共查询到20条相似文献,搜索用时 156 毫秒
1.
Heinrich Lang Bettina Lühmann Roy Buschbeck 《Journal of organometallic chemistry》2004,689(22):3598-3603
A straightforward method for the preparation of metallo carbosiloxanes of type Si(OCH2CH2CH2SiMe2[OCH2PPh2M(CO)n])4 (n = 3, M = Ni, 7a; n = 4, M = Fe, 7b; n = 5: M = Mo, 7c; M = W, 7d), Si(OCH2CH2CH2SiMe[OCH2PPh2Ni(CO)3]2)4 (8) and Me2Si(OCH2CH2CH2SiMe[OCH2PPh2Ni(CO)3]2)2 (11) is described. The reaction of Si(OCH2CH2CH2SiMeXCl)4 (1: X = Me, 2: X = Cl) or Me2Si(OCH2CH2CH2SiMeCl2)2 (9) with HOCH2PPh2 (3) produces Si(OCH2CH2CH2SiMe2(OCH2PPh2))4 (4), Si(OCH2CH2CH2SiMe(OCH2PPh2)2)4 (5) or Me2Si(OCH2CH2CH2SiMe(OCH2PPh2)2)2 (10) in presence of DABCO. Treatment of the latter molecules with Ni(CO)4 (6a), Fe2(CO)9 (6b), M(CO)5(Thf) (6c: M = Mo; 6d: M = W), respectively, gives the title compounds 7a-7d, 8 and 11 in which the PPh2 groups are datively bound to a 16-valence-electron metal carbonyl fragment.The formation of analytical pure and uniform branched and dendritic metallo carbosiloxanes is based on elemental analysis, and IR, 1H, 13C{1H}, 29Si{1H} and 31P{1H} NMR spectroscopic studies. In addition, ESI-TOF mass spectrometric studies were carried out. 相似文献
2.
Reactions of neutral amino phosphine compounds HL1-3 with rare earth metal tris(alkyl)s, Ln(CH2SiMe3)3(THF)2, afforded a new family of organolanthanide complexes, the molecular structures of which are strongly dependent on the ligand framework. Alkane elimination reactions between 2-(CH3NH)-C6H4P(Ph)2 (HL1) and Lu(CH2SiMe3)3(THF)2 at room temperature for 3 h generated mono(alkyl) complex (L1)2Lu(CH2SiMe3)(THF) (1). Similarly, treatment of 2-(C6H5CH2NH)-C6H4P(Ph)2 (HL2) with Lu(CH2SiMe3)3(THF)2 afforded (L2)2Lu(CH2SiMe3)(THF) (2), selectively, which gradually deproportionated to a homoleptic complex (L2)3Lu (3) at room temperature within a week. Strikingly, under the same condition, 2-(2,6-Me2C6H3NH)-C6H4P(Ph)2 (HL3) swiftly reacted with Ln(CH2SiMe3)3(THF)2 at room temperature for 3 h to yield the corresponding lanthanide bis(alkyl) complexes L3Ln(CH2SiMe3)2(THF)n (4a: Ln = Y, n = 2; 4b: Ln = Sc, n = 1; 4c: Ln = Lu, n = 1; 4d: Ln = Yb, n = 1; 4e: Ln = Tm, n = 1) in high yields. All complexes have been well defined and the molecular structures of complexes 1, 2, 3 and 4b-e were confirmed by X-ray diffraction analysis. The scandium bis(alkyl) complex activated by AlEt3 and [Ph3C][B(C6F5)4], was able to catalyze the polymerization of ethylene to afford linear polyethylene. 相似文献
3.
Da Jung Kim Sang-deok Mun Sungwoo YoonChang Hwa Oh Hyoung-Ryun ParkTae-Soo You Junseong Lee Youngjo Kim 《Polyhedron》2011,30(6):1076-1079
Three monomeric boratranes B[(OCH2CH2)nN(CH2CMe2O)3−n] (n = 0, 1; n = 1, 2; n = 2, 3) have been synthesized by the reaction of B(OMe)3 with a series of triethanolateamines such as [(OCH2CH2)nN(CH2CMe2O)3−n]3− (n = 0, L1; n = 1, L2; n = 2, L3), where the number of CMe2 groups adjacent to the OH functionality varied from 3 (L1H3) to 2 (L2H3) to 1 (L3H3). These boratranes 1-3 have been characterized by solution 1H, 13C{1H} and 11B NMR, and the crystal structures of 1 and 2 have been determined by single crystal X-ray diffraction. 相似文献
4.
The organotin (IV) derivatives of 2-mercapto-4-methylpyrimidine (Hmpymt) R3SnL (R = Ph 1, PhCH22, n-Bu 3), R2SnClmLn (m = 1, n = 1, R = CH34, Ph 5, n-Bu 6, PhCH27; m = 0, n = 2, R = CH38, n-Bu 9, Ph 10, PhCH211) were obtained by the reaction of the organotin(IV) chlorides R3SnCl or R2SnCl2 with 2-mercapto-4-methylpyrimidine hydrochloride (HCl · Hmpymt) in 1:1 or 1:2 molar ratio. All complexes 1-11 were characterized by elemental analyses, IR, 1H, 13C and temperature-dependent 119Sn NMR spectra. Except for complexes 3 and 6, the structures of complexes 1, 2, 4, 5, 7, 8-11 were confirmed by X-ray crystallography. Including tin-nitrogen intramolecular interaction, the tin atoms of complexes 1-7 are all five-coordinated and their geometries are distorted trigonal bipyramidal. While the tin atoms of complexes 8-11 are six-coordinated and their geometries are distorted octahedral. Besides, the ligand adopts the different coordination modes to bond to tin atom between the complexes 1, 6, 7 and 2, 3, 4, 5, 8-11. Furthermore, intermolecular Sn?N or Sn?S interactions were recognized in crystal structures of complexes 4, 7 and 11, respectively. 相似文献
5.
A series of new palladacycloalkanes of formula cis-[PdL2(CH2)n] (9. n = 6, L = PPh3; 10. n = 6, L2 = dppe; 11. n = 8, L = PPh3; 12. n = 8, L2 = dppe) have been prepared by two routes. In the first route, the precursor bis(1-alkenyl) complexes cis-[PdL2((CH2)nCHCH2)2] (1. n = 2, L = PPh3, 2. n = 2, L2 = dppe, 3. n = 3, L = PPh3, 4. n = 3, L2 = dppe) were allowed to react with Grubb’s 2nd generation catalyst to give the palladacycloalkenes, cis-[PdL2(CH2)nCHCH(CH2)n] (5. n = 2, L = PPh3, 6. n = 2, L2 = dppe, 7. n = 3, L = PPh3, 8. n = 3, L2 = dppe), which were then hydrogenated to the palladacycloalkanes, 9-12. In the second route, the di-Grignard reagents BrMg(CH2)nMgBr (n = 6, 8) were reacted with the palladium complex [PdCl2(COD)] followed by immediate ligand displacement to form the respective palladacycloalkanes 10 and 12. The complexes obtained were characterized by a range of spectroscopic and analytical techniques. Thermal decomposition studies were carried out on the palladacycloalkanes 9-12 and the main organic products shown to be 1-alkenes and 2-alkenes. 相似文献
6.
José M. Benito F. Javier de la Mata Rafael Gómez Pilar Gómez-Sal 《Journal of organometallic chemistry》2006,691(17):3602-3608
Anilines Gn-{(C6H4)N(SiMe3)2}m, based on simple or dendritic carbosilanes, have been used to synthesized (imido)tantalum compounds Gn-{(C6H4)NTaCl2Cp∗}m (1, n = 0, m = 1; 2, n = 1, m = 4; Cp∗ = η5-C5Me5), by the reaction with [TaCl4Cp∗] and elimination of SiMe3Cl. (Imido)niobocene compounds of general formula (3-5; n = 0, 1, 2; m = 1, 4, 8, respectively) have been readily prepared from their corresponding half-sandwich complexes Gn-{(C6H4)NNbCl2Cp′}m by the reaction with m equiv. of LiCp′ (Cp′ = η5-C5H4SiMe3). Compounds 1-5 are all found to be exceedingly moisture sensitive, and in the case of the (imido)niobocene materials the hydrolytic reaction selectively leads to the formation of (6). The molecular structure of 6 has been determined by X-ray diffraction studies. 相似文献
7.
The reaction of HgCl2 and Te(R)CH2SiMe3 [R = CH2SiMe3 (1), Ph (2)] in ethanol yielded a mononuclear complex [HgCl2{Te(R)CH2SiMe3}2] (R = Ph, 3a; R = CH2SiMe3, 3b). The recrystallization of 3a or 3b from CH2Cl2 produced a dinuclear complex [Hg2Cl2(μ-Cl)2{Te(R)CH2SiMe3}2] (R = Ph, 4a; R = CH2SiMe3, 4b). When 3a was dissolved in CH2Cl2, the solvent quickly removed, and the solid recrystallized from EtOH, a stable ionic [HgCl{Te(Ph)CH2SiMe3}3]Cl·2EtOH (5a·2EtOH) was obtained. Crystals of [HgCl2{Te(CH2SiMe)2}]·2HgCl2·CH2Cl2 (6b·2HgCl2·CH2Cl2) were obtained from the CH2Cl2 solution of 3b upon prolonged standing. The complex formation was monitored by 125Te-, and 199Hg NMR spectroscopy, and the crystal structures of the complexes were determined by single crystal X-ray crystallography. 相似文献
8.
Monomeric titanatrane i-PrOTi(OCMe2CH2)3N (1) and dimeric titanatranes [i-PrOTi(OCH2CH2)nN(CH2CMe2O)3−n]2 (n = 1, 2; n = 2, 3) were synthesized by the reaction of Ti(O-i-Pr)4 with a series of triethanolateamines such as (OCH2CH2)nN(CH2CMe2O)3−n3− (n = 0, Lig1; n = 1, Lig2; n = 2, Lig3), which vary by the number of CMe2 groups adjacent to a OH functionality from 3 (Lig1H3) to 2 (Lig2H3) to 1 (Lig3H3). The resultant titanatranes 1–3 have been characterized by solution 1H and 13C{1H} NMR and their solid state structures have been determined by X-ray crystallography. Whereas compound 1 is monomeric in the solid state, compounds 2 and 3 are dimeric, due to the reduction of the steric congestion in the vicinity of the Ti. 相似文献
9.
Twelve new organotin complexes with 4-sulfanylbenzoic acid of two types: RnSn[S(C6H4COOH)]4−n (I) (n = 3: R = Me 1, n-Bu 2, Ph 3; PhCH24; n = 2: R = Me 5; n-Bu 6, Ph 7, PhCH28) and R3Sn(SC6H4COO)SnR3 · mEtOH (II) (m = 0: R = Me 9, n-Bu 10, PhCH212; m = 2: R = Ph 11), along with the 4,4′-bipy adduct of 9, [Me3Sn(SC6H4COO)SnMe3]2(4,4-bipy) 13, have been synthesized. The coordination behavior of 4-sulfanylbenzoic acid is monodentate in 1-8 by thiol S atom but not carboxylic oxygen atom. While, in 9-13 it behaves as multidenate by both thiol S atom and carboxylic oxygen atoms. The supramolecular structures of 6, 11 and 13 have been found to consist of 1D molecular chains built up by intermolecular O-H?O, C-H?O or C-H?S hydrogen bonds. The supramolecular aggregation of 7 is 2D network determined by two C-H?O hydrogen bonds. Extended intermolecular C-H?O interactions in the crystal lattice of 9 link the molecules into a 2D network. 相似文献
10.
Wen-Qian Geng Hong-Ping Zhou Long-Huai ChengFu-Ying Hao Guo-Yi XuFei-Xia Zhou Zhi-Peng YuZheng Zheng Jian-Qing WangJie-Ying Wu Yu-Peng Tian 《Polyhedron》2012,31(1):738-747
Six novel organotin(IV) carboxylates have been successfully synthesized, namely, the polymer (C6H5)3Sn(L1)∞ (1) [HL1 = 4-imidazolyl benzoic acid], the mononuclear (C6H5)3Sn(L2) (2) [HL2 = 4-pyrazolylbenzoic acid], (C6H5)3Sn(L3)·CH3OH (3) [HL3 = 4-triazolylbenzoic acid] and (C6H5)3Sn(L4) (4) [HL4 = 4-tetrazolyl benzoic acid] and the tetranuclear [(n-Bu2Sn)4(L2)2O2(OCH3)2] (5) and [(n-Bu2Sn)4(L3)2O2(OCH3)2] (6). X-ray diffraction analyses show 1D infinite chain of polymer 1, single molecular structures of isomorphous complexes 2 and 4, single molecule structures of complex 3 containing solvent CH3OH molecule and similar ladder-type structures of complexes 5 and 6. The photoluminescence of ligands and 1-6 were also measured in the solid state at room temperature. 相似文献
11.
A series of organotin(IV) complexes with 2,5-dimercapto-1, 3, 4-thiodiazole (HHdmt) of the type (RnSnClm)2(dmt) (m=0, n=3, R=Ph 1, PhCH22, n-Bu 3; m=1, n=2, R=Ph 4) and [R2Sn(dmt) · L]n (L=0.5C6H6, R=CH35; L=0, n=5, R=n-Bu 6) have been synthesized. All complexes 1-6 were characterized by elemental analysis, IR, 1H and 13C NMR spectra. And except for 3, complexes 1, 2, 4, 5 and 6 were also determined by X-ray crystallography. The tin atoms of complexes 1, 2, 3 and 4 are all five-coordinated. The geometries at tin atoms of 1, 2, 3 and 4 are distorted trigonal bipyramidal. The tin atoms of complexes 5 and 6 are six-coordinated and their geometries are distorted octahedral. 相似文献
12.
Oleg V. Chernov Aleksandr Yu. Smirnov Victor N. Khrustalev 《Journal of organometallic chemistry》2009,694(19):3184-3189
A straightforward method of synthesis of heteroleptic tin (II) alkoxides stabilized by one intramolecular coordination bond was developed. Addition of one equivalent of dimethylamino ethanol to diamide Sn(N(SiMe3)2)2 (5) yields alkoxy-amido derivative Sn(OCH2CH2NMe2)(N(SiMe3)2) (2). Further addition of alcohol leads to corresponding heteroleptic dialkoxides Sn(OCH2CH2NMe2)(OR) (R = Me (6), Et (7), iPr (8), tBu (9), Ph (10)). Catalytic activity of tin (II) compounds in polyurethane formation was tested. 相似文献
13.
Laura Díez Jesús A. Miguel M. Paz Rodríguez-Medina 《Journal of organometallic chemistry》2005,690(2):261-268
The binuclear cyclopalladated compounds [Pd2(μ-OH)2(Ln)2] (1) derived from imines HLn = p-CnH2n + 1O-C6H4-CHN-C6H4-OCnH2n + 1-p (n = 6,10) react with carboxylic acids to give the derivatives [Pd2(μ-ox)2(Ln)2] (2) with a planar core for oxalic acid, and [Pd2(μ-OOCR)2(Ln)2] (3-7) compounds with a non-planar ridge tent structure for other RCOOH acids: (3) R = CmH2m + 1 (m = 1, 3, 5, 7, 9, 11, 13, 15, 17); (4) R = CH2(OCH2CH2)pOCH3 (p = 1, 2); (5) R = CH2-C6H4-OCqH2q + 1-p (q = 2, 4, 6, 8, 10, 12); (6) R = C6H4-OCrH2r + 1-p (r = 4, 10); (7) R = C*H(OH)CH3. The acids used were designed to explore the effect on the thermal properties of the compounds prepared of systematic variations in the type of carboxylato ligand, which induce structure, packing, and polarity changes, and in the length of the carboxylato chain. Most of the complexes prepared, even when far from planar, show liquid crystal behavior and display nematic, smectic A and smectic C phases. 相似文献
14.
Arunabha Thakur Amarnath Chakraborty Manjula Devi 《Journal of organometallic chemistry》2010,695(7):1059-13900
Mono and doubly alkynyl substituted ferrocene complexes, [Fc(CH2OCH2CCH)n], 2-3 (2: n = 1; 3: n = 2; Fc = ferrocene) have been synthesized from the room temperature reaction of mono and 1,1′-dihydroxymethyl ferrocene, Fc(CH2OH)n , 1a-b (1a: n = 1; 1b: n = 2) and propargyl bromide, in modest to good yields. These new ferrocene derivatives have been characterized by mass, IR, 1H, 13C NMR spectroscopy, and molecular structures of compound 2 and 3 were unequivocally established by single crystal X-ray diffraction study. The crystal structure analysis revealed that 2 and 3 consist of infinite 1D zig-zag hydrogen bonded chains and 2D microporous hydrogen bonded network of molecules, linked by intermolecular C-H···O hydrogen bonding. The molecular structures of both 2 and 3 are further stabilized by C-H···π interactions. 相似文献
15.
Treatment of (C5H4SiMe2tBu)2LnR with 1 equiv of elemental sulfur in toluene at ambient temperature gives dimeric complexes [(C5H4SiMe2tBu)2Ln(μ-SR)]2 [R = Me, Ln = Yb (1), Er (2), Dy (3), Y (4); R = nBu, Ln = Yb (5), Dy (6)]. All these complexes have been characterized by elemental analysis, IR and mass spectroscopies. The structures of complexes 1, 3, 5 and 6 are also determined through X-ray single crystal diffraction analysis, indicating that only one sulfur atom from elemental sulfur inserts into Ln–C σ-bond. 相似文献
16.
Meisu Zhou 《Journal of organometallic chemistry》2007,692(23):5195-5202
Equivalent addition reactions of PhN(Li)SiMe3 to nitriles, RCN (R = dimethylamido, 1-piperidino), generated non-symmetric guanidinato lithium [(Et2O)LiN(SiMe3)C(NMe2)N(Ph)]2 (1) or [(THF)LiN(SiMe3)C(NMe2)N(Ph)]2 (2) and [(Et2O)LiN(SiMe3)C(N(CH2)5)N(Ph)]2 (5) which further reacted with zirconium or hafnium tetrachloride to form Zr and Hf guanidinato complexes with the general formula [PhNC(R)NSiMe3]3MCl (R = dimethylamido, M = Zr (3), Hf (4); R = 1-piperidino, M = Zr (6), Hf (7)). Complexes 1-4, 6 and 7 were well characterized by 1H, 13C NMR and microanalysis, the single crystal X-ray diffraction analysis data for complexes 1, 3, 4 and 7 were also provided. Furthermore, complexes 3, 4, 6 and 7 were found to be active for ethylene polymerization. The influences of cocatalyst, pressure, reaction temperature and Al/M ratio on activity were investigated. 相似文献
17.
Ivan A. Portnyagin 《Journal of organometallic chemistry》2009,694(19):3149-8653
A series of germylene and stannylene (Me2NCH2CH2O)2E (E = Ge, 1; E = Sn, 2) complexes of group 6 metals and iron carbonyls L·M(CO)n (M = Cr, Mo, W, n = 5 (3-8), n = 4 (9, 10); M = Fe, n = 4 (11, 12)) were prepared. These complexes were characterized by 1H, 13C NMR, FTIR and elemental analysis. Ligand properties of 1 and 2 were compared to PPh3 and dmiy (N,N′-dimethylimidazolin-2-ylidene) using theoretical calculations (PBE/TZ2P) and FTIR. Ligand dissociation energies increase in the order Ph3P < 2∼1 < dmiy, while donor strength rise in the order PPh3 < dmiy < 2 < 1. 相似文献
18.
Antonio Antiñolo Rafael Fernández-Galán Antonio Otero Ana M. Rodríguez 《Journal of organometallic chemistry》2009,694(13):1959-3497
The allyl-substituted group 4 metal complexes [M{(R)CH(η5-C5Me4)(η5-C5H4)}Cl2] [M = Ti, R = CH2CHCH2, (2); R = CH2C(CH3)CH2 (3); M = Zr, R = CH2CHCH2 (4), R = CH2C(CH3)CH2 (5)] have been synthesized by the reaction of allyl ansa-magnesocene derivatives and the tetrachloride salts of the corresponding transition metal. The dialkyl complexes ] [M = Ti, R = CH2=CHCH2, R′ = Me (6), R′ = CH2Ph (7); R = CH2C(CH3)CH2, R′ = Me (8), R′ = CH2Ph (9); M = Zr, R = CH2CHCH2, R′ = Me (10), R′ = CH2Ph (11); R = CH2C(CH3)CH2, R′ = Me (12), R′ = CH2Ph (13)] have been synthesized by the reaction of the corresponding ansa-metallocene dichloride complexes 2-5 and two molar equivalents of the alkyl Grignard reagent. Compounds 2-5 reacted with H2 under catalytic conditions (Wilkinson’s catalyst or Pd/C) to give the hydrogenation products [M{(R)CH(η5-C5Me4)(η5-C5H4)}Cl2] [M = Ti and R = CH2CH2CH3 (14) or R = CH2CH(CH3)2 (15); M = Zr and R = CH2CH2CH3 (16) or R = CH2CH(CH3)2 (17)]. The reactivity of 2-5 has also been tested in hydroboration and hydrosilylation reactions. The hydroboration reactions of 3, 4 and 5 with 9-borabicyclo[3.3.1]nonane (9-BBN) yielded the complexes [M{(9-BBN)CH2CH(R)CH2CH(η5-C5Me4)(η5-C5H4)}Cl2] [M = Ti and R = H (18); M = Zr and R = H (19) or R = CH3 (20)]. The reaction with the silane reagents HSiMe2Cl gave the corresponding [M{ClMe2SiCH2CHRCH2CH(η5-C5Me4)(η5-C5H4)}Cl2] [M = Ti and R = H (21); M = Zr and R = H (22) or R = CH3 (23)]. The reaction of 22 with t-BuMe2SiOH produced a new complex [Zr{t-BuMe2SiOSi(Me2)CH2CH2CH2CH(η5-C5Me4)(η5-C5H4)}Cl2] (24) through the formation of Si-O-Si bonds. On the other hand, reactivity studies of some zirconocene complexes were carried out, with the insertion reaction of phenyl isocyanate (PhNCO) into the zirconium-carbon σ-bond of [Zr{(n-Bu)CH(η5-C5Me4)(η5-C5H4)}2Me2] (25) giving [{(n-Bu)CH(η5-C5Me4)(η5-C5H4)]}Zr{Me{κ2-O,N-OC(Me)NPh}] as a mixture of two isomers 26a-b. The reaction of [Zr{(n-Bu)(H)C(η5-C5Me4)(η5-C5H4)}(CH2Ph)2] (27) with CO also provided a mixture of two isomers [{(n-Bu)CH(η5-C5Me4)(η5-C5H4)]}Zr(CH2Ph){κ2-O,C-COCH2Ph}] 28a-b. The molecular structures of 4, 11, 16 and 17 have been determined by single-crystal X-ray diffraction studies. 相似文献
19.
Laurence Bourget-Merle 《Journal of organometallic chemistry》2004,689(24):4357-4365
The metal β-diketiminato ligand-to-metal binding modes are briefly reviewed, with reference particularly to our previous work on metal complexes using the ligands [{N(R1)C(R2)}2CH] (R1 = SiMe3 = R and R2 = Ph; or R1 = C6H3Pri2-2,6 and R2 = Me). The syntheses of the β-diketimines H[{N(R)C(Ar)}2CH] 1 (Ar = Ph) and 2 (Ar = C6H4Me-4) and the ansa-CH2-bridged bis(β-diketimine)s 3 (Ar = Ph) and 4 (Ar = C6H4Me-4) are reported. Thus, from the appropriate compound Li[{N(R)C(Ar)}2CH] and H2O, (CH2Br)2 or CH2Br2 the product was 2, 3 or 4. Compound 1 was prepared from K[{N(R)C(Ph)}2CH] and (CH2Br)2. Each of 3 or 4 with LiBun surprisingly yielded the bicyclic dilithium compound 5 (Ar = Ph) or 6 (Ar = C6H4Me-4) in which each of the β-diketiminato fragments is an N,N′-bridge between the two lithium atoms and the CH2 moiety joins the two ligands through their central carbon atoms. However, 4 with AlMe3 yielded the expected ansa-CH2-bridged-bis[(β-diketiminato)(dimethyl)alane] 7, which was also obtained from 6 and Al(Cl)Me2. X-ray structures of the known compounds 2 and 3, and of 5, 6 and 7 are presented; the 1H NMR spectra of 6 in toluene-d8 show that there is restricted rotation about the NC-C6H4Me-4 bond. 相似文献
20.
Fluorotitanates (LH)2[TiF6]·nH2O (1: R = pyridine, n = 1, 2: R = 2-picoline, n = 2, 3: R = 2,6-lutidine, n = 0, 4: R = 2,4,6-collidine, n = 0) and (LH)[TiF5(H2O)] (3a: L = 2,6-lutidine) have been synthesized by the reaction of pyridine or corresponding methyl substituted pyridines and titanium dioxide dissolved in hydrofluoric acid. The crystal structures of ionic compounds 1, 2, 3, 3a and 4 have been determined by single-crystal X-ray diffraction analysis. The hydrogen bonding led to the formation of discrete (LH)2[TiF6] units (4), chains (1-3), and layers (3a). The additional π-π interactions present in 1, 2, and 4 results in chain structures of 1 and 4 and in a layer structure of 2. The [TiF6]2− and [TiF5(H2O)]− anions were observed by 19F NMR spectroscopy in aqueous solutions of 1, 2, 3, 3a and 4. 相似文献