Heterobimetallic Clusters of Copper(I) with Trithiotungstate and Trithiomolybdate. Synthesis and Characterization of the Octanuclear Clusters [Et(4)N](4)[M(4)Cu(4)S(12)O(4)] (M = Mo, W) and the Dodecanuclear Clusters [M(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (M = Mo, W; TMEN = N,N,N',N'-Tetramethylethylenediamine)

Synthetic methods for [Et(4)N](4)[W(4)Cu(4)S(12)O(4)] (1), [Et(4)N](4)[Mo(4)Cu(4)S(12)O(4)] (2), [W(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (3), and [Mo(4)Cu(4)S(12)O(4)(CuTMEN)(4)] (4) are described. [Et(4)N](2)[MS(4)], [Et(4)N](2)[MS(2)O(2)], Cu(NO(3))(2).3H(2)O, and KBH(4) (or Et(4)NBH(4)) were used as starting materials for the synthesis of 1 and 2. Compounds 3 and 4 were produced by reaction of [Et(4)N](2)[WOS(3)], Cu(NO(3))(2).3H(2)O, and TMEN and by reaction of [Me(4)N](2)[MO(2)O(2)S(8)], Cu(NO(3))(2).3H(2)O, and TMEN, respectively. Crystal structures of compounds 1-4 were determined. Compounds 1 and 2 crystallized in the monoclinic space group C2/c with a = 14.264(5) ?, b = 32.833(8) ?, c = 14.480(3) ?, beta = 118.66(2) degrees, V = 5950.8(5) ?(3), and Z = 4 for 1 and a = 14.288(5) ?, b = 32.937(10) ?, c = 14.490(3) ?, beta = 118.75(2) degrees, V = 5978.4(7) ?(3), and Z = 4 for 2. Compounds 3 and 4 crystallized in the trigonal space group P3(2)21 with a = 13.836(6) ?, c = 29.81(1) ?, V = 4942(4) ?(3), and Z = 3 for 3 and a = 13.756(9) ?, c = 29.80(2) ?, V = 4885(6) ?(3), and Z = 3 for 4. The cluster cores have approximate C(2v) symmetry. The anions of 1 and 2 may be viewed as consisting of two butterfly-type [CuMOS(3)Cu] fragments bridged by two [MOS(3)](2-) groups. Eight metal atoms in the anions are arranged in an approximate square configuration, with a Cu(4)M(4)S(12) ring structure. Compounds 3 and 4 can be considered to consist of one [M(4)Cu(4)S(12)O(4)](4-) (the anions of 1 and 2) unit capped by Cu(TMEN)(+) groups on each M atom; the Cu(TMEN)(+) groups extend alternately up and down around the Cu(4)M(4) square. The electronic spectra of the compounds are dominated by the internal transitions of the [MOS(3)](2-) moiety. (95)Mo NMR spectral data are investigated and compared with those of other compounds.     

Hydrothermal Synthesis, Structure, and Solid State (19)F NMR Study of ULM-17: (H(3)O)(2)[V(4)(HPO(4))(PO(4))(3)O(6)F](2)[NC(7)H(14)](6)

(H(3)O)(2)[V(4)(HPO(4))(PO(4))(3)O(6)F](2)[NC(7)H(14)](6) (labeled ULM-17) has been hydrothermally synthesized (150 degrees, 24 h, autogeneous pressure). It is monoclinic (space group P2(1)/c (No. 14)) with a = 21.4747(6) ?, b = 17.7223(5) ?, c = 20.1616(6) ?, beta = 94.329(1) degrees, and Z = 4. The structure consists in the hexagonal close packing of discrete hydronium cations, protonated quinuclidine and molecular anions [V(4)(HPO(4))(PO(4))(3)O(6)F](4)(-) (1) The structure presents two kinds of octameric anions built up from the tetrahedral arrangement of V(V)O(5)F octahedra sharing edges and vertices, capped by phosphorus tetrahedra. The stability of the solid is ensured via strong hydrogen bonds between the oxygens of the polyanions and the hydrogens of both hydronium and quinuclidinium cations. The particuliar location of fluorine at the center of the molecular anion 4-fold coordinated by V(V) was studied by solid state NMR.     

Sandwich-type germanotungstates: structure and magnetic properties of the dimeric polyoxoanions [M4(H2O)2(GeW9O34)2]12 - (M = Mn2+, Cu2+, Zn2+, Cd2+)

The novel dimeric germanotungstates [M(4)(H(2)O)(2)(GeW(9)O(34))(2)](12)(-) (M = Mn(2+), Cu(2+), Zn(2+), Cd(2+)) have been synthesized and characterized by IR spectroscopy, elemental analysis, magnetic measurements, and (183)W-NMR spectroscopy. X-ray single-crystal analyses were carried out on Na(12)[Mn(4)(H(2)O)(2)(GeW(9)O(34))(2)].38H(2)O (Na(12)()-1), which crystallizes in the monoclinic system, space group P2(1)/n, with a = 13.0419(8) A, b = 17.8422(10) A, c = 21.1626(12) A, beta = 93.3120(10) degrees, and Z = 2; Na(11)Cs(2)[Cu(4)(H(2)O)(2)(GeW(9)O(34))(2)]Cl.31H(2)O (Na(11)()Cs-2) crystallizes in the triclinic system, space group P, with a = 12.2338(17) A, b = 12.3833(17) A, c = 15.449(2) A, alpha = 100.041(2) degrees, beta = 97.034(2) degrees, gamma = 101.153(2) degrees, and Z = 1; Na(12)[Zn(4)(H(2)O)(2)(GeW(9)O(34))(2)].32H(2)O (Na(12)()-3) crystallizes in the triclinic system, space group P, with a = 11.589(3) A, b = 12.811(3) A, c = 17.221(4) A, alpha = 97.828(6) degrees, beta = 106.169(6) degrees, gamma = 112.113(5) degrees, and Z = 1; Na(12)[Cd(4)(H(2)O)(2)(GeW(9)O(34))(2)].32.2H(2)O (Na(12)()-4) crystallizes also in the triclinic system, space group P, with a = 11.6923(17) A, b = 12.8464(18) A, c = 17.616(2) A, alpha = 98.149(3) degrees, beta = 105.677(3) degrees, gamma = 112.233(2) degrees, and Z = 1. The polyanions consist of two lacunary B-alpha-[GeW(9)O(34)](10)(-) Keggin moieties linked via a rhomblike M(4)O(16) (M = Mn, Cu, Zn, Cd) group leading to a sandwich-type structure. (183)W-NMR studies of the diamagnetic Zn and Cd derivatives indicate that the solid-state polyoxoanion structures are preserved in solution. EPR measurements on Na(12)()-1 at frequencies up to 188 GHz and temperatures down to 4 K yield a single, exchange-narrowed peak, at g(iso) = 1.9949, typical of Mn systems, and an upper limit of |D| = 20.0 mT; its magnetization studies still await further theoretical treatment. Detailed EPR studies on Na(11)()Cs-2 over temperatures down to 2 K and variable frequencies yield g( parallel ) = 2.4303 and g( perpendicular ) = 2.0567 and A( parallel ) = 4.4 mT (delocalized over the Cu(4) framework), with |D| = 12.1 mT. Magnetization studies in addition yield the exchange parameters J(1) = -11 and J(2) = -82 cm(-)(1), in agreement with the EPR studies.     

Trivalent [(C5Me5)2(THF)Ln]2(mu-eta2:eta2-N2) complexes as reducing agents including the reductive homologation of CO to a ketene carboxylate, (mu-eta4-O2C-C=C=O)2-

The [Z(2)Ln(THF)](2)(mu-eta(2)():eta(2)()-N(2)) complexes (Z = monoanionic ligand) generated by reduction of dinitrogen with trivalent lanthanide salts and alkali metals are strong reductants in their own right and provide another option in reductive lanthanide chemistry. Hence, lanthanide-based reduction chemistry can be effected in a diamagnetic trivalent system using the dinitrogen reduction product, [(C(5)Me(5))(2)(THF)La](2)(mu-eta(2)():eta(2)()-N(2)), 1, readily obtained from [(C(5)Me(5))(2)La][BPh(4)], KC(8), and N(2). Complex 1 reduces phenazine, cyclooctatetraene, anthracene, and azobenzene to form [(C(5)Me(5))(2)La](2)[mu-eta(3):eta(3)-(C(12)H(8)N(2))], 2, (C(5)Me(5))La(C(8)H(8)), 3, [(C(5)Me(5))(2)La](2)[mu-eta(3):eta(3)-(C(14)H(10))], 4, and [(C(5)Me(5))La(mu-eta(2)-(PhNNPh)(THF)](2), 5, respectively. Neither stilbene nor naphthalene are reduced by 1, but 1 reduces CO to make the ketene carboxylate complex {[(C(5)Me(5))(2)La](2)[mu-eta(4)-O(2)C-C=C=O](THF)}(2), 6, that contains CO-derived carbon atoms completely free of oxygen.     

Pentanuclear homoleptic M(5)L(6) (M = Mn(II), Co(II), Zn(II)) complexes formed by strict self-assembly

A series of trigonal bipyramidal pentanuclear complexes involving the alkoxo-diazine ligands poap and p3oap, containing the M(5)[mu-O](6) core is described, which form by a strict self-assembly process. [Co(5)(poap-H)(6)](ClO(4))(4).3H(2)O (1), [Mn(5)(poap-H)(6)](ClO(4))(4).3.5CH(3)OH.H(2)O (2), [Mn(5)(p3oap-H)(6)](ClO(4))(4).CH(3)CH(2)OH.3H(2)O (3), and [Zn(5)(poap-H)(6)](ClO(4))(4).2.5H(2)O (4) are homoleptic pentanuclear complexes, where there is an exact match between the coordination requirements of the five metal ions in the cluster, and the available coordination pockets in the polytopic ligand. [Zn(4)(poap)(poap-H)(3)(H(2)O)(4)] (NO(3))(5).1.5H(2)O (5) is a square [2 x 2] grid with a Zn(4)[mu-O](4) core, and appears to result from the presence of NO(3), which is thought to be a competing ligand in the self-assembly. X-ray structures are reported for 1, 4, and 5. 1 crystallized in the monoclinic system, space group P2(1)/n with a = 13.385(1) A, b = 25.797(2) A, c = 28.513(3) A, beta = 98.704(2) degrees, and Z = 4. 4 crystallized in the triclinic system, space group P1 with a = 13.0897(9) A, b = 18.889(1) A, c = 20.506(2) A, alpha = 87.116(1) degrees, beta = 74.280(2) degrees, gamma = 75.809(2) degrees, and Z = 2. 5 crystallized in the monoclinic system, space group P2(1)/n with a = 14.8222(7) A, b = 21.408(1) A, c = 21.6197(9) A, beta = 90.698(1) degrees, and Z = 4. Compounds 1-3 exhibit intramolecular antiferromagnetic coupling.     

Preparation,structures, and redox and emission characteristics of the isothiocyanate complexes of hexarhenium(III) clusters [Re6(mu3-E)8(NCS)6]4- (E = S,Se)

Hexarhenium(III) complexes with terminal isothiocyanate ligands, [(n-C(4)H(9))(4)N](4)[Re(6)(mu(3)-S)(8)(NCS)(6)] (1) and (L)(4)[Re(6)(mu(3)-Se)(8)(NCS)(6)] (L(+) = PPN(+) (2a), (n-C(4)H(9))(4)N(+) (2b)), have been prepared by three different methods. Complex 1 was prepared by the reaction of [(n-C(4)H(9))(4)N](4)[Re(6)(mu(3)-S)(8)Cl(6)] with molten KSCN at 200 degrees C, while 2b was obtained by refluxing the chlorobenzene-DMF (2:1 v/v) solution of [Re(6)(mu(3)-Se)(8)(CH(3)CN)(6)](SbF(6))(2) and [(n-C(4)H(9))(4)N]SCN. The [Re(6)(mu(3)-Se)(8)(NCS)(6)](4)(-) anion was also obtained from a mixture of Cs(2)[Re(6)(mu(3)-Se)(8)Br(4)] and KSCN in C(2)H(5)OH by a mechanochemical activation at room temperature for 20 h and isolated as 2a. The X-ray structures of 1 and 2a.4DMF have been determined (1, C(70)H(144)N(10)S(14)Re(6), monoclinic, space group P2(1)/n (No. 14), a = 14.464(7) A, b = 22.059(6) A, c = 16.642(8) A, beta = 113.62(3) degrees, V = 4864(3) A(3), Z = 2; 2a.4DMF, C(162)H(144)N(14)O(4)P(8)S(6)Se(8)Re(6), triclinic, space group P1 (No. 2), a = 15.263(2) A, b = 16.429(2) A, c = 17.111(3) A, alpha = 84.07(1) degrees, beta = 84.95(1) degrees, gamma = 74.21(1) degrees, V = 4098.3(8) A(3), Z = 1). All the NCS(-) ligands in both complexes are coordinated to the metal center via nitrogen site with the Re-N distances in the range of 2.07-2.13 A. The redox potentials of the reversible Re(III)(6)/Re(III)(5)Re(IV) process in acetonitrile are +0.84 and +0.70 V vs. Ag/AgCl for [Re(6)(mu(3)-S)(8)(NCS)(6)](4)(-) and [Re(6)(mu(3)-Se)(8)(NCS)(6)](4)(-), respectively, which are the most positive among the known hexarhenium complexes with six terminal anionic ligands. The complexes show strong red luminescence with the emission maxima (lambda(max)/nm), lifetimes (tau(em)/micros), and quantum yields (phi(em)) being 745 and 715, 10.4 and 11.8, and 0.091 and 0.15 for 1 and 2b, respectively, in acetonitrile. The data reasonably well fit in the energy-gap plots of other hexarhenium(III) complexes. The temperature dependence of the emission spectra and tau(em) of 1 and [(n-C(4)H(9))(4)N](4)[Re(6)(mu(3)-S)(8)Cl(6)] are also reported.     

Synthesis and characterization of the silver maleonitrilediselenolates and silver maleonitriledithiolates [K([2.2.2]-cryptand)]4[Ag4(Se2C2(CN)2)4], [Na([2.2.2]-cryptand)]4[Ag4(S2C2(CN)2)4].0.33MeCN, [NBu4]4[Ag4(S2C2(CN)2)4], [K([2.2.2]-cryptand)]3[Ag(Se2C2(CN)2)2].2MeCN, and [Na([2.2.2]-cryptand)]3[Ag(S2C2(CN)2)2

Reaction of AgBF(4), KNH(2), K(2)Se, Se, and [2.2.2]-cryptand in acetonitrile yields [K([2.2.2]-cryptand)](4)[Ag(4)(Se(2)C(2)(CN)(2))(4)] (1). In the unit cell of 1 there are four [K([2.2.2]-cryptand)](+) units and a tetrahedral Ag(4) anionic core coordinated in mu(1)-Se, mu(2)-Se fashion by each of four mns ligands (mns = maleonitrilediselenolate, [Se(2)C(2)(CN)(2)](2)(-)). Reaction of AgNO(3), Na(2)(mnt) (mnt = maleonitriledithiolate, [S(2)C(2)(CN)(2)](2)(-)), and [2.2.2]-cryptand in acetonitrile yields [Na([2.2.2]-cryptand)](4)[Ag(4)(mnt)(4)].0.33MeCN (2). The Ag(4) anion of 2 is analogous to that in 1. Reaction of AgNO(3), Na(2)(mnt), and [NBu(4)]Br in acetonitrile yields [NBu(4)](4)[Ag(4)(mnt)(4)] (3). The anion of 3 also comprises an Ag(4) core coordinated by four mnt ligands, but the Ag(4) core is diamond-shaped rather than tetrahedral. Reaction of [K([2.2.2]-cryptand)](3)[Ag(mns)(Se(6))] with KNH(2) and [2.2.2]-cryptand in acetonitrile yields [K([2.2.2]-cryptand)](3)[Ag(mns)(2)].2MeCN (4). The anion of 4 comprises an Ag center coordinated by two mns ligands in a tetrahedral arrangement. Reaction of AgNO(3), 2 equiv of Na(2)(mnt), and [2.2.2]-cryptand in acetonitrile yields [Na([2.2.2]-cryptand)](3)[Ag(mnt)(2)] (5). The anion of 5 is analogous to that of 4. Electronic absorption and infrared spectra of each complex show behavior characteristic of metal-maleonitriledichalcogenates. Crystal data (153 K): 1, P2/n, Z = 2, a = 18.362(2) A, b = 16.500(1) A, c = 19.673(2) A, beta = 94.67(1) degrees, V = 5941(1) A(3); 2, P4, Z = 4, a= 27.039(4) A, c = 15.358(3) A, V = 11229(3) A(3); 3, P2(1)/c, Z = 6, a = 15.689(3) A, b = 51.924(11) A, c = 17.393(4) A, beta = 93.51(1) degrees, V = 14142(5) A(3); 4, P2(1)/c, Z = 4, a = 13.997(1) A, b = 21.866(2) A, c = 28.281(2) A, beta = 97.72(1) degrees, V = 8578(1) A(3); 5, P2/n, Z = 2, a = 11.547(2) A, b = 11.766(2) A, c = 27.774(6) A, beta = 91.85(3) degrees, V = 3772(1) A(3).     

Structure,magnetism, and electrochemistry of the multinickel polyoxoanions [Ni6As3W24O94(H2O)2]17-, [Ni3Na(H2O)2(AsW9O34)2]11-, and [Ni4Mn2P3W24O94(H2O)2]17-

The three novel, multi-nickel-substituted heteropolytungstates [Ni(6)As(3)W(24)O(94)(H(2)O)(2)](17)(-) (1), [Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)](11)(-) (2), and [Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)](17)(-) (3) have been synthesized and characterized by IR, elemental analysis, electrochemistry, and magnetic studies. Single-crystal X-ray analysis was carried out on Na(16.5)Ni(0.25)[Ni(6)As(3)W(24)O(94)(H(2)O)(2)].54H(2)O, which crystallizes in the triclinic system, space group P1, with a = 17.450(4) A, b = 17.476(4) A, c = 22.232(4) A, alpha = 85.73(3) degrees, beta = 89.74(3) degrees, gamma = 84.33(3) degrees, and Z = 2, Na(11)[Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)].30.5H(2)O, which crystallizes in the triclinic system, space group P1, with a = 12.228(2) A, b = 16.743(3) A, c = 23.342(5) A, alpha = 78.50(3) degrees, beta = 80.69(3) degrees, gamma = 78.66(3) degrees, and Z = 2, and Na(17)[Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)].50.5H(2)O, which crystallizes in the monoclinic system, space group P2(1)/c, with a = 17.540(4) A, b = 22.303(5) A, c = 35.067(7) A, beta = 95.87(3) A, and Z = 4. Polyanion 1 consists of two B-alpha-(Ni(3)AsW(9)O(40)) Keggin moieties linked via a unique AsW(6)O(16) fragment, leading to a banana-shaped structure with C(2)(v)() symmetry. The mixed-metal tungstophosphate 3 is isostructural with 1. Polyanion 2 consists of two lacunary B-alpha-[AsW(9)O(34)](9)(-) Keggin moieties linked via three nickel(II) centers and a sodium ion. Electrochemical studies show that 1-3 exhibit a unique and reproducible voltammetric pattern and that all three compounds are stable in a large pH range. An investigation of the magnetic properties of 1-3 indicates that the exchange interactions within the trimetal clusters are ferromagnetic. However, for 1 and 3 intra- and intermolecular interactions between different trinuclear clusters are also present.     

High-dimensional assembly depending on polyoxoanion templates, metal ion coordination geometries, and a flexible bis(imidazole) ligand

By introducing the flexible 1,1'-(1,4-butanediyl)bis(imidazole) (bbi) ligand into the polyoxovanadate system, five novel polyoxoanion-templated architectures based on [As(8)V(14)O(42)](4-) and [V(16)O(38)Cl](6-) building blocks were obtained: [M(bbi)(2)](2)[As(8)V(14)O(42)(H(2)O)] [M = Co (1), Ni (2), and Zn (3)], [Cu(bbi)](4)[As(8)V(14)O(42)(H(2)O)] (4), and [Cu(bbi)](6)[V(16)O(38)Cl] (5). Compounds 1-3 are isostructural, and they exhibit a binodal (4,6)-connected 2D structure with Schl?fli symbol (3(4) x 4(2))(3(4) x 4(4) x 5(4) x 6(3))(2), in which the polyoxoanion induces a closed four-membered circuit of M(4)(bbi)(4). Compound 4 exhibits an interesting 3D framework constructed from tetradentate [As(8)V(14)O(42)](4-) cluster anions and cationic ladderlike double chains. There exists a bigger M(8)(bbi)(6)O(2) circuit in 4. The 3D extended structure of 5 is composed of heptadentate [V(16)O(38)Cl](6-) anions and flexural cationic chains; the latter consists of six Cu(bbi) segments arranged alternately. It presents the largest 24-membered circuit of M(24)(bbi)(24) so far observed made of bbi molecules and transition-metal cations. Investigation of their structural relations shows the important template role of the polyoxoanions and the synergetic interactions among the polyoxoanions, transition-metal ions, and flexible ligand in the assembly process. The magnetic properties of compounds 1-3 were also studied.     

Vanadogermanate cluster anions

Three novel vanadogermanate cluster anions have been synthesized by hydrothermal reactions. The cluster anions are derived from the (V(18)O(42)) Keggin cluster shell by substitution of V=O(2+) "caps" by Ge(2)O(OH)(2)(4+) species. In Cs(8)[Ge(4)V(16)O(42)(OH)(4)].4.7H(2)O, 1, (monoclinic, space group C2/c (No. 15), Z = 8, a = 44.513(2) A, b = 12.7632(7) A, c = 22.923(1) A, beta = 101.376(1) degrees ) and (pipH(2))(4)(pipH)(4)[Ge(8)V(14)O(50).(H(2)O)] (pip = C(4)N(2)H(10)), 2 (tetragonal, space group P4(2)/nnm (No. 134), Z = 2, a = 14.9950(7) A, c = 18.408(1) A), two and four VO(2+) caps are replaced, respectively, and each cluster anion encapsulates a water molecule. In K(5)H(8)Ge(8)V(12)SO(52).10H(2)O, 3, (tetragonal, space group I4/m (No. 87), Z = 2, a = 15.573(1) A, c = 10.963(1) A), four VO(2+) caps are replaced by Ge(2)O(OH)(2)(4+) species, and an additional two are omitted. The cluster ion in 3 contains a sulfate anion disordered over two positions. The cluster anions are analogous to the vanadoarsenate anions [V(18)(-)(n)()As(2)(n)()O(42)(X)](m)(-) (X = SO(3), SO(4), Cl; n = 3, 4) previously reported.     

Polyoxometalate Derivatives with Multiple Organic Groups. 3. Synthesis and Structure of Bis(phenyltin) Bis(decatungstosilicate), [(PhSnOH(2))(2)(gamma-SiW(10)O(36))(2)](10)(-)

A new phenyltin tungstosilicate derivative, [(PhSnOH(2))(2)(gamma-SiW(10)O(36))(2)](10)(-) (1), has been prepared by reaction of phenyltin trichloride with K(8)[gamma-SiW(10)O(36)].xH(2)O. The new heteropolyanion was characterized by elemental analysis, infrared spectroscopy, multinuclear NMR, and X-ray crystallography. The crystals of Cs(9)H[(PhSnOH(2))(2)(gamma-SiW(10)O(36))(2)].16H(2)O (Cs salt of 1) are triclinic, space group P&onemacr;, with lattice constants a = 12.401(3) ?, b = 13.832(3) ?, c = 16.313(3) ?, alpha = 96.17(2) degrees, beta = 109.73(2) degrees, gamma = 97.13(2) degrees, V = 2579.9(10) ?, and Z = 1. Anion 1 has a structure of virtual C(2)(h)() symmetry with two phenyltin groups sandwiched between two gamma-SiW(10) groups. Such a structure is different from all previously reported polytungstates derived from [gamma-SiW(10)O(36)](8)(-) lacunary anions.     

Group 9 Chalcogenometalates

The compounds [K(18-crown-6)](3)[Ir(Se(4))(3)] (1), [K(2.2.2-cryptand)](3)[Ir(Se(4))(3)].C(6)H(5)CH(3) (2), and [K(18-crown-6)(DMF)(2)][Ir(NCCH(3))(2)(Se(4))(2)] (3) (DMF = dimethylformamide) have been prepared from the reaction of [Ir(NCCH(3))(2)(COE)(2)][BF(4)] (COE = cyclooctene) with polyselenide anions in acetonitrile/DMF. Analogous reactions utilizing [Rh(NCCH(3))(2)(COE)(2)][BF(4)] as a Rh source produce homologues of the Ir complexes; these have been characterized by (77)Se NMR spectroscopy. [NH(4)](3)[Ir(S(6))(3)].H(2)O.0.5CH(3)CH(2)OH (4) has been synthesized from the reaction of IrCl(3).nH(2)O with aqueous (NH(4))(2)S(m)(). In the structure of [K(18-crown-6)](3)[Ir(Se(4))(3)] (1) the Ir(III) center is chelated by three Se(4)(2)(-) ligands to form a distorted octahedral anion. The structure contains a disordered racemate of the Deltalambdalambdalambda and Lambdadeltadeltadelta conformers. The K(+) cations are pulled out of the planes of the crowns and interact with Se atoms of the [Ir(Se(4))(3)](3)(-) anion. [K(2.2.2-cryptand)](3)[Ir(Se(4))(3)].C(6)H(5)CH(3) (2) possesses no short K.Se interactions; here the [Ir(Se(4))(3)](3)(-) anion crystallizes as the Deltalambdalambdadelta/Lambdadeltadeltalambda racemate. In the crystal structure of [K(18-crown-6)(DMF)(2)][Ir(NCCH(3))(2)(Se(4))(2)] (3), the K(+) cation is coordinated by an 18-crown-6 ligand and two DMF molecules and the anion comprises an octahedral Ir(III) center bound by two chelating Se(4)(2)(-) chains and two trans acetonitrile groups. The [Ir(Se(4))(3)](3)(-) and [Rh(Se(4))(3)](3)(-) anions undergo conformational transformations as a function of temperature, as observed by (77)Se NMR spectroscopy. The thermodynamics of these transformations are: [Ir(Se(4))(3)](3)(-), DeltaH = 2.5(5) kcal mol(-)(1), DeltaS = 11.5(2.2) eu; [Rh(Se(4))(3)](3)(-), DeltaH = 5.2(7) kcal mol(-)(1), DeltaS = 24.7(3.0) eu.     

Tetranuclear and Pentanuclear Vanadium(IV/V) Carboxylate Complexes: [V(4)O(8)(NO(3))(O(2)CR)(4)](2-) and [V(5)O(9)X(O(2)CR)(4)](2-) (X = Cl(-), Br(-)) Salts

The syntheses and properties of tetra- and pentanuclear vanadium(IV,V) carboxylate complexes are reported. Reaction of (NBzEt(3))(2)[VOCl(4)] (1a) with NaO(2)CPh and atmospheric H(2)O/O(2) in MeCN leads to formation of (NBzEt(3))(2)[V(5)O(9)Cl(O(2)CPh)(4)] 4a; a similar reaction employing (NEt(4))(2)[VOCl(4)] (1b) gives (NEt(4))(2)[V(5)O(9)Cl(O(2)CPh)(4)] (4b). Complex 4a.MeCN crystallizes in space group P2(1)2(1)2(1) with the following unit cell dimensions at -148 degrees C: a = 13.863(13) ?, b = 34.009(43) ?, c = 12.773(11) ?, and Z = 4. The reaction between (NEt(4))(2)[VOBr(4)] (2a) and NaO(2)CPh under similar conditions gives (NEt(4))(2)[V(5)O(9)Br(O(2)CPh)(4)] (6a), and the use of (PPh(4))(2)[VOBr(4)] (2b) likewise gives (PPh(4))(2)[V(5)O(9)Br(O(2)CPh)(4)] (6b). Complex 6b crystallizes in space group P2(1)2(1)2(1) with the following unit cell dimensions at -139 degrees C: a = 18.638(3) ?, b = 23.557(4) ?, c = 12.731(2) ?, and Z = 4. The anions of 4a and 6b consist of a V(5) square pyramid with each vertical face bridged by a &mgr;(3)-O(2)(-) ion, the basal face bridged by a &mgr;(4)-X(-) (X = Cl, Br) ion, and a terminal, multiply-bonded O(2)(-) ion on each metal. The RCO(2)(-) groups bridge each basal edge to give C(4)(v)() virtual symmetry. The apical and basal metals are V(V) and V(IV), respectively (i.e., the anions are trapped-valence). The reaction of 1b with AgNO(3) and Na(tca) (tca = thiophene-2-carboxylate) in MeCN under anaerobic conditions gives (NEt(4))(2)[V(4)O(8)(NO(3))(tca)(4)] (7). Complex 7.H(2)O crystallizes in space group C2/c with the following unit cell dimensions at -170 degrees C: a = 23.606(4) ?, b = 15.211(3) ?, c = 23.999(5) ?, and Z = 4. The anion of 7 is similar to those of 4a and 6b except that the apical [VO] unit is absent, leaving a V(4) square unit, and the &mgr;(4)-X(-) ion is replaced with a &mgr;(4),eta(1)-NO(3)(-) ion. The four metal centers are now at the V(IV), 3V(V) oxidation level, but the structure indicates four equivalent V centers, suggesting an electronically delocalized system. Variable-temperature magnetic susceptibility data were collected on powdered samples of 4b, 6a, and 7 in the 2.00-300 K range in a 10 kG applied field. 4b and 6a both show a slow increase in effective magnetic moment (&mgr;(eff)) from approximately 3.6-3.7 &mgr;(B) at 320 K to approximately 4.5-4.6 &mgr;(B) at 11.0 K and then a slight decrease to approximately 4.2 &mgr;(B) at 2.00 K. The data were fit to the theoretical expression for a V(IV)(4) square with two exchange parameters J = J(cis)() and J' = J(trans)() (H = -2JS(i)()S(j)()): fitting of the data gave, in the format 4b/6a, J= +39.7/+46.4 cm(-)(1), J' = -11.1/-18.2 cm(-)(1) and g = 1.83/1.90, with the complexes possessing S(T) = 2 ground states. The latter were confirmed by magnetization vs field studies in the 2.00-30.0 K and 0.500-50.0 kG ranges: fitting of the data gave S(T) = 2 and D = 0.00 cm(-)(1) for both complexes, where D is the axial zero-field splitting parameter. Complex 7 shows a nearly temperature-independent &mgr;(eff) (1.6-2.0 &mgr;(B)) consistent with a single d electron per V(4) unit. The (1)H NMR spectra of 4b and 6a in CD(3)CN are consistent with retention of their pentanuclear structure on dissolution. The EPR spectrum of 7 in a toluene/MeCN (1:2) solution at approximately 25 degrees C yields an isotropic signal with a 29-line hyperfine pattern assignable to hyperfine interactions with four equivalent I = (7)/(2) (51)V nuclei.     

Metallosupramolecular chemistry with bis(benzene-o-dithiolato) ligands

The bis(benzene-o-dithiol) ligands H(4)-1, H(4)-2, and H(4)-3 react with [Ti(OC(2)H(5))(4)] to give dinuclear triple-stranded helicates [Ti(2)L(3)](4)(-) (L = 1(4)(-), 2(4)(-), 3(4)(-)). NMR spectroscopic investigations revealed that the complex anions possess C(3) symmetry in solution. A crystal structure analysis for (PNP)(4)[Ti(2)(2)(3)] ((PNP)(4)[14]) confirmed the C(3) symmetry for the complex anion in the solid state. The complex anion in Li(PNP)(3)[Ti(2)(1)(3)] (Li(PNP)(3)[13]) does not exhibit C(3) symmetry in the solid state due to the formation of polymeric chains of lithium bridged complex anions. Complexes [13](4)(-) and [14](4)(-) were obtained as racemic mixtures of the Delta,Delta and Lambda,Lambda isomers. In contrast to that, complex (PNP)(4)[Ti(2)(3)(3)] ((PNP)(4)[15]) with the enantiomerically pure chiral ligand 3(4)(-) shows a strong Cotton effect in the CD spectrum, indicating that the chirality of the ligands leads to the formation of chiral metal centers. The o-phenylene diamine bridged bis(benzene-o-dithiol) ligand H(4)-4 reacts with Ti(4+) to give the dinuclear double-stranded complex Li(2)[Ti(2)(4)(2)(mu-OCH(3))(2)] containing two bridging methoxy ligands between the metal centers. The crystal structure analysis and the (1)H NMR spectrum of (Ph(4)As)(2)[Ti(2)(4)(2)(mu-OCH(3))(2)] ((Ph(4)As)(2)[(16]) reveal C(2) symmetry for the anion [Ti(2)(4)(2)(mu-OCH(3))(2)](2)(-). For a comparative study the dicatechol ligand H(4)-5, containing the same o-phenylene diamine bridging group as the bis(benzene-o-dithiol) ligands H(4)-4, was prepared and reacted with [TiO(acac)(2)] to give the dinuclear complex anion [Ti(2)(5)(2)(mu-OCH(3))(2)](2)(-). The molecular structure of (PNP)(2)[Ti(2)(5)(2)(mu-OCH(3))(2)] ((PNP)(2)[17]) contains a complex anion which is similar to [16](2)(-), with the exception that strong N-H...O hydrogen bonds are formed in complex anion [17](2)(-), while N-H...S hydrogen bonds are absent in complex anion [16](2)(-).     

Cation-directed synthesis of tungstosilicates. 1. Syntheses and structures of K10A-alpha-[SiW9O34].24H2O,of the sandwich-type complex K10.75[Co(H2O)6]0.5[Co(H2O)4Cl]0.25A-alpha-[K2(Co(H2O)2)3(SiW9O34)2].32H2O and of Cs15[K(SiW11O39)2].39H2O

The influence of the nature of alkali metal cations on the structure of the species obtained from the trivacant precursor A-alpha-[SiW(9)O(34)](10-) has been studied. Starting from the potassium salt 1, K(10)A-alpha-[SiW(9)O(34)].24H(2)O, the sandwich-type complex 2, K(10.75)[Co(H(2)O)(6)](0.5)[Co(H(2)O)(4)Cl](0.25)A-alpha-[K(2)(Co(H(2)O)(2))(3)(SiW(9)O(34) )(2)].32H(2)O, has been obtained. The crystal structures of these two compounds consist of two A-alpha-[SiW(9)O(34)](10-) anions linked by a set of potassium (1) or cobalt plus potassium cations (2), and the relative orientation of the two half-anions is the same. Attempts to link two A-alpha-[SiW(9)O(34)](10-) anions by tungsten atoms instead of cobalt failed whatever the alkali metal cation. Moreover, the nondisordered structure of Cs(15)[K(SiW(11)O(39))(2)].39H(2)O is described. Two [SiW(11)O(39)](8-) anions are linked through a potassium cation with a "trans-oid" conformation, and the potassium occupies a cubic coordination site.     

Expanding the remarkable structural diversity of uranyl tellurites: hydrothermal preparation and structures of K[UO(2)Te(2)O(5)(OH)], Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O,beta-Tl(2)[UO(2)(TeO(3))(2)], and Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2)

The reactions of UO(2)(C(2)H(3)O(2))(2).2H(2)O with K(2)TeO(3).H(2)O, Na(2)TeO(3) and TlCl, or Na(2)TeO(3) and Sr(OH)(2).8H(2)O under mild hydrothermal conditions yield K[UO(2)Te(2)O(5)(OH)] (1), Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O (2) and beta-Tl(2)[UO(2)(TeO(3))(2)] (3), or Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2) (4), respectively. The structure of 1 consists of tetragonal bipyramidal U(VI) centers that are bound by terminal oxo groups and tellurite anions. These UO(6) units span between one-dimensional chains of corner-sharing, square pyramidal TeO(4) polyhedra to create two-dimensional layers. Alternating corner-shared oxygen atoms in the tellurium oxide chains are protonated to create short/long bonding patterns. The one-dimensional chains of corner-sharing TeO(4) units found in 1 are also present in 2. However, in 2 there are two distinct chains present, one where alternating corner-shared oxygen atoms are protonated, and one where the chains are unprotonated. The uranyl moieties in 2 are bound by five oxygen atoms from the tellurite chains to create seven-coordinate pentagonal bipyramidal U(VI). The structures of 3 and 4 both contain one-dimensional [UO(2)(TeO(3))(2)](2-) chains constructed from tetragonal bipyramidal U(VI) centers that are bridged by tellurite anions. The chains differ between 3 and 4 in that all of the pyramidal tellurite anions in 3 have the same orientation, whereas the tellurite anions in 4 have opposite orientations on each side of the chain. In 4, there are also additional isolated TeO(3)(2-) anions present. Crystallographic data: 1, orthorhombic, space group Cmcm, a = 7.9993(5) A, b = 8.7416(6) A, c = 11.4413(8) A, Z = 4; 2, orthorhombic, space group Pbam, a = 10.0623(8) A, b = 23.024(2) A, c = 7.9389(6) A, Z = 4; 3, monoclinic, space group P2(1)/n, a = 5.4766(4) A, b = 8.2348(6) A, c = 20.849(3) A, beta = 92.329(1) degrees, Z = 4; 4, monoclinic, space group C2/c, a = 20.546(1) A, b = 5.6571(3) A, c = 13.0979(8) A, beta = 94.416(1) degrees, Z = 4.     

Mixed-metal uranium(VI) iodates: hydrothermal syntheses,structures, and reactivity of Rb[UO(2)(CrO(4))(IO(3))(H(2)O)], A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K,Rb, Cs), and K(2)[UO(2)(MoO(4))(IO(3))(2)

The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4.     

Synthesis and Ligand Substitution Reactions of a Mesitylphosphido-Bridged Platinum(II) Dimer

The stable primary phosphine complexes trans-M(PH(2)Mes)(2)Cl(2) (1, M = Pd; 2, M = Pt; Mes = 2,4,6-(t-Bu)(3)C(6)H(2)) were prepared from Pd(PhCN)(2)Cl(2) and K(2)PtCl(4), respectively. Reaction of Pt(COD)Cl(2) (COD = 1,5-cyclooctadiene) with less bulky arylphosphines gives the unstable cis-Pt(PH(2)Ar)(2)Cl(2) (3, Ar = Is = 2,4,6-(i-Pr)(3)C(6)H(2); 4, Ar = Mes = 2,4,6-Me(3)C(6)H(2)). Spontaneous dehydrochlorination of 4 or direct reaction of K(2)PtCl(4) with 2 equiv of PH(2)Mes gives the insoluble primary phosphido-bridged dimer [Pt(PH(2)Mes)(&mgr;-PHMes)Cl](2) (5), which was characterized spectroscopically, including solid-state (31)P NMR studies. The reversible reaction of 5 with PH(2)Mes gives [Pt(PH(2)Mes)(2)(&mgr;-PHMes)](2)[Cl](2) (6), while PEt(3) yields [Pt(PEt(3))(2)(&mgr;-PHMes)](2)[Cl](2) (7), which on recrystallization forms [Pt(PEt(3))(&mgr;-PHMes)Cl](2) (8). Complex 5 and PPh(3) afford [Pt(PPh(3))(&mgr;-PHMes)Cl](2) (9). Addition of 1,2-bis(diphenylphosphino)ethane (dppe) to 5 gives the dicationic [Pt(dppe)(&mgr;-PHMes)](2)[Cl](2) (10-Cl), which was also obtained as the tetrafluoroborate salt 10-BF(4)() by deprotonation of [Pt(dppe)(PH(2)Mes)Cl][BF(4)] (11) with Et(3)N or by reaction of [Pt(dppe)(&mgr;-OH)](2)[BF(4)](2) with 2 equiv of PH(2)Mes. Complexes 8, 9, and 10-Cl.2CH(2)Cl(2).2H(2)O were characterized crystallographically.     

Anion-directed crystallization of coordination polymers: syntheses and characterization of Cu(4)(2-pzc)(4)(H(2)O)(8)(Mo(8)O(26)).2H(2)O and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2-pzc = 2-pyrazinecarboxylate)

Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo(8)O(26)](4-) and [V(10)O(28)H(4)](2-) anions were synthesized and structurally characterized: Cu(4)(2-pzc)(4))(H(2)O)(8)(Mo(8)O(26)).2H(2)O (1) and Cu(3)(2-pzc)(4)(H(2)O)(2)(V(10)O(28)H(4)).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) A, b = 13.4149(6) A, c = 15.9633(7) A, beta = 90.816(1) degrees; 2, triclinic, space group P1, a = 10.5896(10) A, b = 10.7921(10) A, c = 13.5168(13) A, alpha = 104.689(2) degrees, beta = 99.103(2) degrees, gamma = 113.419(2) degrees. Compound 1 contains [Cu(2-pzc)(H(2)O)(2)] chains charge-balanced by [Mo(8)O(26)](4-) anions. In compound 2, layers of [Cu(3)(2-pzc)(4)(H(2)O)(2)] form cavities that are filled with [V(10)O(28)H(4)](2-) anions. The magnetic properties of both compounds are described.     

Synthesis and characterization of iron(III)-substituted, dimeric polyoxotungstates, [Fe(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](n-) (n = 6, X = As(III), Sb(III); n = 4, X = Se(IV), Te(IV))

Interaction of the lacunary [alpha-XW(9)O(33)](9-) (X = As(III), Sb(III)) with Fe(3+) ions in acidic, aqueous medium leads to the formation of dimeric polyoxoanions, [Fe(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](6-) (X = As(III), Sb(III)) in high yield. X-ray single-crystal analyses were carried out on Na(6)[Fe(4)(H(2)O)(10)(beta-AsW(9)O(33))(2)] x 32H(2)O, which crystallizes in the monoclinic system, space group C2/m, with a = 20.2493(18) A, b = 15.2678(13) A, c = 16.0689(14) A, beta = 95.766(2) degrees, and Z = 2; Na(6)[Fe(4)(H(2)O)(10)(beta-SbW(9)O(33))(2)] x 32H(2)O is isomorphous with a = 20.1542(18) A, b = 15.2204(13) A, c = 16.1469(14) A, and beta = 95.795(2) degrees. The selenium and tellurium analogues are also reported, [Fe(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](4-) (X = Se(IV), Te(IV)). They are synthesized from sodium tungstate and a source of the heteroatom as precursors. X-ray single-crystal analysis was carried out on Cs(4)[Fe(4)(H(2)O)(10)(beta-SeW(9)O(33))(2)] x 21H(2)O, which crystallizes in the triclinic system, space group P macro 1, with a = 12.6648(10) A, b = 12.8247(10) A, c = 16.1588(13) A, alpha = 75.6540(10) degrees, beta = 87.9550(10) degrees, gamma = 64.3610(10) gamma, and Z = 1. All title polyanions consist of two (beta-XW(9)O(33)) units joined by a central pair and a peripheral pair of Fe(3+) ions leading to a structure with idealized C(2h) symmetry. It was also possible to synthesize the Cr(III) derivatives [Cr(4)(H(2)O)(10)(beta-XW(9)O(33))(2)](6-) (X = As(III), Sb(III)), the tungstoselenates(IV) [M(4)(H(2)O)(10)(beta-SeW(9)O(33))(2)]((16)(-)(4n)-) (M(n+) = Cr(3+), Mn(2+), Co(2+), Ni(2+), Zn(2+), Cd(2+), and Hg(2+)), and the tungstotellurates(IV) [M(4)(H(2)O)(10)(beta-TeW(9)O(33))(2)]((16-4n)-) (M(n+) = Cr(3+), Mn(2+), Co(2+), Ni(2+), Cu(2+), Zn(2+), Cd(2+), and Hg(2+)), as determined by FTIR. The electrochemical properties of the iron-containing species were also studied. Cyclic voltammetry and controlled potential coulometry aided in distinguishing between Fe(3+) and W(6+) waves. By variation of pH and scan rate, it was possible to observe the stepwise reduction of the Fe(3+) centers.