Synthesis, characterization, and crystal structure of the Pd(phen)(bdt) complex. A DFT and TDDFT study of its ground electronic and excited states compared to those of analogous complexes

The synthesis and characterization of Pd(phen)(bdt) (1) (phen = 1,10-phenanthroline, bdt = 1,2-benzenedithiolate) is presented. 1 crystallizes in the monoclinic space group P2(1)/c, alpha = 11.281(4) A, b = 20.498(8) A, c = 8.374(3) A, beta = 90.234(8), V = 1936.5(13) A(3), Z = 4, and is isostructural with its previously reported related complexes. The ground and low lying excited electronic states in 1 and in the related complexes Pd(bpy)(bdt) (2), Pt(bpy)(bdt) (3), Pt(bpy)(mnt) (4), and Pt(bpy)(edt) (5) [where bpy = 2,2'-bipyridine, edt = ethylene-1,2-dithiolate, and mnt = maleonitriledithiolate] are studied using density functional theory techniques. The electronic properties of 1-5 are studied using the B3LYP functional. Optimized geometries are compared to experimentally observed structures. Time dependent density functional theory (TDDFT) is employed to investigate the excited singlet and triplet states. The calculated energies of the lowest singlet state and the lowest triplet state in all five complexes are in considerable agreement with experimental data. It is shown that variation of both metal and dithiolate-ligand going from 1 and 2 to 3, 4, and 5 has a substantial impact on the spectroscopic and excited-state properties, indicating at the same time the mixed metal/dithiolate character of the HOMO orbital. All the low-lying transitions are categorized as MMLL'CT transitions. The emissive state of all complexes is assigned as a triplet dithiolate/metal to diimine charge transfer with differences in the structures of the emissions resulting from differences in the pi dithiolate orbital of the mnt, bdt, and edt as well as from differences in metal.     

Coordination polymers and hybrid networks of different dimensionalities formed by metal sulfites

In our effort to explore the use of the sulfite ion to design hybrid and open-framework materials, we have been able to prepare, under hydrothermal conditions, zero-dimensional [Zn(C12H8N2)(SO3)].2H2O, I (a = 7.5737(5) A, b = 10.3969(6) A, c = 10.3986(6) A, alpha = 64.172(1) degrees , beta = 69.395(1) degrees , gamma = 79.333(1) degrees , Z = 2, and space group P), one-dimensional [Zn2(C12H8N2)(SO3)2(H2O)], II (a = 8.0247(3) A, b = 9.4962(3) A, c = 10.2740(2) A, alpha = 81.070(1) degrees , beta = 80.438(1) degrees , gamma = 75.66(5) degrees , Z = 2, and space group P), two-dimensional [Zn2(C10H8N2)(SO3)2].H2O, III (a = 16.6062(1) A, b = 4.7935(1) A, c = 19.2721(5) A, beta = 100.674(2) degrees , Z = 4, and space group C2/c), and three-dimensional [Zn4(C6H12N2)(SO3)4(H2O)4], IV (a = 11.0793(3) A, c = 8.8246(3) A, Z = 2, and space group P42nm), of which the last three are coordination polymers. A hybrid open-framework sulfite-sulfate of the composition [C2H10N2][Nd(SO3)(SO4)(H2O)]2, V (a = 9.0880(3) A, b = 6.9429(2) A, c = 13.0805(5) A, beta = 91.551(2) degrees , Z = 2, and space group P21/c), with a layered structure containing metal-oxygen-metal bonds has also been described.     

Dirhodium formamidinate compounds with bidentate nitrogen chelating ligands

The reactions of [Rh(2)(DTolF)(2)(CH(3)CN)(6)][BF(4)](2) (1) (DTolF = N,N'-di-p-tolylformamidinate) with 2,2'-bipyridine (bpy) and 1,10-phenanthroline (phen) proceed with substitution of CH(3)CN molecules to give products with the N-N ligands chelating in an equatorial-equatorial (eq-eq) fashion. Compound 1 reacts with 1 equiv of bpy to yield a mixture of [Rh(2)(DTolF)(2)(bpy)(CH(3)CN)(3)][BF(4)](2).(CH(3))(2)CO (2a) and [Rh(2)(DTolF)(2)(bpy)(CH(3)CN)(4)][BF(4)](2) (2b). Compound 2a crystallizes in the monoclinic space group P2(1)/n with a = 13.5856(2) A, b = 18.0402(2) A, c = 21.4791(3) A; alpha = 90 degrees, beta = 101.044(1) degrees, gamma = 90 degrees; V = 5167.27(12) A(3), Z = 4, R = 0.0531, and R(w) = 0.0948. Compound 2b crystallizes in the monoclinic space group P2(1)/n with a = 10.9339(2) A, b = 24.4858(1) A, c = 19.4874(3) A; alpha = 90 degrees, beta = 94.329(1) degrees, gamma = 90 degrees; V = 5202.38(13) A(3), Z = 4, R = 0.0459, and R(w) = 0.1140. The reaction of compound 1 with 2 equiv of bpy affords [Rh(2)(DTolF)(2)(bpy)(2)(CH(3)CN)][BF(4)](2) (3) which crystallizes in the monoclinic space group P2(1)/a with a = 19.4534(4) A, b = 13.8298(3) A, c = 19.8218(5) A; alpha = 90 degrees, beta = 109.189(1) degrees, gamma = 90 degrees; V = 5036.5(2) A(3), Z = 4, R = 0.0589, and R(w) = 0.0860. Compound 1 reacts with 1 equiv of phen to form [Rh(2)(DTolF)(2)(phen)(CH(3)CN)(3)][BF(4)](2).2C(2)H(5)OC(2)H(5) (4) which crystallizes in the triclinic space group P1macro with a = 12.6346(2) A, b = 13.5872(2) A, c = 19.0597(3) A; alpha = 71.948(1) degrees, beta = 73.631(1) degrees, gamma = 71.380(1) degrees; V = 2886.70(8) A(3), Z = 2, R = 0.0445, and R(w) = 0.1207. A notable feature of the cations in 2a, 3, and 4 is the presence of only one axial (ax) CH(3)CN ligand, a fact that can be attributed to the steric effect of the formamidinate bridging ligands. Compounds 2a, 2b, 3, and 4 were fully characterized by X-ray crystallography and (1)H NMR spectroscopy, whereas [Rh(2)(DTolF)(2)(phen)(2)(CH(3)CN)(2)][BF(4)](2) (5) was characterized by (1)H NMR spectroscopy.     

Intramolecular metal...sulfur interactions of platinum(II) 1,4,7-trithiacyclononane complexes with bipyridyl ligands: the relationship between molecular and electronic structures

Five platinum(II) 1,4,7-trithiacyclononane (ttcn) complexes with bidentate-substituted 2,2'-bipyridine ligands have been prepared and structurally characterized: [Pt(bpy)(ttcn)](PF6)2 (bpy = 2,2'-bipyridine), triclinic, P1, a = 10.2529(3) A, b = 10.7791(3) A, c = 10.7867(3) A, alpha = 83.886(1) degrees, beta = 87.565(1) degrees, gamma = 84.901(1), V = 1179.99(6) A3, Z = 2; [Pt(4,4'-dmbpy)(ttcn)](PF6)2 x CH3CN x H2O (4,4'-dmbpy = 4,4'-dimethyl-2,2'-bipyridine), triclinic, P1, a = 10.1895(3) A, b = 11.8566(4) A, c = 13.1004(4) A, alpha = 77.345(1) degrees, beta = 79.967(1) degrees, gamma = 72.341(1) degrees, V = 1461.56(8) A3, Z = 2; [Pt(5,5'-dmbpy)(ttcn)](PF6)2 (5,5'-dmbpy = 5,5'-dimethyl-2,2'-bipyridine), triclinic, P1, a = 10.6397(4) A, b = 10.8449(4) A, c = 11.2621(4) A, alpha = 90.035(1) degrees, beta = 98.061(1) degrees, gamma = 91.283(1) degrees, V = 1286.32(8) A3, Z = 2; [Pt(dbbpy)(ttcn)](PF6)2 x CH3NO2 (dbbpy = 4,4'-di-tert-butyl-2,2'-bipyridine), triclinic, P1, a = 11.5422(7) A, b = 11.6100(7) A, c = 13.6052(9) A, alpha = 85.902(1) degrees, beta = 89.675(1) degrees, gamma = 74.942(1) degrees, V = 1755.90(19) A3, Z = 2; and [Pt(dtfmbpy)(ttcn)](PF6)2 x CH3CN (dtfmbpy = 5,5'-di-trifluoromethyl-2,2'-bipyridine): monoclinic, P2(1)/c, a = 13.1187(9) A, b = 20.9031(15) A, c = 11.3815(8) A, beta = 105.789(2) degrees, V = 3003.3(4) A3, Z = 4. For each salt, the platinum(II) center of the cation is bonded to two nitrogen atoms of the chelating diimine and two sulfur atoms of the thioether macrocycle. The third sulfur atom of ttcn forms a long apical interaction with the metal center (2.84-2.97 A), resulting in a flattened square pyramid structure. An examination of these and 17 other structures of platinum(II) ttcn complexes reveals a correlation between the apical Pt...S distance and the donor properties of the ancillary ligands, suggesting a means for using variations in ligand electronic properties to tune molecular structure. The room-temperature absorption spectra in acetonitrile solution show a broad and comparatively low-energy MLCT band maximizing near approximately 390 nm for the bpy and dialkyl-substituted bipyridyl derivatives. The maximum is dramatically red-shifted to 460 nm in the spectrum of the dtfmbpy complex as a result of the electron-withdrawing properties of the -CF(3) groups. The 3:1 EtOH/MeOH 77 K glassy solution emission spectra exhibit low-energy emission bands (lambdamax, 570-645 nm), tentatively assigned as originating from a lowest, predominantly spin-forbidden MLCT excited state that is stabilized by apical Pt...S interactions.     

Thermal and photo control of the linkage isomerism of bis(thiocyanato)(2,2'-bipyridine)platinum(II)

Three linkage isomers, bis(thiocyanato-S)(2,2'-bipyridine)platinum(II) ([Pt(SCN)(2)(bpy)]), (thiocyanato-S)(thiocyanato-N)(2,2'-bipyridine)platinum(II) ([Pt(SCN)(NCS)(bpy)]), and bis(thiocyanato-N)(2,2'-bipyridine)platinum(II) ([Pt(NCS)(2)(bpy)]) were isolated, and their structures were elucidated. The crystal data are as follows: for [Pt(SCN)(2)(bpy)], C(12)H(8)N(4)S(2)Pt, orthorhombic, P2(1)2(1)2(1) (No. 19), a = 12.929(9) A, b = 18.67(1) A, c = 5.497(4) A, Z = 4; for [Pt(SCN)(NCS)(bpy)], C(12)H(8)N(4)S(2)Pt, monoclinic, P2(1)/n (No. 14), a = 10.909(7) A, b = 7.622(4) A, c = 16.02(1) A, beta = 102.323(7) degrees, Z = 4; for [Pt(NCS)(2)(bpy)], C(12)H(8)N(4)S(2)Pt, orthorhombic, Pbcm (No. 57), a = 10.3233(8) A, b = 19.973(2) A, c = 6.4540(5) A, Z = 4. The stacking structures of the isomers were found to be different depending on the coordination geometries based on the N- and S-coordination of the thiocyanato ligands, which control the color and luminescence of the crystals sensitively. The isomerization behaviors of the complex have been investigated both in solution and in the solid state. In solution, stepwise thermal isomerization from [Pt(SCN)(2)(bpy)] to [Pt(NCS)(2)(bpy)] by way of [Pt(SCN)(NCS)(bpy)] was observed using (1)H NMR spectroscopy. Reverse isomerization, from [Pt(NCS)(2)(bpy)] to [Pt(SCN)(NCS)(bpy)] and [Pt(SCN)(2)(bpy)], occurred when irradiated with near ultraviolet (UV) light. In contrast, the [Pt(SCN)(2)(bpy)] yellow crystals exhibited thermal isomerization directly to red crystals of [Pt(NCS)(2)(bpy)], as detected by changes in the emission spectrum, which indicates that the flip of two SCN(-) ligands correlatively occurred in the solid state. The yellow crystals of [Pt(SCN)(NCS)(bpy)] were also converted to the thermodynamically stable red crystal of [Pt(NCS)(2)(bpy)] though the reverse isomerization has never been observed to occur by photoirradiation in the solid state.     

Coordination polymers based on cobridging of rigid and flexible spacer ligands: syntheses, crystal structures, and magnetic properties of [Mn(bpy)(H2O)(C4H4O4)].0.5bpy, Mn(bpy)(C5H6O4), and Mn(bpy)(C6H8O4)

Reactions of 4,4'-bipyridine (bpy) with Mn(C(4)H(4)O(4)).4H(2)O and Mn(C(5)H(6)O(4)).4H(2)O in methanolic aqueous solutions yielded [Mn(bpy)(H(2)O)(C(4)H(4)O(4))].0.5bpy (1) and Mn(bpy)(C(5)H(6)O(4)) (2), respectively, and reactions of freshly prepared Mn(OH)(2)(-)(2)(x)(CO(3))(x).yH(2)O, adipic acid and 4,4'-bipyridine in a methanolic aqueous solution afforded Mn(bpy)(C(6)H(8)O(4)) (3). The six-coordinate Mn atoms in 1 are interlinked by flexible succinato ligands to form layers, which are sustained by rigid bpy ligands into an 3D open framework with the free bpy molecules in tunnels. The ribbonlike chains in 2 result from Mn atoms bridged by glutarato ligands and are connected by bpy ligands into open layers. In 3, the Mn atoms are bridged by both bpy and adipato ligands to form 3D nanoporous frameworks and 2-fold interpenetration of the resulting 3D frameworks completes the crystal structure. In comparison with 1 and 2, compound 3 displays significant antiferromagnetic behavior at low temperature. The antiferromagnetic exchange becomes stronger from 1 through 2 to 3, and the antiferromagnetic ordering of Mn(2+) centers is related to the syn-syn bridging mode of the terminal carboxylate groups of alpha,omega-dicarboxylate anions. Crystal data: C(19)H(18)MnN(3)O(5) (1), monoclinic P2(1)/c, a= 11.686(2) A, b = 17.847(2) A, c = 8.852(1) A, beta = 99.67(1) degrees, V = 1819.9(4) A(3), Z = 4, D(c) = 1.545 g.cm(-3); C(15)H(14)MnN(2)O(4) (2), triclinic P, a = 8.145(2) A, b = 9.574(2) A, c = 10.180(1) A, alpha = 108.01(3) degrees, beta = 93.55(3) degrees, gamma = 105.30(1) degrees, V = 719.2(2) A(3), Z = 2, D(c) = 1.576 g.cm(-3); C(15)H(14)MnN(2)O(4) (3), triclinic P, a = 8.544(1) A, b= 8.881(1) A, c = 10.949(2) A, alpha = 108.81(1) degrees, beta = 95.40(1) degrees, gamma = 101.94(1) degrees, V = 757.7(2) A(3), Z = 2, D(c) = 1.557 g.cm(-3).     

Symmetric and asymmetric dinuclear manganese(IV) complexes possessing a [MnIV2(mu-O)2(muO2CMe)]3+ core and terminal Cl- ligands

The synthesis of new dinuclear manganese(IV) complexes possessing the [Mn(IV)(2)(mu-O)(2)(mu-O(2)CMe)](3+) core and containing halide ions as terminal ligands is reported. [Mn(2)O(2)(O(2)CMe)Cl(2)(bpy)(2)](2)[MnCl(4)] (1; bpy = 2,2'-bipyridine) was prepared by sequential addition of [MnCl(3)(bpy)(H(2)O)] and (NBzEt(3))(2)[MnCl(4)] to a CH(2)Cl(2) solution of [Mn(3)O(4)(O(2)CMe)(4)(bpy)(2)]. The complex [Mn(IV)(2)O(2)(O(2)CMe)Cl(bpy)(2)(H(2)O)](NO(3))(2) (2) was obtained from a water/acetic acid solution of MnCl(2).4H(2)O, bpy, and (NH(4))(2)[Ce(NO(3))(6)], whereas the [Mn(IV)(2)O(2)(O(2)CR)X(bpy)(2)(H(2)O)](ClO(4))(2) [X = Cl(-) and R = Me (3), Et (5), or C(2)H(4)Cl (6); and X = F(-), R = Me (4)] were prepared by a slightly modified procedure that includes the addition of HClO(4). For the preparation of 4, MnF(2) was employed instead of MnCl(2).4H(2)O. [Mn(2)O(2)(O(2)CMe)Cl(2)(bpy)(2)](2)[MnCl(4)].2CH(2)Cl(2) (1.2CH(2)Cl(2)) crystallizes in the monoclinic space group C2/c with a = 21.756(2) A, b = 12.0587(7) A, c = 26.192(2) A, alpha = 90 degrees, beta = 111.443(2) degrees, gamma = 90 degrees, V = 6395.8(6) A(3), and Z = 4. [Mn(2)O(2)(O(2)CMe)Cl(H(2)O)(bpy)(2)](NO(3))(2).H(2)O (2.H(2)O) crystallizes in the triclinic space group Ponemacr; with a = 11.907(2) A, b = 12.376(2) A, c = 10.986(2) A, alpha = 108.24(1) degrees, beta = 105.85(2) degrees, gamma = 106.57(1) degrees, V = 1351.98(2) A(3), and Z = 2. [Mn(2)O(2)(O(2)CMe)Cl(H(2)O)(bpy)(2)](ClO(4))(2).MeCN (3.MeCN) crystallizes in the triclinic space group Ponemacr; with a = 11.7817(7) A, b = 12.2400(7) A, c = 13.1672(7) A, alpha = 65.537(2) degrees, beta = 67.407(2) degrees, gamma = 88.638(2) degrees, V = 1574.9(2) A(3), and Z = 2. The cyclic voltammogram (CV) of 1 exhibits two processes, an irreversible oxidation of the [MnCl(4)](2)(-) at E(1/2) approximately 0.69 V vs ferrocene and a reversible reduction at E(1/2) = 0.30 V assigned to the [Mn(2)O(2)(O(2)CMe)Cl(2)(bpy)(2)](+/0) couple (2Mn(IV) to Mn(IV)Mn(III)). In contrast, the CVs of 2 and 3 show only irreversible reduction features. Solid-state magnetic susceptibility (chi(M)) data were collected for complexes 1.1.5H(2)O, 2.H(2)O, and 3.H(2)O in the temperature range 2.00-300 K. The resulting data were fit to the theoretical chi(M)T vs T expression for a Mn(IV)(2) complex derived by use of the isotropic Heisenberg spin Hamiltonian (H = -2JS(1)S(2)) and the Van Vleck equation. The obtained fit parameters were (in the format J/g) -45.0(4) cm(-)(1)/2.00(2), -36.6(4) cm(-)(1)/1.97(1), and -39.3(4) cm(-)(1)/1.92(1), respectively, where J is the exchange interaction parameter between the two Mn(IV) ions. Thus, all three complexes are antiferromagnetically coupled.     

Rhenium(I) carbonyl complexes of 2,4,6-tris(2-pyridyl)-1,3,5-triazine (TPT). Rhenium(I)-promoted methoxylation of the triazine ring carbon atom in dinuclear rhenium complexes

2,4,6-Tris(2-pyridyl)-1,3,5-triazine (TPT) bridged dinuclear rhenium(I) tricarbonyl halide complexes with the composition (mu-TPT)[ReX(CO)(3)](2) (3, X = Cl; 4, X = Br) can be made either by one-pot reaction of TPT with 2 equiv of [ReX(CO)(5)] (X = Cl and Br) in chloroform or by reacting mononuclear [ReX(CO)(3)(TPT)] (2) (1, X = Cl; 2, X = Br) with an excess amount of [ReX(CO)(5)]. Crystal data are as follows. 1: monoclinic, P2(1)/c, a = 11.751(1) A, b = 11.376(1) A, c = 15.562(2) A, beta = 103.584(2) degrees, V = 2022.0(4) A(3), Z = 4. 2: monoclinic, P2(1)/c, a = 11.896(1) A, b = 11.396(1) A, c = 15.655(1) A, beta = 104.474(2) degrees, V = 2054.9(3) A(3), Z = 4. 3: triclinic, P1, a = 11.541(2) A, b = 12.119(2) A, c = 13.199(2) A, alpha = 80.377(2) degrees, beta = 76.204(3) degrees, gamma = 66.826(2) degrees, V = 1642.5(4) A(3), Z = 2. Crystals of 4 crystallized from acetone: triclinic, P1, a = 11.586(5) A, b = 12.144(5) A, c = 13.364(6) A, alpha = 80.599(7) degrees, beta = 76.271(8) degrees, gamma = 67.158(8) degrees, V = 1678.0(12) A(3), Z = 2. Crystals of 4' are obtained from CH(2)Cl(2)-pentane solution: monoclinic, C2/c, a = 17.555(4) A, b = 15.277(3) A, c = 13.093(3) A, beta = 111.179(3) degrees, V = 3274.0(12) A(3), Z = 4. By contrast, similar reactions in the presence of methanol yielded complexes with the composition [mu-C(3)N(3)(OMe)(py)(2)(pyH)][ReX(CO)(3)](2) (5, X = Cl; 6, X = Br). Crystal data for 5: monoclinic, C2/c, a = 26.952(2) A, b = 16.602(1) A, c = 14.641(1) A, beta = 116.147(1) degrees, V = 5880.5(8) A(3), Z = 8. 6: monoclinic, C2/c, a = 27.513(3) A, b = 16.740(2) A, c = 14.837(2) A, beta = 116.925(2) degrees, V = 6092.8(10) A(3), Z = 8. An unusual metal-induced methoxylation at the carbon atom of the triazine ring of the bridging TPT ligand was observed. The nucleophilic attack of MeO(-) on C(3) results in a tetrahedral geometry around the carbon atom. Concomitantly, the uncoordinated pyridyl ring is protonated and rotated into a perpendicular orientation relative to the central C(3)N(3) ring. Reaction of TPT with [NEt(4)](2)[ReBr(3)(CO)(3)] in benzene-methanol resulted in an unexpected dinuclear complex 7, with formulation [mu-C(3)N(3)(OMe)(py)(3)][Re(CO)(3)][ReBr(CO)(3)]. The methoxylated TPT ligand functions simultaneously as a tridentate and bidentate ligand with two fac-Re(CO)(3)(+) cores. Crystal data for 7: monoclinic, P2(1)/n, a = 12.114(1) A, b = 14.878(1) A, c = 15.807(1) A, beta = 104.601(1) degrees, V = 2756.9(3) A(3), Z = 4.     

Modified polyoxometalates: Hydrothermal syntheses and crystal structures of three novel reduced and capped Keggin derivatives decorated by transition metal complexes

Three novel polyoxometalate derivatives decorated by transition metal complexes have been hydrothermally synthesized. Compound 1 consists of [PMo(VI)(6)Mo(V)(2)V(IV)(8)O(44)[Co (2,2'-bipy)(2)(H(2)O)](4)](3+) polyoxocations and [PMo(VI)(4-)Mo(V)(4)V(IV)(8)O(44)[Co(2,2'-bipy)(2)(H(2)O)](2)](3-) polyoxoanions, which are both built on mixed-metal tetracapped [PMo(8)V(8)O(44)] subunits covalently bonded to four or two [Co(2,2'-bpy)(2)(H(2)O)](2+) clusters via terminal oxo groups of the capping V atoms. Compound 2 is built on [PMo(VI)(8)V(IV)(6)O(42)[Cu(I)(phen)](2)](5-) clusters constructed from mixed-metal bicapped [PMo(VI)(8)V(IV)(6)O(42)](7-) subunits covalently bonded to two [Cu(phen)](+) fragments in the similar way to 1. The structure of 3 is composed of [PMo(VI)(9)Mo(V)(3)O(40)](6-) units capped by two divalent Ni atoms via four bridging oxo groups. The crystal data for these are the following: C(120)H(126)Co(6)Mo(16)N(24)O(103)P(2)V(16) (1), triclinic P1, a = 15.6727(2) A, b = 17.3155(3) A, c = 19.5445(2) A, alpha = 86.1520(1) degrees, beta = 81.2010(1) degrees, gamma = 63.5970(1) degrees, Z = 1; C(120)H(85)Cu(6-)Mo(8)N(20)O(44)PV(6) (2), triclinic P1, a = 14.565(4) A, b = 15.899(3) A, c = 16.246(4) A, alpha = 116.289(2) degrees, beta = 103.084(2) degrees, gamma = 94.796(2) degrees, Z = 1; C(60)H(40)Mo(12)N(10)Ni(3)O(40)P (3), monoclinic P2(1)/c, a = 14.804(3) A, b = 22.137(4) A, c = 25.162(5) A, alpha = 90 degrees, beta = 98.59(3) degrees, gamma = 90 degrees, Z = 4.     

Unsymmetrical linear pentanuclear nickel string complexes: [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3))

The one-electron oxidized linear pentanuclear nickel complexes [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) (1) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3)) (2) have been synthesized by reacting the neutral compound [Ni(5)(tpda)(4)Cl(2)] with the corresponding silver salts. These compounds have been characterized by various spectroscopic techniques. Compound 1 crystallizes in the monoclinic space group P2(1)/n with a = 15.3022(1) A, b = 31.0705(3) A, c = 15.8109(2) A, beta = 92.2425(4) degrees, V = 7511.49(13) A(3), Z = 4, and compound 2 crystallizes in the monoclinic space group C2/c with a = 42.1894(7) A, b = 17.0770(3) A, c = 21.2117(4) A, beta = 102.5688(8) degrees, V = 14916.1(5) A(3), Z = 8. X-ray structural studies reveal an unsymmetrical Ni(5) unit for both compounds 1 and 2. Compounds 1 and 2 show stronger Ni-Ni interactions as compared to those of the neutral compounds.     

Synthesis of TiRru2 heterobimetallic and TiRuM (M = Rh, Rr, Pd, Pt) heterotrimetallic sulfido clusters from a hydrosulfido-bridged titanium-ruthenium complex

Treatment of the hydrosulfido-bridged titanium-ruthenium heterobimetallic complex [Cp2Ti(mu2-SH)2RuCl(eta5-C5Me5)] (1; Cp = eta5-C5H5) with an excess of triethylamine followed by addition of [RuCl2(PPh3)3] and [[(cod)M]2(mu2-Cl)2] (M = Rh, Ir; cod = 1,5-cyclooctadiene) led to the formation of the TiRu2 and TiRuM mixed-metal sulfido clusters [(CpTi)[(eta5-C5Me5)Ru][Ru(PPh3)2](mu3-S)2(mu2-Cl)2] (3) and [(CpTi)[(eta5-C5Me5)Ru][M(cod)](mu3-S)2(mu2-Cl)] (M = Rh (4a), Ir (4b)), respectively. On the other hand, the reactions of 1 with [M(PPh3)4] (M = Pd, Pt) afforded the TiRuM trinuclear clusters [(CpTiCl)[(eta5-C5Me5)Ru][M(PPh3)2](mu3-S)(mu2-S)(mu2-H)] (M = Pd (5a), Pt (5b)) with an unprecedented M3(mu3-S)(mu2-S) core. The detailed structures of these triangular clusters 3-5 have been determined by X-ray crystallography. Crystal data: 3, triclinic, P1, a = 12.448(4) A, b = 12.773(4) A, c = 17.270(4) A, alpha = 100.16(2) degrees, beta = 99.93(2) degrees, gamma = 114.11(3) degrees, V = 2373(1) A(3), Z = 2; 4a, triclinic, P1, a = 7.714(2) A, b = 11.598(3) A, c = 14.802(4) A, alpha = 80.46(2) degrees, beta = 82.53(2) degrees, gamma = 71.47(2) degrees, V = 1234.0(6) A3, Z = 2; 4b, triclinic, P1, a = 7.729(1) A, b = 11.577(2) A, c = 14.766(3) A, alpha = 80.14(1) degrees, beta = 82.71(1) degrees, gamma = 71.55(1) degrees, V = 1231.1(4) A3, Z = 2; 5a, monoclinic, P2(1)/c, a = 11.259(4) A, b = 16.438(4) A, c = 26.092(5) A, beta = 102.23(3) degrees, V = 4719(2) A(3), Z = 4; 5b, monoclinic, P2(1)/n, a = 11.369(2) A, b = 16.207(3) A, c = 26.116(2) A, beta = 102.29(1) degrees, V = 4701(1) A3, Z = 4.     

2 + 3] cycloaddition of nitrones to platinum-bound organonitriles: effect of metal oxidation state and of nitrile substituent

The ligated benzonitriles in the platinum(II) complex [PtCl2(PhCN)2] undergo metal-mediated [2 + 3] cycloaddition with nitrones -ON+(R3)=C(R1)(R2) [R1/R2/R3 = H/Ph/Me, H/p-MeC6H4/Me, H/Ph/CH2Ph] to give delta 4-1,2,4-oxadiazoline complexes, [PtCl2(N=C(Ph)O-N(R3)-C(R1)(R2))2] (2a, 4a, 6a), as a 1:1 mixture of two diastereoisomers, in 60-75% yields, while [PtCl2(MeCN)2] is inactive toward the addition. However, a strong activation of acetonitrile was reached by application of the platinum(IV) complex [PtCl4(MeCN)2] and both [PtCl4(RCN)2] (R = Me, Ph) react smoothly with various nitrones to give [PtCl4(N=C(R)O-N(R3)-C(R1)(R2))2] (1b-6b). The latter were reduced to the corresponding platinum(II) complexes [PtCl2(N=C(R)O-N(R3)-C(R1)(R2))2] (1a-6a) by treatment with PhCH2NHOH, while the reverse reaction, i.e. conversion of 1a-6a to 1b-6b, was achieved by chlorination with Cl2. The diastereoisomers of [PtCl2(N=C(R)O-N(R3)-C(R1)(R2))2] (1a-6a) exhibit different kinetic labilities, and liberation of the delta 4-1,2,4-oxadiazolines by substitution with 1,2-bis(diphenylphosphino)ethane (dppe) in CDCl3 proceeds at different reaction rates to give free N=C(R)O-N(R3)-C(R1)(R2) and [PtCl2(dppe)] in almost quantitative NMR yield. All prepared compounds were characterized by elemental analyses, FAB mass spectrometry, and IR and 1H, 13C(1H), and 195Pt (metal complexes) NMR spectroscopies; X-ray structure determination of the first (delta 4-1,2,4-oxadiazoline)Pt(II) complexes was performed for (S,S)/(R,R)-rac-[PtCl2(N=C(Me)O-N(Me)-C(H)Ph)2] (1a) (a = 9.3562(4), b = 9.8046(3), c = 13.1146(5) A; alpha = 76.155(2), beta = 83.421(2), gamma = 73.285(2) degrees; V = 1117.39(7) A3; triclinic, P1, Z = 2), (R,S)-meso-[PtCl2(N=C(Ph)O-N(Me)-C(H)Ph)2] (2a) (a = 8.9689(9), b = 9.1365(5), c = 10.1846(10) A; alpha = 64.328(6), beta = 72.532(4), gamma = 67.744(6) degrees; V = 686.82(11) A3; triclinic, P1, Z = 1), (S,S)/(R,R)-rac-[PtCl2(N=C(Me)O-N(Me)-C(H)(p-C6H4Me))2] (3a) (a = 11.6378(2), b = 19.0767(7), c = 11.5782(4) A; beta = 111.062(2) degrees; V = 2398.76(13) A3; monoclinic, P2(1)/c, Z = 4), and (S,S)/(R,R)-rac-[PtCl2(N=C(Me)O-N(CH2Ph)-C(H)Ph2] (5a) (a = 10.664(2), b = 10.879(2), c = 14.388(3) A; alpha = 73.11(3), beta = 78.30(3), gamma = 88.88(3) degrees; V = 1562.6(6) A3; triclinic, P1, Z = 2).     

Amine-templated linear vanadium sulfates with different chain structures

Amine-templated vanadium sulfates of the formula [HN(CH(2))(6)NH][(V(IV)O)(2)(OH)(2)(SO(4))(2)].H(2)O, I, [H(3)N(CH(2))(2)NH(3)][V(III)(OH)(SO(4))(2)].H(2)O, II, and [H(2)N(CH(2))(4)NH(2)][(V(IV)O)(H(2)O)(SO(4))(2)], III, have been prepared under hydrothermal conditions. These vanadium sulfates add to the new emerging family of organically templated metal sulfates. Compound I has a linear chain structure consisting of V(2)O(8) square-pyramid dimers connected by corner-sharing SO(4) tetrahedra, creating four-membered rings along the chain. Both II and III possess simple linear chain topologies formed by VO(6) octahedra and SO(4) tetrahedra, with II having the tancoite chain structure. Compound I crystallizes in the triclinic space group P1 (No. 2) with a = 7.4852(4) A, b = 9.5373(5) A, c = 11.9177(6) A, alpha = 77.22 degrees, beta = 76.47(2) degrees, gamma = 80.86 degrees, Z = 2. Compound II: monoclinic, space group P2(1)/c (No. 14), a = 6.942(2) A, b = 10.317(3) A, c = 15.102(6) A, beta = 90.64(4) degrees, Z = 4. Compound III: triclinic, space group P1 (No. 2) with a = 6.2558(10) A, b = 7.0663(14) A, c = 15.592(4) A, alpha = 90.46(2) degrees, beta = 90.47(2) degrees, gamma = 115.68(2) degrees, Z = 2. Magnetic susceptibility measurements reveal weak antiferromagnetic interactions in I and III and ferromagnetic interactions in II.     

N,N,N ',N '-Tetrakis(2-pyridylmethyl)ethylenediamine and its analogues as hypodentate ligands. Synthesis and characterization of the rhodium(III), ruthenium(II), and palladium(II) complexes

New complexes of Rh(III), Ru(II), and Pd(II) with N,N,N',N'-tetrakis(2-pyridylmethyl)ethylenediamine (tpen) and its analogues have been prepared. The reaction of RhCl(3).nH(2)O with tpen is slow and allows one to isolate the products of three consecutive substitution steps: Rh(2)Cl(6)(tpen) (1), cis-[RhCl(2)(eta(4)-tpen)](+) (2), and [RhCl(eta(5)-tpen)](2+) (3). In acetonitrile the reaction stops at the step of the formation of cis-[RhCl(2)(eta(4)-tpen)](+), whereas [RhCl(eta(5)-tpen)](2+) is the final product of the further reaction in ethanol. Fully chelated [Rh(tpen)](3+) could not be obtained. Bis(acetylacetonato)palladium(II), Pd(acac)(2), reacts with tpen and its analogues, N,N,N',N'-tetrakis(2-pyridylmethyl)-1,3-propanediamine (tptn) and N,N,N',N'-tetrakis(2-pyridylmethyl)-(R)-1,2-propylenediamine (R-tppn), to give [Pd(eta(4)-tpen)](2+) (4), [Pd(eta(4)-tppn)](2+) (5), and [Pd(eta(4)-tptn)](2+) (6), respectively. Two pyridyl arms remain uncoordinated in these cases. The formation of unstable Pd(III) complexes from these Pd(II) complexes in solution was suggested on the basis of electrochemical measurements. Ruthenium(III) trichloride, RuCl(3).nH(2)O, is reduced to give a Ru(II) complex with fully coordinated tpen, [Ru(tpen)](2+) (7). The same product was obtained in a more straightforward reaction of Ru(II)Cl(2)(dimethyl sulfoxide)(4) with tpen. Electrochemical studies showed a quasi-reversible [Ru(tpen)](2+/3+) couple for [7](ClO(4))(2) (E(1/2) = 1.05 V vs Ag/AgCl). Crystal structures of [2](PF(6)).2CH(3)CN, [3](PF(6))(2).CH(3)CN, [6](ClO(4))(2), and [7](ClO(4))(2).0.5H(2)O were determined. Crystal data: [2](PF(6)).2CH(3)CN, monoclinic, C2, a = 16.974(4) A, b = 8.064(3) A, c = 13.247(3) A, beta = 106.37(2) degrees, V = 1739.9(8) A(3), Z = 2; [3](PF(6))(2).CH(3)CN, triclinic, P1, a = 11.430(1) A, b = 19.234(3) A, c = 8.101(1) A, alpha = 99.43(1) degrees, beta = 93.89(1) degrees, gamma = 80.10(1) degrees, V = 1729.3(4) A(3), Z = 2; [6](ClO(4))(2), orthorhombic, Pnna, a = 8.147(1) A, b = 25.57(1) A, c = 14.770(4) A, V = 3076(3) A(3), Z = 4; [7](ClO(4))(2).0.5H(2)O, monoclinic, P2(1)/c, a = 10.046(7) A, b = 19.049(2) A, c = 15.696(3) A, beta = 101.46(3) degrees, V = 2943(2) A(3), Z = 4.     

Synthesis and structural characterization of trinuclear Cu(II)-pyrazolato complexes containing mu(3)-OH, mu(3)-O, and mu(3)-Cl ligands. Magnetic susceptibility study of [PPN](2)[(mu(3)-O)Cu(3)(mu-pz)(3)Cl(3)

The nine-membered [-Cu(II)-N-N-](3) ring of trimeric copper-pyrazolato complexes provides a sturdy framework on which water is twice deprotonated in consecutive steps, forming mu(3)-OH and mu(3)-O species. In the presence of excess chlorides the mu(3)-O(H) ligand is replaced by two mu(3)-Cl ions. The interconversion of mu(3)-OH and mu(3)-O and the exchange of mu(3)-O(H) and mu(3)-Cl are reversible, and the three species involved have been structurally characterized: [PPN][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(thf)].CH(2)Cl(2) (1a), monoclinic P2(1)/n, a = 10.055(2) A, b = 35.428(5) A, c = 15.153(2) A, beta = 93.802(3) degrees, V = 5386(1) A(3), Z = 4; [Bu(4)N][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)] (1b), triclinic P-1, a = 9.135(2) A, b = 13.631(2) A, c = 14.510(2) A, alpha = 67.393(2) degrees, beta = 87.979(2) degrees, gamma = 80.268(3) degrees, V = 1643.2(4) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-O)(mu-pz)(3)Cl(3)] (2), monoclinic P2/c, a = 12.807(2) A, b = 13.093(2) A, c = 23.139(4) A, beta = 105.391(3) degrees, V = 3741(1) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)].0.75H(2)O.0.5CH(2)Cl(2) (3a), triclinic P-1, a = 14.042(2) A, b = 23.978(4) A, c = 25.195(4) A, alpha = 76.796(3) degrees, beta = 79.506(3) degrees, gamma = 77.629(3) degrees, V = 7988(2) A(3), Z = 4; [Bu(4)N](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)] (3b), monoclinic C2/c, a = 17.220(2) A, b = 15.606(2) A, c = 20.133(2) A, beta = 103.057(2) degrees, V = 5270(1) A(3), Z = 4; [Et(3)NH][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(pzH)] (4), triclinic P-1, a = 11.498(2) A, b = 11.499(2) A, c = 12.186(2) A, alpha = 66.475(3) degrees, beta = 64.279(3) degrees, gamma = 80.183(3) degrees, V = 1331.0(5) A(3), Z = 2. Magnetic susceptibility measurements show that the three copper centers of 2 are strongly antiferromagnetically coupled with J(Cu-Cu) = -500 cm(-1).     

Toward novel DNA binding metal complexes: structure and basic kinetic data of [M(9MeG)2(CH3OH)(CO)3]+(M = 99Tc,Re)

To study the interaction of the fac-[M(CO)(3)](+) moiety (M = (99m)Tc, (188)Re) with DNA bases, we reacted [M(OH(2))(3)(CO)(3)](+) with 9-methylguanine (9-MeG), guanosine (G), and 2-deoxyguanosine (2dG). Two bases bind to the metal center via the N7 atoms. X-ray structure analysis of [(99)Tc(CH(3)OH)(9-MeG)(2)(CO)(3)](+) (4) (monoclinic, I2/a, a = 28.7533(14) A, b = 8.0631(4) A, c = 32.3600(15) A, beta = 91.543(6) degrees, V = 7499.6(6) A(3), Z = 8) and [Re(OH(2))(9-MeG)(2)(CO)(3)](+) (7) (monoclinic, P2(1)/n, a = 12.2873(11) A, b = 16.0707(13) A, c = 14.1809(16) A, beta = 103.361(12) degrees, V = 2724.4(5) A(3), Z = 4) reveals that the two bases are in a head-to-tail (HT) orientation. Kinetic studies show that the rates of substitution of the purine bases are comparable to that of one of the active forms of cisplatin. The bis-substituted complexes are generally less stable than the platinum adducts, and metalation of the bases is reversible.     

Unusual Reactivity Mode of Coordinated Oximes: Platinum(IV)-Assisted Ring Closure by Reaction with Acetone

The platinum(II) complexes trans-[PtCl(2)(RR'C=NOH)(2)], where R = R' = Me, RR' = (CH(2))(4) and (CH(2))(5), react with m-chloroperoxybenzoic acid in Me(2)CO to give the platinum(IV) complexes [PtCl(2)(OCMe(2)ON=CRR')(2)] in 50-60% yields. The complexes [PtCl(2)(OCMe(2)ON=CRR')(2)] were characterized by elemental analysis, EI-MS, and IR and Raman spectroscopies; X-ray structure analyses were performed for both trans-[PtCl(2)(OCMe(2)ON=CC(4)H(8))(2)] and trans-[PtCl(2)(OCMe(2)ON=CC(5)H(10))(2)]. The former compound crystallizes in the triclinic space group P&onemacr; with a = 8.088(2) ?, b = 8.327(2) ?, c = 8.475(2) ?, alpha = 103.54(3) degrees, beta = 102.15(3) degrees, gamma = 108.37(3) degrees, V = 501.0(2) ?(3), Z = 1, and rho(calcd) = 1.917 g cm(-)(3). The latter complex crystallizes in the monoclinic space group C2/c with a = 12.5260(10) ?, b = 9.3360(10) ?, c = 18.699(2) ?, beta = 98.320(10) degrees, V = 2163.7(4) ?(3), Z = 4, and rho(calcd) = 1.862 g cm(-)(3). The structures of [PtCl(2)(OCMe(2)ON=CC(4)H(8))(2)] and [PtCl(2)(OCMe(2)ON=CC(5)H(10))(2)] show an octahedron of Pt where two Cl atoms and two chelate ligands are mutually trans, respectively.     

Ni（bpy）（H2O）（V2O6）和[Ni（bpy）2]2（V6O17）的水热合成与晶体结构

用NiCl2·6H2O,2,2＇-联吡啶（bpy）,NH4VO3,WO3在443K下通过水热反应法得到了两种多钒酸镍配合物Ni（bpy）（H2O）（V2O6）（1）和[Ni（bpy）2]2（V6O17）（2）．单晶X射线衍射结果表明化合物（1）属于正交晶系,空间群为Pcα2（1）,晶胞参数为0=0．91704（18）nm,b=1．0519（2）nm,c=1．4336（3）nm,V=1．3830（5）nm^3,Z=4;化合物（2）属于单斜晶系,空间群为P2（1）／c,晶胞参数为α=1．5467（3）nm,b=1．4740（3）nm,c=1．0457（2）nm,β=91．99（3）°,V=2．3826（8）nm^3,Z=4．化合物（1）由2,2’-联吡啶修饰的二维[Ni（V2O6）（H2O）]∞电中性层构成,而化合物（2）则由2,2＇-联吡啶修饰的、呈正弦波浪状的[Ni：（V6O17）]∞二维电中性层构成．     

Reactivity of rhenium(V) oxo Schiff base complexes with phosphine ligands: rearrangement and reduction reactions

The symmetric rhenium(V) oxo Schiff base complexes trans-[ReO(OH2)(acac2en)]Cl and trans-[ReOCl(acac2pn)], where acac2en and acac2pn are the tetradentate Schiff base ligands N,N'-ethylenebis(acetylacetone) diimine and N,N'-propylenebis(acetylacetone) diimine, respectively, were reacted with monodentate phosphine ligands to yield one of two unique cationic phosphine complexes depending on the ligand backbone length (en vs pn) and the identity of the phosphine ligand. Reduction of the Re(V) oxo core to Re(III) resulted on reaction of trans-[ReO(OH2)(acac2en)]Cl with triphenylphosphine or diethylphenylphosphine to yield a single reduced, disubstituted product of the general type trans-[Re(III)(PR3)2(acac2en)]+. Rather unexpectedly, a similar reaction with the stronger reducing agent triethylphosphine yielded the intramolecularly rearranged, asymmetric cis-[Re(V)O(PEt3)(acac2en)]+ complex. Reactions of trans-[Re(V)O(acac2pn)Cl] with the same phosphine ligands yielded only the rearranged asymmetric cis-[Re(V)O(PR3)(acac2pn)]+ complexes in quantitative yield. The compounds were characterized using standard spectroscopic methods, elemental analyses, cyclic voltammetry, and single-crystal X-ray diffraction. The crystallographic data for the structures reported are as follows: trans-[Re(III)(PPh3)2(acac2en)]PF6 (H48C48N2O2P2Re.PF6), 1, triclinic (P), a = 18.8261(12) A, b = 16.2517(10) A, c = 15.4556(10) A, alpha = 95.522(1) degrees , beta = 97.130(1) degrees , gamma = 91.350(1) degrees , V = 4667.4(5) A(3), Z = 4; trans-[Re(III)(PEt2Ph)2(acac2en)]PF6 (H48C32N2O2P2Re.PF6), 2, orthorhombic (Pccn), a = 10.4753(6) A, b =18.4315(10) A, c = 18.9245(11) A, V = 3653.9(4) A3, Z = 4; cis-[Re(V)O(PEt3)(acac2en)]PF6 (H33C18N2O3PRe.1.25PF6, 3, monoclinic (C2/c), a = 39.8194(15) A, b = 13.6187(5) A, c = 20.1777(8) A, beta = 107.7730(10) degrees , V = 10419.9(7) A3, Z = 16; cis-[Re(V)O(PPh3)(acac2pn)]PF6 (H35C31N2O3PRe.PF6), 4, triclinic (P), a = 10.3094(10) A, b =12.1196(12) A, c = 14.8146(15) A, alpha = 105.939(2) degrees , beta = 105.383(2) degrees , gamma = 93.525(2) degrees , V = 1698.0(3) A3, Z = 2; cis-[Re(V)O(PEt2Ph)(acac2pn)]PF6 (H35C23N2O3PRe.PF6), 5, monoclinic (P2(1)/n), a = 18.1183(18) A, b = 11.580(1) A, c = 28.519(3) A, beta = 101.861(2) degrees , V = 5855.9(10) A(3), Z = 4.     

Reactions of acetonitrile coordinated to a nitrosylruthenium complex with H2O or CH(3)OH under mild conditions: structural characterization of imido-type complexes

The reaction of cis-[Ru(NO)(CH(3)CN)(bpy)(2)](3+) (bpy = 2,2'-bipyridine) in H(2)O at room temperature proceeded to afford two new nitrosylruthenium complexes. These complexes have been identified as nitrosylruthenium complexes containing the N-bound methylcarboxyimidato ligand, cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](2+), and methylcarboxyimido acid ligand, cis-[Ru(NO)(NH=C(OH)CH(3))(bpy)(2)](3+), formed by an electrophilic reaction at the nitrile carbon of the acetonitrile coordinated to the ruthenium ion. The X-ray structure analysis on a single crystal obtained from CH(3)CN-H(2)O solution of cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](PF(6))(3) has been performed: C(22)H(20.5)N(6)O(2)P(2.5)F(15)Ru, orthorhombic, Pccn, a = 15.966(1) A, b = 31.839(1) A, c = 11.707(1) A, V = 5950.8(4) A(3), and Z = 8. The structural results revealed that the single crystal consisted of 1:1 mixture of cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](2+) and cis-[Ru(NO)(NH=C(OH)CH(3))(bpy)(2)](3+) and the structural formula of this single crystal was thus [Ru(NO)(NH=C(OH(0.5))CH(3))(bpy)(2)](PF(6))(2.5). The reaction of cis-[Ru(NO)(CH(3)CN)(bpy)(2)](3+) in dry CH(3)OH-CH(3)CN at room temperature afforded a nitrosylruthenium complex containing the methyl methylcarboxyimidate ligand, cis-[Ru(NO)(NH=C(OCH(3))CH(3))(bpy)(2)](3+). The structure has been determined by X-ray structure analysis: C(25)H(29)N(8)O(18)Cl(3)Ru, monoclinic, P2(1)/c, a = 13.129(1) A, b = 17.053(1) A, c = 15.711(1) A, beta = 90.876(5) degrees, V = 3517.3(4) A(3), and Z = 4.