共查询到20条相似文献,搜索用时 46 毫秒
1.
The title compound [Co(IM2-Py)(PCA)(N3)2] (IM2-Py = 2-(2'-pyridyl)-4,4,5,5-te-
tramethylimidazoline-1-oxyl, PCA = 2-pyridine carboxylic acid) has been prepared and structurally
characterized by elemental analysis, IR spectra and X-ray diffraction. It crystallizes in monoclinic,
space group P21/c with a = 13.169(3), b = 11.235(2), c = 15.596(3) (A), β = 104.70(3)°, V = 2232.0(8) (A)3, C18H21CoN1oO3, Mr = 484.38, Z = 4, Dc = 1.441 g/cm3,μ(MoKα) = 0.811 mm-1, F(000) = 1000,the final R = 0.0563 and wR = 0.1010. The nitronyl nitroxide (NIT2Py) was reduced to IM2-Py, and another NIT2Py oxidated to PCA. The self-redox reaction between the radicals was observed. The cobalt(Ⅱ) ion is six-coordinated into a distorted octahedral geometry. Meanwhile, the intermolecular hydrogen bonds result in the dimer. 相似文献
2.
1 INTRODUCTION The design and synthesis of molecule-based mag-netic materials is one of the major subjects of mate-rials science. Nitronyl nitroxides acting as useful pa-ramagnetic building blocks have been extensively usedto assemble molecular magnetic materials in the pastfew years[1~5]. However, their weakly basic charac-ter strongly limits their coordination ability. Mean-while, the azide anion is a versatile ligand which canlink the transition metal atoms with different coor-dinatio… 相似文献
3.
A new pseudo three-dimensional framework structure of the title compound {[CuⅡ(1,10-phen)]2[PMoⅥ11MoⅤO40]}[CuⅠ(C8N4H6)(C9H6NO)(H2O)](1) has been prepared by the hydrothermal method for the first time and characterized by elemental analyses,X-ray single-crystal diffraction and IR spectra.1 consists of two building blocks,one {[CuⅡ(1,10-phen)]2[PMoⅥ11MoⅤO40]} and one [CuⅠ(C8N4H6)(C9H6NO)(H2O)] coordinated group.Singlecrystal X-ray diffraction revealed that 1 crystallizes in the monoclinic system,space group P2/c with a=13.498(4),b=12.890(3),c=21.465(8),β=97.314o,V=3704(2)3,Mr=2693.61,Z=2,Dc=2.415 Mg/m3,μ=2.915 mm-1,F(000)=2562,S=1.009,the final R=0.0583 and wR=0.1406 for 5129 observed reflections with I2σ(I).Furthermore,compound 1 shows strong fluorescent properties in the solid state at room temperature.The electrochemical behavior of 1 has also been studied by cyclic voltammograms. 相似文献
4.
Jiménez CA Belmar JB Alderete J Delgado FS López-Rodríguez M Peña O Julve M Ruiz-Perez C 《Dalton transactions (Cambridge, England : 2003)》2007,(21):2135-2144
Four potential tetradentate ligands of formulae 1,2-bis-(3,5-di-tert-butyl-2-hydroxybenzamido)ethane (H(4)L(1), 1), 1,2-bis-(3,5-di-tert-butyl-2-hydroxybenzamido)propane (H(4)L(2), 2), 1,2-bis-(3,5-di-tert-butyl-2-hydroxybenzamido)benzene (H(4)L(3), 3) and 1,8-bis-(3,5-di-tert-butyl-2-hydroxybenzamido)naphthalene (H(4)L(4), 4) have been prepared and the crystal structures of three of them (1, 3 and 4) determined by single crystal X-ray diffraction. The investigation of their complexing ability toward Co(II) afforded the compounds of formulae [Co(III)(L(3))Na(I)(H(2)O)(2)] (5), [Co(III)(L(n))Li(I)(H(2)O)2] with n = 1 (6), 2 (7) and 3 (8) and [Co(II)(L(4))Li(I)(2)] (9). Complexes 5-8 are square planar Co(III) species, as corroborated by the crystal structure of 5. In this compound, two amide-nitrogen and two phenolate-oxygen atoms of a fully deprotonated (L(3))(4-) anion build a slightly distorted square planar surrounding around the cobalt atom, the Co-N distances [1.858(3) and 1.861(3) A] being somewhat longer than the Co-O ones [1.798(3) and 1.801(3) A]. Magnetic and 1H NMR data at room temperature for 6-8 support the occurrence of an intermediate S = 1 low-lying state for the Co(III) center which is stabilized by the strong donating ability of the fully deprotonated bis-amidate ligands. In the case of the compound with the naphthalene derivative (9), the analytical and spectroscopic data suggest the occurrence of a low spin Co(II) complex. The weakening of the ligand field strength of the tetradentate bis-amidate ligand in the naphthalene derivative (5-6-5 ring-membered fused chelate) when compared to the situation in complexes 5-8 (5-5-5 ring-membered fused chelate) would account for this feature. 相似文献
5.
Ciani G Sironi A Martinengo S Garlaschelli L Della Pergola R Zanello P Laschi F Masciocchi N 《Inorganic chemistry》2001,40(16):3905-3911
The [Co(9)P(CO)(21)](2)(-) anion has been isolated from the products of the reaction between Na[Co(CO)(4)] and PCl(5) in tetrahydrofuran at reflux. The structure of the cluster anion [Co(9)P(CO)(21)](2)(-) in its tetraphenylphosphonium salt has been elucidated by X-ray analysis. The crystals are monoclinic, space group P2(1)/n, a = 12.528(3), b = 14.711(5), c = 19.312(6) A, beta = 93.68(2) degrees, Z = 2. Final R = 0.065 for 2300 unique reflections having I > 3sigma(I). The anion, which is disordered about an inversion center, consists of a monocapped square antiprismatic cluster containing an interstitial phosphide and surrounded by 13 terminal and 8 edge-bridging carbonyl ligands. Average values are: Co-Co 2.685 A, and Co-P 2.256 A. The [Co(10)P(CO)(22)](3)(-) anion has been obtained by condensation of the [Co(9)P(CO)(21)](2)(-) anion with [Co(CO)(4)](-) in tetrahydrofuran at reflux. While the [Co(9)P(CO)(21)](2)(-) anion is stable under CO, the [Co(10)P(CO)(22)](3)(-) anion is decomposed to [Co(9)P(CO)(21)](2)(-) and [Co(CO)(4)](-). The benzyltrimethylammonium salt of the [Co(10)P(CO)(22)](3)(-) anion has been studied by X-ray analysis. It gives triclinic crystals, space group P_1, a = 11.452(3), b = 23.510(6), c = 25.606(4) A, alpha = 112.46(1), beta = 95.79(1), gamma = 73.548(2) degrees, Z = 4. Final R = 0.041 for 8600 unique reflections having I > 3sigma(I). There are two independent trianions in the asymmetric unit, both showing similar geometries, consisting of bicapped square antiprismatic clusters with a central P atom, each bearing 10 terminal and 12 edge-bridging carbonyl ligands, 8 of which, bound to the capping metals, are markedly asymmetric. Average values are: Co-Co 2.678 A, and Co-P 2.262 A. Electrochemistry shows that [Co(9)P(CO)(21)](2)(-) and [Co(10)P(CO)(22)](3)(-) in acetonitrile solution undergo either a one-electron oxidation or a two-electron reduction. This latter process appears as a single step in the case of the dianion and as two separated one-electron steps in the case of the trianion. All the processes are accompanied by slow chemical complications, thus testifying that no stable redox congeners exist for these phosphide clusters. 相似文献
6.
cis-[Ru(NO)Cl(pyca)(2)] (pyca = 2-pyridinecarboxylato), in which the two pyridyl nitrogen atoms of the two pyca ligands coordinate at the trans position to each other and the two carboxylic oxygen atoms at the trans position to the nitrosyl ligand and the chloro ligand, respectively (type I shown as in Chart 1), reacted with NaOCH(3) to generate cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I). The geometry of this complex was confirmed to be the same as the starting complex by X-ray crystallography: C(13.5)H(13)N(3)O(6.5)Ru; monoclinic, P2(1)/n; a = 8.120(1), b = 16.650(1), c = 11.510(1) A; beta = 99.07(1) degrees; V = 1536.7(2) A(3); Z = 4. The cis-trans geometrical change reaction occurred in the reactions of cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I) in water and alcohol (ROH, R = CH(3), C(2)H(5)) to form [[trans-Ru(NO)(pyca)(2)](2)(H(3)O(2))](+) (type V) and trans-[Ru(NO)(OR)(pyca)(2)] (type V). The reactions of the trans-form complexes, trans-[Ru(NO)(H(2)O)(pyca)(2)](+) (type V) and trans-[Ru(NO)(OCH(3))(pyca)(2)] (type V), with Cl(-) in hydrochloric acid solution afforded the cis-form complex, cis-[Ru(NO)Cl(pyca)(2)] (type I). The favorable geometry of [Ru(NO)X(pyca)(2)](n)(+) depended on the nature of the coexisting ligand X. This conclusion was confirmed by theoretical, synthetic, and structural studies. The mono-pyca-containing nitrosylruthenium complex (C(2)H(5))(4)N[Ru(NO)Cl(3)(pyca)] was synthesized by the reaction of [Ru(NO)Cl(5)](2)(-) with Hpyca and characterized by X-ray structural analysis: C(14)H(24)N(3)O(3)Cl(3)Ru; triclinic, Ponemacr;, a = 7.631(1), b = 9.669(1), c = 13.627(1) A; alpha = 83.05(2), beta = 82.23(1), gamma = 81.94(1) degrees; V = 981.1(1) A(3); Z = 2. The type II complex of cis-[Ru(NO)Cl(pyca)(2)] was synthesized by the reaction of [Ru(NO)Cl(3)(pyca)](-) or [Ru(NO)Cl(5)](2)(-) with Hpyca and isolated by column chromatography. The structure was determined by X-ray structural analysis: C(12)H(8)N(3)O(5)ClRu; monoclinic, P2(1)/n; a = 10.010(1), b = 13.280(1), c = 11.335(1) A; beta = 113.45(1) degrees; V = 1382.4(2) A(3); Z = 4. 相似文献
7.
The Schiff base ligands 1,4-bis(4-pyridyl)-2,3-diaza-1,3-butadiene (L1, monoclinic, P2(1)/c, a = 3.856(1) A, b = 11.032(2) A, c = 12.738(3) A, beta = 92.21(3) degrees, Z = 2) and 2,5-bis(4-pyridyl)-3,4-diaza-2,4-hexadiene (L2, monoclinic, P2(1)/c, a = 10.885(2) A, b = 4.613(1) A, c = 14.978(3) A, beta = 92.827(4) degrees, Z = 2) were used in the synthesis of four new organic-inorganic coordination polymers, each of them adopting a different structural motif. Synthesis, X-ray structural determinations, and spectroscopic and thermogravimetric analyses are presented. The reaction between Co(NO(3))(2).6H(2)O and L1 afforded a two-dimensional noninterpenetrating brick-wall structure, [Co(C(12)N(4)H(10))(1.5)(NO(3))(2)(H(2)O)(CH(2)Cl(2))(2)](n)() (1, triclinic, P1; a = 10.242(7) A, b = 10.802(7) A, c = 15.100(1) A, alpha = 70.031(1), beta = 75.168(11), gamma = 76.155(11), Z = 2), while Ni(NO(3))(2).6H(2)O combined with L1 yielded an interpenetrating three-dimensional rhombus-grid polymer, [Ni(C(12)N(4)H(10))(2)(NO(3))(2)(OC(4)H(8))(1.66)(H(2)O)(0.33)](n) (2, monoclinic, C2/c; a = 20.815(8) A, b = 23.427(8) A, c = 17.291(6) A, beta = 116.148(6), Z = 8). The reaction of Co(NO(3))(2).6H(2)O and L2 was found to be solvent-sensitive and resulted in the formation of two different noninterpenetrating compounds: [Co(C(14)N(4)H(14))(2)(NO(3))(2)(C(6)H(6))(1.5)](n)() (3, monoclinic, C2/c; a = 22.760(2) A, b = 21.010(3) A, c = 25.521(2) A, beta = 97.151(2), Z = 8), which adopts a two-dimensional square-grid motif formed by propeller-type modules, and [Co(C(14)N(4)H(14))(1.5)(NO(3))(2)(CH(2)Cl(2))(2)](n)() (4, monoclinic, P2(1)/n; a = 14.432(2) A, b = 14.543(8) A, c = 15.448(4) A, beta = 96.968(0), Z = 4), consisting of T-shaped building blocks assembled into a one-dimensional ladder-type structure. These four coordination polymers all exhibit impressive thermal stability. Thermogravimetric studies showed that after complete removal of the solvents, the frameworks are stable to temperatures between 234 degrees C and 260 degrees C. 相似文献
8.
A novel 5-aminoisophthalate compound, [Mn(C8H5NO4)(H2O]n(2nH2O 1, has been synthesized by the hydrothermal assembly of 5-aminoisophthalic acid with manganese acetate. Ele- mental analysis, X-ray crystal structure analyses, IR spectra, FT-Raman and ESR were carried out for the structural determination and characterization of the title compound. Compound 1 crystallizes in triclinic, space group Pī with a = 7.7562(2), b = 8.6121(3), c = 8.7107(2)(A), α = 85.411(2), β = 76.030(2), γ = 66.510(2)o, V = 517.76(3)(A)3, MnC8H11NO7, Mr = 288.12, Z = 2, Dc = 1.848 g/cm3, μ = 1.300 mm-1, F(000) = 294, R = 0.0381 and wR = 0.1043 for 1652 observed reflections (I > 2σ(I)). 相似文献
9.
Dreos R Nardin G Randaccio L Siega P Tauzher G Vrdoljak V 《Inorganic chemistry》2001,40(22):5536-5540
The reaction of CH(3)Co(DH)(2)H(2)O with 4-pyridinyl boronic acid in methanol or water affords the dinuclear complexes [MeCo(DH)(DB(OR)(4-Py))](2), with R = Me (2) or H (3), respectively, through reaction of boron with the oxime oxygens of the alkylcobaloxime and coordination of the pyridinyl N to cobalt. The reaction is strongly pH dependent, and the formation of the complexes requires a neutral medium. The complexes have been fully characterized by (1)H and (13)C NMR spectroscopy, ESI-MS spectrometry, and elemental analysis. The X-ray structure shows that in 2, the pyridinyl groups are facing each other and nearly perpendicular both to the plane of the Co B Co1 B1 atoms and to the mean equatorial plane, so that the complex may be considered a molecular box. A dimeric arrangement has already been found in the related [MeCo(DH)(DB(OMe)(3-Py))](2) (1) complex, which forms a distorted molecular rectangle [Dreos, R.; Nardin, G.; Randaccio, L.; Tauzher, G.; Vuano, S. Inorg. Chem. 1997, 36, 2463]. The dimerization is possible in both cases, as the conformational freedom of the B bridge compensates for the different position (3- or 4-) of the pyridinyl N donor. 相似文献
10.
The reaction of μ-alkyne-bridged dimolybdenum compound [Mo2(μ-C2HPh)(CO)4(η5-C5H4C(O)Me)2] 1 with Co2(CO)8 in refluxing toluene gave a new butterfly compound [Co2Mo2(μ4-C2HPh)(μ-CO)4(CO)4(η5-C5H4C(O)Me)2] 2 which was fully characterized by elemental analysis, IR, 1H NMR and X-ray single crystal diffraction techniques. 2 crystallized in monoclinic system, C30H20Co2Mo2O10, Mr=850.23, space group P21/a(#14), a=14.165(5), b=12.498(2), c=16.204(2)(A), β = 96.50(2)°, V = 2850(1)(A)3, Z = 4, Dc = 1.981 g cm-3, F(000)=1672, μ(MoKα)=20.41 cm-1, final R=0.030, Rw=0.039 for 4831 observable reflections with I>2σ(I). The structure contains a Co2Mo2 butterfly core, and each Mo-Co bond is spanned by an asymmetric semi-bridging carbonyl ligand. 相似文献
11.
The compound phenol,2-[4(S)-4,5-dihydro-4-phenyl-2-ozazolinyl(1,C15H13NO2) was synthesized with a simple,one step method free of water and air.It was obtained in a moderate yield from the reaction of 2-hydroxybenzonitrile with optically active amino alcohol in chloroben-zene under dry,anaerobic conditions.It belongs to the orthorhombic system,space group P212121 with a = 5.786(5),b = 10.730(5),c = 19.722(5),C15H13NO2,Mr = 239.26,V = 1224.4(12)3,Z = 4 and Dc = 1.298 mg/m3.The final R = 0.0324 for 1627 observed reflections with Ⅰ 2σ(Ⅰ) and Rw = 0.0826 for all data.The structure of compound 1 was determined by X-ray diffraction,NMR and HRMS. 相似文献
12.
Herrera JM Bleuzen A Dromzée Y Julve M Lloret F Verdaguer M 《Inorganic chemistry》2003,42(22):7052-7059
The synthesis, X-ray structures, and magnetic behavior of two new, three-dimensional compounds [W(IV)[(mu-CN)(4)Co(II)(H(2)O)(2)](2).4H(2)O](n) (1) and [[W(V)(CN)(2)](2)[(mu-CN)(4)Co(II)(H(2)O)(2)](3).4H(2)O](n) (2) are presented. Compound 1 crystallizes in the tetragonal system, space group I4/m with cell constants a = b = 11.710(3) A, c = 13.003(2) A, and Z = 4, whereas 2 crystallizes in the orthorhombic system, space group Cmca with cell constants a = 13.543(5) A, b = 16.054(6) A, c = 15.6301(9) A, and Z = 4. The structure of 1 shows alternating eight-coordinated W(IV) and six-coordinated Co(II) ions bridged by single cyanides in a three-dimensional network. The geometry of each [W(IV)(CN)(8)](4-) entity in 1 is close to a square antiprism. Its eight cyanide groups are coordinated to Co(II) ions which have two coordinated water molecules in trans position. The structure of 2 consists of alternating eight-coordinated W(V) and six-coordinated Co(II) ions linked by single cyanide bridges in a three-dimensional network. Each [W(V)(CN)(8)](3-) unit shows a geometry close to a square antiprism. Only six of its eight cyanide groups are coordinated to Co(II) ions while the other two are terminal. The Co(II) ion in 2 has the same CoN(4)O(2) environment as in 1. The magnetic behavior of 1 is that of magnetically isolated high spin Co(II) ions (S(Co) = 3/2), bridged by the diamagnetic [W(IV)(CN)(8)](3-) units (S(W(IV)) = 0). The magnetic behavior of 2, where the high spin Co(II) ions are bridged by the paramagnetic [W(V)(CN)(8)](3-) units [S(W(V)) = 1/2], is that of ferromagnetically coupled Co(II) and W(V) giving rise to an ordered ferromagnetic phase below 18 K. The magnetic properties of 1 are used as a blank to extract the parameters that are useful to analyze the magnetic data of compound 2. 相似文献
13.
Zhang SH Ma LF Zou HH Wang YG Liang H Zeng MH 《Dalton transactions (Cambridge, England : 2003)》2011,40(43):11402-11409
Three new polynuclear complexes, [Co(7)(bm)(12)]·(ClO(4))(2)·13H(2)O (1), [Co(4)(bm)(4)Cl(4)(C(3)H(7)OH)(4)] (2), and [Co(4)(bm)(4)(μ-HCO(2))(2)(μ(2)-HCO(2))(2)(C(3)H(7)OH)(2)] (3) (Hbm = (1H-Benzimidazol)-methanol), have been synthesized and characterized by elemental analysis, IR, powder X-ray diffraction and X-ray single-crystal diffraction. Compound 1 features a centrosymmetric wheel-like heptanuclear Co(II) cluster. Compound 2 having a I4(1)/a space group exhibits a tetranuclear Co(II) cluster with a cubane topology in which the central Co(II) ion and oxygen atoms from bm occupy the alternate vertices of the cube. However, compound 3 has a tetranuclear Co(II) cluster with a C2/c space group different from that of compound 2. These results show that the geometries and sizes of the corresponding anions as well as their coordinating and hydrogen-bonding properties are essential in determining the final structures of the assemblies. Magnetic properties of 1-3 in the 2-300 K have also been discussed. The {Co(7)} (1) and {Co(4)} (2) cores display dominant ferromagnetic interactions while the {Co(4)} (3) core displays dominant anti-ferromagnetic interactions. 相似文献
14.
Chen XY Shi W Xia J Cheng P Zhao B Song HB Wang HG Yan SP Liao DZ Jiang ZH 《Inorganic chemistry》2005,44(12):4263-4269
The syntheses, crystal structures, and magnetic properties of three novel cyano-bridged bimetallic assemblies, [Ni(bpm)(2)](3)[Co(CN)(6)](2)x3.5H(2)O (1), [Co(bpm)(2)][Fe(CN)(5)NO]x2H(2)O (2), and [Co(bpm)(2)][Ni(CN)(4)] (3) (bpm = bis(1-pyrazolyl)methane), are reported. Complex 1 crystallizes in the tetragonal space group P4(3)2(1)2 with a = 12.800(5) A, b = 12.800(5) A, c = 42.80(3) A, V = 7012(6) A(3), and Z = 8. Complex 2 crystallizes in the chiral trigonal space group P3(2)21 with a = 11.9961(19) A, b = 11.9961(19) A, c = 16.062(5) A, gamma = 120 degrees , V = 2001.7(8) A(3), and Z = 3. Complex 1 is a trigonal bipyramidal complex in which three [Ni(bpm)(2)](2+) units are situated in the equatorial plane and are connected to the two apical [Co(CN)(6)](3)(-) units via three N ends of the cyanide groups. Complex 2 possesses a triangular left-handed helical chain structure composed of [Co(bpm)(2)](2+) linked by [Fe(CN)(5)NO](2)(-); the shortest intramolecular Co...Fe distance is 5.162 A. To the best of our knowledge, this is the first observation of a heteronuclear helical chain structure based on pentacyanonitrosylferrate(II). The structure of complex 3 is roughly determined by X-ray crystallograhy analysis to be a 1D zigzag chain. These structure variations, from a discrete cluster to a 1D helical chain and a 1D zigzag chain, rely on the semirigidity of the capping ligand bpm. Magnetic susceptibility measurements indicate that complex 1 has an intramolecular ferromagnetic interaction (J = 4.06 cm(-)(1)) between the nickel(II) ions; this is further confirmed by the magnetization measurements. In complexes 2 and 3, the cobalt(II) ions are located in a moderately strong field. 相似文献
15.
The long, rigid ligands 1,4-bis[(3-pyridyl)ethynyl]benzene (L1) and 1,4-bis[(4-pyridyl)ethynyl]benzene (L2) were used in the synthesis of 10 new organic-inorganic coordination frameworks, each of them adopting different structural motifs. Synthesis, single-crystal X-ray structure determination, and spectroscopic and thermogravimetric analyses are presented. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] with L1 afforded the following one-dimensional zigzag chain structures: [Cd(C20H12N2)0.5(NO3)(CH3OH)]n (1, monoclinic, C2/c; a = 7.586(1) A, b = 23.222(1) A, c = 13.572(1) A, beta = 92.824(1), Z = 4); [{Cu(C20H12N2)(NO3)2(CH3OH)} x CH3OH]n (2, orthorhombic, P2(1)2(1)2(1); a = 8.589(1) A, b = 15.766(1) A, c = 17.501(1) A, Z = 4); [Co(C20H12N2)2(NO3)2(H2O)2] (5, triclinic, P1; a = 7.493(1) A, b = 8.948(1) A, c = 14.854(1) A, alpha = 100.427(1), beta = 97.324(1), gamma = 110.901(1), Z = 1); [Cu(C20H12N2)(hfac)2]n (4, monoclinic, C2/c, a = 18.828(1) A, b = 14.671(1) A, c = 13.427(1) A, beta = 90.447(1) degrees, Z = 4). Moreover, the minority phase compound formed from Cu(NO3)2 x 3H2O and L1 yielded a metallocyclic chain structure, [Cu(C20H12N2)(NO3)]n (3, triclinic, P; a = 8.728(1) A, b = 10.018(1) A, c = 11.893(1) A, alpha = 109.991(1), beta = 97.109(1), gamma = 115.542(1), Z = 1). In addition to the dinuclear coordination complex 5, all other polymeric structures (1-4) from L1 are composed of interpenetrating 2D and 3D cross-linked zigzag chains via hydrogen-bonding interactions. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] and L2 were dependent on the nature of the metal center and resulted in the formation of four different interpenetrating and noninterpenetrating compounds (6-10): [Co(C20H12N2)1.5(NO3)2]n (6, triclinic, P; a = 14.172(1) A, b = 15.795(1) A, c = 18.072(1) A, alpha = 115.380(1), beta = 101.319(1), gamma = 93.427(2), Z = 4), which consists of T-shaped building blocks assembled into three-dimensional interpenetrating polycatenated ladders; [Cd(C20H12N2)2(NO3)2]n (7, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), which adopts a two-dimensional noninterpenetrating square-grid motif; [Cu(C20H12N2)(hfac)2]n (8, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), composed of three sets of distinct one-dimensional linear chains; [Cu(C20H12N2)(EtOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2EtOH (9, triclinic, P; a = 12.248(2) A, b = 13.711(3) A, c = 18.257(4) A, alpha = 108.078(4) degrees, beta = 97.890(4) degrees, gamma = 103.139(5) degrees, Z = 2) and [Cu(C20H12N2)(MeOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2MeOH (10, triclinic, P; a = 12.136(1) A, b = 13.738(2) A, c = 17.563(3) A, alpha = 107.663(3) degrees, beta = 94.805(4) degrees, gamma = 104.021(4) degrees, Z = 2). Both 9 and 10 stack into infinite interpenetrating ladders through bundles of infinite chains and are described in our preliminary communication. 相似文献
16.
Reactions of two new tripodal ligands 1,3,5-tris(1-imidazolyl)benzene (4) and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene (5) with metal [Ag(I), Cu(II), Zn(II), Ni(II)] salts lead to the formation of novel two-dimensional (2D) metal-organic frameworks [Ag(2)(4)(2)][p-C(6)H(4)(COO)(2)].H(2)O (6), [Ag(4)]ClO(4) (7), [Cu(4)(2)(H(2)O)(2)](CH(3)COO)(2).2H(2)O (8), [Zn(4)(2)(H(2)O)(2)](NO(3))(2) (9), [Ni(4)(2)(N(3))(2)].2H(2)O (10), and [Ag(5)]ClO(4) (11). All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 6: monoclinic, C2/c, a = 23.766(3) A, b = 12.0475(10) A, c = 13.5160(13) A, beta = 117.827(3) degrees, Z = 4. For compound 7: orthorhombic, P2(1)2(1)2(1), a = 7.2495(4) A, b = 12.0763(7) A, c = 19.2196(13) A, Z = 4. For compound 8: monoclinic, P2(1)/n, a = 8.2969(5) A, b = 12.2834(5) A, c = 17.4667(12) A, beta = 96.5740(10) degrees, Z = 2. For compound 9: monoclinic, P2(1)/n, a =10.5699(3) A, b = 11.5037(3) A, c = 13.5194(4) A, beta = 110.2779(10) degrees, Z = 2. For compound 10: monoclinic, P2(1)/n, a = 9.8033(3) A, b = 12.1369(5) A, c = 13.5215(5) A, beta = 107.3280(10) degrees, Z = 2. For compound 11: monoclinic C2/c, a = 18.947(2) A, b = 9.7593(10) A, c = 19.761(2) A, beta = 97.967(2) degrees, Z = 8. Both complexes 6 and 7 are noninterpenetrating frameworks based on the (6, 3) nets, and 8, 9 and 10 are based on the (4, 4) nets while complex 11 has a twofold parallel interpenetrated network with 4.8(2) topology. It is interesting that, in complexes 6,7, and 11 with three-coordinated planar silver(I) atoms, each ligand 4 or 5 connects three metal atoms, while in the case of complexes 8, 9, and 10 with six-coordinated octahedral metal atoms, each ligand 4 only links two metal atoms, and another imidazole nitrogen atom of 4 did not participate in the coordination with the metal atoms in these complexes. The results show that the nature of organic ligand and geometric needs of metal atoms have great influence on the structure of metal-organic frameworks. 相似文献
17.
The reactions of Co(CIO4)2.6H2O and Co(NO3)2·6H2O with the di-Schiff base ligand N,N'-bis-(1-benzimidazo-2-yl-ethylidene)-ethane-1,2-diamine (LA) in ethanol have been investigated.The reactions of LA with excess amount of cobalt salts yield the six-coordinate complexes [CoL2](CIO4)2·H2O 1 and [CoL2](NO3)2·H2O 2 as isolatable products (L = N-(1-benzimidazo-2-yl-ethylidene)-ethane-1,2-diamine), where L is a tri-dentate mono-Schiff base ligand, resulting from the hydrolysis of the precursor di-Schiff base LA.Both complexes were characterized by X-ray crystallography.Crystal data for complex 1: monoclinic, space group P21/c, a = 11.9214(10), b = 23.5828(17), c = 14.0387(12)(A), β= 135.219[4]°,C22H30CI2CoN9O9,Mr = 680.37, V = 2780.1(4)(A)3, Z = 4, Dc = 1.625 g/cm3,μ(MoKa) = 0.876 mm-1, F(000) = 1404,the final R = 0.0725 and wR = 0.1530 for 5726 observed reflections (I>2σ(I)).Crystal data for complex 2: monoclinic, space group P21/c, a = 18.2162(16), b = 10.0610(6), c = 18.593(2)(A),β=130.099(3)°, C22H30CoN10O7, Mr = 605.49, V = 2606.5(4)(A)3, Z = 4, Dc = 1.543 g/cm3,μ(MoKα)= 0.722 mm-1, F(000) = 1260, the final R = 0.0619 and wR = 0.1429 for 5194 observed reflections (I > 2σ(I)).X-ray diffraction analysis reveals that each cobalt atom in the two complexes is chelated by six nitrogen atoms from two tridentate iigands L, exhibiting a slightly distorted octahedral coordination sphere.In both complexes, the strong hydrogen-bonding interactions between the lattice waters and N-H groups of the ligands result in 1D chains which are further connected by ClO4- (or NO3-) groups to form a 3D framework.In complex 2, the strong π-π interactions increase the stability of the structure. 相似文献
18.
New coordination polymers of the formula [M(btre)(2)(NCS)(2)] (btre = 1,2-bis(1,2,4-triazol-4-yl)ethane; M(II) = Fe, Co) have been synthesized, and their crystal structures have been determined at 293 K by X-ray analysis. The Fe(II) compound (C(7)H(8)FeN(7)S(2)) crystallizes in the monoclinic space group P2(1)/n, a = 12.439(5) A, b = 8.941(2) A, c = 9.321(3) A, beta = 90.88(2) degrees , V = 1036.6(6) A(3), Z = 2, 3791 reflections [I > 3sigma(I)], R(F) = 0.036, wR2 = 0.123. The Co(II) compound is isostructural to the Fe(II) compound. The crystal structure consists of a 2D sheet in which the metal ions are linked by bis monodentate (N1, N1') 1,2,4-triazole ligands. The structure is stabilized by pi-bond interactions between two adjacent sheets and by S...S interactions. Temperature-dependent SQUID, (57)Fe M?ssbauer, and X-ray diffraction measurements indicate that [Fe(btre)(2)(NCS)(2)] retains a HS ground state upon cooling from 293 K down to 8 K. The surprising absence of spin-crossover behavior for this Fe(II)-1,2,4-triazole polymeric coordination compound that has been confirmed by pressure experiments up to approximately 12 kbar and by light irradiation experiments at 10 K is discussed on the basis of its structural features. Insight into the origin of the cooperative effects of the spin transition in [Fe(btr)(2)(NCS)(2)].H(2)O (btr = 4,4'-bis-1,2,4-triazole) is also given thanks to a re-evaluation of its distortion parameters in the high- and low-spin states. 相似文献
19.
A novel one-dimensional chain-like coordination polymer constructed from 3-nitrobenzene-1,2-dicarboxylic acid, [Cd2(C8H3NO6)2(H2O)4]n·2nH2O, has been synthesized and its structure was determined by X-ray crystallography method. The crystal belongs to monoclinic, space group P21/c with a = 6.1252(8), b = 20.706(3), c = 8.8067(11) (A), β = 95.608(2)°, V= 1111.6(2)(A)3, Mr =751.12, Dc = 2.244 g/cm3, F(000) = 736, μ = 2.011 mm-1, Z = 2, the final R = 0.0262 and wR = 0.0692for 2338 observed reflections with I > 2σ(I). The structure of the title compound presents a 1-D chain-like structure constructed by dimer units, [Cd2(CsH3NO6)2(H2O)4]n, through two carboxylate oxygen atoms. The fluorescence of the tifle compound has been also discussed in this paper. 相似文献
20.
Little MA Ronson TK Hardie MJ 《Dalton transactions (Cambridge, England : 2003)》2011,40(45):12217-12227
A series of new 1D chain and 2D coordination polymers with cyclotriguaiacylene-type ligands are reported. A zig-zag 1D coordination chain is found in complex [Cd(2)(4ph4py)(NO(3))(3)(H(2)O)(2)(DMA)(2)]·(NO(3))·(DMA)(4), where 4ph4py = tris[4-(4-pyridyl)benzoyl]-cyclotriguaiacylene and DMA = dimethylacetamide, while complex [Zn(4ph4py)(2)(CF(3)COO)(H(2)O)]·(CF(3)COO)(NMP)(7), where NMP = N-methylpyrrolidone, has a doubly bridged coordination chain structure. Complexes [M(3ph3py)(NO(3))(2)]·(NMP)(4) where M = Co or Zn, 3ph3py = tris[3-(3-pyridyl)benzoyl]cyclotriguaiacylene, are isostructural and feature 1D ladder coordination chains. Complexes [Cd(2)(4ph4py)(2)(NO(3))(4)(NMP)]·(NMP)(9)(H(2)O)(4) and [Co(4ph4py)(H(2)O)(2)]·(NO(3))(2)·(DMF)(2), where DMF = dimethylformamide, both have (3,4)-connected 2D coordination polymers with a rare (4(2).6(2))(4.6(2))(2) topology. A 2D coordination polymer with this topology is also found in complex [Co(2)(3ph4py)(2)(NO(3))(H(2)O)(5)]·(NO(3))(3)·(DMF)(9) where 3ph4py = tris[3-(4-pyridyl)benzoyl]cyclotriguaiacylene. All 2D coordination polymer complexes are interpenetrating or polycatenating. [Co(2)(3ph4py)(2)(NO(3))(H(2)O)(5)](3+)polymers form a 2D→3D polycatenation showing self-complementary "hand-shake" interactions between the host-type ligands. 相似文献