Synthesis and Chemical and Electrochemical Characterization of Fe-S Carbonyl Clusters. X-ray Crystal Structures of [N(PPh(3))(2)](2)[Fe(5)S(2)(CO)(14)] and [N(PPh(3))(2)](2)[Fe(6)S(6)(CO)(12)

A reinvestigation of the redox behavior of the [Fe(3)(&mgr;(3)-S)(CO)(9)](2)(-) dianion led to the isolation and characterization of the new [Fe(5)S(2)(CO)(14)](2)(-), as well as the known [Fe(6)S(6)(CO)(12)](2)(-) dianion. As a corollary, new syntheses of the [Fe(3)S(CO)(9)](2)(-) dianion are also reported. The [Fe(5)S(2)(CO)(14)](2)(-) dianion has been obtained by oxidative condensation of [Fe(3)S(CO)(9)](2)(-) induced by tropylium and Ag(I) salts or SCl(2), or more straightforwardly through the reaction of [Fe(4)(CO)(13)](2)(-) with SCl(2). The [Fe(6)S(6)(CO)(12)](2)(-) dianion has been isolated as a byproduct of the synthesis of [Fe(3)S(CO)(9)](2)(-) and [Fe(5)S(2)(CO)(14)](2)(-) or by reaction of [Fe(4)(CO)(13)](2)(-) with elemental sulfur. The structures of [N(PPh(3))(2)](2)[Fe(5)S(2)(CO)(14)] and [N(PPh(3))(2)](2)[Fe(6)S(6)(CO)(12)] were determined by single-crystal X-ray diffraction analyses. Crystal data: for [N(PPh(3))(2)](2)[Fe(5)S(2)(CO)(14)], monoclinic, space group P2(1)/c (No. 14), a = 24.060(5), b = 14.355(6), c = 23.898(13) ?, beta = 90.42(3) degrees, Z = 4; for [N(PPh(3))(2)](2)[Fe(6)S(6)(CO)(12)], monoclinic, space group C2/c (No. 15), a = 34.424(4), b = 14.081(2), c = 19.674(2) ?, beta = 115.72(1) degrees, Z = 4. The new [Fe(5)S(2)(CO)(14)](2)(-) dianion shows a "bow tie" arrangement of the five metal atoms. The two Fe(3) triangles sharing the central Fe atom are not coplanar and show a dihedral angle of 55.08(3) degrees. Each Fe(3) moiety is capped by a triply bridging sulfide ligand. The 14 carbonyl groups are all terminal; two are bonded to the unique central atom and three to each peripheral iron atom. Protonation of the [Fe(5)S(2)(CO)(14)](2)(-) dianion gives reversibly rise to the corresponding [HFe(5)S(2)(CO)(14)](-) monohydride derivative, which shows an (1)H-NMR signal at delta -21.7 ppm. Its further protonation results in decomposition to mixtures of Fe(2)S(2)(CO)(6) and Fe(3)S(2)(CO)(9), rather than formation of the expected H(2)Fe(5)S(2)(CO)(14) dihydride. Exhaustive reduction of [Fe(5)S(2)(CO)(14)](2)(-) with sodium diphenyl ketyl progressively leads to fragmentation into [Fe(3)S(CO)(9)](2)(-) and [Fe(CO)(4)](2)(-), whereas electrochemical, as well as chemical oxidation with silver or tropylium tetrafluoroborate, in dichloromethane, generates the corresponding [Fe(5)S(2)(CO)(14)](-) radical anion which exhibits an ESR signal at g = 2.067 at 200 K. The electrochemical studies also indicated the existence of a subsequent one-electron anodic oxidation which possesses features of chemical reversibility in dichloromethane but not in acetonitrile solution. A reexamination of the electrochemical behavior of the [Fe(3)S(CO)(9)](2)(-) dianion coupled with ESR monitoring enabled the spectroscopic characterization of the [Fe(3)S(CO)(9)](-) radical monoanion and demonstrated its direct involvement in the generation of the [Fe(5)S(2)(CO)(14)](n)()(-) (n = 0, 1, 2) system.     

Mixed-metal uranium(VI) iodates: hydrothermal syntheses,structures, and reactivity of Rb[UO(2)(CrO(4))(IO(3))(H(2)O)], A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K,Rb, Cs), and K(2)[UO(2)(MoO(4))(IO(3))(2)

The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4.     

Preparation, Molecular and Electronic Structures, and Magnetic Properties of Face-Sharing Bioctahedral Titanium(III) Compounds: [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PR(3))(2)

Reduction of TiCl(4) with 1 equiv of HSnBu(3) followed by addition of [PPh(4)]Cl and then PR(3) leads to two new dinuclear titanium(III) compounds, [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PR(3))(2)] (R = Et and R(3) = Me(2)Ph), both of which contain an anion with the face-sharing bioctahedral type structure. Their crystal structures are reported. [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PEt(3))(2)].2CH(2)Cl(2) crystallized in the triclinic space group P&onemacr;. Cell dimensions: a = 12.461(1) ?, b = 20.301(8) ?, c = 11.507(5) ?, alpha = 91.44 degrees, beta = 113.27(1) degrees, gamma = 104.27(2) degrees, and Z = 2. The distance between titanium atoms is 3.031(2) ?. [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PMe(2)Ph)(2)].CH(2)Cl(2) also crystallized in the triclinic space group P&onemacr; with cell dimensitions a = 11.635(4) ?, b = 19.544(3) ?, c = 11.480(3) ?, alpha = 100.69(2) degrees, beta = 109.70(1) degrees, gamma = 95.08(2) degrees, and Z = 2. The distance between titanium atoms in this compound is 2.942(1) ?. Variable temperature magnetic susceptibilities were measured for [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PEt(3))(2)]. Electronic structure calculations were carried out for a model ion, [Ti(2)(&mgr;-Cl)(3)Cl(4)(PH(3))(2)](-), and another well-known anion, [Ti(2)(&mgr;-Cl)(3)Cl(6)](3)(-), by employing an ab initio configuration interaction method. The results of the calculations reveal that the metal-metal interaction in these Ti(III) face-sharing compounds can be best described by strong antiferromagnetic coulping that leads to a singlet ground state and a thermally accessible triplet first excited state. Accordingly the measured magnetic data were satisfactorily fitted to a spin-only formula.     

Synthesis and characterization of the silver maleonitrilediselenolates and silver maleonitriledithiolates [K([2.2.2]-cryptand)]4[Ag4(Se2C2(CN)2)4], [Na([2.2.2]-cryptand)]4[Ag4(S2C2(CN)2)4].0.33MeCN, [NBu4]4[Ag4(S2C2(CN)2)4], [K([2.2.2]-cryptand)]3[Ag(Se2C2(CN)2)2].2MeCN, and [Na([2.2.2]-cryptand)]3[Ag(S2C2(CN)2)2

Reaction of AgBF(4), KNH(2), K(2)Se, Se, and [2.2.2]-cryptand in acetonitrile yields [K([2.2.2]-cryptand)](4)[Ag(4)(Se(2)C(2)(CN)(2))(4)] (1). In the unit cell of 1 there are four [K([2.2.2]-cryptand)](+) units and a tetrahedral Ag(4) anionic core coordinated in mu(1)-Se, mu(2)-Se fashion by each of four mns ligands (mns = maleonitrilediselenolate, [Se(2)C(2)(CN)(2)](2)(-)). Reaction of AgNO(3), Na(2)(mnt) (mnt = maleonitriledithiolate, [S(2)C(2)(CN)(2)](2)(-)), and [2.2.2]-cryptand in acetonitrile yields [Na([2.2.2]-cryptand)](4)[Ag(4)(mnt)(4)].0.33MeCN (2). The Ag(4) anion of 2 is analogous to that in 1. Reaction of AgNO(3), Na(2)(mnt), and [NBu(4)]Br in acetonitrile yields [NBu(4)](4)[Ag(4)(mnt)(4)] (3). The anion of 3 also comprises an Ag(4) core coordinated by four mnt ligands, but the Ag(4) core is diamond-shaped rather than tetrahedral. Reaction of [K([2.2.2]-cryptand)](3)[Ag(mns)(Se(6))] with KNH(2) and [2.2.2]-cryptand in acetonitrile yields [K([2.2.2]-cryptand)](3)[Ag(mns)(2)].2MeCN (4). The anion of 4 comprises an Ag center coordinated by two mns ligands in a tetrahedral arrangement. Reaction of AgNO(3), 2 equiv of Na(2)(mnt), and [2.2.2]-cryptand in acetonitrile yields [Na([2.2.2]-cryptand)](3)[Ag(mnt)(2)] (5). The anion of 5 is analogous to that of 4. Electronic absorption and infrared spectra of each complex show behavior characteristic of metal-maleonitriledichalcogenates. Crystal data (153 K): 1, P2/n, Z = 2, a = 18.362(2) A, b = 16.500(1) A, c = 19.673(2) A, beta = 94.67(1) degrees, V = 5941(1) A(3); 2, P4, Z = 4, a= 27.039(4) A, c = 15.358(3) A, V = 11229(3) A(3); 3, P2(1)/c, Z = 6, a = 15.689(3) A, b = 51.924(11) A, c = 17.393(4) A, beta = 93.51(1) degrees, V = 14142(5) A(3); 4, P2(1)/c, Z = 4, a = 13.997(1) A, b = 21.866(2) A, c = 28.281(2) A, beta = 97.72(1) degrees, V = 8578(1) A(3); 5, P2/n, Z = 2, a = 11.547(2) A, b = 11.766(2) A, c = 27.774(6) A, beta = 91.85(3) degrees, V = 3772(1) A(3).     

Synthesis, Structure, and Reactivities of [eta(2)-P(7)M(CO)(4)](3)(-), [eta(2)-HP(7)M(CO)(4)](2)(-), and [eta(2)-RP(7)M(CO)(4)](2)(-) Zintl Ion Complexes Where M = Mo, W

Ethylenediamine (en) solutions of [eta(4)-P(7)M(CO)(3)](3)(-) ions [M = W (1a), Mo (1b)] react under one atmosphere of CO to form microcrystalline yellow powders of [eta(2)-P(7)M(CO)(4)](3)(-) complexes [M = W (4a), Mo (4b)]. Compounds 4 are unstable, losing CO to re-form 1, but are highly nucleophilic and basic. They are protonated with methanol in en solvent giving [eta(2)-HP(7)M(CO)(4)](2)(-) ions (5) and are alkylated with R(4)N(+) salts in en solutions to give [eta(2)-RP(7)M(CO)(4)](2)(-) complexes (6) in good yields (R = alkyl). Compounds 5 and 6 can also be prepared by carbonylations of the [eta(4)-HP(7)M(CO)(3)](2)(-) (3) and [eta(4)-RP(7)M(CO)(3)](2)(-) (2) precursors, respectively. The carbonylations of 1-3 to form 4-6 require a change from eta(4)- to eta(2)-coordination of the P(7) cages in order to maintain 18-electron configurations at the metal centers. Comparative protonation/deprotonation studies show 4 to be more basic than 1. The compounds were characterized by IR and (1)H, (13)C, and (31)P NMR spectroscopic studies and microanalysis where appropriate. The [K(2,2,2-crypt)](+) salts of 5 were characterized by single crystal X-ray diffraction. For 5, the M-P bonds are very long (2.71(1) ?, average). The P(7)(3)(-) cages of 5 are not displaced by dppe. The P(7) cages in 4-6 have nortricyclane-like structures in contrast to the norbornadiene-type geometries observed for 1-3. (31)P NMR spectroscopic studies for 5-6 show C(1) symmetry in solution (seven inequivalent phosphorus nuclei), consistent with the structural studies for 5, and C(s)() symmetry for 4 (five phosphorus nuclei in a 2:2:1:1:1 ratio). Crystallographic data for [K(2,2,2-crypt)](2)[eta(2)-HP(7)W(CO)(4)].en: monoclinic, space group C2/c, a = 23.067(20) ?, b = 12.6931(13) ?, c = 21.433(2) ?, beta = 90.758(7) degrees, V = 6274.9(10) ?(3), Z = 4, R(F) = 0.0573, R(w)(F(2)) = 0.1409. For [K(2,2,2-crypt)](2)[eta(2)-HP(7)Mo(CO)(4)].en: monoclinic, space group C2/c, a = 22.848(2) ?, b = 12.528(2) ?, c = 21.460(2) ?, beta = 91.412(12) degrees, V = 6140.9(12) ?(3), Z = 4, R(F) = 0.0681, R(w)(F(2)) = 0.1399.     

Synthesis, Structure, and Reactivity of [Zr(6)Cl(18)H(5)](2)(-), the First Paramagnetic Species of Its Class

Reaction of [Zr(6)Cl(18)H(5)](3)(-) (1) with 1 equiv of TiCl(4) yields a new cluster anion, [Zr(6)Cl(18)H(5)](2)(-) (2), which can be converted back into [Zr(6)Cl(18)H(5)](3)(-) (1) upon addition of 1 equiv of Na/Hg. Cluster 2 is paramagnetic and unstable in the presence of donor molecules. It undergoes a disproportionation reaction to form 1, some Zr(IV) compounds, and H(2). It also reacts with TiCl(4) to form [Zr(2)Cl(9)](-) (4) and a tetranuclear mixed-metal species, [Zr(2)Ti(2)Cl(16)](2)(-) (3). The oxidation reaction of 1 with TiCl(4) is unique. Oxidation of 1 with H(+) in CH(2)Cl(2) solution results in the formation of [ZrCl(6)](2)(-) (5) and H(2), while in py solution the oxidation product is [ZrCl(5)(py)](-) (6). There is no reaction between 1 and TiI(4), ZrCl(4), [TiCl(6)](2)(-), [ZrCl(6)](2)(-), or CrCl(3). Compounds [Ph(4)P](2)[Zr(6)Cl(18)H(5)] (2a), [Ph(4)P](2)[Zr(2)Ti(2)Cl(16)] (3a), [Ph(4)P](2)[Zr(2)Cl(9)] (4a), [Ph(4)P](2)[ZrCl(6)].4MeCN (5a.4MeCN), and [Ph(4)P][ZrCl(5)(py)] (6a) were characterized by X-ray crystallography. Compound 2a crystallized in the trigonal space group R&thremacr; with cell dimensions (20 degrees C) of a = 28.546(3) ?, b = 28.546(3) ?, c = 27.679(2) ?, V = 19533(3) ?(3), and Z = 12. Compound 3a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 11.375(3) ?, b = 13.357(3) ?, c = 11.336(3) ?, alpha = 106.07(1) degrees, beta = 114.77(1) degrees, gamma = 88.50(1) degrees, V = 1494.8(7) ?(3), and Z = 1. Compound 4a crystallized in the triclinic space group P&onemacr; with cell dimensions (-60 degrees C) of a = 12.380(5) ?, b = 12.883(5) ?, c = 11.000(4) ?, alpha = 110.39(7) degrees, beta = 98.29(7) degrees, gamma = 73.12(4) degrees, V = 1572(1) ?(3), and Z = 2. Compound 5a.4MeCN crystallized in the monoclinic space group P2(1)/c with cell dimensions (-60 degrees C) of a = 9.595(1) ?, b = 19.566(3) ?, c = 15.049(1) ?, beta = 98.50(1) degrees, V = 2794.2(6) ?(3), and Z = 2. Compound 6a crystallized in the monoclinic space group P2(1)/c with cell dimensions (20 degrees C) of a = 10.3390(7) ?, b = 16.491(2) ?, c = 17.654(2) ?, beta = 91.542(6) degrees, V = 3026.4(5) ?(3), and Z = 4.     

Reaction of bis(phosphine)(hydrotris(3,5-dimethylpyrazolyl)borato)rhodium(I) with phenylacetylene,p-nitrobenzaldehyde,and triphenyltin hydride: structures of [Rh(Tp)(PPh(3))(2)], [Rh(Tp)(H)(C(2)Ph)(P(4-C(6)H(4)F)(3))], [Rh(Tp)(H)(COC(6)H(4)-4-NO(2))(PPh(3))], and [Rh(Tp)(H)(SnPh(3))(PPh(3))

The complexes [Rh(Tp)(PPh(3))(2)] (1a) and [Rh(Tp)(P(4-C(6)H(4)F)(3))(2)] (1b) combine with PhC(2)H, 4-NO(2)-C(6)H(4)CHO and Ph(3)SnH to give [Rh(Tp)(H)(C(2)Ph)(PR(3))] (R = Ph, 2a; R = 4-C(6)H(4)F, 2b), [Rh(Tp)(H)(COC(6)H(4)-4-NO(2))(PR(3))] (R = Ph, 3a), and [Rh(Tp)(H)(SnPh(3))(PR(3))] (R = Ph, 4a; R = 4-C(6)H(4)F, 4b) in moderate to good yield. Complexes 1a, 2b, 3a, and 4a have been structurally characterized. In 1a the Tp ligand is bidentate, in 2b, 3a, and 4a it is tridentate. Crystal data for 1a: space group P2(1)/c; a = 11.9664(19), b = 21.355(3), c = 20.685(3) A; beta = 112.576(7) degrees; V = 4880.8(12) A(3); Z = 4; R = 0.0441. Data for 2b: space group P(-)1; a = 10.130(3), b = 12.869(4), c = 17.038(5) A; alpha = 78.641(6), beta = 76.040(5), gamma = 81.210(6) degrees; V = 2100.3(11) A(3); Z = 2; R = 0.0493. Data for 3a: space group P(-)1; a = 10.0073(11), b = 10.5116(12), c = 19.874(2) A; alpha = 83.728(2), beta = 88.759(2), gamma = 65.756(2) degrees; V =1894.2(4) A(3); Z = 2; R = 0.0253. Data for 4a: space group P2(1)/c; a = 15.545(2), b = 18.110(2), c = 17.810(2) A; beta = 95.094(3) degrees; V = 4994.1(10) A(3); Z = 4; R = 0.0256. NMR data ((1)H, (31)P, (103)Rh, (119)Sn) are also reported.     

Synthesis and Characterization of nido-[1,1,2,2-(CO)(4)-1,2-(PPh(3))(2)-1,2-FeIrB(2)H(5)]: A Heterobimetallaborane Analogue of nido-[B(4)H(7)](-)

The synthesis and characterization of nido-[1,1,2,2-(CO)(4)-1,2-(PPh(3))(2)-1,2-FeIrB(2)H(5)] (1) is reported. 1 is formed in low yield as a degradation product from the reaction between [{&mgr;-Fe(CO)(4)}B(6)H(9)](-) and trans-Ir(CO)Cl(PPh(3))(2) in THF and is characterized from NMR, IR, and analytical data and by a single-crystal X-ray diffraction study. 1 crystallizes in the monoclinic space group P2(1)/n with a = 12.8622(12), b = 14.3313(12), c = 23.579(3) ?, beta = 97.12(2) degrees, Z = 4, V = 4257.0(8) ?(3), R(1) = 4.83%, and wR(2)()(F(2)) = 12.43%. The heterobimetallaborane structure may be viewed as a derivative of the binary boron hydride nido-[B(4)H(7)](-) and is related to the known homobimetallatetraborane analogues [Fe(2)(CO)(6)B(2)H(6)] and [Co(2)(CO)(6)B(2)H(4)]. 1 exhibits proton fluxionality in its (1)H NMR spectrum, which is related to that found in the latter two compounds.     

Unsymmetrical linear pentanuclear nickel string complexes: [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3))

The one-electron oxidized linear pentanuclear nickel complexes [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) (1) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3)) (2) have been synthesized by reacting the neutral compound [Ni(5)(tpda)(4)Cl(2)] with the corresponding silver salts. These compounds have been characterized by various spectroscopic techniques. Compound 1 crystallizes in the monoclinic space group P2(1)/n with a = 15.3022(1) A, b = 31.0705(3) A, c = 15.8109(2) A, beta = 92.2425(4) degrees, V = 7511.49(13) A(3), Z = 4, and compound 2 crystallizes in the monoclinic space group C2/c with a = 42.1894(7) A, b = 17.0770(3) A, c = 21.2117(4) A, beta = 102.5688(8) degrees, V = 14916.1(5) A(3), Z = 8. X-ray structural studies reveal an unsymmetrical Ni(5) unit for both compounds 1 and 2. Compounds 1 and 2 show stronger Ni-Ni interactions as compared to those of the neutral compounds.     

Anionic Halomolybdate(III) Chemistry. Tetrahydrofuran Loss from [MoX(3)Y(THF)(2)](-) (X, Y = Cl, Br, I), Preparation and Properties of [Mo(3)X(12)](3)(-) (X = Br, I), and Crystal Structure of the Edge-Sharing Trioctahedral [PPh(4)](3)[Mo(3)I(12)

By interaction of MoX(3)(THF)(3) with [Cat]X in THF, the salts [Cat][MoX(4)(THF)(2)] have been synthesized [X = I, Cat = PPh(4), NBu(4), NPr(4), (Ph(3)P)(2)N; X = Br, Cat = NBu(4), PPh(4) (Ph(3)P)(2)N]. Mixed-halide species [MoX(3)Y(THF)(2)](-) (X, Y = Cl, Br, I) have also been generated in solution and investigated by (1)H-NMR. When the tetraiodo, tetrabromo, and mixed bromoiodo salts are dissolved in CH(2)Cl(2), clean loss of all coordinated THF is observed by (1)H-NMR. On the other hand, [MoCl(4)(THF)(2)](-) loses only 1.5 THF/Mo. The salts [Cat](3)[Mo(3)X(12)] (X = Br, I) have been isolated from [Cat][MoX(4)(THF)(2)] or by running the reaction between MoX(3)(THF)(3) and [Cat]X directly in CH(2)Cl(2). The crystal structure of [PPh(4)](3)[Mo(3)I(12)] exhibits a linear face-sharing trioctahedron for the trianion: triclinic, space group P&onemacr;; a = 11.385(2), b = 12.697(3), c = 16.849(2) ?; alpha = 76.65(2), beta = 71.967(12), gamma = 84.56(2) degrees; Z = 1; 431 parameters and 3957 data with I > 2sigma(I). The metal-metal distance is 3.258(2) ?. Structural and magnetic data are consistent with the presence of a metal-metal sigma bond order of (1)/(2) and with the remaining 7 electrons being located in 7 substantially nonbonding orbitals. The ground state of the molecule is predicted to be subject to a Jahn-Teller distortion, which is experimentally apparent from the nature of the thermal ellipsoid of the central Mo atom. The [Mo(3)X(12)](3)(-) ions reacts with phosphines (PMe(3), dppe) to form products of lower nuclearity by rupture of the bridging Mo-X bonds.     

Cyano-bridged homometallic 1-D and bimetallic 2-D assemblies: synthesis,structures, and magnetic properties of [Ni(baepn)(CN)]n(ClO4)n and [Ni(baepn)]2n[Fe(CN)(6)]n(H2O)8n

Cyano-bridged homometallic complex [Ni(baepn)(CN)](n)(ClO(4))(n)(1) and bimetallic complex [Ni(baepn)](2)(n)[Fe(CN)(6)](n)(H(2)O)(8)(n)(2) [baepn = N,N'-bis(2-aminoethyl)-1,3-propanediamine] were synthesized and characterized. 1 crystallizes in the monoclinic space group P2(1)/n with a = 9.560(3) A, b = 10.700(3) A, c = 14.138(9) A, beta = 90.18(6) degrees, and Z = 4; 2 crystallizes in the monoclinic space group P2(1)/c with a = 8.951(2) A, b = 13.672(3) A, c = 14.392(3) A, beta = 98.906(4) degrees, and Z = 4. The complex 1 has one-dimensional structure whose chain vector runs along the b axis with baepn ligands and perchlorate anions alternately arranged up and down in the c direction. The antiferromagnetic nature of 1 was explained in terms of the infinite chain model and Haldane gap, giving g = 2.33, J = -29.4 cm(-1), and the magnitude of Haldane gap E(g) = 5.22 K. The complex 2 that constitutes the first example of 2-D bimetallic assembly of Ni(II) ion and ferrocyanide anion is composed of the neutral layers based on the [Ni(4)Fe(4)] square grid spanning in the bc plane. For 2, the analysis with the Curie-Weiss law in 2-300 K range results in THETA = 0.200 K and the magnetism was explained in terms of the ability of ferrocyanide in the -Ni-NC-Fe-CN-Ni unit to promote ferromagnetic Ni-Ni interaction.     

Synthesis and structural characterization of integrally oxidized, metal-free phthalocyanine compounds: [H(2)(pc)][IBr(2)] and [H(2)(pc)](2)[IBr(2)]Br.C(10)H(7)Br

The first integrally oxidized metal-free phthalocyanine compounds have been synthesized by chemical oxidation. Phthalocyanine (H(2)(pc), pc = phthalocyaninato) was oxidized with IBr to afford the compounds [H(2)(pc)][IBr(2)] (1) and [H(2)(pc)](2)[IBr(2)]BrAC(10)H(7)Br (2), whose structures were determined by means of single-crystal X-ray diffraction methods: [H(2)(pc)][IBr(2)], P2(1)/c, a = 8.0272(9) A, b = 21.258(2) A, c = 18.1439(2) A, beta = 113.975(2) degrees, V = 2828.8(5) A(3), T = 153 K, Z = 4; [H(2)(pc)](2)[IBr(2)]Br.C(10)H(7)Br, P, a = 8.4724(6) A, b = 13.5794(10) A, c = 13.8403(10) A, alpha = 90.854(1) degrees, beta = 103.417(1) degrees, gamma = 97.049(1)E degrees, V = 1535.61(19) A(3), T = 153 K, Z = 1. The extended structure of [H(2)(pc)][IBr(2)] comprises slipped columns of pc rings stacked along the a axis in adjacent columns at approximately 70 degrees to one another. IBr(2-) ions occupy the interstitial columns. The extended structure of [H(2)(pc)](2)[IBr(2)]Br.C(10)H(7)Br comprises slant stacks of pc rings along the crystallographic a axis with IBr(2-) ions, Br(-) ions, and disordered 1-bromonaphthalene molecules in the adjacent, parallel columns. The overall reaction for the formation of 1 is 2H(2)(pc) + 4IBr --> 2[H(2)(pc)][IBr(2)] + I(2), and the overall reaction for the formation of 2 (not including solvent) is 2H(2)(pc) + 3IBr --> [H(2)(pc)](2)Br[IBr(2)] + I(2).     

Preparation and X-ray structures of Cu(I), Ni(II), and Pd(II) (N,S) complexes of the monoanion [(tBuN)(S)P(mu-N(t)Bu)2P(S)(NH(t)Bu)]- and a Pt(II) (S,S') complex of the dianion [((t)BuN)(S)P(mu-N(t)Bu)2P(S)(N(t)Bu)]2-

The metathetical reactions of the lithium derivative of the monoanion [((t)BuN)(S)P(mu-N(t)Bu)(2)P(S)(NH(t)Bu)](-) (L) with CuCl/PPh(3), NiCl(2)(PEt(3))(2), PdCl(2)L'(2) (L' = PhCN, PPh(3)), and PtCl(2)(PEt(3))(2) produced the complexes (PPh(3))CuL (5), NiL(2) (6), PdCl(L)(PPh(3)) (7), PdL(2) (8), and Pt(PEt(3))(2)[((t)BuN)(S)P(mu-N(t)Bu)(2)P(S)(N(t)Bu)] (9). The X-ray structures of 5, 6, and 8 reveal a N,S-coordination for the chelating monoanion L with the metal centers in trigonal planar, tetrahedral, and square planar environments, respectively. By contrast, the dianionic ligand in the square planar Pt(II) complex 9 is S,S'-chelated to the metal center. (31)P NMR spectra readily distinguish between the N,S and S,S' bonding modes, and, on that basis, N,S chelation is inferred for the Pd(II) complex 7. Crystal data: 5, monoclinic, P2(1)/c, a = 19.175(4) A, b = 20.331(4) A, c = 10.017(6) A, beta = 91.79(3) degrees, V = 3903(2) A(3), and Z = 4; 6, orthorhombic, Pbcn, a = 14.298(5) A, b = 15.333(5) A, c = 24.378(5) A, beta = 90.000(5) degrees, V = 5344(3) A(3), and Z = 4; 8, monoclinic, P2(1)/n, a = 13.975(3) A, b = 14.283(3) A, c = 15.255(4) A, beta = 116.565(18) degrees, V = 2723.5(11) A(3), and Z = 2; 9, monoclinic, P2(1)/n, a = 12.479(6) A, b = 21.782(7) A, c = 17.048(5) A, beta = 100.30(3) degrees, V = 4559(3) A(3), and Z = 4.     

An Approach to Heterometallic Complexes with Selenolate and Tellurolate Ligands: Crystal Structures of cis-[Mn(CO)(4)(SePh)(2)](-), [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-), (CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3), and (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3)

Oxidative addition of diorganyl diselenides to the coordinatively unsaturated, low-valent transition-metal-carbonyl fragment [Mn(CO)(5)](-) produced cis-[Mn(CO)(4)(SeR)(2)](-). The complex cis-[PPN][Mn(CO)(4)(SePh)(2)] crystallized in triclinic space group P&onemacr; with a = 10.892(8) ?, b = 10.992(7) ?, c = 27.021(4) ?, alpha = 101.93(4) degrees, beta = 89.79(5) degrees, gamma = 116.94(5) degrees, V = 2807(3) ?(3), and Z = 2; final R = 0.085 and R(w) = 0.094. Thermolytic transformation of cis-[Mn(CO)(4)(SeMe)(2)](-) to [(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)](-) was accomplished in high yield in THF at room temperature. Crystal data for [Na-18-crown-6-ether][(CO)(3)Mn(&mgr;-SeMe)(3)Mn(CO)(3)]: trigonal space group R&thremacr;, a = 13.533(3) ?, c = 32.292(8) ?, V = 5122(2) ?(3), Z = 6, R = 0.042, R(w) = 0.041. Oxidation of Co(2+) to Co(3+) by diphenyl diselenide in the presence of chelating metallo ligands cis-[Mn(CO)(4)(SePh)(2)](-) and cis-[Mn(CO)(4)(TePh)(2)](-), followed by a bezenselenolate ligand rearranging to bridge two metals and a labile carbonyl shift from Mn to Co, led directly to [(CO)(4)Mn(&mgr;-TePh)(2)Co(CO)(&mgr;-SePh)(3)Mn(CO)(3)]. Crystal data: triclinic space group P&onemacr;, a = 11.712(3) ?, b = 12.197(3) ?, c = 15.754(3) ?, alpha = 83.56(2) degrees, beta = 76.13(2) degrees, gamma = 72.69(2) degrees, V = 2083.8(7) ?(3), Z = 2, R = 0.040, R(w) = 0.040. Addition of fac-[Fe(CO)(3)(SePh)(3)](-) to fac-[Mn(CO)(3)(CH(3)CN)(3)](+) resulted in formation of (CO)(3)Mn(&mgr;-SePh)(3)Fe(CO)(3). This neutral heterometallic complex crystallized in monoclinic space group P2(1)/n with a = 8.707(2) ?, b = 17.413(4) ?, c = 17.541(4) ?, beta = 99.72(2) degrees, V = 2621(1) ?(3), and Z = 4; final R = 0.033 and R(w) = 0.030.     

Synthesis and structural characterization of trinuclear Cu(II)-pyrazolato complexes containing mu(3)-OH, mu(3)-O, and mu(3)-Cl ligands. Magnetic susceptibility study of [PPN](2)[(mu(3)-O)Cu(3)(mu-pz)(3)Cl(3)

The nine-membered [-Cu(II)-N-N-](3) ring of trimeric copper-pyrazolato complexes provides a sturdy framework on which water is twice deprotonated in consecutive steps, forming mu(3)-OH and mu(3)-O species. In the presence of excess chlorides the mu(3)-O(H) ligand is replaced by two mu(3)-Cl ions. The interconversion of mu(3)-OH and mu(3)-O and the exchange of mu(3)-O(H) and mu(3)-Cl are reversible, and the three species involved have been structurally characterized: [PPN][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(thf)].CH(2)Cl(2) (1a), monoclinic P2(1)/n, a = 10.055(2) A, b = 35.428(5) A, c = 15.153(2) A, beta = 93.802(3) degrees, V = 5386(1) A(3), Z = 4; [Bu(4)N][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)] (1b), triclinic P-1, a = 9.135(2) A, b = 13.631(2) A, c = 14.510(2) A, alpha = 67.393(2) degrees, beta = 87.979(2) degrees, gamma = 80.268(3) degrees, V = 1643.2(4) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-O)(mu-pz)(3)Cl(3)] (2), monoclinic P2/c, a = 12.807(2) A, b = 13.093(2) A, c = 23.139(4) A, beta = 105.391(3) degrees, V = 3741(1) A(3), Z = 2; [PPN](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)].0.75H(2)O.0.5CH(2)Cl(2) (3a), triclinic P-1, a = 14.042(2) A, b = 23.978(4) A, c = 25.195(4) A, alpha = 76.796(3) degrees, beta = 79.506(3) degrees, gamma = 77.629(3) degrees, V = 7988(2) A(3), Z = 4; [Bu(4)N](2)[Cu(3)(mu(3)-Cl)(2)(mu-pz)(3)Cl(3)] (3b), monoclinic C2/c, a = 17.220(2) A, b = 15.606(2) A, c = 20.133(2) A, beta = 103.057(2) degrees, V = 5270(1) A(3), Z = 4; [Et(3)NH][Cu(3)(mu(3)-OH)(mu-pz)(3)Cl(3)(pzH)] (4), triclinic P-1, a = 11.498(2) A, b = 11.499(2) A, c = 12.186(2) A, alpha = 66.475(3) degrees, beta = 64.279(3) degrees, gamma = 80.183(3) degrees, V = 1331.0(5) A(3), Z = 2. Magnetic susceptibility measurements show that the three copper centers of 2 are strongly antiferromagnetically coupled with J(Cu-Cu) = -500 cm(-1).     

Investigations of the TeCl(4)-(t)BuNHLi Reaction: Synthesis, X-ray Structures, and Fluxional Behavior of the Tellurium-Nitrogen Compounds [Li(2)Te(N(t)Bu)(3)](2), {[LiTe(N(t)Bu)(2)(NH(t)Bu)](2)LiCl}(2), and {Te(2)(N(t)Bu)(4)[LiTe(N(t)Bu)(2)(NH(t)Bu)]LiCl}(2)

The reaction of (t)BuNHLi with TeCl(4) in toluene at -78 degrees C produces (t)BuNTe(&mgr;-N(t)Bu)(2)TeN(t)Bu (1) (55%) or [((t)BuNH)Te(&mgr;-N(t)Bu)(2)TeN(t)Bu]Cl (2) (65%) for 4:1 or 7:2 molar ratios, respectively. The complex {Te(2)(N(t)Bu)(4)[LiTe(N(t)Bu)(2)(NH(t)Bu)]LiCl}(2) (5) is obtained as a minor product (23%) from the 4:1 reaction. It is a centrosymmetric dimer in which each half consists of the tellurium diimide dimer 1 bonded through an exocyclic nitrogen atom to a molecule of LiTe(N(t)Bu)(2)(NH(t)Bu) which, in turn, is linked to a LiCl molecule. Crystals of 5 are monoclinic, of space group C2/c, with a = 27.680(6) ?, b = 23.662(3) ?, c = 12.989(2) ?, beta = 96.32(2) degrees, V = 8455(2) ?(3), and Z = 4. The final R and R(w) values were 0.046 and 0.047. At 65 degrees C in toluene solution, 5 dissociates into 1, LiCl, and {[LiTe(N(t)Bu)(2)(NH(t)Bu)](2)LiCl}(2) (4), which may also be prepared by treatment of [Li(2)Te(N(t)Bu)(3)](2) (6) with 2 equiv of HCl gas. The centrosymmetric structure of 6 consists of a distorted hexagonal prism involving two pyramidal Te(N(t)Bu)(3)(2)(-) anions linked by four Li atoms to give a Te(2)N(6)Li(4) cluster. Crystals of 6 are monoclinic, of space group P2(1)/c, with a = 10.194(2) ?, b = 17.135(3) ?, c = 10.482(2) ?, beta = 109.21(1) degrees, V = 1729.0(5) ?(3), and Z = 2. The final R and R(w) values were 0.026 and 0.023. VT (1)H and (7)Li NMR studies reveal that, unlike 1, compounds 2, 4, and 6 are fluxional molecules. Possible mechanisms for these fluxional processes are discussed.     

Heterobimetallic Clusters of Copper(I) with Trithiotungstate and Trithiomolybdate. Synthesis and Characterization of the Octanuclear Clusters [Et(4)N](4)[M(4)Cu(4)S(12)O(4)] (M = Mo, W) and the Dodecanuclear Clusters [M(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (M = Mo, W; TMEN = N,N,N',N'-Tetramethylethylenediamine)

Synthetic methods for [Et(4)N](4)[W(4)Cu(4)S(12)O(4)] (1), [Et(4)N](4)[Mo(4)Cu(4)S(12)O(4)] (2), [W(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (3), and [Mo(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (4) are described. [Et(4)N](2)[MS(4)], [Et(4)N](2)[MS(2)O(2)], Cu(NO(3))(2).3H(2)O, and KBH(4) (or Et(4)NBH(4)) were used as starting materials for the synthesis of 1 and 2. Compounds 3 and 4 were produced by reaction of [Et(4)N](2)[WOS(3)], Cu(NO(3))(2).3H(2)O, and TMEN and by reaction of [Me(4)N](2)[MO(2)O(2)S(8)], Cu(NO(3))(2).3H(2)O, and TMEN, respectively. Crystal structures of compounds 1-4 were determined. Compounds 1 and 2 crystallized in the monoclinic space group C2/c with a = 14.264(5) ?, b = 32.833(8) ?, c = 14.480(3) ?, beta = 118.66(2) degrees, V = 5950.8(5) ?(3), and Z = 4 for 1 and a = 14.288(5) ?, b = 32.937(10) ?, c = 14.490(3) ?, beta = 118.75(2) degrees, V = 5978.4(7) ?(3), and Z = 4 for 2. Compounds 3 and 4 crystallized in the trigonal space group P3(2)21 with a = 13.836(6) ?, c = 29.81(1) ?, V = 4942(4) ?(3), and Z = 3 for 3 and a = 13.756(9) ?, c = 29.80(2) ?, V = 4885(6) ?(3), and Z = 3 for 4. The cluster cores have approximate C(2v) symmetry. The anions of 1 and 2 may be viewed as consisting of two butterfly-type [CuMOS(3)Cu] fragments bridged by two [MOS(3)](2-) groups. Eight metal atoms in the anions are arranged in an approximate square configuration, with a Cu(4)M(4)S(12) ring structure. Compounds 3 and 4 can be considered to consist of one [M(4)Cu(4)S(12)O(4)](4-) (the anions of 1 and 2) unit capped by Cu(TMEN)(+) groups on each M atom; the Cu(TMEN)(+) groups extend alternately up and down around the Cu(4)M(4) square. The electronic spectra of the compounds are dominated by the internal transitions of the [MOS(3)](2-) moiety. (95)Mo NMR spectral data are investigated and compared with those of other compounds.     

Synthesis and structure of [PPh(4)](3)[Cr(Te(4))(3)].DMF: the first tris(tetratelluride) complex

The compound [PPh(4)](3)[Cr(Te(4))(3)].DMF has been synthesized from the reaction of Cr(CO)(6) with a polytelluride solution in dimethylformamide at 100 degrees C. The compound has been characterized by (125)Te NMR and single-crystal X-ray diffraction techniques. The compound crystallizes in the triclinic space group P(-)1, with a = 12.991(3) A, b = 14.782(3) A, c = 24.628(5) A, alpha= 90.63(3)o, beta= 104.45(3)o, gamma= 106.49(3)o, and Z = 2 (T = 153 K). The [Cr(Te(4))(3)](3-) anion consists of a Cr(III) center chelated by three Te(4)(2-) ligands in a distorted octahedral environment. The anion has the Deltalambdalambdalambda (or Lambdadeltadeltadelta) conformation.     

New metalloligands [M(SC[O]Ph)(4)](-): synthesis and characterization of polymeric [A(MeCN)(x)[M(SC[O]Ph)(4)]] compounds (A = Li,Na and K; M = Ga and In; x = 0-2)

Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials.     

Composition Space of the (CuO, (1)/(2)Nb(2)O(5))/(HF)(x)().pyridine/H(2)O System. Structure and Synthesis of [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2-) and CuNb(py)(4)OF(5)

Single crystals of [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2)(-) and CuNb(py)(4)OF(5) were synthesized in a (HF)(x)().pyridine/pyridine/water solution (150 degrees C, 24 h, autogeneous pressure) using CuO and Nb(2)O(5) as reagents. The compound [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2)(-) contains clusters of [CuNb(2)(py)(4)O(2)F(10)](2)(-) anions linked through N-H(+).F hydrogen bonds to the [pyH(+)] cations. In contrast CuNb(py)(4)OF(5) is a unidimensional compound consisting only of chains, perpendicular to the c axis, of alternating [Cu(py)(4)(O/F)(2/2)](0.5+) and [NbF(4)(O/F)(2/)(2)](0.5)(-) octahedra. The chains change direction between the [110] and [1&onemacr;0] every c/2. Crystal data for [pyH(+)](2)[CuNb(2)(py)(4)O(2)F(10)](2)(-): tetragonal, space group I4(1)22 (No. 98),with a = 11.408(3) ?, c = 30.36(1) ?, and Z = 4. Crystal data for CuNb(py)(4)OF(5): monoclinic, space group C2/c (No. 15), with a = 10.561(3) ?, b = 13.546(6) ?, c = 16.103(4) ?, beta = 97.77(2) degrees, and Z = 4.