共查询到20条相似文献,搜索用时 31 毫秒
1.
《Solid State Sciences》2007,9(7):619-627
Three new crystal structures, isotypic with β-Zr2O(PO4)2, have been resolved by the Rietveld method. All crystallize with an orthorhombic cell (S.G.: Cmca) with a = 7.1393(2) Å, b = 9.2641(2) Å, c = 12.5262(4) Å, V = 828.46(4) Å3 and Z = 8 for Th(OH)PO4; a = 7.0100(2) Å, b = 9.1200(2) Å, c = 12.3665(3) Å, V = 790.60(4) Å3 and Z = 8 for U(OH)PO4; a = 7.1691(3) Å, b = 9.2388(4) Å, c = 12.8204(7) Å, V = 849.15(7) Å3 and Z = 4 for Th2O(PO4)2. By heating, the M(OH)PO4 (M = Th, U) compounds condense topotactically into M2O(PO4)2, with a change of the environment of the tetravalent cation that lowers from 8 to 7 oxygen atoms. The lower stability of Th2O(PO4)2 compared to that of U2O(PO4)2 seems to result from this unusual environment for tetravalent thorium. 相似文献
2.
Dawei Feng Cheng Wang Wentai Cheng Guobao Li Shujian Tian Fuhui Liao Ming Xiong Jianhua Lin 《Solid State Sciences》2009,11(4):845-851
A new layered compound, K4Mn3(HPO4)4(H2PO4)2 (1), has been synthesized under hydrothermal conditions. It crystallizes in the monoclinic space group P21/n with a = 8.874(2) Å, b = 6.554(1) Å, c = 18.075(4) Å, and β = 93.39(3)°. The structure consists of zigzag [Mn3O14]n chains of edge-sharing MnO6 octahedrons and MnO7 pentagonal bi-pyramids, which form layers of formula [Mn3(HPO4)4(H2PO4)2]4? in the ab plane via H2PO4 and HPO4 units with vertex-sharing. Potassium ions lie between these layers. Magnetic measurements indicate Curie–Weiss behavior above 6 K for 1. A Heisenberg model, with alternating exchange interactions J1J1J2… within the chain and exchange interactions J3J3… between the chains, is proposed to describe the magnetic behavior. 相似文献
3.
《Journal of solid state chemistry》2004,177(4-5):1297-1301
Compound Cu2(H2O)2{O3PCH2N(C2H4)2NCH2PO3} (1) has a pillared layered structure in which the organic groups of N,N′-piperazinebis(methylenephosphonate) are sandwiched between the inorganic layers. Compared with other copper phosphonates with layered or pillared layered structures, the inorganic layer in 1 is unique in that each {CPO3} tetrahedron is corner-shared with three {CuO4N} square pyramids through three oxygen donors. Ferromagnetic interactions are mediated between the metal centers. Crystal data: Pbca, a=10.0830(16) Å, b=9.4517(15) Å, c=13.218(2) Å, V=1259.7(3) Å3, Z=4. 相似文献
4.
Anne Carton Adel Mesbah Lionel Aranda Pierre Rabu Michel François 《Solid State Sciences》2009,11(4):818-823
The metastable phase (phase 1) Zn(OH)2(tp)2 (tp = C8H4O42?) was found to be an intermediate forming during the hydrothermal synthesis of Zn3(OH)4tp (phase 2). Its structure has been determined ab initio from synchrotron powder diffraction data and refined with the Rietveld method: space group P21/c, a = 3.48856(2) Å, b = 5.84645(2) Å, c = 22.1331(1) Å, β = 103.46(1)°, Dx = 2.488 g/cm3, Rp = 0.10, RB = 0.095 (402 independent reflections). The structures of the two analogues were compared. Whereas a mixed coordination of the zinc atoms was found in phase 2, phase 1 exhibits only penta-coordinated Zn(II). Moreover, different optical properties were observed, Zn2(OH)2(tp) showing photoluminescence at 378 nm under λex = 316 nm. 相似文献
5.
《Polyhedron》2005,24(6):723-729
The mixed ligand complex [La(hfa)3(Phen)2] (I) was obtained by the interaction of La(hfa)3 and Phen; its composition does not depend on the stoichiometry of the reagents. According to the X-ray single crystal analysis data, complex I crystallizes in the monoclinic space group P21/n, with a = 13.583(3) Å, b = 16.959(3) Å, c = 18.860(4) Å, β = 94.71(3)° and Z = 4. The structure of I consists of isolated mononuclear molecules, the coordination number of La being 10. Thermal behaviour and composition of the vapor phase have been studied for I by thermal analysis and mass-spectrometry using a Knudsen cell. The mixed ligand complex I was found to sublime congruently in the temperature range 370–460 K: [La(hfa)3(Phen)2](s) = [La(hfa)3(Phen)](g) + Phen(g), ΔrH0(T) = 316.2 ± 1.8 kJ/mol. 相似文献
6.
《Journal of organometallic chemistry》2007,692(1-3):122-128
A photoresponsive rhodium dinuclear complex having phenyltetramethylcyclopentadienyl (CpPh = η5-C5Me4Ph) and photosensitive dithionite (μ-O2SSO2) ligands, [(CpPhRh)2(μ-CH2)2(μ-O2SSO2)] (1), has been synthesized. The crystal of complex 1 (monoclinic, C2/m (No. 12), a = 24.805(2) Å, b = 29.111(2) Å, c = 10.8475(11) Å, β = 105.9830(7)°, V = 7530.0(12) Å3, Z = 8) consists of two independent molecules, 1-cis and 1-trans, with different arrangement of the CpPh ligands. The flexibility, volume, and shape of the reaction cavities around the dithionite unit of 1-cis and 1-trans in the crystal are discussed. The crystal structures of the precursors of 1, trans-[(CpPhRh)2(μ-Cl)2Cl2] and trans-[(CpPhRh)2(μ-CH2)2Me2], are also reported. 相似文献
7.
Xianzhu Xu Peng Wang Rong Hao Meina Gan Fuxing Sun Guang-shan Zhu 《Solid State Sciences》2009,11(1):68-71
A novel zinc diphosphonate, Zn[HO3PCH2(C6H4)CH2PO3H] (1) was synthesized from tetraethyl para-xylylenediphosphonate, Et2O3PCH2C6H4CH2PO3Et2, and Zn (AcO)2·2H2O under solvothermal conditions. The structure of compound 1 was determined by single-crystal X-ray diffraction, which reveals that the structure crystallizes in the monoclinic space group C2/c (No. 15), with a = 22.4844(19) Å, b = 6.4361(5) Å, c = 8.1194(7) Å, β = 102.595(2)°, V = 1146.70(16) Å3, T = 298(2) K, Z = 8. The novel three-dimensional (3D) construction is simply built up from linear inorganic chains of corner-sharing four-rings of tetrahedral [ZnO4] and [PO3C] which connected adjacent chains by the organophosphorus ligand para-xylylenediphosphonate. The framework has 10 Å × 4 Å (containing the van der Waals radii of atoms) channels running along the b-axis. 相似文献
8.
Two manganese coordination polymers, [Mn2(ip)2(dmf)]·dmf (1) and [Mn4(ip)4(dmf)6]·2dmf (2) (ip=isophthalate; dmf=N,N-dimethylformamide), have been synthesized and characterized. X-ray crystal structural data reveal that compound 1 crystallizes in triclinic space group P?1, a=9.716(3) Å, b=12.193(3) Å, c=12.576(3) Å, α=62.19(2)°, β=66.423(17)°, γ=72.72(2)°, Z=2, while compound 2 crystallizes in monoclinic space group Cc, a=19.80(3) Å, b=20.20(2) Å, c=18.01(3) Å, β=108.40(4)°, Z=4. Variable-temperature magnetic susceptibilities of compounds 1 and 2 exhibit overall weak antiferromagnetic coupling between the adjacent Mn(II) ions. 相似文献
9.
Ce(H2O)(PO4)3/2(H3O)1/2(H2O)1/2, a second entry in the structural chemistry of cerium(IV) phosphates
《Solid State Sciences》2007,9(8):672-677
A cerium(IV) phosphate has been prepared using precipitation methods and its structure has been solved by single crystal X-ray diffraction (R1 = 0.0292 for 3092 reflections with I>2σ(I) and wR2 = 0.0540). Ce(H2O)(PO4)3/2(H3O)1/2(H2O)1/2 crystallises in the monoclinic space group C2/c (a = 15.7058(17) Å, b = 9.6261(9) Å, c = 10.1632(4) Å, ß = 121.623(7)°, and V = 1308.4 (2) Å3). Its structure is based on a negatively charged 3D framework, made of cerium atoms connected by PO4 tetrahedra. There are two types of PO4 units; one shares only corners with the cerium coordination polyhedra while the other one shares edges and corners. This structure also includes hydronium cations, to balance the framework charge, and water molecules. One special feature of this 3D framework is the formation of interconnected tunnels which extend along the c axis and contain the hydronium cations and the water molecules. This open framework and the presence of cationic species in the tunnels are in perfect agreement with the previously reported ion exchange properties. 相似文献
10.
《Solid State Sciences》2007,9(11):1012-1019
Two novel inorganic–organic hybrid compounds composed of Keggin tungstocobaltate framework and cobalt(II)–N coordination complexes, K[Co(phen)2(H2O)]2[HCoW12O40]·2H2O (1) (phen = 1,10-phenanthroline) and [Co(2,2′-bipy)3]1.5{[Co(2,2′-bipy)2(H2O)][HCoW12O40]·0.5H2O (2) (bipy = bipyridine), have been synthesized under hydrothermal conditions by directly using Keggin POMs as starting materials, which were characterized by elemental analyses, IR, TG analyses and X-ray single crystal diffraction. Crystal data for compound 1: C48H41Co3KN8O44W12, triclinic, space group P-1, a = 10.918(5) Å, b = 13.401(5) Å, c = 13.693(5) Å, α = 69.291(5)°, β = 71.568(5)°, γ = 78.421(5)°, V = 1768.9(12) Å3, Z = 1; for compound 2: C130H104Co7N26O83W24, orthorhombic, space group, C2/c, a = 46.839(9) Å, b = 14.347(3) Å, c = 26.147(5) Å, α = β = γ = 90°, V = 17,570(6) Å3, Z = 4. Compound 1 exhibits a pseudo-1D chainlike structure, in which potassium ions act as linkages of Keggin unit doubly grafted by [Co(phen)2(H2O)] complex. Compound 2 represents a [Co(2,2′-bipy)2(H2O)]2+ mono-grafted Keggin tungstocobaltate derivative with 1.5[Co(2,2′-bipy)3]2+ countercations. The cyclic voltammetric behavior of 1-CPE is similar to the parent 3-CPE, but the cyclic voltammetric behavior of CoII shows a little difference. Variable-temperature magnetic susceptibility measurement of compound 1 demonstrates the presence of antiferromagnetic interactions. 相似文献
11.
《Solid State Sciences》2007,9(8):686-692
Hydrothermal reactions of 2-quinolinephosphonic acid (1) and CuSO4 or CdSO4 result in two new compounds with formula Cu(2-C9H6NPO3) (2) and Cd(2-C9H6NPO3)(H2O) (3). Compound 2 has a layer structure in which dimers of edge-sharing {CuO4N} square-pyramids are linked by {CPO3} tetrahedra through corner sharing. Compound 3 shows a new type of layer structure where chains of corner sharing {CdO5N} octahedra are connected by {CPO3} tetrahedra into an inorganic layer. The quinoline groups fill in the inter-layer spaces in both cases. Crystal data for 1: monoclinic, space group P21/c, a = 10.270(2) Å, b = 13.566(3) Å, c = 6.9818(16) Å, β = 101.916(4)°, V = 951.8(4) Å3, Z = 4. For 2: monoclinic, space group P21/c, a = 13.976(3) Å, b = 7.9398(18) Å, c = 7.8687(18) Å, β = 101.150(5)°, V = 856.7(3) Å3, Z = 4. For 3: monoclinic, space group P21/c, a = 17.164(4) Å, b = 5.4870(12) Å, c = 10.850(2) Å, β = 101.557(4)°, V = 1001.1(4) Å3, Z = 4. The magnetic measurement on 2 reveals a dominant antiferromagnetic exchange coupling between the Cu(II) centers. A quasi-reversible electrochemical reaction is observed for complex 2 immobilized on the surface of GC electrode, corresponding to the redox couple Cu2+/Cu+. The fluorescent properties of 1–3 are also investigated. 相似文献
12.
《Comptes Rendus Chimie》2007,10(12):1170-1179
In continuation of studies carried out previously [I. Bernal, Inorg. Chim. Acta 96 (1985) 99; I. Bernal, Inorg. Chim. Acta (1986) 121; I. Bernal, E.O. Schlemper, C.K. Fair, Inorg. Chim. Acta 115 (1986) 25; I. Bernal, Inorg. Chim. Acta 101 (1985) 175; I. Bernal, J. Cetrullo, J. Coord. Chem. 20 (1989) 237], we have now expanded the nature and number of cations associated with the [trans-(NH3)2Co(NO2)4] anion in order to better document when, and how, this helical propeller species crystallizes as a conglomerate.[(tren)Co(NO2)2][trans-(NH3)2Co(NO2)4] (I) crystallizes as a racemate in space group P21/n with cell constants of a = 15.8900(2), b = 19.7800(3), c = 26.6200(4) Å, β = 101.970(3)°, z = 15.[(tren)Co(ox)][trans-(NH3)2Co(NO2)4] (II) crystallizes as a racemate in space group I2/a with cell constants of a = 21.592(11), b = 7.050(4), c = 26.46(2) Å, β = 93.09(6)°, z = 8.[(en)2Co(ox)][trans-(NH3)2Co(NO2)4] (III) crystallizes as a racemate in space group P21/n with cell constants of a = 6.4740(1), b = 22.8950(6), c = 13.1660(3) Å, β = 97.3310(10)°, z = 4.[trans-(pn)2Co(NO2)2][trans-(NH3)2Co(NO2)4] (IV) also crystallizes as a racemate in space group P(¯1; no. 2) with cell constants of a = 6.508(2), b = 8.829(5), c = 9.851(5) Å, α = 72.84(2), β = 80.15(3), and γ = 81.45(6)°, z = 1.The most notable results are as follows: (1) all four compounds studied are racemates unlike the previously studied [cis-Co(en)2(NO2)2][trans-(NH3)2Co(NO2)4] [I. Bernal, Inorg Chim Acta 101 (1985) 175] (V) and K[trans-(NH3)2Co(NO2)4] (VI) that crystallize as conglomerates. Nevertheless, they share certain crystalline features, which are readily observed in their packing diagrams.In all the four cases the new data were collected at 295 K and 120 K, using Mo Kα radiation; the former with a Nonius CAD-4 diffractometer and the latter with a Nonius CCD instrument. Of primary interest to us are the changes in packing caused by repeated changes in the charge compensating cations. Comparisons with the packing observed previously in [cis-Co(en)2(NO2)2][trans-(NH3)2Co(NO2)4] (V) and K[trans-(NH3)2Co(NO2)4] (VI) are made since, at the time of publications of those early papers, no detailed study of the packing characteristics of these anions was published and the existing graphic software were primitive compared with the current packages. This oversight is remedied below. 相似文献
13.
《Solid State Sciences》2007,9(2):149-154
The mild-condition syntheses, single-crystal structures and properties of H3N(CH2)5NH3·Zn3(HPO3)4 and β-H3N(CH2)6NH3·Zn3(HPO3)4 are reported. Both are constructed from (3,4)-nets of ZnO4 tetrahedra and HPO3 pyramids, sharing vertices to result in three-dimensional anionic open-frameworks. In both materials, the organic species interacts with the framework by way of N–H⋯O bonds. Crystal data: H3N(CH2)5NH3·Zn3(HPO3)4, Mr = 620.22, orthorhombic, Pccn (No. 56), a = 9.5364 (9) Å, b = 21.8015 (19) Å, c = 9.1118 (7) Å, V = 1894.4 (3) Å3, Z = 4, R(F) = 0.044, wR(F2) = 0.111. β-H3N(CH2)6NH3·Zn3(HPO3)4, Mr = 634.25, monoclinic, P21/n (No. 14), a = 8.7627 (1) Å, b = 13.8117 (2) Å, c = 16.6187 (3) Å, β = 92.680 (1)°, V = 2009.12 (5) Å3, Z = 4, R(F) = 0.072, wR(F2) = 0.187. 相似文献
14.
《Comptes Rendus Chimie》2015,18(8):816-822
The treatment of [PdL3(NH3)]OTf (L3 = (PEt3)2(Ph) (1), (2,6-(Cy2PCH2)2C6H3) (3)) with NaNH2 in THF afforded dimeric and monomeric parent-amido palladium(II) complexes with bridging and terminal NH2, respectively, anti-[Pd(PEt3)(Ph)(μ-NH2)]2 (2) and Pd(2,6-(Cy2PCH2)2C6H3)(NH2) (4). The dimeric complex 2 crystallizes in the space group P21/n with a = 13.228(2) Å, b = 18.132(2) Å, c = 24.745(2) Å, β = 101.41(1)°, and Z = 4. It has been found that there are two crystallographically independent molecules with Pd(1)–Pd(2) and Pd(3)–Pd(4) distances of 2.9594 (10) and 2.9401(9) Å, respectively. The monomeric amido complex 4 protonates from trace amounts of water to give the cationic ammine species [Pd(2,6-(Cy2PCH2)2C6H3)(NH3)]+. Complex 4 reacts with diphenyliodonium triflate ([Ph2I]OTf) to give aniline complex [Pd(2,6-(Cy2PCH2)2C6H3)(NH2Ph)]OTf (5). Reaction of 4 with dialkyl acetylenedicarboxylate (DMAD, DEAD) yields diastereospecific palladium(II) vinyl derivative (Z)–(Pd(Cy2PCH2)2C6H3)(CR = CR(NH2)) (R = CO2Me (6a), CO2Et (6b)). Reacting complexes 6a and 6b with p-nitrophenol produces (Pd(Cy2PCH2)2C6H3)(OC6H4–p-NO2) (8) and cis-CHR = CR(NH2), exclusively. 相似文献
15.
《Solid State Sciences》2007,9(1):16-20
A new molybdenum complex (C4H12N2)2[(MoV2O4)(MoVIO4)(C2O4)2]·2H2O, was solvothermally synthesized and characterized by single-crystal X-ray diffraction. The structure of the compound consists of oxalate acid-coordinated mixed-valent [MoV2O4][MoVIO4] helical chains and protonated piperazine cations. The helical chains are built up from the [MoV2O4] units and [MoVIO4] tetrahedral. The central axis about helical chain is a 2-fold screw axis. The compound crystallizes in the space group P21/n of monoclinic system with a = 11.396(2) Å, b = 14.107(3) Å, c = 15.805(3) Å, β = 102.09(3)°, V = 2484.6(9) Å3, Z = 4. Other characterizations by elemental analysis, IR, and thermal analysis for this compound are also given. 相似文献
16.
S. Kaoua P. Gravereau J.P. Chaminade S. Pechev S. Krimi A. El Jazouli 《Solid State Sciences》2009,11(3):628-634
We have extended our research interest on titanium oxyphosphates (MII(TiO)2(PO4)2, with MII = Mg, Fe, Co, Ni, Cu, Zn) to vanadium oxyphosphates MII(VIVO)2(PO4)2 (MII = Co, Ni). For each compound two phases, named α and β according to synthesis conditions, have been stabilized at room temperature, then characterized. The four crystal structures M(VO)2(PO4)2 (α and β for M = Co, Ni) have been determined in monoclinic P21/c space group using X-ray single crystals diffraction data. Structure of the α phase is derived from the Li(TiO)(PO4) (orthorhombic Pnma) and LiNi0.50(TiO)2(PO4)2 (monoclinic P21/c) types, with cell parameters: a = 6.310(1) Å, b = 7.273(1) Å, c = 7.432(1) Å, β = 90.43(1)° for M = Co, and a = 6.297(2) Å, b = 7.230(2) Å, c = 7.421(2) Å, β = 90.36(2)° for M = Ni. Structure of the β phase is derived from the Ni(TiO)2(PO4)2-type (monoclinic P21/c) with cell parameters: a = 7.2742(2) Å, b = 7.2802(2) Å, c = 7.4550(2) Å, β = 120.171(2)° for M = Co, and a = 7.2691(2) Å, b = 7.2366(2) Å, c = 7.4453(2) Å, β = 120.231(2)° for M = Ni. All these structures consist of a three dimensional (3D) framework built up of infinite chains of tilted corner-sharing [VO6] octahedra, cross-linked by corner-sharing [PO4] tetrahedra. The M2+ ion (M = Co, Ni) is located in a triangular based antiprism which shares faces with two [VO6] octahedra. Structural filiation is discussed based on a common structural unit, a sheet where divalent cations M2+ (M = Co, Ni) are inserted. A thermal study of the α ? β transition is also presented. 相似文献
17.
Peng Chen Jiyang Li Jun Xu Fangzheng Duan Feng Deng Ruren Xu 《Solid State Sciences》2009,11(3):622-627
A new zero-dimensional (0D) aluminophosphate monomer [dl-Co(en)3]2[Al(HPO4)2(H1.5PO4)2(H2PO4)2](H3PO4)4 (designated AlPO-CJ38) with Al/P ratio of 1/6 has been solvothermally prepared by using racemic cobalt complex dl-Co(en)3Cl3 as the template. The Al atom is octahedrally linked to six P atoms via bridging oxygen atoms, forming a unique [Al(HPO4)2(H1.5PO4)2(H2PO4)2]6? monomer. Notably, there exists intramolecular symmetrical O?H?O bonds, which results in pseudo-4-rings stabilized by the strong H-bonding interactions. The structure is also featured by the existence of four different types of monophosphates that have been confirmed by 31P NMR and 1H NMR spectra. The crystal data are as follows: AlPO-CJ38, [dl-Co(en)3]2[Al(HPO4)2(H1.5PO4)2(H2PO4)2](H3PO4)4, M = 1476.33, monoclinic, C2/c (No. 15), a = 36.028(7) Å, b = 8.9877(18) Å, c = 16.006(3) Å, β = 100.68(3)°, U = 5093.2(18) Å3, Z = 4, R1 = 0.0509 (I > 2σ(I)) and wR2 = 0.1074 (all data). CCDC number 689491. 相似文献
18.
Hüseyin Ünver Zeliha Hayvali 《Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy》2010,75(2):782-788
Two new nickel(II) [Ni(L)2] and copper(II) [Cu(L)2] complexes have been synthesized with bidentate NO donor Schiff base ligand (2-{(Z)-[furan-2-ylmethyl]imino]methyl}-6-methoxyphenol) (HL) and both complexes Ni(L)2 and Cu(L)2 have been characterized by elemental analyses, IR, UV–vis, 1H, 13C NMR, mass spectroscopy and room temperature magnetic susceptibility measurement. The tautomeric equilibria (phenol-imine, O–H?N and keto-amine, O?H–N forms) have been systemetically studied by using UV–vis absorption spectra for the ligand HL. The UV–vis spectra of this ligand HL were recorded and commented in polar, non-polar, acidic and basic media. The crystal structures of these complexes have also been determined by using X-ray crystallographic techniques. The complexes Ni(L)2 and Cu(L)2 crystallize in the monoclinic space group P21/n and P21/c with unit cell parameters: a = 10.4552(3) Å and 12.1667(4) Å, b = 8.0121(3) Å and 10.4792(3) Å, c = 13.9625(4) Å and 129.6616(3)Å, V = 1155.22(6) Å3 and 1155.22(6) Å3, Dx = 1.493 and 1.476 g cm?3 and Z = 2 and 2, respectively. The crystal structures were solved by direct methods and refined by full-matrix least squares to a find R = 0.0377 and 0.0336 of for 2340 and 2402 observed reflections, respectively. 相似文献
19.
F.Y. Bai X.T. Li G.S. Zhu Y.H. Xing 《Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy》2010,75(5):1388-1393
A new complex of oxovanadium(IV), V2O2[(HB(pz)3)2(pyrro)2 (1) and a dimer-dithio carboxyl compound (C5H8NS2)2 (2) have been synthesized by the reaction of VOSO4·nH2O with NaHB(pz)3 and pyrrolidine dithio carboxylic acid ammonium salt. They were characterized by element analysis, IR spectra, UV–vis spectra and X-ray diffraction. Structural analyses of 1 and 2 gave the following parameters: 1, triclinic, P-1, a = 7.732(4) Å, b = 14.285(8) Å, c = 17.802(9) Å, α = 101.314(8)°, β = 92.682(9)°, γ = 92.228(9)°, V = 1923.6(18) Å3, and Z = 4; 2, monoclinic, C2/c, a = 13.857(2) Å, b = 10.4213(18) Å, c = 9.436(2) Å, β = 97.099(2), V = 1352.1(4) Å3, and Z = 4. In complex 1, vanadium atom adopts a distorted tetragonal bipyramid structure, which is typical for oxovanadium(IV) complexes. Compound 2 is a dimer-dithio carboxyl compound with S–S bond. In addition, thermal analysis was performed for analyzing the stabilization of the complexes. 相似文献
20.
Xizheng Liu Guanggang Gao Lin Xu Fengyan Li Li Liu Ning Jiang Yanyan Yang 《Solid State Sciences》2009,11(8):1433-1438
Two inorganic polymers constructed from transition metal-substituted heteropolymolybdates, [(CH3)3NH]5n[PMo11MO39]n·xH2O (M = Mn2+, x = n (1); M = Co2+, x = 2n (2)), have been synthesized in aqueous solutions and characterized by IR, TGA, and single-crystal X-ray diffraction analysis. Crystal data: 1, monoclinic, C2/c, a = 17.1322(7) Å, b = 17.6062(7) Å, c = 17.6459(7) Å, β = 103.2220(10)°, V = 5181.5(4) Å3 and Z = 4; 2, triclinic, P-1, a = 12.1986(7) Å, b = 13.0973(7) Å, c = 16.7736(9) Å, α = 97.1810(10)°, β = 98.5040(11)°, γ = 96.3920(10)°, V = 2606.5(2) Å3 and Z = 2. The cyclic voltammograms of 1 and 2 show irreversible redox peaks in DMF solution and there are three reversible couples after addition of 0.1 M H2SO4 aqueous solutions. The cyclic voltammograms of 1/2-modified carbon paste electrode (1-CPE/2-CPE) show two consecutive reversible two-electron redox processes. Especially, 2-CPE shows good electrocatalytic activity toward the reduction of nitrite and hydrogen peroxide. The magnetic properties of the two complexes have also been investigated. 相似文献