Hydrothermal Syntheses and Structural Characterization of Layered Vanadium Oxides Incorporating Organic Cations: alpha-, beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] and alpha-, beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)

Four new layered mixed-valence vanadium oxides, which contain interlamellar organic cations, alpha-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1a), beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1b), alpha-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2a), and beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2b), have been prepared under hydrothermal conditions and their single-crystal structures determined: 1a, triclinic, space group P&onemacr;, a = 6.602(2) ?, b = 7.638(2) ?, c = 5.984(2) ?, alpha = 109.55(3) degrees, beta = 104.749(2) degrees, gamma = 82.31(3) degrees, Z = 1; 1b, triclinic, P&onemacr;, a = 6.387(1) ?, b = 7.456(2) ?, c = 6.244(2) ?, alpha = 99.89(2) degrees, beta = 102.91(2) degrees, gamma = 78.74(2) degrees, Z = 1; 2a, triclinic, P&onemacr;, a = 6.3958(5) ?, b = 8.182(1) ?, c = 6.3715(7) ?, alpha = 105.913(9) degrees, beta = 104.030(8) degrees, gamma = 94.495(8) degrees, Z = 1; 2b, monoclinic, space group P2(1)/n, a = 9.360(2) ?, b = 6.425(3) ?, c = 10.391(2) ?, beta = 105.83(1) degrees, Z = 2. All four of the compounds contain mixed-valence V(5+)/V(4+) vanadium oxide layers constructed from V(5+)O(4) tetrahedra and pairs of edge-sharing V(4+)O(5) square pyramids with protonated organic amines occupying the interlayer space.     

Synthesis and characterization of six new quaternary actinide thiophosphate compounds: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6)(,) K(10)Th(3)(P(2)S(7))(4)(PS(4))(2), and A(5)An(PS(4))(3), (A = K, Rb, Cs; An = U, Th)

Six new actinide metal thiophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6) (I), K(10)Th(3)(P(2)S(7))(4)(PS(4))(2) (II), K(5)U(PS(4))(3) (III), K(5)Th(PS(4))(3) (IV), Rb(5)Th(PS(4))(3) (V), and Cs(5)Th(PS(4))(3) (VI). Compound I crystallizes in the monoclinic space group P2(1)/c with a = 33.2897(1) A, b = 14.9295(1) A, c = 17.3528(2) A, beta = 115.478(1) degrees, Z = 8. Compound II crystallizes in the monoclinic space group C2/c with a = 32.8085(6) A, b = 9.0482(2) A, c = 27.2972(3) A, beta = 125.720(1) degrees, Z = 8. Compound III crystallizes in the monoclinic space group P2(1)/c with a = 14.6132(1) A, b = 17.0884(2) A, c = 9.7082(2) A, beta = 108.63(1) degrees, Z = 4. Compound IV crystallizes in the monoclinic space group P2(1)/n with a = 9.7436(1) A, b = 11.3894(2) A, c = 20.0163(3) A, beta = 90.041(1) degrees, Z = 4, as a pseudo-merohedrally twinned cell. Compound V crystallizes in the monoclinic space group P2(1)/c with a = 13.197(4) A, b = 9.997(4) A, c = 18.189(7) A, beta = 100.77(1) degrees, Z = 4. Compound VI crystallizes in the monoclinic space group P2(1)/c with a = 13.5624(1) A, b = 10.3007(1) A, c = 18.6738(1) A, beta = 100.670(1) degrees, Z = 4. Optical band-gap measurements by diffuse reflectance show that compounds I and III contain tetravalent uranium as part of an extended electronic system. Thorium-containing compounds are large-gap materials. Raman spectroscopy on single crystals displays the vibrational characteristics expected for [PS(4)](3)(-), [P(2)S(7)](4-), and the new [P(3)S(10)](5)(-) building blocks. This new thiophosphate building block has not been observed except in the structure of the uranium-containing compound Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6).     

Anion-directed crystallization of coordination polymers: syntheses and characterization of Cu(4)(2-pzc)(4)(H(2)O)(8)(Mo(8)O(26)).2H(2)O and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2-pzc = 2-pyrazinecarboxylate)

Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo(8)O(26)](4-) and [V(10)O(28)H(4)](2-) anions were synthesized and structurally characterized: Cu(4)(2-pzc)(4))(H(2)O)(8)(Mo(8)O(26)).2H(2)O (1) and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) A, b = 13.4149(6) A, c = 15.9633(7) A, beta = 90.816(1) degrees; 2, triclinic, space group P1, a = 10.5896(10) A, b = 10.7921(10) A, c = 13.5168(13) A, alpha = 104.689(2) degrees, beta = 99.103(2) degrees, gamma = 113.419(2) degrees. Compound 1 contains [Cu(2-pzc)(H(2)O)(2)] chains charge-balanced by [Mo(8)O(26)](4-) anions. In compound 2, layers of [Cu(3)(2-pzc)(4)(H(2)O)(2)] form cavities that are filled with [V(10)O(28)H(4)](2-) anions. The magnetic properties of both compounds are described.     

Stereochemical Consequences of the Bismuth Atom Electron Lone Pair, a Comparison between MX(6)E and MX(6) Systems. Crystal and Molecular Structures of Tris[N-(P,P-diphenylphosphinoyl)-P,P-diphenylphosphinimidato]bismuth(III), [Bi{(OPPh(2))(2)N}(3)], -indium(III), [In{(OPPh(2))(2)N}(3)].C(6)H(6), and -gallium(III), [Ga{(OPPh(2))(2)N}(3)].CH(2)Cl(2)

The tetraphenylimidodiphosphinate [N-(P,P-diphenylphosphinoyl)-P,P-diphenylphosphinimidate] ion forms stable tris-chelates with the Bi(III), In(III), and Ga(III) cations. The crystal and molecular structures of [M{(OPPh(2))(2)N}(3)] (M = Ga, In, Bi) were determined by X-ray diffractometry. The geometry around the bismuth atom in compound 3 displays an approximately C(3)(v)() symmetry. This arrangement suggests the presence of a stereoactive lone pair of electrons, which is located in one of the triangular octahedral faces. Derivative 3 crystallizes in the triclinic space group P&onemacr; with Z = 2, a = 14.006(6) ?, b = 14.185(4) ?, c = 17.609(8) ?, alpha = 88.45(2) degrees, beta = 79.34(2) degrees, and gamma = 78.23(2) degrees. The structures of the gallium(III) and indium(III) tris-chelate oxygen-based complexes (1 and 2, respectively) were compared with the bismuth analogue in order to determine the ligand steric bulk influence on the coordination sphere in the absence of the electron lone pair. Complex 1 crystallizes as the [Ga{(OPPh(2))(2)N}(3)].CH(2)Cl(2) solvate in the triclinic space group P&onemacr;; Z = 2, a = 13.534(4) ?, b = 13.855(4) ?, c = 18.732(7) ?, alpha = 95.48(2) degrees, beta = 98.26(2) degrees, and gamma = 97.84(2) degrees. Crystal data for the benzene solvate of 2, [In{(OPPh(2))(2)N}(3)].C(6)H(6): triclinic space group P&onemacr;, Z = 2, a = 13.542(9) ?, b = 15.622(3) ?, c = 18.063(5) ?, alpha = 98.21(1) degrees, beta = 104.77(0) degrees, and gamma = 92.260(0) degrees.     

Sandwich-type phosphotungstates: structure,electrochemistry, and magnetism of the trinickel-substituted polyoxoanion [Ni(3)Na(H(2)O)(2)(PW(9)O(34))(2)](11-)

The novel nickel-substituted, dimeric phosphotungstate [Ni(3)Na(H(2)O)(2)(PW(9)O(34))(2)](11-) (1) has been synthesized and characterized by IR spectroscopy, elemental analysis, and electrochemistry. X-ray single-crystal analysis was carried out on Na(11)[Ni(3)Na(H(2)O)(2)(PW(9)O(34))(2)].21.25H(2)O, which crystallizes in the triclinic system, space group P1, with a = 12.2467(6) A, b = 16.6031(7) A, c = 22.4017(12) A, alpha = 73.9870(10) degrees, beta = 87.6060(10) degrees, gamma = 79.344(2) degrees, and Z = 2. The polyanion consists of two lacunary B-alpha-[PW(9)O(34)](9-) Keggin moieties linked via three nickel(II) centers and a sodium ion. The structure of 1 is composed of two fused Keggin fragments that represent different Baker-Figgis isomers (alpha- vs beta-type). Electrochemical studies show that 1 exhibits a stable and reproducible voltammetric pattern, with a first wave featuring a chemically reversible four-electron/four-proton process. An investigation of the magnetic properties indicates that the three nickel centers exhibit ferromagnetic exchange interaction.     

Novel vanadium(V) compounds with a layer structure: synthesis,crystal structures,and solid state NMR spectroscopy of [(VO(2))(2)(4,4'-bpy)(0.5)(4,4'-Hbpy)(XO(4))] x H(2)O (X = P and As)

A novel vanadium(V) phosphate and the arsenate analogue, [(VO(2))(2)(4,4'-bpy)(0.5)(4,4'-Hbpy)(XO(4))].H(2)O (X = P, As; bpy = bipyridine), have been synthesized under hydrothermal conditions and structurally characterized by single-crystal X-ray diffraction. They are the first structurally characterized compounds in the vanadium(V)/4,4'-bpy/phosphate (or arsenate) systems. The two compounds are isostructural and crystallize in the triclinic space group P macro (No. 2) with a = 7.9063(3) A, b = 10.2201(4) A, c = 12.1336(5) A, alpha = 113.4652(7) degrees, beta = 95.7231(7) degrees, gamma = 94.4447(7) degrees, and Z = 2 for the phosphate, and a = 7.8843(6) A, b = 10.3686(7) A, c = 12.2606(9) A, alpha = 113.464(1) degrees, beta = 95.560(1) degrees, gamma = 94.585(1) degrees, and Z = 2 for the arsenate. The structure consists of phosphate-bridged vanadium(V) double chains linked through 4,4'-bpy ligands to form a sheet with the monoprotonated 4,4'-Hbpy(+) ligand being coordinated to the metal atom as a pendent group. The (1)H MAS NMR spectrum exhibits four resonances at 14.2, 9.5, 7.2, and 3.7 ppm with an intensity ratio close to 1:6:6:2, corresponding to three different types of protons in 4,4'-bpy and 4,4'-Hbpy(+) and one type of protons in H(2)O. The peak at 14.2 ppm can be assigned to the proton bonded to the pyridine nitrogen atom, which confirms the presence of 4,4'-Hbpy(+).     

Copper and Bismuth Complexes Containing Dipyridyl gem-Diolato Ligands: Bi(III)(2)[(2-Py)(2)CO(OH)](2)(O(2)CCF(3))(4)(THF)(2), Cu(II)[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), and Cu(II)(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), a Ferromagnetically Coupled Tetranuclear Copper(II) Chain

The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1.     

Formation of a spiral-shaped inorganic-organic hybrid chain, [Cu(II)(2,2'-bipy)(H(2)O)(2)Al(OH)(6)Mo(6)O(18)](n)()(n)()(-): influence of intra- and interchain supramolecular interactions

A novel chainlike coordination polymer [Cu(II)(2,2'-bipy)(H(2)O)(2)Al(OH)(6)Mo(6)O(18)](n)()(n)()(-), formed from a heteropolyanion [Al(OH)(6)Mo(6)O(18)](3)(-) as a building unit and a copper(II) complex fragment, [Cu(II)(2,2'-bipy)(H(2)O)(2)](2+), as a linker, provides the first example of an extended structure based on an Anderson type of polyanion and a transition metal complex with organic ligand. The intra- and interchain O-H.O hydrogen-bonding interactions are seemingly responsible for the spiral shape of this chain. Crystal data: triclinic space group Ponemacr;, a = 11.2253(18) A, b = 14.5194(17) A, c = 15.2672(10) A, alpha = 112.191(8) degrees, beta = 106.693(9) degrees, gamma = 93.916(13) degrees, and Z = 2.     

Unsymmetrical linear pentanuclear nickel string complexes: [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3))

The one-electron oxidized linear pentanuclear nickel complexes [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) (1) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3)) (2) have been synthesized by reacting the neutral compound [Ni(5)(tpda)(4)Cl(2)] with the corresponding silver salts. These compounds have been characterized by various spectroscopic techniques. Compound 1 crystallizes in the monoclinic space group P2(1)/n with a = 15.3022(1) A, b = 31.0705(3) A, c = 15.8109(2) A, beta = 92.2425(4) degrees, V = 7511.49(13) A(3), Z = 4, and compound 2 crystallizes in the monoclinic space group C2/c with a = 42.1894(7) A, b = 17.0770(3) A, c = 21.2117(4) A, beta = 102.5688(8) degrees, V = 14916.1(5) A(3), Z = 8. X-ray structural studies reveal an unsymmetrical Ni(5) unit for both compounds 1 and 2. Compounds 1 and 2 show stronger Ni-Ni interactions as compared to those of the neutral compounds.     

Homologous series of redox-active, dinuclear cations [M(2)(O(2)CCH(3))(2)(pynp)(2)](2+) (M = Mo, Ru, Rh) with the bridging ligand 2-(2-pyridyl)-1,8-naphthyridine (pynp)

A homologous series of dinuclear compounds with the bridging ligand 2-(2-pyridyl)-1,8-naphthyridine (pynp) has been prepared and characterized by X-ray crystallographic and spectroscopic methods. [Mo(2)(O(2)CCH(3))(2)(pynp)(2)][BF(4)](2) x 3CH(3)CN (1) crystallizes in the monoclinic space group P2(1)/c with a = 15.134(5) A, b = 14.301(6) A, c = 19.990(6) A, beta = 108.06(2) degrees, V = 4113(3) A(3), and Z = 4. [Ru(2)(O(2)CCH(3))(2)(pynp)(2)][PF(6)](2) x 2CH(3)OH (2) crystallizes in the monoclinic space group C2/c with a = 14.2228(7) A, b = 20.3204(9) A, c = 14.1022(7) A, beta = 95.144(1) degrees, V = 4059.3(3) A(3), and Z = 4. [Rh(2)(O(2)CCH(3))(2)(pynp)(2)][BF(4)](2) x C(7)H(8) (3) crystallizes in the monoclinic space group C2/c with a = 13.409(2) A, b = 21.670(3) A, c = 13.726(2) A, beta = 94.865(2) degrees, V = 3973.9(8) A(3), and Z = 4. A minor product, [Rh(2)(O(2)CCH(3))(2)(pynp)(2)(CH(3)CN)(2)][BF(4)][PF(6)] x 2CH(3)CN (4), was isolated from the mother liquor after crystals of 3 had been harvested; this compound crystallizes in the triclinic space group, P1 with a = 12.535(3) A, b = 13.116(3) A, c = 13.785(3) A, alpha = 82.52(3) degrees, beta = 77.70(3) degrees, gamma = 85.76(3) degrees, V = 2193.0(8) A(3), and Z = 2. Compounds 1-3 constitute a convenient series for probing the influence of the electronic configuration on the extent of mixing of the M-M orbitals with the pi system of the pynp ligand. Single point energy calculations performed on 1-3 at the B3LYP level of theory lend insight into the bonding in these compounds and allow for correlations to be made with electronic spectral data. Although purely qualitative in nature, the values for normalized change in orbital energies (NCOE) of the frontier orbitals before and after reduction are in agreement with the observed differences in reduction potentials as determined by cyclic voltammetry.     

Synthesis and Structural Investigations of [Mn(3)O(4)(phen)(4)(H(2)O)(2)](NO(3))(4).2.5H(2)O: A Water-Bound Complex Obtained by Cerium(IV) Oxidation

The trinuclear manganese complex [Mn(3)O(4)(phen)(4)(H(2)O)(2)](NO(3))(4).2.5H(2)O, 1 (where, phen = 1,10-phenanthroline), has been synthesized by the Ce(IV) oxidation of a concentrated solution of manganese(II) acetate and phen in 1.6 N nitric acid. The complex crystallizes in the triclinic space group P&onemacr; with a = 10.700(2) ?, b = 12.643(3) ?, c = 20.509(4) ?, alpha = 78.37(3) degrees, beta = 83.12(3) degrees, gamma = 82.50(3) degrees, and Z = 2. The structure was solved by direct methods and refined by least-squares techniques to the conventional R (R(w)) factors of 0.055 (0.076) based on 4609 unique reflections with F(o) >/= 6.0sigma(F(o)). The structure of the cation consists of an oxo-bridged Mn(3)O(4)(4+) core, with the geometry of the manganese atoms being octahedral. The coordination polyhedron of one of the manganese atoms (Mn(1)) consists of two &mgr; oxo ligands and two pairs of nitrogen atoms of two phen moieties, whereas that of each of the remaining two manganese atoms consists of three &mgr;-oxo ligands, two nitrogen atoms of a phen moiety, and the oxygen atom of a water molecule. The complex represents the second example for water coordination to manganese(IV) centers in complexes with a Mn(3)O(4)(4+) core. Optical spectra in ligand buffer (pH 4.5) reveal complete conversion of the complex into a Mn(III)Mn(IV) species. The observed room-temperature (298 K) magnetic moment of 3.75 &mgr;(B) indicates the presence of strong antiferromagnetic coupling in the complex.     

A novel group of alkaline earth metal amides: syntheses and characterization of M[N(2,6-(i)Pr(2)C(6)H(3))(SiMe(3))](2)(THF)(2) (M = Mg,Ca, Sr,Ba) and the linear,two-coordinate Mg[N(2,6-(i)Pr(2)C(6)H(3))(SiMe(3))](2)

Novel alkaline earth metal aryl-substituted silylamides were prepared using alkane (Mg) and salt elimination reactions (Mg, Ca, Sr, and Ba). The salt elimination regime involved the treatment of the alkaline earth metal iodides with 2 equiv of the respective potassium amide KNDiip(SiMe(3)), (Diip = 2,6-i-Pr(2)C(6)H(3)). The organomagnesium source for the alkane elimination was ((n)()Bu/(s)()Bu)(2)Mg. All compounds were characterized using (1)H, (13)C NMR, and IR spectroscopy, in addition to X-ray crystallography (except Mg[NDiip(SiMe(3))](2)THF(2)). Crystal data with Mo Kalpha (lambda = 0.710 73 A) are as follows: Mg[NDiip(SiMe(3))](2), 1, a = 9.4687(6) A, b = 9.6818(6) A, c = 17.9296(1) A, alpha = 96.487(1) degrees, beta = 94.537(1) degrees, gamma = 89.222(1) degrees, V = 1608.8(2) A(3), Z = 2 (two independent molecules), triclinic, space group P(-)1, R1 (all data) = 0.0508; (n)()BuMg[NDiip(SiMe(3))]THF(2), 2, a = 9.5413(1) A, b = 16.493(2) A, c = 9.8218(1) A, beta = 108.149(2) degrees, V = 1468.7(4) A(3), Z = 2, monoclinic, space group P2(1), R1(all data) = 0.1232; Ca[NDiip(SiMe(3))](2)THF(2), 4, a = 9.7074(1) A, b = 20.9466(4) A, c = 21.6242(3) A, alpha = 73.573(1) degrees, beta = 78.632(1) degrees, gamma = 89.621(1) degrees, V = 4129.1(1) A(3), Z = 4 (two independent molecules), triclinic, space group P(-)1, R1 (all data) = 0.0902; Sr[NDiip(SiMe(3))](2)THF(2), 5, a = 20.5874(5) A, b = 9.8785(2) A, c = 20.8522(5) A, beta = 102.035(2) degrees, V = 4147.6(2) A(3), Z = 4 (two independent molecules), monoclinic, space group P2/n, R1 (all data) = 0.0756; Ba[NDiip(SiMe(3))](2)THF(2), 6, a = 20.5476(2) A, b = 10.0353(2) A, c = 20.9020(4) A, beta = 101.657(1) degrees, V = 4221.0(1) A(3), Z = 4 (two independent molecules), monoclinic, space group P2/n, R1 (all data) = 0.0573.     

Thiophosphate phase diagrams developed in conjunction with the synthesis of the new compounds KLaP(2)S(6), K(2)La(P(2)S(6))(1/2)(PS(4)), K(3)La(PS(4))(2), K(4)La(0.67)(PS(4))(2), K(9-)(x)La(1+x/3)(Ps(4))(4) (x = 0.5), K(4)Eu(PS(4))(2), and KEuPS(4)

An alkali-metal sulfur reactive flux has been used to synthesize a series of quaternary rare-earth metal compounds. These include KLaP(2)S(6) (I), K(2)La(P(2)S(6))(1/2)(PS(4)) (II), K(3)La(PS(4))(2) (III), K(4)La(0.67)(PS(4))(2) (IV), K(9-x)La(1+x/3)(PS(4))(4) (x = 0.5) (V), K(4)Eu(PS(4))(2) (VI), and KEuPS(4) (VII). Compound I crystallizes in the monoclinic space group P2(1)/c with the cell parameters a = 11.963(12) A, b = 7.525(10) A, c = 11.389(14) A, beta = 109.88(4) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/n with a = 9.066(6) A, b = 6.793(3) A, c = 20.112(7) A, beta = 97.54(3) degrees, and Z = 4. Compound III crystallizes in the monoclinic space group P2(1)/c with a= 9.141(2) A, b = 17.056(4) A, c = 9.470(2) A, beta = 90.29(2) degrees, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ibam with a = 18.202(2) A, b = 8.7596(7) A, c = 9.7699(8) A, and Z = 4. Compound V crystallizes in the orthorhombic space group Ccca with a = 17.529(9) A, b = 36.43(3) A, c = 9.782(4) A, and Z = 8. Compound VI crystallizes in the orthorhombic space group Ibam with a = 18.29(5) A, b = 8.81(2) A, c= 9.741(10) A, and Z = 4. Compound VII crystallizes in the orthorhombic space group Pnma with a = 16.782(2) A, b = 6.6141(6) A, c = 6.5142(6) A, and Z = 4. The sulfur compounds are in most cases isostructural to their selenium counterparts. By controlling experimental conditions, these structures can be placed in quasi-quaternary phase diagrams, which show the reaction conditions necessary to obtain a particular thiophosphate anionic unit in the crystalline product. These structures have been characterized by Raman and IR spectroscopy and UV-vis diffuse reflectance optical band gap analysis.     

Reaction of bis(phosphine)(hydrotris(3,5-dimethylpyrazolyl)borato)rhodium(I) with phenylacetylene,p-nitrobenzaldehyde,and triphenyltin hydride: structures of [Rh(Tp)(PPh(3))(2)], [Rh(Tp)(H)(C(2)Ph)(P(4-C(6)H(4)F)(3))], [Rh(Tp)(H)(COC(6)H(4)-4-NO(2))(PPh(3))], and [Rh(Tp)(H)(SnPh(3))(PPh(3))

The complexes [Rh(Tp)(PPh(3))(2)] (1a) and [Rh(Tp)(P(4-C(6)H(4)F)(3))(2)] (1b) combine with PhC(2)H, 4-NO(2)-C(6)H(4)CHO and Ph(3)SnH to give [Rh(Tp)(H)(C(2)Ph)(PR(3))] (R = Ph, 2a; R = 4-C(6)H(4)F, 2b), [Rh(Tp)(H)(COC(6)H(4)-4-NO(2))(PR(3))] (R = Ph, 3a), and [Rh(Tp)(H)(SnPh(3))(PR(3))] (R = Ph, 4a; R = 4-C(6)H(4)F, 4b) in moderate to good yield. Complexes 1a, 2b, 3a, and 4a have been structurally characterized. In 1a the Tp ligand is bidentate, in 2b, 3a, and 4a it is tridentate. Crystal data for 1a: space group P2(1)/c; a = 11.9664(19), b = 21.355(3), c = 20.685(3) A; beta = 112.576(7) degrees; V = 4880.8(12) A(3); Z = 4; R = 0.0441. Data for 2b: space group P(-)1; a = 10.130(3), b = 12.869(4), c = 17.038(5) A; alpha = 78.641(6), beta = 76.040(5), gamma = 81.210(6) degrees; V = 2100.3(11) A(3); Z = 2; R = 0.0493. Data for 3a: space group P(-)1; a = 10.0073(11), b = 10.5116(12), c = 19.874(2) A; alpha = 83.728(2), beta = 88.759(2), gamma = 65.756(2) degrees; V =1894.2(4) A(3); Z = 2; R = 0.0253. Data for 4a: space group P2(1)/c; a = 15.545(2), b = 18.110(2), c = 17.810(2) A; beta = 95.094(3) degrees; V = 4994.1(10) A(3); Z = 4; R = 0.0256. NMR data ((1)H, (31)P, (103)Rh, (119)Sn) are also reported.     

Selenophosphate phase diagrams developed in conjunction with the synthesis of the new compounds K(2)La(P(2)Se(6))(1/2)(PSe(4)), K(3)La(PSe(4))(2), K(4)La(0.67)(PSe(4))(2), K(9-x)La(1+x/3)(PSe(4))(4) (x = 0.5), and KEuPSe(4)

Five new rare-earth metal polyselenophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: K(2)La(P(2)Se(6))(1/2)(PSe(4)) (I), K(3)La(PSe(4))(2) (II), K(4)La(0.67)(PSe(4))(2) (III), K(9-x)()La(1+)(x/3)(PSe(4))(4) (x = 0.5) (IV), and KEuPSe(4) (V). Compound I crystallizes in the monoclinic space group P2(1)/n with a = 9.4269(1) A, b = 7.2054(1) A, c = 21.0276(5) A, beta = 97.484(1) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/c with a = 9.5782(2) A, b = 17.6623(4) A, c = 9.9869(3) A, beta = 90.120(1) degrees, and Z = 4. Compound III crystallizes in the orthorhombic space group Ibam with a = 19.0962(2) A, b = 9.1408(1) A, c = 10.2588(2) A, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ccca with a = 18.2133(1) A, b = 38.0914(4) A, c = 10.2665(1) A, and Z = 8. Compound V crystallizes in the orthorhombic space group Pnma with a = 17.5156(11) A, b = 7.0126(5) A, c = 6.9015(4) A, and Z = 4. Optical band gap measurements show that compound V has an optical band gap of 1.88 eV. Solid-state Raman spectroscopy of compounds II-V shows the four normal vibrations expected for the (PSe(4))(3-) unit. The observation of compounds I-V in several reactions has allowed the creation of a quasi-quaternary phase diagram for potassium rare-earth-metal polyselenophosphates. This phase diagram can qualitatively be separated into three regions on the basis of the oxidation state of phosphorus in the crystalline products observed and takes the next step in designing solid-state compounds.     

Coordination Chemistry of 2,2'-Dipyridyl Diselenide: X-ray Crystal Structures of PySeSePy, [Zn(PySeSePy)Cl(2)], [(PySeSePy)Hg(C(6)F(5))(2)], [Mo(SePy)(2)(CO)(3)], [W(SePy)(2)(CO)(3)], and [Fe(SePy)(2)(CO)(2)] (PySeSePy = C(5)H(4)NSeSeC(5)H(4)N; SePy = [C(5)H(4)N(2-Se)-N,Se])

The coordination chemistry of 2,2'-dipyridyl diselenide (PySeSePy) (2) (C(10)H(8)N(2)Se(2)) has been investigated and its crystal structure has been determined (monoclinic, P2(1)/c, a = 10.129(2) ?, b = 5.7332(12) ?, c = 19.173(3) ?, beta = 101.493(8) degrees, Z = 4). In metal complexes the ligand was found to coordinate in three different modes, as also confirmed by X-ray structure determination. N,N'-coordination was found in the zinc complex [Zn(PySeSePy)Cl(2)] (3) (C(10)H(8)Cl(2)N(2)Se(2)Zn, triclinic, P&onemacr;, a = 7.9430(10) ?, b = 8.147(2) ?, c = 11.999(2) ?, alpha = 93.685(10) degrees, beta = 107.763(10) degrees, gamma = 115.440(10) degrees, Z = 2) and Se,Se'-coordination in the adduct of the ligand with bis(pentafluorophenyl)mercury(II) [PySeSePyHg(C(6)F(5))(2)] (5) (C(10)H(8)F(10)HgN(2)Se(2), monoclinic, P2(1)/n, a = 7.7325(10) ?, b = 5.9974(14) ?, c = 25.573, beta = 98.037(10) degrees, Z = 2), which however displays only weak interactions between selenium and mercury. The reaction of the ligand with norbornadiene carbonyl complexes of molybdenum and tungsten leads to reductive cleavage of the selenium-selenium bond with oxidation of the metal center and concomitant addition of the resulting selenolate to the metal carbonyl fragment. Thus the 7-coordinate complexes [Mo(SePy)(2)(CO)(3)] (6) (C(13)H(8)MoN(2)O(3)Se(2), monoclinic, P2(1)/n, a = 9.319(3) ?, b = 12.886(5) ?, c = 13.231(6) ?, beta = 109.23(3) degrees, Z = 4) and [W(SePy)(2)(CO)(3)] (7) (C(13)H(8)N(2)O(3)Se(2)W, monoclinic, P2(1)/n, a = 9.303(2) ?, b = 12.853(2) ?, c = 13.232(2) ?, beta = 109.270(10) degrees, Z = 4) were obtained. The same N,Se-coordination pattern emerges from the reaction of [Fe(2)(CO)(9)] with (2) leading to [Fe(SePy)(2)(CO)(2)] (8) (C(12)H(8)FeN(2)O(2)Se(2), monoclinic, P&onemacr;, a = 8.6691(14) ?, b = 12.443(2) ?, c = 14.085(2) ?, alpha = 105.811(10) degrees, beta = 107.533(8) degrees, gamma = 92.075(10) degrees, Z = 4).     

Synthesis and characterization of [Mo(7)O(16)(O(3)PCH(2)PO(3))(3)]:(8-) a mixed-valent polyoxomolybdenum diphosphonate anion with octahedrally and tetrahedrally coordinated molybdenum

Two new compounds containing the title diphosphono-polyoxometalate anion and diprotonated ethylenediamine (enH(2)) or piperazine (ppzH(2)) countercations have been hydrothermally synthesized and structurally characterized ((enH(2))(4)[Mo(7)O(16)(O(3)PCH(2)PO(3))(3)].7H(2)O, triclinic, P(-)1, Z = 2, a = 10.3455(7) A, b = 13.136(1) A, and c = 20.216(3) A, alpha = 93.247(6) degrees, beta = 96.434(6) degrees, and gamma = 111.900(6) degrees; (ppzH(2))(4)[Mo(7)O(16)(O(3)PCH(2)PO(3))(3)].8H(2)O, triclinic, P(-)1, Z = 2, a = 13.255(2) A, b = 13.638(2) A, and c = 16.874(4) A, alpha = 93.20(2) degrees, beta = 101.27(2) degrees, and gamma = 105.87(1) degrees). The anion is a ring of three pairs of edge-sharing octahedra of Mo(V)O(6) (with Mo(V)-Mo(V) bonds) that share corners with each other. The diphosphonate groups connect the pairs at the periphery. The ring is "capped" by a tetrahedron of Mo(VI)O(4). According to magnetic measurements, the compounds are diamagnetic.     

1H NMR, EPR, UV-Vis, and Electrochemical Studies of Imidazole Complexes of Ru(III). Crystal Structures of cis-[(Im)(2)(NH(3))(4)Ru(III)]Br(3) and [(1MeIm)(6)Ru(II)]Cl(2).2H(2)O

Comparisons of the spectroscopic properties of a number of Ru(III) complexes of imidazole ligands provide methods of distinguishing between various types of bonding that can occur in proteins and nucleic acids. In particular, EPR and (1)H NMR parameters arising from the paramagnetism of Ru(III) should aid in determining binding sites of Ru(III) drugs in macromolecules. Electrochemical studies on several imidazole complexes of ruthenium suggest that imidazole may serve as a significant pi-acceptor ligand in the presence of anionic ligands. Crystal structures are reported on two active immunosuppressant complexes. cis-[(Im)(2)(NH(3))(4)Ru(III)]Br(3) crystallizes in the triclinic space group P&onemacr; (No. 2) with the cell parameters a = 8.961(2) ?, b = 12.677(3) ?, c = 7.630(2) ?, alpha = 98.03(2) degrees, beta = 100.68(2) degrees, gamma = 81.59(2) degrees, and Z = 2 (R = 0.044). [(1MeIm)(6)Ru(II)]Cl(2).2H(2)O crystallizes in the monoclinic space group P2(1)/n (No. 14) with the cell parameters a = 7.994(2) ?, b = 13.173(4) ?, c = 14.904(2) ?, beta = 97.89(1) degrees, and Z = 2 (R = 0.052). The average Ru(II)-N bond distance is 2.106(8) ?.     

Sandwich-type silicotungstates: structure and magnetic properties of the dimeric polyoxoanions[[SiM2W9O34(H2O)]2]12- (M = Mn2+, Cu2+, Zn2+)

The novel dimeric silicotungstates [[SiM2W9O34(H2O)]2]12- (M = Mn2+, Cu2+, Zn2+) have been synthesized and characterized by IR spectroscopy, elemental analysis, and magnetic measurements. X-ray single-crystal analyses were carried out on K4Na6Mn[[SiMn2W9O34(H2O)]2].33H2O (1), which crystallizes in the triclinic system, space group P1, with a = 12.2376(7) A, b = 13.6764(8) A, c = 15.6177(9) A, alpha = 70.2860(10) degrees, beta = 79.9150(10) degrees, gamma = 70.2760(10) degrees, and Z = 1; K3Na5[[SiCu2W9O34(H2O)]2].26H2O (2) crystallizes in the triclinic system, space group P1, with a = 11.4271(12) A, b = 12.5956(13) A, c = 15.3223(16) A, alpha = 80.456(2)degrees, beta = 76.383(2) degrees, gamma = 76.968(2) degrees, and Z = 1; K4Na6[[SiZn2W9O34(H2O)]2].34H2O (3) crystallizes also in the triclinic system, space group P1, with a = 12.2596(14) A, b = 13.2555(15) A, c = 16.2892(18) A, alpha = 96.431(2) degrees, beta = 100.944(2) degrees, gamma = 110.404(2) degrees, and Z = 1. The polyanions consist of two lacunary B-alpha-[SiW9O34]10- Keggin moieties linked via a rhomblike M4O16 (M = Mn, Cu, Zn) group leading to a sandwich-type structure. Magnetic measurements show that the central Mn4 unit in 1 exhibits antiferromagnetic (J = -1.77(5) cm(-1)) as well as weak ferromagnetic (J' = 0.08(2) cm(-1)) Mn-Mn exchange interactions. In 2 the Cu-Cu exchange interactions are antiferromagnetic (J = -0.10(2) cm(-1), J' = -0.29(2) cm(-1)).     

Self-assembly of coordination polymers from AgX (X = SbF(6)(-), PF(6)(-), and CF(3)SO(3)(-)) and oxadiazole-containing ligands

The coordination chemistry of the oxadiazole-containing rigid bidentate ligands 2,5-bis(4-pyridyl)-1,3,4-oxadiazole (L1), 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L2), and 2,5-bis(3-aminophenyl)-1,3,4-oxadiazole (L3) with inorganic Ag(I) salts has been investigated. Four new coordination polymers (1, 2, 3, and 5) and one new bimetallic macrocyclic supramolecular complex (4) were synthesized from solution reactions of L1-L3 with inorganic Ag(I) salts, respectively. Compounds [[Ag(L1)]SbF(6)](n) (1) (1, monoclinic, P2(1)/c, a = 6.6846(4) A, b = 27.1113(15) A, c = 8.6802(5) A, beta = 94.1080(10) degrees, Z = 4) and [[Ag(L1)]PF(6)](n) (2) (2, monoclinic, P2(1)/c, a = 6.6753(3) A, b = 27.2824(14) A, c = 8.2932(4) A, beta = 94.6030(10) degrees, Z = 4) were obtained from the reactions of L1 with AgSbF(6) and AgPF(6) in a CH(2)Cl(2)/CH(3)OH mixed solvent system, respectively. Compounds 1 and 2 are isostructural and feature a novel two-dimensional zeolite-like net with two different individual rings. [[Ag(L2)]SbF(6)](n) (3) (3, monoclinic, P2(1)/c, a = 5.5677(3) A, b = 17.3378(9) A, c = 15.6640(8) A, beta = 94.4100(10) degrees, Z = 2) and [Ag(2)(L2)(2)](SbF(6))(2) (4) (4, triclinic, P1, a = 8.7221(5) A, b = 9.2008(6) A, c = 10.7686(7) A, alpha = 70.6270(10) degrees, beta = 75.7670(10) degrees, gamma = 73.7560(10) degrees, Z = 1) were obtained from one-pot reaction of L2 with AgSbF(6) in a CH(2)Cl(2)/CH(3)OH mixed solvent system. Compound 3 features a one-dimensional chain pattern, while compound 4 adopts a novel bimetallic macrocyclic structural motif which consists of Ag(2)(L2)(2) ringlike units (crystallographic dimensions, 8.06 x 7.42 A(2)). [[Ag(L3)]SO(3)CF(3)](n) (5) is generated from L3 and AgSO(3)CF(3) in a CH(2)Cl(2)/CH(3)OH mixed solvent system and crystallizes in the unusual space group Pbcn, with a = 9.8861(5) A, b = 20.2580(10) A, c = 17.5517(8) A, Z = 8. It adopts novel two-dimensional sheets that are cross-linked to each other by strong interlayer N-H...O hydrogen bonding interactions into a novel H-bonded three-dimensional network.