Crystal Structures of a Family of New Copper(I) Cyanide Complexes of Thiourea and Substituted Thioureas

The syntheses and crystal structures of the first cyanide, sulfur mixed ligand copper(I) complexes are reported. The first complex of the family was discovered when (CuCN)(3)(C(6)H(12)N(4))(2) (1) (C(6)H(12)N(4) = hexamethylenetetramine) was treated with aqueous thiourea. The sulfur ligands include thiourea (tu), 1,3-dimethyl-2-thiourea (dmtu), 1,3-diethyl-2-thiourea (detu), 1,1,3,3-tetramethyl-2-thiourea (tmtu), and 2-imidazolidinethione (N,N'-ethylenethiourea, etu). Synthesis was effected by adding the ligand to a solution of CuCN in aqueous sodium thiosulfate. Complex 2, (CuCN)(2)(tu)(3)(H(2)O), crystallizes in the triclinic space group P&onemacr;with unit cell dimensions a = 7.696(5) ?, b = 9.346(2) ?, c = 10.772(2) ?, alpha = 106.53(2) degrees, beta = 91.11(4) degrees, gamma = 98.42(3) degrees, and Z = 2. Complex 3, (CuCN)(3)(dmtu)(2), crystallizes in the monoclinic space group Cc with unit cell dimensions a = 10.082(3) ?, b = 14.984(5) ?, c = 11.413(3) ?, beta = 104.50(2) degrees, and Z = 4. Complex 4, (CuCN)(2)(detu)(H(2)O), crystallizes in the monoclinic space group P2(1)/n with unit cell dimensions a = 7.969(5) ?, b = 11.559(4) ?, c = 13.736(5) ?, beta = 100.48(4) degrees, and Z = 4. Complex 5, (CuCN)(tmtu) (polymorph a), crystallizes in the orthorhombic space group P2(1)2(1)2(1) with unit cell dimensions a = 8.653(1) ?, b = 9.426(1) ?, c = 11.620(3) ?, and Z = 4. Complex 6, (CuCN)(tmtu) (polymorph b), which has the same connectivity as 5, crystallizes in the triclinic space group P&onemacr; with unit cell dimensions a = 9.660(4) ?, b = 14.202(4) ?, c = 16.03(1) ?, alpha = 101.68(5) degrees, beta = 107.08(6) degrees, gamma = 70.07(2) degrees, and Z = 8. The difference between the polymorphs is that 5 has a zig-zag chain with a repeat unit of two while 6 has a 4-fold helix. Complex 7, (CuCN)(2)(etu), crystallizes in the monoclinic space group P2(1)( )()with unit cell dimensions a = 3.994(2) ?, b = 13.886(3) ?, c = 7.556(1) ?, beta = 97.07(2) degrees, and Z = 2.     

Synthesis, crystal structures, luminescent and magnetic properties of homodinuclear lanthanide complexes with a flexible tripodal carboxylate ligand

Six new homodinuclear lanthanide(III) complexes with a flexible tripodal carboxylate ligand (H(3)L), of formulae [Ln(2)L(2)(DMF)(4)]·4DMF (Ln = La (1), Nd (2), Eu (3), Gd (4), Tb (5), Dy (6), DMF = N, N-Dimethylformamide) have been synthesized. Among them, 1, 2, 3, 4, 6 were characterized by single-crystal X-ray diffraction, which crystallized in the monoclinic space group P2(1)/n with a = 13.309(2) ?, b = 27.404(4) ?, c = 16.686(3) ?, β = 105.115(2) and V = 5875.2(17) ?(3) for 1, a = 13.3016(5) ?, b = 27.1952(12) ?, c = 16.6339(7) ?, β = 105.030(2) and V = 5811.3(4) ?(3) for 2, a = 13.2797(10) ?, b = 27.072(2) ?, c = 16.6564(13) ?, β = 104.9390(10) and V = 5785.7(8) ?(3) for 3, a = 13.2855(3) ?, b = 27.0074(6) ?, c = 16.6357(3) ?, β = 104.9790(10) and V = 5766.2(2) ?(3) for 4, a = 13.2837(5) ?, b = 26.9105(10) ?, c = 16.6066(6) ?, β = 104.917(2) and V = 5736.3(4) ?(3) for 6. The crystal structures reveal that these complexes are isostructural, and molecules are connected from 0D to 3D supramolecular structures by hydrogen bonds. All of them were characterized by elemental analysis, IR spectroscopy, XRD and TGA. Unusually, non-luminescent Tb(III) complex was obtained. The photophysical property of the Eu(III) complex and the magnetic property of Gd(III) complex are investigated and discussed in detail.     

Utility of Arylamido Ligands in Yttrium and Lanthanide Chemistry(1)

The reactivity of KNHAr reagents (Ar = C(6)H(5), C(6)H(3)Me(2)-2,6, C(6)H(3)(i)Pr(2)-2,6) with lanthanide and yttrium trichlorides has been investigated. With the larger metals Nd and Sm and the smaller 2,6-dimethyl-substituted ligand, the bimetallic dianionic complexes [K(THF)(6)](2)[Ln(&mgr;-NHC(6)H(3)Me(2)-2,6)(NHC(6)H(3)Me(2)-2,6)(3)](2) (Ln: Sm, 1a; Nd, 1b) are isolated as the potassium salts. Under the same reaction conditions YCl(3) forms a bimetallic anion which retains chloride: [K(DME)(2)(THF)(3)][Y(2)(&mgr;-NHC(6)H(3)Me(2)-2,6)(2)(&mgr;-Cl)(NHC(6)H(3)Me(2)-2,6)(4)(THF)(2)], 2. With the larger 2,6-diisopropyl ligands, neutral complexes are isolated in both solvated monometallic and unsolvated bimetallic forms. With Nd, a distorted octahedral trisolvate, Nd(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(3), 3, was obtained, whereas with Yb and Y the trigonal bipyramidal disolvates, Ln(NHC(6)H(3)(i)Pr(2)-2,6)(3)(THF)(2) (Ln: Yb, 4a; Y, 4b), were isolated. THF-free complexes of the NHC(6)H(3)(i)Pr(2)-2,6 ligand are available by reacting the amine NH(2)C(6)H(3)(i)Pr(2)-2,6 with Ln[N(SiMe(3))(2)](3) complexes. By this route, the dimers [Ln(&mgr;-NHC(6)H(3)(i)Pr(2)-2,6)(NHC(6)H(3)(i)Pr(2)-2,6)(2)](2) (Ln: Yb, 5a; Y, 5b) were isolated. The reaction of the unsubstituted arylamido salt KNHC(6)H(5) with NdCl(3) produced an insoluble material which was characterized as [Nd(NHC(6)H(5))(3)(KCl)(3)], 6. 6 reacted with Al(2)Me(6) in hexanes and produced a heteroleptic mixed-metal complex {[Me(2)Al(&mgr;-Me(2))](2)Nd(&mgr;(3)-NC(6)H(5))(&mgr;-Me)AlMe}(2), 7, and the trimeric aluminum arylamido complex [Me(2)Al(&mgr;-NHC(6)H(5))](3), 8. The solvent of crystallization and relevant crystallographic data for the compounds identified by X-ray analysis follow: 1a,THF, 156 K, P2(1)/n, a = 12.985(2) ?, b = 27.122(5) ?, c = 17.935(3) ?, beta = 100.19(1) degrees, V = 6216(1) ?(3), Z = 2, 6148 reflections (I > 3sigma(I)), R(F)() = 7.1%; 1b,THF, 156 K, P2(1)/n, a = 12.998(2) ?, b = 27.058(3) ?, c = 17.962(2) ?, beta = 99.74(1) degrees, V = 6225(1) ?(3), Z = 2; 2,DME/hexanes, P2(1)/n, a = 23.335(2) ?, b = 12.649(1) ?, c = 27.175(3) ?, beta = 96.36(1) degrees, V = 7971(1) ?(3), Z = 4, 2788 reflections (I > 3sigma(I)), R(F)() = 9.5%; 3, THF, P2(1), a = 12.898(1) ?, b = 16.945(1) ?, c = 13.290(1) ?, beta = 118.64(2) degrees, V = 2549.3(3) ?(3), Z = 2, 3414 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4a, hexanes, P2(1), a = 9.718(2) ?, b = 19.119(3) ?, c = 12.640(2) ?, beta = 112.08(1) degrees, V = 2176.3(6) ?(3), Z = 2, 2933 reflections (I > 3sigma(I)), R(F)() = 4.3%; 4b, hexanes, 158 K, a = 9.729(2) ?, b = 19.095(5) ?, c = 12.744(1) ?, beta = 112.11(1) degrees, V = 2193.4(6) ?(3); 5b, hot toluene, 158 K, P2(1), a =19.218(9) ?, b = 9.375(3) ?, c = 19.820(5) ?, beta = 110.25(2) degrees, V = 3350(2)?(3), Z = 2, 1718 reflections (I > 2sigma (I)), R1 = 9.7%; 7, hexanes, 156 K, P&onemacr;, a = 9.618(3) ?, b = 12.738(4) ?, c = 9.608(3) ?, alpha = 99.32(1) degrees, beta = 108.87(1) degrees, gamma = 94.23(1) degrees, V = 1089.1(6) ?(3), Z = 2, 2976 reflections (I > 3sigma(I)), R(F)() = 3.9%; 8, hexanes, 156 K, Pcab, a = 23.510(5) ?, b = 25.462(5) ?, c = 8.668(2) ?, V = 5188(1) ?(3), Z = 8, 1386 reflections (I > 3sigma(I)), R(F)() = 5.7%.     

3,5-二(4-甲基苯基)吡啶的Suzuki偶联合成及其光学性能

以3,5-二溴吡啶和对甲基苯硼酸为原料,醋酸钯为催化剂,经Suzuki偶联反应合成了3,5-二(4-甲基苯基)吡啶(1),收率73%,其结构和性能经¹H NMR, ¹³C NMR, IR, 元素分析, UV-Vis, FL和X-射线单晶衍射表征。结果表明：1（CCDC: 1509844）属正交晶系,空间群P2₁2₁2₁,晶胞参数a=6.447 8(12) , b=7.240 2(14) , c=29.890 0(6) ,β=90°。1为非平面刚性共轭分子,荧光量子产率13.9%。     

Donor-Free Alkali Metal Thiolates: Synthesis and Structure of Dimeric, Trimeric, and Tetrameric Complexes with Sterically Encumbered Terphenyl Substituents

The synthesis and characterization of the tetrameric lithium thiolate (LiSC(6)H(2)-2,4,6-Ph(3))(4).C(7)H(8) (1), the trimeric lithium thiolate (LiSC(6)H(3)-2,6-Mes(2))(3).C(6)H(14)()()(2) (Mes = 2,4,6-Me(3)C(6)H(2)), the thiol HSC(6)H(3)-2,6-Trip(2) (3) (Trip = 2,4,6-i-Pr(3)C(6)H(2)), and the complete alkali metal series of dimeric thiolates (MSC(6)H(3)-2,6-Trip(2))(2) (M = Li (4, 5), Na (6), K (7), Rb (8), Cs (9)) are described. The compounds were characterized by (1)H, (7)Li, and (13)C NMR and IR spectroscopy and by X-ray crystallography. The compounds 1 and 2 crystallize as four- and three-rung ladder framework structures. The compounds 4-9 crystallize as dimers with M(2)S(2) cores. In addition, the metal ions interact with the ortho aryl groups to varying degrees in all the structures. The extent of these interactions appears to be determined mainly by ionic sizes and geometric factors. The coordination geometry of the thiolato sulfurs also varies from pyramidal in 1, 2, 4, 5, and 6 and one planar and one slightly pyramidal sulfur geometry in 7 to both sulfurs being planar coordinated in 8 and 9. Crystal data at 130 K are as follows: (LiSC(6)H(2)-2,4,6-Ph(3))(4).C(7)H(8) (1), a = 15.961(2) ?, b = 16.243(3) ?, c = 17.114(3) ?, alpha = 89.375(14) degrees, beta = 85.334(14) degrees, gamma = 63.343(12) degrees, V = 3950(1) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.082; (LiSC(6)H(3)-2,6-Mes(2))(3).C(6)H(14)()()(2), a = 14.554(4) ?, b = 14.010(4) ?, c = 32.832(8) ?, beta = 95.20(2) degrees, V = 6667(2) ?(3), space group P2(1)/n, Z = 4, R(1) = 0.089; HSC(6)H(3)-2,6-Trip(2) (3), a = 8.180(2) ?, b = 25.437(5) ?, c = 15.752(3) ?, V = 3278(1) ?(3), space group Pnma, Z = 4, R(1) = 0.045; (LiC(6)H(3)-2,6-Trip(2))(2) (4), a = 12.652(2) ?, b = 14.218(1) ?, c = 18.713(2) ?, alpha = 83.56(1) degrees, beta = 84.36(1) degrees, gamma = 73.82(1) degrees, V = 3205(1) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.055; (LiC(6)H(3)-2,6-Trip(2))(2).C(7)H(8) (5), a = 15.383(3) ?, b = 14.381(2) ?, c = 16.524(2) ?, beta = 111.10(1), V = 3410.3(9) ?(3), space group P2(1)/n, Z = 2, R(1) = 0.086; (NaSC(6)H(3)-2,6-Trip(2))(2).0.5C(7)H(8) (6), a = 13.952(2) ?, b = 20.267(2) ?, c = 24.475(3) ?, beta = 98.673(9) degrees, V = 6842(1) ?(3), space group P2(1)/n, Z = 4, R(1) = 0.068; (KSC(6)H(3)-2,6-Trip(2))(2).C(7)H(8) (7), a = 13.683(4) ?, b = 15.071(4) ?, c = 17.824(5) ?, alpha = 82.73(2), beta = 86.09(2), gamma = 88.46(2), V = 3637(2) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.072; (RbSC(6)H(3)-2,6-Trip(2))(2).C(7)H(8) (8), a = 19.710(3) ?, b = 20.892(3) ?, c = 18.755(2) ?, beta = 106.900(9) degrees, V = 7389(2) ?(3), space group P2(1)/n, Z = 4, R(1) = 0.069; (CsSC(6)H(3)-2,6-Trip(2))(2) (9), a = 13.109(3) ?, b = 15.941(3) ?, c = 17.748(4) ?, alpha = 101.65(2) degrees, beta = 100.76(2) degrees, gamma = 104.25(2) degrees, V = 3410(1) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.048.     

Structural Chemistry of Poly(ethylene glycol) Complexes of Lead(II) Nitrate and Lead(II) Bromide

The reaction of 1:1 stoichiometries (1:1.5 for the nitrate/tetraethylene glycol (EO4) and pentaethylene glycol (EO5) complexes) of PbX(2) (X = NO(3), Br) with five- to eight-donor poly(ethylene glycols) (PEGs) in 3:1 CH(3)CN/CH(3)OH (CH(3)CN only for the nitrate/EO5 complex) followed by solvent evaporation resulted in six crystalline materials upon which X-ray structural analyses were carried out: [Pb(NO(3))(2)(EO4)](n)(), [Pb(NO(3))(2)(EO5)], [Pb(NO(3))(2)(EO6)], [PbBr(EO5)(&mgr;-Br)PbBr(2)].H(2)O, [PbBr(NCMe)(EO6)](2)[PbBr(2)(EO6)][PbBr(3)](2), and [PbBr(EO7)][PbBr(3)]. The nitrates crystallize as tight ion pairs with the PEG ligands coordinating in an equatorial plane around the Pb(2+) ions. Because EO4 has only five oxygen donors, this complex exhibits steric unsaturation which is overcome by a monodentate interaction with a third nitrate anion that is also coordinated to a neighboring Pb(2+) ion. The six donors of EO5 coordinate in an equatorial plane resulting in a 10-coordinate complex with trans, twisted, bidentate nitrate anions. The seven-donor hexaethylene glycol (EO6) only uses six of its oxygen donors to coordinate Pb(2+). [Pb(NO(3))(2)(EO4)](n)() is monoclinic, P2(1)/c, with a = 7.902(3) ?, b = 22.136(6) ?, c = 8.910(2) ?, beta = 90.96(3) degrees, and Z = 4. [Pb(NO(3))(2)(EO5)] is triclinic P&onemacr;, with a = 9.332(3) ?, b = 10.025(3) ?, c = 11.688(4) ?, alpha = 68.41(3) degrees, beta = 68.39(3) degrees, gamma = 68.58(3) degrees, and Z = 2. [Pb(NO(3))(2)(EO6)] is monoclinic P2(1)/c, with a = 16.289(4) ?, b = 10.773(4) ?, c = 12.329(4) ?, beta = 106.77(2) degrees, and Z = 4. Lead(II) bromide complexes with PEGs tend to crystallize as PEG complexed cations with polymeric lead(II) bromide anions. In the EO5 complex, bromide anions in the polymer also coordinate to the PEG-wrapped Pb(2+) cations. The hexa- and heptaethylene glycol (EO6 and EO7, respectively) complexes contain discreet ions. In these halide complexes, EO7 is the only PEG to expand the Pb(2+) coordination number from eight to nine. [PbBr(EO5)(&mgr;-Br)PbBr(2)].H(2)O is triclinic P&onemacr;, with a = 7.922(6) ?,b = 15.802(9) ?, c = 19.001(9) ?, alpha = 73.19(8) degrees, beta = 88.91(9) degrees, gamma = 87.22(9) degrees, and Z = 4. [PbBr(NCMe)(EO6)](2)[PbBr(2)(EO6)][PbBr(3)](2) is monoclinic P2(1)/c, with a = 14.389(4) ?, b = 31.931(9) ?, c = 8.029(2) ?, beta = 97.76(3) degrees, and Z = 2. [PbBr(EO7)][PbBr(3)] is monoclinic Cc, with a = 13.165(3) ?, b = 24.732(5) ?, c = 8.007(1) ?, beta = 94.58(2) degrees, and Z = 4.     

Synthesis, characterization and magnetic properties of four new organically templated metal sulfates [C5H14N2][M(II)(H2O)6](SO4)2, (M(II) = Mn, Fe, Co, Ni)

A series of novel organically templated metal sulfates, [C(5)H(14)N(2)][M(II)(H(2)O)(6)](SO(4))(2) with (M(II) = Mn (1), Fe (2), Co (3) and Ni (4)), have been successfully synthesized by slow evaporation and characterized by single-crystal X-ray diffraction as well as with infrared spectroscopy, thermogravimetric analysis and magnetic measurements. All compounds were prepared using a racemic source of the 2-methylpiperazine and they crystallized in the monoclinic systems, P2(1)/n for (1, 3) and P2(1)/c for (2,4). Crystal data are as follows: [C(5)H(14)N(2)][Mn(H(2)O)(6)](SO(4))(2), a = 6.6385(10) ?, b = 11.0448(2) ?, c = 12.6418(2) ?, β = 101.903(10)°, V = 906.98(3) ?(3), Z = 2; [C(5)H(14)N(2)][Fe(H(2)O)(6)](SO(4))(2), a = 10.9273(2) ?, b = 7.8620(10) ?, c = 11.7845(3) ?, β = 116.733(10)°, V = 904.20(3) ?(3), Z = 2; [C(5)H(14)N(2)][Co(H(2)O)(6)](SO(4))(2), a = 6.5710(2) ?, b = 10.9078(3) ?, c = 12.5518(3) ?, β = 101.547(2)°, V = 881.44(4) ?(3), Z = 2; [C(5)H(14)N(2)][Ni(H(2)O)(6)](SO(4))(2), a = 10.8328(2) ?, b = 7.8443(10) ?, c = 11.6790(2) ?, β = 116.826(10)°, V = 885.63(2) ?(3), Z = 2. The three-dimensional structure networks for these compounds consist of isolated [M(II)(H(2)O)(6)](2+) and [C(5)H(14)N(2)](2+) cations and (SO(4))(2-) anions linked by hydrogen-bonds only. The use of racemic 2-methylpiperazine results in crystallographic disorder of the amines and creation of inversion centers. The magnetic measurements indicate that the Mn complex (1) is paramagnetic, while compounds 2, 3 and 4, (M(II) = Fe, Co, Ni respectively) exhibit single ion anisotropy.     

Stabilizing Heterobimetallic Complexes Containing Unsupported Ti-M Bonds (M = Fe, Ru, Co): The Nature of Ti-M Donor-Acceptor Bonds

The stabilization of unsupported Ti-M (M = Fe, Ru, Co) heterodinuclear complexes has been achieved by use of amidotitanium building blocks containing tripodal amido ligands. Salt metathesis of H(3)CC(CH(2)NSiMe(3))(3)TiX (1) and C(6)H(5)C(CH(2)NSiMe(3))(3)TiX (2) as well as HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)TiX (3) (X = Cl, a; Br, b) with K[M(CO)(2)Cp] (M = Fe, Ru) and Na[Co(CO)(3)(PR(3))] (R = Ph, Tol) gave the corresponding stable heterobimetallic complexes of which H(3)CC(CH(2)NSiMe(3))(3)Ti-M(CO)(2)Cp (M = Fe, 6; Ru, 7) and HC{SiMe(2)N(4-CH(3)C(6)H(4))}(3)Ti-M(CO)(2)Cp (M = Fe, 12; Ru, 13) have been characterized by X-ray crystallography. 6: monoclinic, P2(1)/n, a = 15.496(3) ?, b = 12.983(3) ?, c = 29.219(3) ?, beta = 104.52(2) degrees, Z = 8, V = 5690.71 ?(3), R = 0.070. 7: monoclinic, P2(1)/c, a = 12.977(3) ?, b = 12.084(3) ?, c = 18.217(3) ?, beta = 91.33(2) degrees, Z = 4, V = 2855.91 ?(3), R = 0.048. 12: monoclinic, I2/c, a = 24.660(4) ?, b = 15.452(3) ?, c = 20.631(4) ?, beta = 103.64(3) degrees, Z = 8, V = 7639.65 ?(3), R = 0.079. 13: monoclinic, I2/c, a = 24.473(3) ?, b = 15.417(3) ?, c = 20.783(4) ?, beta = 104.20(2) degrees, Z = 8, V = 7601.84 ?(3), R = 0.066. (1)H- and (13)C-NMR studies in solution indicate free internal rotation of the molecular fragments around the Ti-M bonds. Fenske-Hall calculations performed on the idealized system HC(CH(2)NH)(3)Ti-Fe(CO)(2)Cp (6x) have revealed a significant degree of pi-donor-acceptor interaction between the two metal fragments reinforcing the Ti-Fe sigma-bond. Due to the availability of energetically low-lying pi-acceptor orbitals at the Ti center this partial multiple bonding is more pronounced that in the tin analogue HC(CH(2)NH)(3)Sn-Fe(CO)(2)Cp (15x) in which an N-Sn sigma-orbital may act as pi-acceptor orbital.     

Carboracycles: Macrocyclic Compounds Composed of Carborane Icosahedra Linked by Organic Bridging Groups

A family of macrocyclic compounds are described, together with their precursors. These cycles are composed of icosahedral carboranes linked via their carbon vertices through 1,3-trimethylene, alpha,alpha'-1,3-xylylene, or alpha,alpha'-2,6-lutidylene groups. The compounds cyclo-(1,3-trimethylene-1',2'-closo-1',2'-C(2)B(10)H(10))(4) (6a), cyclo-(1,3-trimethylene-1',2'-closo-9',12'-dimethyl-1',2'-C(2)B(10)H(8))(4) (6b), cyclo-(1,3-trimethylene-1',2'-closo-1',2'-C(2)B(10)H(10))(3) (9), cyclo-(alpha,alpha'-1,3-xylylene-1',2'-closo-1',2'-C(2)B(10)H(10))(2) (11a), cyclo-(alpha,alpha'-1,3-xylylene-1',7'-closo-1',7'-C(2)B(10)H(10))(2) (11b), cyclo-(alpha,alpha'-1,3-xylylene-1',7'-closo-9',10'-dimethyl-1,7-C(2)B(10)H(8))(2) (11c), cyclo-(alpha,alpha'-1,3-xylylene-1',2'-closo-1',2'-C(2)B(10)H(10))(4) (12), cyclo-(alpha,alpha'-1,3-xylylene-1',7'-closo-1',7'-C(2)B(10)H(10))(3) (13), cyclo-(alpha,alpha'-2,6-lutidylene-1',7'-closo-1',7'-C(2)B(10)H(10))(2) (19), and cyclo-(alpha,alpha'-2,6-lutidylene N-oxide-1',7'-closo-1',7'-C(2)B(10)H(10))(2) (20) have been synthesized. The structures of 6a, 6b, 9, 11a, 11b, 11c, 12, and 19 have been determined by X-ray crystallography. Crystal data: for 6a, triclinic, space group P&onemacr;, a = 11.131(2) ?, b = 12.642(2) ?, c = 12.996(2) ?, alpha = 84.383(6) degrees, beta = 65.884(6) degrees, gamma = 97.292(5) degrees, Z = 1, R = 0.079; for 6b, monoclinic, space group P2(1)/a, a = 13.500(2) ?, b = 31.141(3) ?, c = 13.831(2) ?, beta = 99.90(1) degrees, Z = 2, R = 0.097; for 11a, monoclinic, space group C2/c, a = 14.5682(8) ?, b = 14.5046(8) ?, c = 16.1998(8) ?, beta = 95.631(2) degrees, Z = 4, R = 0.081; for 11b, monoclinic, space group P2(1)/n, a = 11.650(2) ?, b = 10.606(2) ?, c = 11.730(2) ?, beta = 104.951(6) degrees, Z = 2, R = 0.069; for 11c, orthorhombic, space group Pbca, a = 12.532(2) ?, b = 14.271(2) ?, c = 18.143(3) ?, Z = 4, R = 0.076; for 19, orthorhombic, space group Pcab (No. 61, standard setting Pbca), a = 11.0428(6) ?, b = 11.3785(6) ?, c = 22.533(1) ?, Z = 4, R = 0.074.     

Photochemical Synthesis of (eta(6)-Arene)chromium Hydrido Stannyl and (eta(6)-Arene)chromium Bis(stannyl) Complexes

Photolysis of (eta(6)-arene)Cr(CO)(3) complexes and HSnPh(3) in aromatic solvents at room temperature has led to two classes of complexes: hydrido stannyl compounds containing the eta(2)-H-SnPh(3) ligand and bis(stannyl) compounds containing two SnPh(3) ligands. The ratio between the two complexes simultaneously produced depends on the choice of the arene. Complexes with different arenes (mesitylene, toluene, benzene, fluorobenzene, and difluorobenzene) have been obtained and characterized including X-ray structures for (eta(6)-C(6)H(3)(CH(3))(3))Cr(CO)(2)(H)(SnPh(3)) (1a), (eta(6)-C(6)H(3)(CH(3))(3))Cr(CO)(2)(SnPh(3))(2) (1b), (eta(6)-C(6)H(5)F)Cr(CO)(2)(SnPh(3))(2) (4b), and (eta(6)-C(6)H(4)F(2))Cr(CO)(2)(SnPh(3))(2) (5b). X-ray crystallography of the last three compounds has given the following results: 1b, monoclinic, space group P2(1)/c (No. 14), a = 13.905(4) ?, b = 18.499(2) ?, c = 17.708(2) ?, Z = 4, V = 4285(1) ?(3); 4b, orthorhombic, space group Pca2(1) (No. 29), a = 16.717(2) ?, b = 18.453(2) ?, c = 25.766(2) ?, Z = 8, V = 7948(2) ?(3); 5b, monoclinic, space group P2(1)/c (No. 14), a = 13.756(2) ?, b = 18.560(2) ?, c = 17.159(2) ?, Z = 4, V = 4372(2) ?(3). The relatively high J((119)Sn-Cr-H) and J((117)Sn-Cr-H) values as well as the X-ray structural data provide evidence for the existence of three-center two-electron bonds in the hydrido stannyl complexes. The (1)H NMR data of the complexes are compared with chromium-arene bond distances, and a sensible trend is observed and discussed.     

Diverse closed cavities in condensed rare earth metal-chalcogenide matrixes: Cs[Lu7Q11] and (ClCs6)[RE21Q34] (RE = Dy, Ho; Q = S, Se, Te)

Two types of novel ordered chalcogenids Cs[Lu(7)Q(11)] (Q = S, Se) and (ClCs(6))[RE(21)Q(34)] (RE = Dy, Ho; Q = S, Se, Te) were discovered by high-temperature solid state reactions. The structures were characterized by single-crystal X-ray diffraction data. Cs[Lu(7)Q(11)] crystallize in the orthorhombic Cmca (no. 64) with a = 15.228(4)-15.849(7) ?, b = 13.357(3)-13.858(6) ?, c = 18.777(5)-19.509(8) ?, and Z = 8. (ClCs(6))[RE(21)Q(34)] crystallize in the monoclinic C2/m (no. 12) with a = 17.127(2)-18.868(2) ?, b = 19.489(2)-21.578(9) ?, c = 12.988(9)-14.356(2) ?, β = 128.604(2)-128.738(4)°, and Z = 2. Both types of compounds feature 3D RE-Q network structures that embed with dual tricapped cubes Cs(2)@Se(18) in the former or unprecedented matryoshka nesting doll structure cavities of (ClCs(6))@Se(32) in the latter. The band gap, band structure, as well as a structure change trend of the majority of A/RE/Q compounds are presented.     

Reactions of [(eta(6)-arene)RuCl(2)](2) with Aromatic Phosphines Containing Methoxy Groups in 2,6-Positions

Reactions of [(eta(6)-arene)RuCl(2)](2) 1 (arene = p-cymene (a), 1,2,3,4-Me(4)C(6)H(2) (b), 1,2,3-Me(3)C(6)H(2) (c)) with tris(2,6-dimethoxyphenyl)phosphine (TDMPP) led to loss of two molecules of CH(3)Cl to give (eta(6)-arene)Ru[{2-O-C(6)H(3)-6-OMe}(2){C(6)H(3)(OMe)(2)-2,6}], 2a-c, which contains a trihapto ligand (eta(3)-P,O,O) derived from TDMPP, whereas the 1,3,5-Me(3)C(6)H(3) (1d), 1,2,3,5-Me(4)C(6)H(2) (1e), and C(6)Me(6) (1f) complexes did not react with TDMPP. The structures of 2a and 2b were confirmed by X-ray analyses: for 2a, a = 11.691(2) ?, b = 15.228(2) ?, c = 10.320(1) ?, alpha = 95.93(1) degrees, beta = 113.783(9) degrees, gamma = 83.86(1) degrees, triclinic, P&onemacr;, Z = 2, R = 0.051; for 2b, a = 17.79(2) ?, b = 15.43(1) ?, c = 20.93(1) ?, beta = 91.25(8) degrees, monoclinic, P2(1)/n, Z = 8, R = 0.056. Bis(2,6-dimethoxyphenyl)phenylphosphine (BDMPP) reacted with 1a, 1b, and 1d at room temperature to give (eta(6)-arene)RuCl[PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}], 3a,b,d, which contains a dihapto (eta(2)-P,O) ligand derived from BDMPP by an X-ray analysis of 3a: a = 12.33(1) ?, b = 14.246(8) ?, c = 11.236(9) ?, alpha = 91.47(8) degrees, beta = 117.28(6) degrees, gamma = 111.70(6) degrees, triclinic, P&onemacr;, Z = 2, R = 0.040. A similar reaction with 1f recovered the starting materials, but that in refluxing MeCN produced [(eta(6)-C(6)Me(6))Ru[PPh(2-O-C(6)H(3)-6-OMe}(2)], 4f, containing a trihapto (eta(3)-P,O,O) ligand derived from BDMPP. Complex 1d reacted with BDMPP at reflux in MeCN/CH(2)Cl(2) and resulted in a loss of an arene ring to give a five-coordinate complex, Ru[eta(2)-P,O-PPh(2-O-C(6)H(3)-6-OMe){C(6)H(3)(OMe)(2)-2,6}](2)(MeCN), 5. Treatment of (2,6-dimethoxyphenyl)diphenylphosphine (MDMPP) with 1f gave (eta(6)-C(6)Me(6))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe)],6f, and that with 1b gave (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl[eta(2)-P,O-PPh(2)(2-O-C(6)H(3)-6-OMe}], 6b, and (eta(6)-1,2,3,4-Me(4)C(6)H(2))RuCl(2)[eta(1)-P-PPh(2){C(6)H(3)(OMe)(2)-2,6}],7b. The phosphine ligand of 6b acted as a bidentate ligand derived from MDMPP: a = 8.074(4) ?, b = 16.816(3) ?, c = 18.916(4) ?, beta = 94.05(3) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.051. Transformation of 7b to 6b readily occurred accompanying an elimination of MeCl. Reaction of 1a with MDMPP eliminated an arene ring to give the octahedral compound RuCl(2)[eta(2)-P,OMe-PPh(2){C(6)H(3)(MeO)(2)-2,6}](2), 8. An X-ray analysis of 8 showed that two MDMPP ligands were in a cis-position: a = 10.596(14) ?, b = 27.586(12) ?, c = 13.036(8) ?, beta = 108.17(7) degrees, monoclinic, P2(1)/n, Z = 4, R = 0.035.     

Coordination Chemistry of 2,2'-Dipyridyl Diselenide: X-ray Crystal Structures of PySeSePy, [Zn(PySeSePy)Cl(2)], [(PySeSePy)Hg(C(6)F(5))(2)], [Mo(SePy)(2)(CO)(3)], [W(SePy)(2)(CO)(3)], and [Fe(SePy)(2)(CO)(2)] (PySeSePy = C(5)H(4)NSeSeC(5)H(4)N; SePy = [C(5)H(4)N(2-Se)-N,Se])

The coordination chemistry of 2,2'-dipyridyl diselenide (PySeSePy) (2) (C(10)H(8)N(2)Se(2)) has been investigated and its crystal structure has been determined (monoclinic, P2(1)/c, a = 10.129(2) ?, b = 5.7332(12) ?, c = 19.173(3) ?, beta = 101.493(8) degrees, Z = 4). In metal complexes the ligand was found to coordinate in three different modes, as also confirmed by X-ray structure determination. N,N'-coordination was found in the zinc complex [Zn(PySeSePy)Cl(2)] (3) (C(10)H(8)Cl(2)N(2)Se(2)Zn, triclinic, P&onemacr;, a = 7.9430(10) ?, b = 8.147(2) ?, c = 11.999(2) ?, alpha = 93.685(10) degrees, beta = 107.763(10) degrees, gamma = 115.440(10) degrees, Z = 2) and Se,Se'-coordination in the adduct of the ligand with bis(pentafluorophenyl)mercury(II) [PySeSePyHg(C(6)F(5))(2)] (5) (C(10)H(8)F(10)HgN(2)Se(2), monoclinic, P2(1)/n, a = 7.7325(10) ?, b = 5.9974(14) ?, c = 25.573, beta = 98.037(10) degrees, Z = 2), which however displays only weak interactions between selenium and mercury. The reaction of the ligand with norbornadiene carbonyl complexes of molybdenum and tungsten leads to reductive cleavage of the selenium-selenium bond with oxidation of the metal center and concomitant addition of the resulting selenolate to the metal carbonyl fragment. Thus the 7-coordinate complexes [Mo(SePy)(2)(CO)(3)] (6) (C(13)H(8)MoN(2)O(3)Se(2), monoclinic, P2(1)/n, a = 9.319(3) ?, b = 12.886(5) ?, c = 13.231(6) ?, beta = 109.23(3) degrees, Z = 4) and [W(SePy)(2)(CO)(3)] (7) (C(13)H(8)N(2)O(3)Se(2)W, monoclinic, P2(1)/n, a = 9.303(2) ?, b = 12.853(2) ?, c = 13.232(2) ?, beta = 109.270(10) degrees, Z = 4) were obtained. The same N,Se-coordination pattern emerges from the reaction of [Fe(2)(CO)(9)] with (2) leading to [Fe(SePy)(2)(CO)(2)] (8) (C(12)H(8)FeN(2)O(2)Se(2), monoclinic, P&onemacr;, a = 8.6691(14) ?, b = 12.443(2) ?, c = 14.085(2) ?, alpha = 105.811(10) degrees, beta = 107.533(8) degrees, gamma = 92.075(10) degrees, Z = 4).     

Axial Site Occupancy by the Least Electronegative Ligands in Trigonal Bipyramidal Tetraoxyphosphoranes(1)

Analogous to the formation of CH(2)[(t-Bu)(2)C(6)H(2)O](2)P(Ph)(O(2)C(6)Cl(4)) (1), the new bicyclic tetraoxyphosphoranes CH(2)[(t-Bu)(2)C(6)H(2)O](2)P(Et)(O(2)C(6)Cl(4)) (3) and CH(2)[ClC(6)H(3)O](2)P(Ph)(O(2)C(6)Cl(4)) (4) were synthesized by the oxidative addition of the appropriate cyclic phosphines with o-tetrachlorobenzoquinone. For the formation of CH(2)[(t-Bu)(2)C(6)H(2)O](2)P(Ph)(O(2)C(2)Ph(2)) (2), a similar reaction was followed with the use of benzil (PhCOCOPh) in place of o-tetrachlorobenzoquinone. X-ray analysis of 1-3 revealed trigonal bipyramidal geometries and provided evidence for the first series of complexes in the absence of ring strain in which the least electronegative group, ethyl or phenyl, is located in an axial position, in violation of the electronegativity rule. Thus, the two oxygen-containing ring systems occupied two different sets of positions in the trigonal bipyramid (TBP) with the eight-membered rings at diequatorial sites. X-ray analysis of 4 revealed a trigonal bipyramidal geometry with electron-withdrawing chlorine substituents on each ring assumed the more conventional geometry with the rings occupying axial-equatorial positions and the phenyl group located in the remaining equatorial site. The fact that molecular mechanics calculations favorably reproduced the observed geometries suggests that a steric contribution associated with the ring tert-butyl groups for 1-3 is partly responsible in favoring diequatorial ring occupancy for the eight-membered ring. NMR data supported rigid pentacoordinated structures in solution at 23 degrees C. Phosphorane 1 crystallizes in the orthorhombic space group Fdd2 with a = 44.787(5) ?, b = 34.648(8) ?, c = 10.3709(9) ?, and Z = 16. Phosphorane 2 crystallizes in the orthorhombic space group Pna2(1) with a = 20.658(8) ?, b = 10.342(2) ?, c = 19.879(6) ?, and Z = 4. Phosphorane 3 crystallizes in the orthorhombic space group Pcmn with a = 9.807(2) ?, b = 16.632(4) ?, c = 23.355(3) ?, and Z = 4. Phosphorane 4 crystallizes in the monoclinic space group C2/c with a = 35.699(5) ?, b = 12.187(2) ?, c = 14.284(3) ?, beta = 107.08(1) degrees, and Z = 8. The final conventional unweighted residuals are 0.0395 (1), 0.0518 (2), 0.0540 (3), and 0.0868 (4).     

PbMSeO6 (M = Mo and W): new quaternary mixed metal selenites with asymmetric cationic coordination environments

Two new isostructural mixed metal selenites, PbMSeO(6) (M = Mo(6+) or W(6+)), that are only composed of second-order Jahn-Teller (SOJT) distortive cations have been synthesized by standard solid-state reaction techniques using PbO, SeO(2), and MoO(3) (or WO(3)) as reagents. The structures of the reported materials were determined by single-crystal and powder X-ray diffraction. The materials show a three-dimensional framework structure consisting of chains of corner-shared MO(6) octahedra connected by SeO(3) and PbO(8) polyhedra. All of the constituent cations (M(6+), Se(4+), and Pb(2+)) are in distorted environments attributable to second-order Jahn-Teller (SOJT) effects. While the Mo(6+) cations undergo a C(2)-type intraoctahedral distortion toward an edge, the Se(4+) and Pb(2+) cations are in asymmetric coordination environments attributable to their lone pairs. The SeO(3) polyhedra strongly influence the direction of the Mo(6+) intraoctahedral distortion. Infrared spectroscopy, thermogravimetric analysis, the magnitudes of out-of-center distortions, and dipole moment calculations are also presented. Crystal data: PbMoSeO(6), triclinic, space group P-1 (No. 2), with a = 6.8944(6) ?, b = 7.2219(6) ?, c = 10.8294(9) ?, α = 99.751(2)°, β = 99.996(2)°, γ = 90.041(2)°, V = 523.09(8) ?(3), and Z = 2; PbWSeO(6), triclinic, space group P-1 (No. 2), with a = 6.8689(2) ?, b = 7.2398(2) ?, c = 10.9037(3) ?, α = 99.699(4)°, β = 100.348(3)°, γ = 90.139(4)°, V = 525.50(3) ?(3), and Z = 2.     

Gallium and Indium Complexes of Bis(amino thiol) (N(2)S(2)) Ligands

Three methods have been developed to prepare gallium and indium complexes of three tetradentate N(2)S(2) ligands of the general formula M(N(2)S(2))R (M = Ga, In; R = Cl, Br, SCN, O(2)CC(6)H(5)-O,O'). The ancillary ligand (Cl, SCN, O(2)CC(6)H(5)-O,O') was varied with the tetradentate ligand BAT-TM. X-ray crystallography shows that the coordination geometry about the d(10) metal ion is influenced by the steric requirements of the ligands. X-ray crystallography of four molecules results in the following data: GaCl(BAT-TM) (1), formula = C(10)H(22)ClGaN(2)S(2), space group = Pnma, a = 12.387(4) ?, b = 21.116(6) ?, c = 5.986(2) ?, V = 1565.8(9) ?(3), Z = 4; InCl(BAT-TM) (2), formula = C(10)H(22)ClInN(2)S(2), space group = Pnma, a = 12.968(9) ?, b = 29.29(1) ?, c = 5.866(2) ?, V = 1620(2) ?(3), Z = 4; InNCS(BAT-TM) (3), formula = C(11)H(24)ClInN(3)S(3), space group = Pbca, a = 11.812(3) ?, b = 11.679(3) ?, c = 24.238(9) ?, V = 3449.7 (17) ?(3), Z = 8; In(O,O'-O(2)CC(6)H(5))(BAT-TM) (4), formula = C(19)H(29)O(2)InN(2)S(2), space group = P2(1)/n, a = 10.783(2) ?, b = 18.708(4) ?, c = 12.335(4) ?, V = 2321.7(9) ?(3), Z = 4. Proton NMR studies show that the complexes are stable in solution; in polar solvents such as acetonitrile, for certain molecules, two metal-ligand complexes are observed. Similarly, two metal-ligand complexes are seen in NMR data taken in 80% acetonitrile/20% D(2)O (pD = 4.6) mixture. HPLC studies (acetonitrile/50 mM sodium acetate, pH = 4.6) show that the lipophilicity of the ligand determines the retention time of the complex.     

Systematic investigation of zinc aminoalkylphosphonates: influence of the alkyl chain lengths on the structure formation

With the high-throughput (HT) methodology, the bifunctional aminoalkylphosphonic acids (AAPA) linker molecules 2-aminoethyl- (AEPA), 3-aminopropyl- (APPA), and 4-aminobutylphosphonic acid (ABPA) [HO(3)P-C(n)H(2n)-NH(2) (n = 2-4)] and zinc nitrate were used to synthesize new metal phosphonates in order to investigate the influence of the alkyl chain length on the structure formation. The systematic investigations led to one known (ZnO(3)PC(2)H(4)NH(2)) and six new compounds: one using AEPA, three using APPA, and two using ABPA. The crystal structures of five compounds were determined by single crystal X-ray diffraction, using X-ray powder diffraction (XRPD) data as well as structure modeling employing force field methods. For compound 1, Zn(O(3)P-C(2)H(4)-NH(3))(NO(3))(H(2)O) (monoclinic, Cc, a = 4.799(1) ?, b = 29.342(6) ?, c = 5.631(1) ?, β = 91.59(3)°, V = 792.7(3) ?(3), Z = 4), and compound 2, Zn(2)(OH)(O(3)P-C(3)H(6)-NH(3))(NO(3)) (monoclinic, P2/c, a = 12.158(2) ?, b = 5.0315(10) ?, c = 13.952(3) ?, β = 113.23(3)°, V = 784.3(3) ?(3), Z = 2), the structures were determined using single crystal X-ray diffraction data. The crystal structures of [Zn(O(3)P-C(3)H(6)-NH(2))]·H(2)O (3) (monoclinic, P2(1)/c, a = 9.094(2) ?, b = 5.0118(7) ?, c = 16.067(4) ?, β = 90.38(2)°, V = 732.3(2) ?(3), Z = 4) and Zn(O(3)P-C(4)H(8)-NH(2)) (5) (monoclinic, P2(1)/c, a = 8.570(7) ?, b = 8.378(4) ?, c = 9.902(6) ?, β = 90.94(5)°, V = 710.9(8) ?(3), Z = 4) were determined using XRPD data. The structural model for compound 6, Zn(O(3)P-C(4)H(8)-NH(3))(NO(3))(H(2)O), was established using lattice parameters from XRPD data and following crystal structure modeling employing force field methods. The structures depend strongly on the alkyl chain length n. For n = 2 and 4 isoreticular compounds are observed, while n = 3 leads to new structures. Larger amounts of all compounds were obtained employing scale-up syntheses in a conventional oven as well as in a microwave reactor system. In addition, in situ energy dispersive X-ray diffraction (EDXRD) experiments at 130 °C were performed at beamline F3 at HASYLAB, DESY, Hamburg, to investigate the formation of compounds 2 and 3 as well as the phase transformation of 2 into 3 upon addition of NaOH. All compounds were characterized in detail using X-ray powder diffraction, IR/Raman spectroscopy, and thermogravimetric and elemental analysis.     

New Zr(6)MTe(2) (M = Mn, Fe, Co, Ni, Ru, Pt), Zr(6)Fe(0.6)Se(2.4), and Zr(6)Fe(0.57)S(2.43) Intermetallics: Structural Links between Binary (Zr,Hf)(3)M Alloys and Porous Metal-Rich Tellurides

The synthesis of the group IV ternary chalcogenides Zr(6)MTe(2) (M = Mn, Fe, Co, Ni, Ru, Pt) and Zr(6)Fe(1)(-)(x)()Q(2+)(x)() (Q = S, Se) is reported, as are the single-crystal structures of Zr(6)FeTe(2), Zr(6)Fe(0.6)Se(2.4), and Zr(6)Fe(0.57)S(2.43). The structure of Zr(6)FeTe(2) was refined in the hexagonal space group P&sixmacr;2m (No. 189, Z = 1) with lattice parameters a = 7.7515(5) ? and c = 3.6262(6) ?, and the structures of Zr(6)Fe(0.6)Se(2.4) and Zr(6)Fe(0.57)S(2.43) were refined in the orthorhombic space group Pnnm (No. 58, Z = 4) with lattice parameters a = 12.737(2) ?, b = 15.780(2) ?, and c = 3.5809(6) ? and a = 12.519(4) ?, b = 15.436(2) ?, and c = 3.4966(6) ?, respectively. The cell parameters of Mn-, Co-, Ni-, Ru-, and Pt-containing tellurides were also determined. The Zr(6)ZTe(2) compounds are isostructural with Zr(6)CoAl(2), while Zr(6)Fe(1)(-)(x)()Q(2+)(x)() (Q = S, Se) were found to adopt a variant of the Ta(2)P-type structure. Chains of condensed M-centered, tetrakaidecahedra of zirconium constitute the basic structural unit in all these compounds. The modes of cross-linking that give rise to the Zr(6)FeTe(2) and Zr(6)Fe(1)(-)(x)()Q(2+)(x)() structures, differences among the title compounds, and the influence of chalcogen size differences are discussed. The stoichiometric nature of Zr(6)FeTe(2) and its contrast with sulfur and selenium congeners apparently result from a Te-Fe size mismatch. The importance of stabilization of both Zr(6)FeSe(2) and Zr(6)FeTe(2) compounds by polar intermetallic Zr-Fe bonding is underscored by a bonding analysis derived from electronic band structure calculations.     

Synthesis, Characterization, and Crystal Structures of New Dications Bearing the -Se-Se- Bridge

Starting from 1,3-dimethyl-4-imidazoline-2-selone (1), 1,2-bis(2-selenoxo-3-methyl-4-imidazolinyl-2-)ethane (3) and 1,3-dimethylimidazolidine-2-selone (4), the following six compounds, [(C(5)H(8)N(2)Se-)(2)](2+).2Br(-) (I), [(C(5)H(8)N(2)Se-)(2)](2+).2I(-) (II), [(C(5)H(8)N(2)Se-)(2)](2+).Cl(-).I(3)(-) (III) [(C(5)H(10)N(2)Se-)(2)](2+).Br(-).IBr(2)(-) (IV), [(C(5)H(7)N(2)Se-)(2)](2+).I(3)(-).(1)/(2)I(4)(-) (V) and [(C(5)H(7)N(2)Se-)(2)](2+).2I(-).CH(3)CN (VI), in which the selenium compounds are oxidized to dications bearing the uncommon -Se-Se- bridge, have been prepared, and I-V crystallographically characterized. I and III were obtained by reacting 1 with IBr and ICl respectively, while II was obtained by reduction of previously described hypervalent selenium compound of 1 (5) bearing the I-Se-I group with elemental tellurium. These three compounds contain the same [(C(5)H(8)N(2)Se-)(2)](2+) dication balanced by two bromides in I, two iodides in II, and Cl(-) and I(3)(-) in III. However, on the basis of the Se-Cl bond length of 2.778(5) ?, III can also be considered as formed by the [(C(5)H(8)N(2)Se-)(2)Cl](+) cation, with I(3)(-) as counterion. Similarly to III, compound IV, which was obtained by reacting 4 with IBr, can be considered as formed by [(C(5)H(10)N(2)Se-)(2)Br](+) cations and IBr(2)(-) anions. As in II, compound V has been prepared by reduction of the hypervalent selenium compound of 3 (6) bearing two I-Se-I groups with elemental tellurium. In V, the [(C(5)H(7)N(2)Se-)(2)](2+) cation is balanced by I(3)(-) and half I(4)(2-) anions. The structural data show that all the cations are very similar, with Se-Se bond lengths ranging from 2.409(2) to 2.440(2) ?. FT-IR and FT-Raman spectra of I-VI allow one to identify two bands around 230 +/- 10 and 193 +/- 5 cm(-1) that are common to all compounds. These bands are generally strong in the FT-Raman and weak in the FT-IR spectra and should contain a contribution of the nu(Se-Se) stretching vibration. The spectra are also in good agreement with the structural features of the polyhalide anions present in the crystals. Crystallographic data are as follows: I is monoclinic, space group P2(1), with a = 9.849(6) ?, b = 11.298(5) ?, c = 7.862(6) ?, beta = 106.44(2) degrees, Z = 2, and R = 0.0362; II is monoclinic, space group P2(1), with a = 8.063(6) ?, b = 11.535(5) ?, c = 10.280(5) ?, beta = 107.13(2) degrees, Z = 2, and R = 0.0429, III is monoclinic, space group P2(1)/n, with a = 10.431(7) ?, b = 18.073(5) ?, c = 11.223(6) ?, beta = 100.76(2) degrees, Z = 4, and R = 0.0490; IV is monoclinic, space group P2(1)/n, with a = 10.298(5) ?, b = 18.428(7) ?, c = 11.475(6) ?, beta = 104.10(4) degrees, Z = 4, and R = 0.0300; V is triclinic, space group P&onemacr;, with a = 7.456(6) ?, b = 11.988(5) ?, c = 12.508(5) ?, alpha = 79.32(2) degrees, beta = 85.49(2) degrees, gamma = 80.62(2) degrees, Z = 2, and R = 0.0340.     

Synthesis and Structural Studies of Platinum Complexes Containing Monodentate, Bridging, and Chelating Formamidine Ligands

The reactions of K(2)PtCl(4) with N,N'-diphenylformamidine (HDPhF) and N,N'-di-p-tolylformamidine (HDTolF) produce the trans square-planar compounds PtCl(2)(HDPhF)(2), 1a, and PtCl(2)(HDTolF)(2), 1b. Compound 1a crystallizes as yellow parallelepipeds in the space group P2(1)/c with two independent molecules in the asymmetric unit and unit cell dimensions a = 23.427(7) ?, b = 16.677(6) ?, c = 12.980(4) ?, and beta = 96.10(2) degrees. These compounds are soluble in common organic solvents and have been used as starting materials for the preparation of diplatinum compounds. Treatment of 1a and 1b with NaOMe and the halide abstraction reagent TlPF(6) produces the compounds Pt(2)(&mgr;-DArF)(2)(eta(2)-DArF)(2), Ar = Ph (2a) and Tol (2b), respectively. Compound 2a crystallizes as yellow rods in the space group P&onemacr; with unit cell dimensions a = 12.296(3) ?, b = 12.310(4) ?, c = 15.374(4) ?, alpha = 90.75(2) degrees, beta = 91.02(2) degrees, and gamma = 110.20(2) degrees. Compound 2b crystallizes with a molecule of THF, as yellow rods in the space group P2(1)/c with a = 17.883(3) ?, b = 14.517(3) ?, c = 22.581(3) ?, and beta = 98.17(1) degrees. These compounds contain two cis bridging formamidinato ligands and two formamidinato ligands that are chelated to separate Pt centers. Upon heating, they further react to give the tetrabridged compounds Pt(2)(&mgr;-DArF)(4), Ar = Ph (3a), Tol (3b). Compound 3a crystallizes as orange cubes in the cubic space group I432 with a = 19.671(1) ?. On going from the bis-bridged, bis-chelate structure in 2a to the tetrabridged structure in 3a, the metal-metal separation decreases from 2.910(1) to 2.649(1) ?. Both 2band 3b have been oxidized to give the Pt(II)-Pt(III) compound Pt(2)(&mgr;-DTolF)(4)(PF(6)), 4. Compound 4 crystallizes as cubes in the tetragonal space group P4/ncc with a = 14.392(1) ? and c = 14.436(1) ?. The Pt-Pt distance in 4 is 2.5304(6) ?.