Synthesis,Crystal Structure and Photoluminescence of a One-dimensional Zinc(Ⅱ)Coordination Polymer with Substituted Terpyridine

<正>The title compound,[Zn(4-pytpy)(NO_3)_2](4-pytpy=4'-(4-pyridyl)-2,2':6',2"- terpyridine)1,has been synthesized by the solvothermal reaction of Zn(NO_3)_2·6H_2O with 4-pytpy in CH_3OH solution.It crystallizes in the triclinic system,space group P_1~-with a=8.358(6),b= 11.121(8),c=11.374(8)(?),α=74.226(11),β=74.532(11),γ=83.085(12)°,M_r=499.74,V= 979.3(12)(?)~3,Z=2,D_c=1.695 g/cm~3,F(000)=508,μ=1.309 mm~(-1),the final R=0.0547 and wR= 0.1588.X-ray crystal structure analysis revealed that the Zn~Ⅱis hexa-coordinated by two oxygen atoms from two nitrate groups and four nitrogen atoms,three of which are from the tridentate domain of one 4-pytpy and the other from the monodentate domain of another 4-pytpy.4-pytpy as a bridging ligand connects Zn~Ⅱinto a one-dimensional coordination polymer.     

Synthesis and Crystal Structure of a Tetranuclear Cu(Ⅰ) Complex with Vinyfidenebis(diphenylphosphine)

The vinylidenebis(diphenylphosphine) (vdpp) reacts with CuBr to give a tetranuclear complex, [Cu4(μ3-Br)2(μ2-Br)2(μ2-vdpp)2(CH3CN)2]·(CH3CN)2 1. The title complex has crystallo-graphically imposed centrosymmetry and presents a Cu4Br4 core with distorted stair-like structure. All copper(Ⅰ) atoms in 1 assume distorted tetrahedral coordination geometry. The distance of 2.7745(11) A between the two copper centers indicates the presence of ligand-supported Cu…Cu interactions. Crystal data for 1: C60H56Br4Cu4N4P4, Mr = 1530.77, triclinic, space group P1, a = 11.6593(9), b = 11.7181(9), c = 13.8711(11) A, α = 110.1020(10), ,β = 102.0050(10), γ = 109.8040(10)°, V = 1557.5(2) A3, Z = 1, Dc = 1.632 g/cm3, F(000) = 760, λ = 0.71073 A, T = 298(2) K, 2θmax = 50.04°,μ = 4.056 mm-1, S = 1.181, R = 0.0507 and wR = 0.1025.     

Synthesis,Crystal Structure and Magnetic Property of a Novel Cu(Ⅱ)-Fluconazole-azide Complex

The title compound formulated as Cu2(C13H11N6OF2)(N3)3CH3OH was synthesized and structurally characterized by elemental analysis,IR and single-crystal X-ray diffraction.In the structure of the complex,the deprotonated fluconazole and azide anion link two copper centers to construct a binuclear SBU and the azide anion exhibits a μ1,1-coordination mode.Each triazole group of fluconazole links two SBUs and the compound exhibits a chain-like architecture with strong antiferromagnetism.     

Synthesis and Crystal Structure of a Tetranuclear Cu（Ⅰ） Complex with Vinylidenebis（diphenylphosphine）

The vinylidenebis（diphenylphosphine） （vdpp） reacts with CuBr to give a tetranuclear complex, [Cu4（μ3-Br）2（μ2-Br）2（μ2-vdpp）2（CH3CN）2]·（CH3CN）2 1. The title complex has crystallo- graphically imposed centrosymmetry and presents a CuaBr4 core with distorted stair-like structure. All copper（I） atoms in 1 assume distorted tetrahedral coordination geometry. The distance of 2.7745（11） A between the two copper centers indicates the presence of ligand-supported Cu…Cu interactions. Crystal data for 1： C_60H_56Br_4Cu_4N_4P_4, Mr= 1530.77, triclinic, space group P1, a = 11.6593（9）, b = 11.7181（9）, c = 13.8711（11） А, a = 110.1020（10）, β = 102.0050（10）, γ = 109.8040（10）°, V = 1557.5（2） А^3, Z = 1, Dc = 1.632 g/cm^3, F（000） = 760, λ= 0.71073А, T = 298（2） K, 2θmax = 50.04°,μ= 4.056 mm^-1, S = 1.181, R = 0.0507 and wR = 0.1025.     

Synthesis,Crystal Structure,Thermal Behavior and Photoluminescence of a Novel Two-dimensional Cd(Ⅱ) Coordination Polymer

A new coordination polymer, [Cd2(bptc)(L)2(H2O)2]·5H2O(1, L = 2-(2-chloro-6-fluorophenyl)-1H-imidazo[4,5-f][1,10]phenanthroline and H4 bptc = 3,3',4,4'-biphenyltetracarboxylic acid), has been synthesized under hydrothermal conditions and characterized by single-crystal X-ray diffraction. The crystal belongs to monoclinic, space group P21/n with a = 18.868(4), b = 7.2111(14), c = 19.464(4), β = 95.75(3)°, C54H31Cd2Cl2F2N8O15, Mr = 1365.57, V = 2635.0(9)3, Z = 2, Dc = 1.721 g/cm3, S = 1.034, μ(MoKα) = 0.995 mm–1, F(000) = 1358, R = 0.0501 and wR = 0.1076. In 1, each bptc anion bridges four Cd(II) atoms to form 2D layer structures, which are further extended by π-π stacking interactions into a 3D supramolecular architecture. The thermal behavior and luminescent properties of the compound have also been studied.     

Synthesis,Crystal Structure and Photoluminescence of a TADF Dinuclear Cu(Ⅰ) Complex

A binuclear Cu(Ⅰ) complex[Cu(PCNP)(mepypz)]_2(BF_4)_2 (1,PCNP=2,6-bis(diphenylphosphine)-benzonitrile,mepypz=2-methyl-6-(1H-pyrazol-3-yl)-pyridine was synthesized from the reaction of Cu(CH_3CN)_4BF_4,PCNP and mepypz in CH_2Cl_2 at room temperature.The compound was characterized by NMR,UV-vis and X-ray single-crystal structure analysis.It crystallizes in monoclinic space group P2_1/c with a=14.0139(5),b=11.8149(3),c=27.1248(10)?,β=96.686(4)°,V=4460.6(3)?~3,Z=2,M_r=1561.97,D_c=1.163 g/cm~3,F(000)=1600.0,μ=1.774 mm~(–1),GOOF=1.071,the final R=0.0523 and w R=0.1412 for 7919 observed reflections with I2σ(I).The Cu atoms in the complex are four-coordinated and adopt a distorted tetrahedral coordination geometry.In the solid state,the complex exhibits yellowish-green emission with a peak wavelength of 546 nm,a lifetime of 390μs,and a quantum yield of 0.45 at room temperature.The temperature-dependent investigation of luminescent properties suggests that the complex emits thermally activated delayed fluorescence (TADF) at room temperature.     

Synthesis,Crystal Structure and Photoluminescence of a Three-dimensional Zinc(Ⅱ) Coordination Polymer with(20~3)_2(20)_3 Topology

The title compound,[Zn2(H2C4BIm)(ox)2]·2H2O(1,H2C4BIm = 2,2'-(1,4-bu-tanediyl)bis(1H-benzimidazole),has been synthesized by the hydrothermal reaction of Zn(NO3)2·6H2O with H2C4BIm and Na2C2O4 in water solution.It crystallizes in the triclinic system,space group P1 with a = 9.445(9),b = 9.598(9),c = 14.962(14) ,α = 72.160(10),β = 79.905(12),γ = 83.680(11)°,Mr = 633.18,V = 1269(2) 3,Z = 2,Dc = 1.657 g/cm3,F(000) = 644,μ = 1.953 mm-1,the final R = 0.0671 and wR = 0.1689.X-ray crystal structure analysis revealed that 1 is a 3D network with(203)2(20)3 topology in which the ZnII atom can be considered as a 3-connected node and both ox2-and H2C4BIm serve as the linear linkers.     

A Two-coordinate Copper(I) Complex Constructed from Cyanuric acid and 4,4′-bipyridyl: Synthesis, Structure and Photoluminescence

A two-coordinate copper（Ⅰ） complex, Cu2（bipy）（H2L）2 （1） （H3L=cyanuric acid, bipy=4,4＇-bipyridyl）, which exhibits strong photoluminescence, has been synthesized under hydrothermal conditions and structurally characterized by single crystal X-ray diffraction. The compound crystallizes in the monoclinic space group P21/n, with cell parameters： Mr= 539.42, a= 13.4806（5）A↑°, b=4.5234（2） A↑°, c= 15.4952（8）A↑°,β = 105.526（3）°, V=910.39（7）A↑°^3, Z=2 and μ=3.52 mm^ -1. In the structure the two Cu（Ⅰ） ions are bridged by bipy to form a two-coordinate copper（Ⅰ） dimer. The adjacent dimer units are connected by hydrogen bonding interactions, resulting in 1D zigzag chains along the c axis. 1 emits intense yellow light when excited with UV light.     

Syntheses and Crystal Structures of Two New Ag(Ⅰ) Complexes with Betaine Derivative: Structure Changes via Metal-to-ligand Ratio

Two new Ag(I) complexes {Ag2(L)(NO3)(H2O)}n(1) and {Ag(L)}n·nH2O(2) have been synthesized via the reaction of silver nitrate and betaine derivative 1-carboxymethylpyridinium-3-carboxylate(L) by only changing the metal-to-ligand ratio. The results of X-ray crystallographic analysis indicate that complexes 1 and 2 both crystallize in the monoclinic space group P21/c with a = 5.0809(14), b = 17.390(5), c = 13.399(4), β = 91.677(5)o, V = 1183.4(6)3, Z = 4, Mr = 475.90, Dc = 2.671 g/cm3, F(000) = 912, μ = 3.352 mm-1, S = 1.259, the final R = 0.0320 and wR = 0.0831 for 2036 observed reflections with I 2σ(I) for 1 and a = 12.180(2), b = 5.0283(10), c = 14.396(3), β = 94.87(3)o, V = 878.5(3)3, Z = 4, Mr = 306.02, Dc = 2.314 g/cm3, F(000) = 600, μ = 2.294 mm-1, S = 1.053, the final R = 0.0283 and wR = 0.0684 for 2011 observed reflections with I 2σ(I) for 2. Complexes 1 and 2 both feature a unique 2D structure. For 1, the 2D undulated network consists of 1D infinite helical chains running parallel to the b axis, while for 2, the 2D network is made up of 1D tubes along the b axis. Moreover, the Ag…Ag interactions in complexes 1 and 2 are also discussed.     

Synthesis,Crystal Structure and Photoluminescence of a New Zn(Ⅱ) Dimer Constructed by 1,10-Phenanthroline Derivative and Flexible Dicarboxylate

A new compound,[Zn(L)(1,4-chdc)]2·2H2O(1,1,4-chdc = 1,4-cyclohexanedicarboxylate and L = 11-fluoro-dipyrido[3,2-a:2,3-c]phenazine),has been synthesized under hydrothermal conditions and characterized by single-crystal X-ray diffraction.The crystal of 1 belongs to triclinic,space group P1 with a = 9.4679(19),b = 10.915(2),c = 12.577(3) ,α = 77.22(3),β = 74.73(3),γ = 65.47(3)°,C52H39F2N8O10Zn2,Mr = 1104.65,V = 1131.4(4) 3,Z = 1,Dc = 1.621 g/cm3,S = 1.091,μ(MoKα) = 1.143 mm–1,F(000) = 565,R = 0.0426 and wR = 0.1171.In 1,two 1,4-chdc anions bridge two Zn(Ⅱ) atoms to form a dimer.The neighboring dimers are further extended by π-π stacking interactions to form a 2D supramolecular layer.The luminescent property of the compound has also been investigated.     

Synthesis,Crystal Structure and Luminescence of a Novel One-dimensional Silver（Ⅰ）Sulfonate Complex with Pyrazine Ligand

The title complex,[Ag 2 (L1) 2 (Pyr)·2.5H 2 O] 1 (L1=6-amino-1-naphthalenesulfonate anion,Pyr=pyrazine),has been synthesized and characterized by single-crystal X-ray diffraction analysis.It crystallizes in triclinic,space group P1,with a=7.339(5),b=13.105(5),c=14.097(5),α=84.377(5),β=76.921(5),γ=79.628(5)°,V=1296.7(11) 3,C 48 H 50 Ag 4 N 8 O 17 S 4,M r=1570.68,Z=1,D c=2.011 g/cm 3,μ=1.732 mm-1,F(000)=782,S=1.148,the final R=0.0436 and wR=0.1181 for 4130 observer reflections (I > 2σ(Ⅰ)).Compound 1 shows a rare one-dimensional (1D) double chain,and the chains are further connected through secondary bonding,hydrogen bonds,and π-π interactions to generate a three-dimensional (3D) supramolecular structure.The luminescent property of 1 was also studied in the solid state at room temperture.     

Synthesis,Characterization and Crystal Structure of a Trinuclear Diorganotin(Ⅳ) Complex with N'-acetylsalicylhydrazide

A diorganotin(IV) complex [(CH3)2Sn]3L2(L=N'-acetylsalicyl-hydrazide) 1 has been successfully synthesized and structurally characterized by elemental analysis,FT-IR,NMR(1H,13C and 119Sn) spectra and X-ray crystallography.The crystal structure belongs to an orthorhombic system,space group Pnma with a=8.5047(16),b=28.466(5),c=12.842(2) ,V=3109.1(10)3,C24H32N4O6Sn3,Mr=828.61,Dc=1.770 g/cm3,μ(Mo-Kα)=2.432 mm-1,Z=4,F(000)=1608,the final R=0.0378 and wR=0.0973 for 2125 observed reflections(Ⅰ 2σ(Ⅰ)).The complex is a trinuclear organotin(Ⅳ) containing five-and six-coordinated tin atoms.And weak but significant Sn···O intermolecular interactions lead to the assembly of complex into a 1D linear polymeric chain supramolecular framework.     

Synthesis,Crystal Structure and Photoluminescence Property of a Ni（Ⅱ） Coordination Polymer with One-dimensional Double-sinusoidal Structure

A new coordination polymer [Ni(3-bpo)(m-bdc)(C2H5OH) 2]n(1,3-bpo = 2,5-bis(3-pyridyl) -1,3,4-oxadiazole,m-H2bdc = 1,3-benzenedicarboxylic acid) was solvothermally synthesi-zed and characterized by IR,TGA and single-crystal X-ray diffraction. The title complex crystalli-zes in the orthorhombic system,space group Pnma with a = 7.786(3) ,b = 17.253(6) ,c = 18.478(6) ,V = 2481.9(14) 3,Mr = 539.18,Dc = 1.443 g/cm3,Z = 4,R = 0.0353 and wR = 0.0589. The m-bdc and 3-bpo bridge two Ni(Ⅱ) ions through two carboxylate groups and two pyridyl groups forming a 1D infinite double-sinusoidal chain along the c axis. The photoluminescence of 1 shows a large red shift compared to that of free ligands in the solid state.     

Synthesis,Crystal Structure and Luminescent Property of a New Copper(Ⅰ) Iodide Complex Based on 3,5-Dimethyl-4-amino-triazole

The title compound,[Cu4I4(C4H8N4)4],has been synthesized and characterized by single-crystal X-ray diffraction analysis.It crystallizes in monoclinic,space group Pbca,with a=18.1851(10),b=9.3697(5),c=19.8034(10),V=3374.3(3)3,C16H32Cu4I4N16,Mr=1210.34,Z=4,Dc=2.383 g/cm3,μ=6.183 mm-1,F(000)=2272,S=1.032,the final R=0.0309 and wR=0.1180 for 3854 observer reflections(I2σ(I)).The structure of the title compound consists of tetranuclear copper cluster units bridged by the halogen atoms with the 3,5-dimethyl-4-aminotriazole ligands coordinated to the metal ions through the triazole nitrogen atoms.The luminescent property of 1 was also studied.     

Synthesis and Properties of a Heteronuclear Ag（Ⅰ）/Ni（Ⅱ） Complex

Introduction Itiswell knownthatcyanogroupsincyanometa latessuchas[Ag(CN)2]-unitscanbeusedasbridg ingligandsandapolymericstructurecanbeformed throughsilver silver(argentophilic)interactions.This propertyhasbeenexploredintheconstructionofmany oligomericandp…     

Synthesis, Crystal Structure and Luminescent Property of a One-dimensional Zinc（Ⅱ） Complex

A metal-organic coordination polymer [Zn2(cbba)4(bix)2]n·nH2O (Hcbba = 2-(4′- chlorine-benzoyl)-benzoic acid, bix = 1,4-bis(imidazol-1-ylmethyl)-benzene) 1 has been hydrothermally synthesized and characterized by elemental analysis, IR, TG, fluorescence spectrum and single-crystal X-ray diffraction. Pale yellow crystals crystallize in the triclinic system, space group Pī, a = 10.2796(13), b = 17.636(2), c = 23.237(3), α = 105.046(2), β = 102.534(2), γ = 100.758(2)o, V = 3837.0(9)3, C84H59Cl4N8O13Zn2, Mr = 1660.93, Dc = 1.438 g/cm3, F(000) = 1702, Z = 2, μ(MoKα) = 0.835 mm-1, the final R = 0.0525 and wR = 0.1211 for 9129 observed reflections (I > 2σ(I)). The structure of 1 exhibits a one-dimensional chain-like structure and shows yellow luminescent property at room temperature.     

Synthesis,Crystal Structure and Antimicrobial Activity of a Novel Ni（Ⅱ） Complex

A new nickel（Ⅱ） complex, C34H38N8NiO4, has been prepared and characterized by X-ray diffraction analysis. It crystallizes in the monoclinic system, space group P21/c with a = 11.715（5）, b = 12.328（5）, c =11.113（5）A, β= 92.589（5）°, Z = 2, Dc = 1.411 g/cm^3,μ = 0.658 mml, the final R = 0.0427 and wR = 0.1099 for 2229 observed reflections with I 〉 2σ（I）. The complex is a centrosymmetric plane in which nickel（Ⅱ） is coordinated in a regular octahedron to the ligand phenytoin through the nitrogen atoms of ethylenediamine, imine and amine. The complex was valued for its antimicrobial activity against bacterial strands using the agar diffusion method, and found to be active against the four test bacterial organisms. Preliminary screening for antimicrobial activities showed that the title complex is quite active against standard strains of Salmonella species, Staphylococcus aureus, Bacillus pumilus and Eschierichia coli.     

Hydrothermal Synthesis and Crystal Structure of a One-dimensional Copper（Ⅱ） Complex

A metal-organic coordination polymer [Cu(cbba)2(bix)]n(Hcbba = 2-(4'-chlorine-benzoyl)-benzoic acid,bix = 1,4-bis(imidazol-1-ylmethyl)-benzene) 1 has been hydrothermally synthesized and characterized by elemental analysis,IR,TG,UV and single-crystal X-ray diffraction.Blue crystals crystallize in the monoclinic system,space group C2/c with a = 26.127(3),b = 10.6143(14),c = 14.5676(19) ,β = 111.289(2),V = 3764.3(8) 3,C42H30Cl2CuN4O6,Mr = 821.14,Dc = 1.449 g/cm3,F(000) = 1684,Z = 4,μ(MoKα) = 0.777 mm 1,the final R = 0.0528 and wR = 0.1200 for 2241 observed reflections(I > 2(I)).The structure of 1 exhibits a one-dimensional chain-like structure.