Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of Complex Cu（α-Furacrylic acid）2（phen）

The title complex (C26H18CuN2O6,Mr=517.96) has been synthesized by the reac-tion of α-furanacrylic acid with 1,10-phenanthroline (phen) in the solvent mixture of water and methanol. Crystal data: monoclinic,space group C2/c with a =2.2927(4),b=1.01248(18),c=1.05061(18) nm,β=111.188(3)o,V=2.274(7) nm3,Dc=1.513 g/cm3,Z=4,F(000)=1060,μ= 1.007mm?1,R=0.0320 and wR=0.0781. The crystal structural analysis shows that the copper atom is coordinated with four oxygen atoms from two α-furacrylic acids and two nitrogen atoms from 1,10-phenanthroline,giving a distorted octahedral coordination geometry. The result of electroche-mical analysis shows that the electron transfer in the electrode reaction is quasi-reversible.     

Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of the Complex Cu(o-Methylbenzoic acid)_2(2,2′-bipy)·(H_2O)

The title complex (C26H24CuN2O5, Mr = 508.01) has been synthesized by o-me- thylbenzoic acid, 2,2′-bipyridine (bipy) and copper perchlorate in the mixed solvent of water and methanol. It crystallizes in orthorhombic, space group P212121 with a = 0.70814(10), b = 1.6953(3), c = 1.9539(3) nm, V = 2.3457(6) nm3, Dc = 1.439 g/cm3, Z = 4, μ = 0.971 mm-1, F(000) = 1052, R = 0.0432 and wR = 0.0860. The structural determination shows that the copper atom is coordinated by three oxygen atoms from two o-methylbenzoic acids and one water molecule together with two nitrogen atoms from 2,2′-bipyridine, giving a distorted square-pyramidal coordination geometry. The cyclic voltammetric behavior of the complex is also discussed.     

Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of Complex Zn（phen）（m-CBA）2（H2O）

A novel complex Zn(phen)(m-CBA)2(H2O) with m-chlorobenzoic acid (m-CBA), 1,10-phenanthroline (phen) and zinc chloride has been hydrothermally synthesized and characterized. Crystal data for this complex: triclinic, space group P1, a = 0.8361(5), b = 1.2455(7), c = 1.3107(7) nm, α = 115.637(8), β = 91.014(9), γ = 104.857(8)o, V = 1.1763(11) nm3, Dc = 1.623 g/cm3, Z = 2, F(000) = 584, GOOF = 1.078, the final R = 0.0453 and wR = 0.1192. Structure analysis shows that the zinc ion coordinates with two nitrogen atoms of one 1,10-phenanthroline molecule, three oxygen atoms from two m-chlorobenzoic acid molecules and one water molecule, giving a distorted square-pyramidal coordination geometry. The cyclic voltametric behavior of the complex was also investigated.     

Synthesis, Crystal Structure and Electrochemical Properties of the Complex Cd(α-FRA)2(Phen)(H2O)

A new cadmium complex Cd(α-FRA)2(Phen)(H2O) was synthesized by self- assembly reaction of α-furoic acid, phenanthroline (phen), and Cd(NO3)2(4H2O. It crystallizes in monoclinic, space group P21/c, with a = 0.6799(2), b = 1.7780(6), c = 1.6866(6) nm, β = 94.912(6)o, V = 2.0315(12) nm3, Dc = 1.742 g/cm3, Z = 4, Mr = 532.77, μ(MoKα) = 1.124 mm-1, F(000) = 1064, R = 0.0411, wR = 0.0790. The structural analysis shows that the cadmium ion is coordinated with two nitrogen atoms from one phen molecule and four oxygen atoms respectively from two α-furoic acids and one water molecule, giving a distorted octahedral coordination geometry. The cyclic voltametric behavior of the complex was also discussed, which shows that the electrode process is irreversible in the electrode reactor.     

Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of Complex Mn2（phen）2（p-CBA）4（H2O）

One novel complex Mn2(phen)2(p-CBA)4(H2O) has been hydrothermally syn- thesized from p-chlorobenzoic acid (p-CBA), 1,10-phenanthroline (phen) and anhydrous man- ganese(Ⅱ) sulfate and then characterized. Crystal data for this complex: monoclinic, space group C2/c, with a = 2.3416(3), b = 1.5604(2), c =1.5605(2) nm, β = 121.048(2)o, V = 4.8849(12) nm3, Dc = 1.510 g/cm3, Mr = 555.26, Z = 8, μ = 0.798 mm-1, F(000) = 2256, GOOF = 1.032, the final R = 0.0393 and wR = 0.0816. The crystal structure shows that two neighboring manganese(Ⅱ ) ions are linked together by two bridge-chelating p-chlorobenzoic groups and one bridging water molecule, forming a cage structure with the Mn–Mn bond distance of 0.3512 nm. Each manganese(Ⅱ ) ion is coordinated by two nitrogen atoms of one 1,10-phenanthroline molecule and four oxygen atoms from three p-chlorobenzoic acid anions and one water molecule, giving a distorted octahedral coordination geometry. The cyclic voltammetric behavior of the complex was also investigated.     

Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of Complex [Cd(phen)3]·(ClO4)2·(p-MBA)2·(H2O)2

One new cadmium complex [Cd(phen)3]·(ClO4)2·(p-MBA)2·(H2O)2 has been hydro- thermally synthesized by reacting p-methylbenzoic acid (p-MBA), 1,10-phenanthroline (phen) and cadmium perchlorate. It crystallizes in the triclinic system, space group P, with a = 1.2809(3), b = 1.3431(3), c = 1.3734(3) nm, α = 84.259(4), β = 71.603(3), γ = 74.424(3)o, V = 2.1594(8) nm3, Dc = 1.532 g/cm3, Z = 2, F(000) = 1008, μ = 0.697 mm-1, R = 0.0646 and wR = 0.1648. The crystal structure shows that the cadmium ion is coordinated with six nitrogen atoms from three 1,10-phenanthroline molecules, forming a distorted octahedral coordination geometry. The result of electrochemical property analysis shows that the electron transfer in the electrode reaction is irreversible.     

Synthesis, Crystal Structure and Electrochemical Properties of [Ni(phen)_3]·(m-nitrobenzoic acid)_2·(H_2O)

A new nickel(II) coordination complex [Ni(phen)3]·(m-nitrobenzoic acid)2·(H2O) was synthesized by self-assembly of m-nitrobenzoic acid, 1,10-phenanthroline and nickelous per- chlorate. It crystallizes in the monoclinic system, space group C2/c, with a = 2.4596(6), b = 1.2124(3), c = 1.9824(5) nm, β = 97.088(5)o, V = 5.866(3) nm3, Dc = 1.474 g/cm3, Z = 4, Mr = 1301.82, μ(MoKα) = 0.417 mm-1 F(000) = 2688, R = 0.0493 and wR = 0.1025. Structural deter- mination indicates that the nickel(II) ion is coordinated with six nitrogen atoms from three phens, giving a distorted octahedral coordination geometry. The cyclic voltametric analysis shows that the electron transfer in the electrode reaction is irreversible.     

Synthesis, Crystal Structure and Electrochemical Properties of a Novel Phenothiazine Derivative

A new compound 1,1‘-bis(3-pyridyl)-propylene(3,7-diformyl-N-ethylphenothiazinyl)ketone (C30H23N3O2S, Mr = 489.4) has been synthesized, and its crystal structure was determined by single-crystal X-ray diffraction method. The crystal is of orthorhombic, space group Ima2 with a = 27.491 (5), b = 11.942(2), c = 7.389(2) A, V = 2425.8(7) A^3, Z = 8, Dc =1.340 g/cm^3,μ = 0,167 mm ^1, F(000) = 1024, the final R = 0.0363 and wR = 0.0869 for 2054 unique reflections with Rint = 0.0254. The structural determination shows that the molecule assumes a butterfly configuration with nearly planar wings. In addition, the electrochemical study indicates that there is a high electronic delocalization in the molecule.     

Hydrothermal Synthesis,Crystal Structure and Antimicrobial Activity of a New Ni(Ⅱ) Complex

The title complex [NiL]·H2O(C20H24N2NiO5,L = paeonol-ehylenediamine) was synthesized by the hydrothermal method and characterized by IR,cyclic voltammetry and X-ray single-crystal diffraction.The complex belongs to the monoclinic system,space group P21/c with a=13.4361(13),b=7.3290(10),c=20.981(2),β=109.244°,V=1950.6(4)3,Z=4,F(000)=904,Dc=1.468 g/cm3,μ(MoKα)=1.029 mm-1,the final R=0.0588 and wR=0.1577.The complex exhibits antimicrobial activities(antimicrobial activities against Staphylococcus aureus and Escherichia codi) by agar diffusion measurement.     

Hydrothermal Synthesis,Crystal Structure and Electrochemical Properties of Complex [Cd(phen)_3]·(ClO_4)_2·(p-MBA)_2·(H_2O)_2

One new cadmium complex [Cd(phen)3]·(ClO4)2·(p-MBA)2·(H2O)2 has been hydro-thermally synthesized by reacting p-methylbenzoic acid (p-MBA),1,10-phenanthroline (phen) and cadmium perchlorate. It crystallizes in the triclinic system,space group P1,with a=1.2809(3),b= 1.3431(3),c=1.3734(3) nm,α=84.259(4),β=71.603(3),γ=74.424(3)o,V=2.1594(8) nm3,Dc= 1.532 g/cm3,Z=2,F(000)=1008,μ=0.697 mm-1,R=0.0646 and wR=0.1648. The crystal structure shows that the cadmium ion is coordinated with six nitrogen atoms from three 1,10-phenanthroline molecules,forming a distorted octahedral coordination geometry. The result of electrochemical property analysis shows that the electron transfer in the electrode reaction is irreversible.     

Hydrothermal Synthesis,Crystal Structure and Properties of a Lanthanum(Ⅲ) Complex Based on a N,O-Donor Ligand

A novel metal-organic complex [La(o-NCP)3]n(o-HNCP = 2-(2-carboxyphenyl)imidazo(4,5- f)(1,10)-phenanthroline) has been hydrothermally synthesized and characterized by elemental analysis, infrared analysis and X-ray single-crystal diffraction. The complex crystallizes in triclinic, space group P1 with a = 9.898(2), b = 16.193(3), c = 16.909(3) , α = 67.68(3), β = 80.85(3), γ = 78.78(3)o, V = 2448.2(8) A3, Z = 2, Mr = 1156.9, Dc = 1.569 g/cm3, μ = 0.71073 A, F(000) = 1164, GOOF = 1.065, the final R = 0.051 and wR = 0.123 for 8539 observed reflections with I 2A(I). The complex exhibits a one-dimensional double chain structure. The adjacent chains are further connected by N–H...N hydrogen bonds which help to form a two-dimensional supramolecular architecture. Furthermore, the complex exhibits excellent thermal stability and luminescent property.     

Synthesis, Crystal Structure and Electrochemical Properties of a Cadmium(II) Complex with α-Furoic Acid and 1,10-Phenanthroline

A new cadmium complex [Cd(phen)3]·(ClO4)2·(α-FRA)·(H2O)3 was prepared by self-assembly of α-furoic acid, 1,10-phenanthroline (phen), and cadmium perchlorate. It crystal- lizes in the monoclinic system, space group P21/n, with a = 1.28130(15), b = 2.5957(3), c = 1.35449(16) nm, β = 109.395(2)o, V = 4.2492(9) nm3, Dc = 1.491 g/cm3, Z = 4, F(000) = 1926, GOOF = 1.023, the final R = 0.0729 and wR = 0.2086. The crystal structure analysis indicates that the cadmium ion is coordinated with six nitrogen atoms from six 1,10-phenanthroline molecules, giving a distorted octahedral coordination geometry. The cyclic voltametric behavior of the com- plex was also investigated.     

Synthesis,Crystal Structure and Photoluminescence of a TADF Dinuclear Cu(Ⅰ) Complex

A binuclear Cu(Ⅰ) complex[Cu(PCNP)(mepypz)]_2(BF_4)_2 (1,PCNP=2,6-bis(diphenylphosphine)-benzonitrile,mepypz=2-methyl-6-(1H-pyrazol-3-yl)-pyridine was synthesized from the reaction of Cu(CH_3CN)_4BF_4,PCNP and mepypz in CH_2Cl_2 at room temperature.The compound was characterized by NMR,UV-vis and X-ray single-crystal structure analysis.It crystallizes in monoclinic space group P2_1/c with a=14.0139(5),b=11.8149(3),c=27.1248(10)?,β=96.686(4)°,V=4460.6(3)?~3,Z=2,M_r=1561.97,D_c=1.163 g/cm~3,F(000)=1600.0,μ=1.774 mm~(–1),GOOF=1.071,the final R=0.0523 and w R=0.1412 for 7919 observed reflections with I2σ(I).The Cu atoms in the complex are four-coordinated and adopt a distorted tetrahedral coordination geometry.In the solid state,the complex exhibits yellowish-green emission with a peak wavelength of 546 nm,a lifetime of 390μs,and a quantum yield of 0.45 at room temperature.The temperature-dependent investigation of luminescent properties suggests that the complex emits thermally activated delayed fluorescence (TADF) at room temperature.     

Synthesis,Crystal Structure,and Photo-and Electro-luminescence of a TADF Cu(Ⅰ) Complex

A four-coordinate mononuclear cuprous complex [Cu(ac1m)POP]BF_4·0.5(C_6H_(14))· 0.5(C_2H_5OH)(1, ac1 m = 2-(2-ethoxyphenyl)-1-phenyl-1H-imidazo[4,5-f][1,10]phenanthroline, POP = bis[2-(dipenylphosphino)phenyl]ether) was synthesized and characterized by elemental analysis, NMR, UV-vis, cyclic voltammetry and X-ray single-crystal structure analysis. It crystallizes in monoclinic space group P2_1/c with a = 17.0546(19), b = 15.4650(17), c = 23.685(2) ?, β = 104.007(11)°, V = 6061.1(12) ?~3, Z = 4, M_r = 1171.46, D_c = 1.284 g/cm~3, F(000) = 2432, μ = 1.50 mm~(–1), GOOF = 1.070, the final R = 0.059 and wR = 0.1640 for 8952 observed reflections with I 2σ(Ⅰ). Compound 1 is composed of a BF4-anion and a [Cu(ac1m)POP]~+ cation. The Cu(Ⅰ) ion adopts a tetrahedral coordination geometry defined by two nitrogen and two phosphorous atoms. The complex exhibits yellow luminescence with maximum emission peaks at 546 nm, lifetimes 15.1 μs and quantum yields(ф = 0.130) at room temperature. The complex displays thermally activated delayed fluorescence(TADF) at room temperature, which is proved experimentally and theoretically. And the organic light-emitting diode(OLED) with 1 as the light emitting material has the maximum current efficiency of 5.86 cd/A and the highest brightness of 3215 cd/m~2.     

Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of the Copper(Ⅱ) Complex [Cu4O4(phen)4(ClC6H4COO)2(H2O)2]·(H2O)3

The title complex of copper(Ⅱ) with m-chlorobenzoic acid, 1,10-phenanthroline (phen) and copper perchlorate has been synthesized and characterized in the solvent mixture of water and methanol. Crystal data for this complex: triclinic, space group P, a = 1.06853(12), b = 1.30740(16), c = 1.49546(17) nm, α = 101.791(2), β = 103.413(2), γ = 105.815(2)o, V = 1.8736(4) nm3, Mr = 904.67, Dc = 1.604 g/cm3, Z = 2, F(000) = 924, μ = 1.34 mm-1, GOOF = 1.049, the final R = 0.0324 and wR = 0.0797. The structure analysis shows that a chair-like structure [Cu4O4] is defined by three quadrilaterals shaped by four copper and four oxygen atoms, and every copper ion is coordinated by three oxygen atoms from three water molecules and two nitrogen atoms from one 1,10-phenanthroline molecule, giving a distorted square-pyramidal coordination geometry. The CV analysis results indicate that the electron transfer in the electrode reaction is quasi-reversible.     

Hydrothermal Synthesis, Crystal Structure and Electrochemical Properties of a New Dinuclear Copper Complex [C2H6ON]2[Cu2Cl2(μ-CH2COO)4]

The hydrothermal reaction of copper chloride dihydrate and 5,5-dimethyl-imi-dazolidine-2,4-dione with a mole ratio of 1:1 in acetonitrile resulted in the formation of a new acetate-bridged dinuelear copper complex, [C2H6ON]2[Cu2Cl2(μCH3COO)4]. Protonated aeetamide in enolic form and acetic acid were yielded by the hydrolysis of aeetonitrile under hydrothermal condition. The title complex (C12H24Cl2Cu2N2O10) was charactetized by X-ray single-crystal diffraction, IR spectrum, elemental and electrochemical analysis. It crystallizes in the monoclinie system, space group P21/c with a = 8.2980(14), b = 14.358(2), c = 12.0010(2) A,β= 130.620(3)°, V= 1085.3(2)A3, Dc = 1.696 g/am3, Mr = 554.31, Z = 2, F(000) = 564 and μ= 2.254 mm-1. The crystal structure consists of a tetraacetate-bridging dinulcear copper complex anion [Cu2Cl2(μ-CH3COO)4]2-, with the chlorine anions in the axial positions, and two protonated acetamide cations [C2H6ON]+, which were connected through hydrogen bonds to form a three-dimensional infinite network.     

Synthesis,Crystal Structure and Magnetic Property of a Novel Cu(Ⅱ)-Fluconazole-azide Complex

The title compound formulated as Cu2(C13H11N6OF2)(N3)3CH3OH was synthesized and structurally characterized by elemental analysis,IR and single-crystal X-ray diffraction.In the structure of the complex,the deprotonated fluconazole and azide anion link two copper centers to construct a binuclear SBU and the azide anion exhibits a μ1,1-coordination mode.Each triazole group of fluconazole links two SBUs and the compound exhibits a chain-like architecture with strong antiferromagnetism.