P1, a = 10.041(2) A, b = 10.172(1) A, c = 11.202(1) A, alpha = 92.07(1) degrees, beta = 96.76(2) degrees, gamma = 92.99(1) degrees, Z = 2), [Cu(H2L4)Cl]Cl.2H2O (monoclinic, P2(1)/n, a = 15.159(5) A, b = 10.645(1) A, c = 19.094(6) A, beta = 93.78(1) degrees, Z = 4), [CuL5].2H2O.NaNO3 (monoclinic, P2(1)/n, a = 10.649(8) A, b = 7.261(2) A, c = 15.25(1) A, beta = 94.77(4) degrees, Z = 2). The conformational rigidity and stereochemical activity of these macrocycles and their complexes are discussed in comparison with close analogues. 相似文献
19.
Reactions of [Cu(CH(3)CN)(4)]X (X = PF(6), BF(4)) with bis(diphenylphosphino)methane (dppm = Ph(2)PCH(2)PPh(2)) and ammonium dialkyldithiophosphates, (NH(4))[S(2)P(OR)(2)] (R = Et, (i)Pr), yield a series of novel Cu(I) polynuclear complexes, trinuclear [Cu(3)(mu-dppm)(3)(mu(3)-Cl){S(2)P(OEt)(2)}] (PF(6)) 1 and [Cu(3)(mu-dppm)(2){S(2)P(OR)(2)}(2)](PF(6)) (R = Et, 2; (i)Pr, 3), tetranuclear [Cu(4)(mu-dppm)(2) {S(2)P(OEt)(2)}(4)] 4, and hexanuclear [Cu(6)(mu-dppm)(2)(mu(4)-Cl){S(2)P(O(i)()Pr)(2)}(4)](BF(4)) 5. Similarly, the reaction of [Cu(2)(mu-L-L)(2)(CH(3)CN)(2)](PF(6))(2) (L-L, dppm, dppe = Ph(2)PCH(2)CH(2)PPh(2)) with (NH(4))[S(2)P(OR)(2)] yields dinuclear [Cu(2)(mu-dppm)(2){S(2)P(OR)(2)}(2)] 6 (R= (i)Pr, 6A; Et, 6B), trinuclear [Cu(3)(mu-dppe)(3)(mu-Cl)(2){S(2)P(O(i)Pr)(2)}] 9, and polymeric [Cu(mu(2)-dppe){S(2)P(OR)(2)}](n) (R = Et, 7; (i)Pr, 8) complexes. The formation of 1 and 5 involved the abstraction of chloride from dichloromethane when the Cu/S(2)P(OR)(2) ratio exceeded 1, but when ratio was 1:1, no Cl abstraction occurred, as in compound 4. Compound 9, however, was obtained as a 12% byproduct in the synthesis of 8 using a 1:1:1 ratio of Cu/dppe/S(2)P(O(i)Pr)(2). The chloride binds to Cu atoms in a mu(3)-Cl mode by capping one face of the Cu(3) triangle of cluster 1. A mu(4)-Cl caps a single tetragonal face of the trigonal prism of cluster 5, and in the cluster 9, two chlorides bond in mu(2)-Cl modes. Both clusters 2 and 3 exhibit the mu(3)-S mode of bonding for dtp ligands. Only cluster 5 exhibited close Cu...Cu contacts (2.997-3.0238 A). All of compounds were characterized by single-crystal X-ray diffraction and pertinent crystallographic data for 1, 5, and 9 are are follows: (1) C(79)H(76)ClCu(3)F(6)O(2)P(8)S(2), triclinic, P, a = 11.213(1) A, b = 14.142(1) A, c = 25.910(2) A, alpha = 95.328(2) degrees , beta = 99.594(2) degrees , gamma = 102.581(2) degrees , V = 3918.2(6) A(3), Z = 2; (5) C(74)H(100)BClCu(6)F(4)O(8)P(8)S(8), monoclinic, P2(1)/n, a = 25.198(4) A, b = 15.990(3) A, c = 25.421(4) A, beta = 106.027(3) degrees , V = 9845(3)A(3), Z = 4; (9) C(84)H(86)Cl(2)Cu(3)O(2)P(7)S(2), monoclinic, C2/c, with a = 24.965(3) A, b = 17.058(2) A, c = 20.253(2) A, beta = 95.351(4) degrees , V = 8587.4(17)A(3), Z = 4. 相似文献
20.
Soler M Artus P Folting K Huffman JC Hendrickson DN Christou G 《Inorganic chemistry》2001,40(19):4902-4912
Methods are reported for the preparation of mixed-carboxylate versions of the [Mn(12)O(12)(O(2)CR)(16)(H(2)O)(4)] family of single-molecule magnets (SMMs). [Mn(12)O(12)(O(2)CCHCl(2))(8)(O(2)CCH(2)Bu(t))(8)(H(2)O)(3)] (5) and [Mn(12)O(12)(O(2)CHCl(2))(8)(O(2)CEt)(8)(H(2)O)(3)] (6) have been obtained from the 1:1 reaction of the corresponding homocarboxylate species. Complex 5.CH(2)Cl(2).H(2)O crystallizes in the triclinic space group P1 with, at -165 degrees C, a = 15.762(1), b = 16.246(1), c = 23.822(1) A, alpha = 103.92(1), beta = 104.50(1), gamma = 94.23(1) degrees, Z = 2, and V = 5674(2) A(3). Complex 6.CH(2)Cl(2) crystallizes in the triclinic space group P1 with, at -158 degrees C, a = 13.4635(3), b = 13.5162(3), c = 23.2609(5) A, alpha = 84.9796(6), beta = 89.0063(8), gamma = 86.2375(6) degrees, Z = 2, and V = 4207.3(3) A(3). Complexes 5 and 6 both contain a [Mn(12)O(12)] core with the CHCl(2)CO(2-) ligands ordered in the axial positions and the RCO(2-) ligands (R = CH(2)Bu(t) (5) or Et (6)) in equatorial positions. There is, thus, a preference for the CHCl(2)CO(2-) to occupy the sites lying on the Mn(III) Jahn-Teller axes, and this is rationalized on the basis of the relative basicities of the carboxylate groups. Direct current magnetic susceptibility studies in a 10.0 kG field in the 2.00-300 K range indicate a large ground-state spin, and fitting of magnetization data collected in the 10.0-70.0 kG field and 1.80-4.00 K temperature range gave S = 10, g = 1.89, and D = -0.65 K for 5, and S = 10, g = 1.83, and D = -0.60 K for 6. These values are typical of [Mn(12)O(12)(O(2)CR)(16)(H(2)O)(4)] complexes. Alternating current susceptibility studies show the out-of-phase susceptibility (chi(M)' ') signals characteristic of the slow relaxation in the millisecond time scale of single-molecule magnets. Arrhenius plots obtained from chi(M)' ' versus T data gave effective barriers to relaxation (U(eff)) of 71 and 72 K for 5 and 6, respectively. (1)H NMR spectra in CD(2)Cl(2) show that 5 and 6 are the main species present on dissolution, but there is evidence for some ligand distribution between axial and equatorial sites, by intra- and/or intermolecular exchange processes. 相似文献