Single crystal X-ray structure study of the Li(2-x)Na(x)Ni[PO4]F system

The new compounds Li(2-x)Na(x)Ni[PO(4)]F (x = 0.7, 1, and 2) have been synthesized by a solid state reaction route. Their crystal structures were determined from single-crystal X-ray diffraction data. Li(1.3)Na(0.7)Ni[PO(4)]F crystallizes with the orthorhombic Li(2)Ni[PO(4)]F structure, space group Pnma, a = 10.7874(3), b = 6.2196(5), c = 11.1780(4) ? and Z = 8, LiNaNi[PO(4)]F crystallizes with a monoclinic pseudomerohedrally twinned structure, space group P2(1)/c, a = 6.772(4), b = 11.154(6), c = 5.021(3) ?, β = 90° and Z = 4, and Na(2)Ni[PO(4)]F crystallizes with a monoclinic twinned structure, space group P2(1)/c, a = 13.4581(8), b = 5.1991(3), c = 13.6978(16) ?, β = 120.58(1)° and Z = 8. For x = 0.7 and 1, the structures contain NiFO(3) chains made up of edge-sharing NiO(4)F(2) octahedra, whereas for x = 2 the chains are formed of dimer units (face-sharing octahedra) sharing corners. These chains are interlinked by PO(4) tetrahedra forming a 3D framework for x = 0.7 and different Ni[PO(4)]F layers for x = 1 and 2. A sodium/lithium disorder over three atomic positions is observed in Li(1.3)Na(0.7)Ni[PO(4)]F structure, whereas the alkali metal atoms are well ordered in between the layers in the LiNaNi[PO(4)]F and Na(2)Ni[PO(4)]F structures, which makes both compounds of great interest as potential positive electrodes for sodium cells.     

Ligand influences on copper molybdate networks: the structures and magnetism of [Cu(3,4'-bpy)MoO(4)], [Cu(3,3'-bpy)(0.5)MoO(4)], and [Cu(4,4'-bpy)(0.5)MoO(4)].1.5H(2)O

The reactions of a Cu(II) salt, MoO(3), and the appropriate bipyridine ligand yield a series of bimetallic oxides, [Cu(3,4'-bpy)MoO(4)] (1), [Cu(3,3'-bpy)(0.5)MoO(4)] (2), and [Cu(4,4'-bpy)(0.5)MoO(4)].1.5H(2)O (3.1.5H(2)O). The structures of 1-3 exhibit three-dimensional covalent frameworks, constructed from bimetallic oxide layers tethered by the dipodal organoimine ligands. However, the [CuMoO(4)] networks are quite distinct. For structure 1, the layer consists of corner-sharing [MoO(4)] tetrehedra and [CuN(2)O(3)] square pyramids, while the layer of 2 is constructed from [MoO(4)] tetrehedra and binuclear [Cu(2)O(6)N(2)] units of edge-sharing copper square pyramids. The oxide substructure of 3 consists of [MoO(4)] tetrahedra corner-sharing with tetranuclear clusters of edge-sharing [CuO(5)N] octahedra. Crystal data: C(10)H(8)N(2)O(4)CuMo (1), orthorhombic Pbca, a = 12.4823(6) A, b = 9.1699(4) A, c = 19.5647(9) A, V = 2239.4(1) A(3), Z = 8; C(5)H(4)NO(4)CuMo (2), triclinic P, a = 5.439(1) A, b = 6.814(1) A, c = 10.727(2) A, alpha = 73.909(4)(o), beta = 78.839(4)(o); gamma = 70.389(4)(o); V = 357.6(1) A(3), Z = 2; C(10)H(8)N(2)O(8)Cu(2)Mo(2).3H(2)O 3.1.5H(2)O, triclinic P, a = 7.4273(7) A, b = 9.2314(8) A, c = 13.880(1) A, alpha = 71.411(2)(o), beta = 88.528(2)(o), gamma = 73.650(2)(o), V = 863.4(1) A(3), Z = 2. The magnetic properties of 1-3 arise solely from the presence of the Cu(II) sites, but reflect the structural differences within the bimetallic oxide layers. Compound 1 exhibits magnetic behavior consistent with ferromagnetic chains which couple antiferromagnetically at low temperature. Compound 2 exhibits strong antiferromagnetic dimeric interactions, with the magnetic susceptibility data consistent with the Bleaney-Bowers equation. Similarly, the magnetic susceptibility of 3 is dominated by antiferromagnetic interactions, which may be modeled as a linear S = 1/2 Heisenberg tetramer.     

UF3(H2O)(C2O4)0.5: a fluorooxalate of tetravalent uranium with a three-dimensional framework structure

A new uranium(IV) fluorooxalate, UF3(H2O)(C2O4)0.5, has been synthesized by a hydrothermal method and structurally characterized by single-crystal X-ray diffraction, infrared spectroscopy, and thermogravimetric analysis. The structure consists of two-dimensional layers of corner- and edge-sharing tricapped trigonal prisms with the composition UF(4/2)F(2/2)O3 linked by bisbidentate oxalate ligands to form a three-dimensional framework. Magnetic susceptibilities were measured to confirm the tetravalent state of uranium. Crystal data: monoclinic, space group C2/c, a = 17.246(3) Angstroms, b = 6.088(1) Angstroms, c = 8.589(2) Angstroms, beta = 95.43(3) degrees, and Z = 8.     

N(CH2CH2NH3)3][U3O2F13].2H2O: a novel organically templated mixed-valent uranium oxyfluoride with a hybrid network structure

The synthesis and characterization of a novel mixed-valent uranium oxyfluoride is described; the inorganic network consists of 2-D [U(2)F(10)](2)(-) sheets constructed from corner- and edge-sharing U(IV)F(9) tricapped trigonal prisms and 1-D [UO(2)F(3)](-) chains constructed from edge-sharing U(VI)O(2)F(5) pentagonal bipyramids with the organic cations and water molecules between the sheets. This is the first example with a hybrid network structure in the system of uranium fluoride or oxyfluoride. The variable-temperature magnetic susceptibility confirms the oxidation state of the uranium ions. Crystal data follow: C(6)H(25)N(4)O(4)F(13)U(3), monoclinic, space group P2(1) (No. 4); a = 8.6876(4) A, b = 7.3158(4) A, c = 16.3376(8) A, beta = 93.7285(9) degrees , V = 1036.2(2) A(3), and Z = 2.     

Hydrothermal synthesis, crystal structure, conductivity, and thermal decomposition of [Cu(4,4'-bipy)(H2O)(Mo3O10)].H2O

The hydrothermal reaction of (NH(4))(6)Mo(7)O(24).4H(2)O, CuCl(2).2H(2)O, and 4,4'-bipyridine yields bipyridine-ligated copper-trimolybdate monohydrate [Cu(4,4'-bipy)(H(2)O)(Mo(3)O(10))].H(2)O in the monoclinic system with space group of C(2/c) and cell parameters of a = 15.335(2) A, b = 15.535(2) A, c = 15.106(2) A, beta = 101.162(2) degrees, V = 3530.7(9) A(3), and Z = 8. Its structure consists of one-dimensional infinite ([Mo3O10]2-)( infinity ) chains linked through [Cu2(H2O)2(4,4'-bipy)] units. The Mo-O chain contains distorted [MoO(6)] octahedra connected through corner-sharing oxygen atoms into infinite chains along the c direction and each chain is located in the channel formed by four adjacent crossing chains of [Cu(4,4'-bipy)(H2O)](n)(2n+). The crystal shows weak conductivity through Mo-O chain along the c direction and insulating property along either a or b direction. Furthermore, a crystalline bimetallic oxide, CuMo3O10, forms when the title compound undergoes thermal treatment in N(2) atmosphere after the complete removal of the ligands.     

Further evidence for the tetraoxoiodate(V) anion,IO(4)(3-): hydrothermal syntheses and structures of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O and Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O

The hydrothermal reaction of MoO(3) with BaH(3)IO(6) at 180 degrees C for 3 days results in the formation of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O (1). Under similar conditions, the reaction of Ba(OH)(2) x 8H(2)O with MoO(3) and Ba(IO(4))(2) x 6H(2)O yields Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O (2). The structure of 1, determined by single-crystal X-ray diffraction, consists of corner- and edge-sharing distorted MoO(6) octahedra that create two-dimensional slabs. Contained within this molybdenum oxide framework are approximately C(2v) tetraoxoiodate(V) anions, IO(4)(3-), that are involved in bonding with five Mo(VI) centers. The two equatorial oxygen atoms of the IO(4)(3-) anion chelate a single Mo(VI) center, whereas the axial atoms are mu(3)-oxo groups and complete the octahedra of four MoO(6) units. The coordination of the tetraoxoiodate(V) anion to these five highly electropositive centers is probably responsible for stabilizing the substantial anionic charge of this anion. The Ba(2+) cations separate the layers from one another and form long ionic contacts with neighboring oxygen atoms and a water molecule. Compound 2 also contains distorted MoO(6) octahedra. However, these solely edge-share with octahedral hexaoxoiodate(VII), IO(6)(5-), anions to form zigzagging one-dimensional, (1)(infinity)[(MoO(2))(IO(6))](3-), chains that are polar. These chains are separated from one another by Ba(2+) cations that are coordinated by additional water molecules. Bond valence sums for the iodine atoms in 1 and 2 are 5.01 and 7.03, respectively. Crystallographic data: 1, monoclinic, space group C2/c, a = 13.584(1) A, b = 7.3977(7) A, c = 20.736(2) A, beta = 108.244(2) degrees, Z = 4; 2, orthorhombic, space group Fdd2, a = 13.356(7) A, b = 45.54(2) A, c = 4.867(3) A, Z = 8.     

Aqueous reactions of U(VI) at high chloride concentrations: syntheses and structures of new uranyl chloride polymers

The reactions of UO(3) with acidic aqueous chloride solutions resulted in the formation of two new polymeric U(VI) compounds. Single crystals of Cs(2)[(UO(2))(3)Cl(2)(IO(3))(OH)O(2)].2H(2)O (1) were formed under hydrothermal conditions with HIO(3) and CsCl, and Li(H(2)O)(2)[(UO(2))(2)Cl(3)(O)(H(2)O)] (2) was obtained from acidic LiCl solutions under ambient temperature and pressure. Both compounds contain pentagonal bipyramidal coordination of the uranyl dication, UO(2)(2+). The structure of 1 consists of infinite [(UO(2))(3)Cl(2)(IO(3))(mu(3)-OH)(mu(3)-O)(2)](2-) ribbons that run down the b axis that are formed from edge-sharing pentagonal bipyramidal [UO(6)Cl] and [UO(5)Cl(2)] units. The Cs(+) cations separate the chains from one another and form long ionic contacts with terminal oxygen atoms from iodate ligands, uranyl oxygen atoms, water molecules, and chloride anions. In 2, edge-sharing [UO(3)Cl(4)] and [UO(5)Cl(2)] units build up tetranuclear [(UO(2))(4)(mu-Cl)(6)(mu(3)-O)(2)(H(2)O)(2)](2-) anions that are bridged by chloride to form one-dimensional chains. These chains are connected in a complex network of hydrogen bonds and interactions of uranyl oxygen atoms with Li(+) cations. Crystal data: 1, orthorhombic, space group Pnma, a = 8.2762(4) A, b = 12.4809(6) A, c = 17.1297(8) A, Z = 4; 2, triclinic, space group P1, a = 8.110(1) A, b = 8.621(1) A, c = 8.740(1) A, Z = 2.     

Synthesis and characterization of fluorinated metal arsenates with a layer structure: (C4H12N2)(1.5)[M3F5(HAsO4)2(AsO4)] (M = Fe, Ga)

Two fluorinated metal arsenates, (C(4)H(12)N(2))(1.5)[M(3)F(5)(HAsO(4))(2)(AsO(4))] (M = Fe, Ga), have been synthesized under hydrothermal conditions and characterized by single-crystal X-ray diffraction, magnetic susceptibility, M?ssbauer spectroscopy, and (71)Ga NMR spectroscopy. The two compounds are isostructural and crystallize in the monoclinic space group P2(1)/c (No. 14) with a = 8.394(1) A, b = 21.992(3) A, c = 10.847(1) A, beta = 96.188(2) degrees, and Z = 4 for the Fe compound, and a = 8.398(1) A, b = 21.730(3) A, c = 10.679(1) A, beta = 95.318(2) degrees, and Z = 4 for the Ga compound. The structure consists of infinite chains of corner-sharing MX(6) (X = O, F) octahedra and dimers of edge-sharing MO(3)F(3) octahedra, which are linked into two-dimensional sheets through arsenate tetrahedra with diprotonated piperazinium cations between the sheets. Magnetic susceptibility and M?ssbauer spectroscopy confirm the presence of Fe(III). The (71)Ga MAS NMR spectrum clearly shows a line shape consisting of three components, corresponding to three crystallographically distinct Ga sites.     

Self-assembled dinuclear,trinuclear, tetranuclear,pentanuclear, and octanuclear Ni(II) complexes of a series of polytopic diazine based ligands: structural and magnetic properties

The nickel coordination chemistry of a series of polytopic diazine (N-N) based ligands has been examined. Self-assembly reactions lead to examples of dinuclear, trinuclear, tetranuclear, pentanuclear, and octanuclear complexes, all of which exhibit magnetic exchange coupling, with antiferromagnetic and ferromagnetic examples. Structural details are presented for [(L1)(2)Ni(2)(H(2)O)(2)](NO(3))(4).3H(2)O (1), [(L2)(2)Ni(3)(H(2)O)(2)](NO(3))(6).8H(2)O (2), [(L3)(4)Ni(4)(H(2)O)(8)] (NO(3))(4).8H(2)O (3), [(L4)(2)Ni(5)(H(2)O)(10)(NO(3))](NO(3))(7).8H(2)O (4), and [(L5)(4)Ni(8)(H(2)O)(8)](BF(4))(8).16H(2)O (5). Compound 1 crystallizes in the monoclinic system, space group P2(1)/c, with a = 14.937(1) A, b = 18.612(2) A, c = 20.583(2) A, beta = 108.862(2) degrees, Z = 4. Compound 2 crystallizes in the orthorhombic system, space group P2(1)2(1)2, with a = 21.771(4) A, b = 13.700(2) A, c = 20.017(3) A, Z = 4. Compound 3 crystallizes in the tetragonal system, space group P4(3), with a = 12.9483(7) A, c = 33.416(3) A, Z = 4. Compound 4 crystallizes in the triclinic system, space group P(-)1, with a = 12.6677(8) A, b = 18.110(1) A, c = 19.998(1) A, alpha = 100.395(1) degrees, beta = 109.514(1) degrees, gamma = 109.686(1) degrees, Z = 2. Compound 5 crystallizes in the monoclinic system, space group P2(1)/n, with a = 21.153(5) A, b = 35.778(9) A, c = 21.823(5) A, beta = 97.757(6) degrees, Z = 4. The linear trinuclear Ni(II) complex (2) has a cis-N-N single bond bridge, and a water bridge linking the central Ni(II) to each external Ni(II) center in each of two similar trinuclear subunits, and exhibits intramolecular ferromagnetic exchange (J = 5.0 cm(-1)). A novel octanuclear metallacyclic ring structure exists in 5, with trans-N-N single bond bridges linking adjacent Ni(II) centers, leading to quite strong intramolecular antiferromagnetic exchange (J = -30.4 cm(-1)).     

Synthesis, structure, and photoluminescence property of a new layered zirconium phosphate |Co(dien)(2)|[Zr(4)H(8)P(5)O(26)] x 3H(2)O

A new layered zirconium phosphate |Co(dien)(2)|[Zr(4)H(8)P(5)O(26)] x 3H(2)O (denoted ZrPO-CJ37) has been synthesized hydrothermally by using a racemic mixture of a chiral cobaltammine complex Co(dien)(2)Cl(3) as the template. Its structure is determined by single-crystal X-ray diffraction analysis and further characterized by X-ray powder diffraction, inductively coupled plasma, thermogravimetric, UV-vis, and photoluminescence analyses. The inorganic layer of ZrPO-CJ37 is built up from the linkage of Zr-centered octahedra and P-centered tetrahedra via vertex oxygen atoms forming a 4.6-net sheet. Its structure features the edge-sharing chains of Zr(OM)(6) (M = P, H) octahedra. The cobaltammine complex cations are located in the interlayer region and interact with the host network through H bonds. ZrPO-CJ37 exhibits interesting photoluminescence in the UV-vis spectral region. The edge-sharing chains of Zr(OM)(6) octahedra in the inorganic layer might be responsible for this unusual photoluminescence.     

Novel metal-organic frameworks with specific topology from new tripodal ligands: 1,3,5-tris(1-imidazolyl)benzene and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene

Reactions of two new tripodal ligands 1,3,5-tris(1-imidazolyl)benzene (4) and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene (5) with metal [Ag(I), Cu(II), Zn(II), Ni(II)] salts lead to the formation of novel two-dimensional (2D) metal-organic frameworks [Ag(2)(4)(2)][p-C(6)H(4)(COO)(2)].H(2)O (6), [Ag(4)]ClO(4) (7), [Cu(4)(2)(H(2)O)(2)](CH(3)COO)(2).2H(2)O (8), [Zn(4)(2)(H(2)O)(2)](NO(3))(2) (9), [Ni(4)(2)(N(3))(2)].2H(2)O (10), and [Ag(5)]ClO(4) (11). All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 6: monoclinic, C2/c, a = 23.766(3) A, b = 12.0475(10) A, c = 13.5160(13) A, beta = 117.827(3) degrees, Z = 4. For compound 7: orthorhombic, P2(1)2(1)2(1), a = 7.2495(4) A, b = 12.0763(7) A, c = 19.2196(13) A, Z = 4. For compound 8: monoclinic, P2(1)/n, a = 8.2969(5) A, b = 12.2834(5) A, c = 17.4667(12) A, beta = 96.5740(10) degrees, Z = 2. For compound 9: monoclinic, P2(1)/n, a =10.5699(3) A, b = 11.5037(3) A, c = 13.5194(4) A, beta = 110.2779(10) degrees, Z = 2. For compound 10: monoclinic, P2(1)/n, a = 9.8033(3) A, b = 12.1369(5) A, c = 13.5215(5) A, beta = 107.3280(10) degrees, Z = 2. For compound 11: monoclinic C2/c, a = 18.947(2) A, b = 9.7593(10) A, c = 19.761(2) A, beta = 97.967(2) degrees, Z = 8. Both complexes 6 and 7 are noninterpenetrating frameworks based on the (6, 3) nets, and 8, 9 and 10 are based on the (4, 4) nets while complex 11 has a twofold parallel interpenetrated network with 4.8(2) topology. It is interesting that, in complexes 6,7, and 11 with three-coordinated planar silver(I) atoms, each ligand 4 or 5 connects three metal atoms, while in the case of complexes 8, 9, and 10 with six-coordinated octahedral metal atoms, each ligand 4 only links two metal atoms, and another imidazole nitrogen atom of 4 did not participate in the coordination with the metal atoms in these complexes. The results show that the nature of organic ligand and geometric needs of metal atoms have great influence on the structure of metal-organic frameworks.     

Hydrothermal synthesis of organic-inorganic hybrid materials: network structures of the bimetallic oxides [M(Hdpa)2V4O12] (M = Co, Ni, dpa = 4,4'-dipyridylamine)

The hydrothermal reactions of MCl(2).6H2O (M = Co, Ni) NaVO3, 4,4'-dipyridylamine (dpa), and H2O yield materials of the type [M(Hdpa)2V4O12] (M = Co (1), Ni (2)). The two-dimensional structures of 1 and 2 are constructed from bimetallic oxide networks (MV4O12)n2n- with monodentate Hdpa projecting the protonated ring into the interlamellar region. The oxide network may be described as ruffled chains of corner-sharing (VO4) tetrahedra linked by (NiO4N2) octahedra into the two-dimensional assembly. Crystal data: C10H10Co0.5N3O6V2(1), monoclinic P2(1)/c, a = 10.388(1) A, b = 7.6749(7) A, c = 16.702(2) A, beta = 102.516(1) degrees, Z = 4. C10H10N3Ni0.5O6V2 (2), monoclinic, P2(1)/c, c = 10.3815(2) A, b = 7.7044(2) A, c = 16.6638(4) A, beta = 102.573(1) degrees, Z = 4.     

Expanding the remarkable structural diversity of uranyl tellurites: hydrothermal preparation and structures of K[UO(2)Te(2)O(5)(OH)], Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O,beta-Tl(2)[UO(2)(TeO(3))(2)], and Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2)

The reactions of UO(2)(C(2)H(3)O(2))(2).2H(2)O with K(2)TeO(3).H(2)O, Na(2)TeO(3) and TlCl, or Na(2)TeO(3) and Sr(OH)(2).8H(2)O under mild hydrothermal conditions yield K[UO(2)Te(2)O(5)(OH)] (1), Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O (2) and beta-Tl(2)[UO(2)(TeO(3))(2)] (3), or Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2) (4), respectively. The structure of 1 consists of tetragonal bipyramidal U(VI) centers that are bound by terminal oxo groups and tellurite anions. These UO(6) units span between one-dimensional chains of corner-sharing, square pyramidal TeO(4) polyhedra to create two-dimensional layers. Alternating corner-shared oxygen atoms in the tellurium oxide chains are protonated to create short/long bonding patterns. The one-dimensional chains of corner-sharing TeO(4) units found in 1 are also present in 2. However, in 2 there are two distinct chains present, one where alternating corner-shared oxygen atoms are protonated, and one where the chains are unprotonated. The uranyl moieties in 2 are bound by five oxygen atoms from the tellurite chains to create seven-coordinate pentagonal bipyramidal U(VI). The structures of 3 and 4 both contain one-dimensional [UO(2)(TeO(3))(2)](2-) chains constructed from tetragonal bipyramidal U(VI) centers that are bridged by tellurite anions. The chains differ between 3 and 4 in that all of the pyramidal tellurite anions in 3 have the same orientation, whereas the tellurite anions in 4 have opposite orientations on each side of the chain. In 4, there are also additional isolated TeO(3)(2-) anions present. Crystallographic data: 1, orthorhombic, space group Cmcm, a = 7.9993(5) A, b = 8.7416(6) A, c = 11.4413(8) A, Z = 4; 2, orthorhombic, space group Pbam, a = 10.0623(8) A, b = 23.024(2) A, c = 7.9389(6) A, Z = 4; 3, monoclinic, space group P2(1)/n, a = 5.4766(4) A, b = 8.2348(6) A, c = 20.849(3) A, beta = 92.329(1) degrees, Z = 4; 4, monoclinic, space group C2/c, a = 20.546(1) A, b = 5.6571(3) A, c = 13.0979(8) A, beta = 94.416(1) degrees, Z = 4.     

Bimetallic cyanide-bridged complexes based on the photochromic nitroprusside anion and paramagnetic metal complexes. Syntheses, structures, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O, [Ni(en)2][Fe(CN)5NO]x3H2O, [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO], and [Mn(5-Brsalen)]2[Fe(CN)5NO

The synthesis, crystal structure, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O (1), [Ni(en)2][Fe(CN)5NO]x3H2O (2), [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO] (3), and [Mn(5-Brsalen)]2[Fe(CN)5NO] (4) are presented. 1 crystallizes in the monoclinic space group P2(1)/n (a = 7.407(4) A, b = 28.963(6) A, c = 14.744(5) A, alpha = 90 degrees, beta = 103.26(4) degrees, gamma = 90 degrees, Z = 2). Its structure consists of branched linear chains formed by cis-[Ni(en)2]2+ cations and ferrocyanide and nitroprusside anions. The presence of two kinds of iron(II) sites has been demonstrated by M?ssbauer spectroscopy. 2 crystallizes in the monoclinic space group P2(1)/c (a = 11.076(3) A, b = 10.983(2) A, c = 17.018(5) A, alpha = 90 degrees, beta = 107.25(2) degrees, gamma = 90 degrees, Z = 4). Its structure consists of zigzag chains formed by an alternated array of cis-[Ni(en)2]2+ cations and nitroprusside anions. 3 crystallizes in the triclinic space group P1 (a = 8.896(5) A, b = 10.430(5) A, c = 12.699(5) A, alpha = 71.110(5) degrees, beta = 79.990(5) degrees, gamma = 89.470(5) degrees, Z = 1). Its structure comprises neutral trinuclear bimetallic complexes in which a central [Fe(CN)5NO]2- anion is linked to two [Mn(3-MeOsalen)]+ cations. 4 crystallizes in the tetragonal space group P4/ncc (a = 13.630(5) A, c = 21.420(8) A, Z = 4). Its structure shows an extended 2D neutral network formed by cyclic octameric [-Mn-NC-Fe-CN-]4 units. The magnetic properties of these compounds indicate the presence of quasi-isolated paramagnetic Ni2+ and Mn3+. Irradiated samples of the four compounds have been studied by differential scanning calorimetry to detect the existence of the long-lived metastable states of nitroprusside.     

Coordination Chemistry of 2,2'-Dipyridyl Diselenide: X-ray Crystal Structures of PySeSePy, [Zn(PySeSePy)Cl(2)], [(PySeSePy)Hg(C(6)F(5))(2)], [Mo(SePy)(2)(CO)(3)], [W(SePy)(2)(CO)(3)], and [Fe(SePy)(2)(CO)(2)] (PySeSePy = C(5)H(4)NSeSeC(5)H(4)N; SePy = [C(5)H(4)N(2-Se)-N,Se])

The coordination chemistry of 2,2'-dipyridyl diselenide (PySeSePy) (2) (C(10)H(8)N(2)Se(2)) has been investigated and its crystal structure has been determined (monoclinic, P2(1)/c, a = 10.129(2) ?, b = 5.7332(12) ?, c = 19.173(3) ?, beta = 101.493(8) degrees, Z = 4). In metal complexes the ligand was found to coordinate in three different modes, as also confirmed by X-ray structure determination. N,N'-coordination was found in the zinc complex [Zn(PySeSePy)Cl(2)] (3) (C(10)H(8)Cl(2)N(2)Se(2)Zn, triclinic, P&onemacr;, a = 7.9430(10) ?, b = 8.147(2) ?, c = 11.999(2) ?, alpha = 93.685(10) degrees, beta = 107.763(10) degrees, gamma = 115.440(10) degrees, Z = 2) and Se,Se'-coordination in the adduct of the ligand with bis(pentafluorophenyl)mercury(II) [PySeSePyHg(C(6)F(5))(2)] (5) (C(10)H(8)F(10)HgN(2)Se(2), monoclinic, P2(1)/n, a = 7.7325(10) ?, b = 5.9974(14) ?, c = 25.573, beta = 98.037(10) degrees, Z = 2), which however displays only weak interactions between selenium and mercury. The reaction of the ligand with norbornadiene carbonyl complexes of molybdenum and tungsten leads to reductive cleavage of the selenium-selenium bond with oxidation of the metal center and concomitant addition of the resulting selenolate to the metal carbonyl fragment. Thus the 7-coordinate complexes [Mo(SePy)(2)(CO)(3)] (6) (C(13)H(8)MoN(2)O(3)Se(2), monoclinic, P2(1)/n, a = 9.319(3) ?, b = 12.886(5) ?, c = 13.231(6) ?, beta = 109.23(3) degrees, Z = 4) and [W(SePy)(2)(CO)(3)] (7) (C(13)H(8)N(2)O(3)Se(2)W, monoclinic, P2(1)/n, a = 9.303(2) ?, b = 12.853(2) ?, c = 13.232(2) ?, beta = 109.270(10) degrees, Z = 4) were obtained. The same N,Se-coordination pattern emerges from the reaction of [Fe(2)(CO)(9)] with (2) leading to [Fe(SePy)(2)(CO)(2)] (8) (C(12)H(8)FeN(2)O(2)Se(2), monoclinic, P&onemacr;, a = 8.6691(14) ?, b = 12.443(2) ?, c = 14.085(2) ?, alpha = 105.811(10) degrees, beta = 107.533(8) degrees, gamma = 92.075(10) degrees, Z = 4).     

New mercury vanadium phosphate hydrate Hg(4)(-)(x)()O(1-)(y)()((VO)(PO(4))(2).H(2)O with unprecedented tetrahedral oxo-cluster [Hg( approximately )(4)O( approximately )(5)

The new mercury vanadium phosphate hydrate Hg(4)(-)(x)()O(1)(-)(y)()(VO)(PO(4))(2).H(2)O has been synthesized under hydrothermal conditions. X-ray investigations led to orthorhombic symmetry, space group P2(1)2(1)2(1) (No. 19), a = 6.3632(2) A, b = 12.4155(5) A, c = 14.2292(6) A, Z = 4. The crystal structure was solved and refined from single-crystal diffractometer data to residuals R[F(2) > 2sigmaF(2)] = 0.039, R(w)(F(2)) = 0.055. The VPO framework consists of infinite one-dimensional [VO(PO(4))(2)]( infinity ) chains with corner-connected VO(6) octahedra and PO(4) tetrahedra. The chains run along the [100] direction and are held together by the unprecedented tetrahedral cationic units [Hg(4)(-)(x)()O(1)(-)(y)()](4+). Presence of Hg-Hg bonding contacts is proved from theoretical calculations.     

Structural influences of organonitrogen ligands on vanadium oxide solids. Hydrothermal syntheses and structures of the terpyridine vanadates [V2O4(terpy)2]3[V10O28], [VO2(terpy)][V4O10], and [V9O22(terpy)3

Hydrothermal reactions of the V2O5/2,2':6':2"-terpyridine/ZnO/H2O system under a variety of conditions yielded the organic-inorganic hybrid materials [V2O4(terpy)2]3[V10O28].2H2O (VOXI-10), [VO2(terpy)][V4O10] (VOXI-11), and [V9O22(terpy)3] (VOXI-12). The structure of VOXI-10 consists of discrete binuclear cations [V2O4(terpy)2]2+ and one-dimensional chains [V10O28]6-, constructed of cyclic [V4O12]4- clusters linked through (VO4) tetrahedra. In contrast, the structure of VOXI-11 exhibits discrete mononuclear cations [VO2(terpy)]1+ and a two-dimensional vanadium oxide network, [V4O10]1-. The structure of the oxide layer is constructed from ribbons of edge-sharing square pyramids; adjacent ribbons are connected through corner-sharing interactions into the two-dimensional architecture. VOXI-12 is also a network structure; however, in this case the terpy ligand is incorporated into the two-dimensional oxide network whose unique structure is constructed from cyclic [V6O18]6- clusters and linear (V3O5(terpy)3) moieties of corner-sharing vanadium octahedra. The rings form chains through corner-sharing linkages; adjacent chains are connected through the trinuclear units. Crystal data: VOXI-10, C90H70N18O42V16, triclinic P1, a = 12.2071(7) A, b = 13.8855(8) A, 16.9832(10) A, alpha = 69.584(1) degrees, beta = 71.204(1) degrees, gamma = 84.640(1) degrees, Z = 1; VOXI-11, C15H11N3O12V5, monoclinic, P2(1)/n, a = 7.7771(1) A, b = 10.3595(2) A, c = 25.715(4) A, beta = 92.286(1) degrees, Z = 4; VOXI-12, C45H33N9O22V9, monoclinic C2/c, a = 23.774(2) A, b = 9.4309(6) A, c = 25.380(2) A, beta = 112.047(1) degrees, Z = 4.     

Syntheses, structures, and ion-exchange properties of the three-dimensional framework uranyl gallium phosphates, Cs4[(UO2)2(GaOH)2(PO4)4].H2O and Cs[UO2Ga(PO4)2

The reaction of UO(2)(NO(3))(2).6H(2)O with Cs(2)CO(3) or CsCl, H(3)PO(4), and Ga(2)O(3) under mild hydrothermal conditions results in the formation of Cs(4)[(UO(2))(2)(GaOH)(2)(PO(4))(4)].H(2)O (UGaP-1) or Cs[UO(2)Ga(PO(4))(2)] (UGaP-2). The structure of UGaP-1 was solved from a twinned crystal revealing a three-dimensional framework structure consisting of one-dimensional (1)(infinity)[Ga(OH)(PO(4))(2)](4-) chains composed of corner-sharing GaO(6) octahedra and bridging PO(4) tetrahedra that extend along the c axis. The phosphate anions bind the UO(2)(2+) cations to form UO(7) pentagonal bipyramids. The UO(7) moieties edge-share to create dimers that link the gallium phosphate substructure into a three-dimensional (3)(infinity)[(UO(2))(2)(GaOH)(2)(PO(4))(4)](4-) anionic lattice that has intersecting channels running down the b and c axes. Cs(+) cations and water molecules occupy these channels. The structure of UGaP-2 is also three-dimensional and contains one-dimensional (1)(infinity)[Ga(PO(4))(2)](3-) gallium phosphate chains that extend down the a axis. These chains are formed from fused eight-membered rings of corner-sharing GaO(4) and PO(4) tetrahedra. The chains are in turn linked together into a three-dimensional (3)(infinity)[UO(2)Ga(PO(4))(2)](1-) framework by edge-sharing UO(7) dimers as occurs in UGaP-1. There are channels that run down the a and b axes through the framework. These channels contain the Cs(+) cations. Ion-exchange studies indicate that the Cs(+) cations in UGaP-1 and UGaP-2 can be exchanged for Ca(2+) and Ba(2+). Crystallographic data: UGaP-1, monoclinic, space group P2(1)/c, a = 18.872(1), b = 9.5105(7), c = 14.007(1) A, beta = 109.65(3)(o) , Z = 4 (T = 295 K); UGaP-2, triclinic, space group P, a = 7.7765(6), b = 8.5043(7), c = 8.9115(7) A, alpha = 66.642(1)(o), beta = 70.563(1)(o), gamma = 84.003(2)(o), Z = 2 (T = 193 K).     

Structural Variability of the Vanadium-Organodiphosphonate System: Hydrothermal Syntheses and Structural Characterizations of One-Dimensional, Two-Dimensional, and Three-Dimensional Phases

The hydrothermal chemistry of the CsVO(3)/methylenediphosphonate system was investigated. Variations in reaction temperatures, heating times, and stoichiometries of reactants resulted in the isolation of mononuclear, one-, two-, and three-dimensional species: Cs[VO(HO(3)PCH(2)PO(3)H)(2)(H(2)O)] (1), Cs[VO(HO(3)PCH(2)PO(3))] (2), Cs[(VO)(2)V (O(3)PCH(2)PO(3))(2)(H(2)O)(2)] (3), and [V(HO(3)PCH(2)PO(3))(H(2)O)] (4), respectively. The structure of the anion of 1 consists of isolated V(IV) octahedra. Phase 2 adopts a chain structure constructed from corner-sharing V(IV) octahedra, forming infinite {-V=OV=O-} linkages. The layer structure of 3 contains trinuclear units of corner-sharing {VO(6)} octahedra with the central V site in the III oxidation state and V(IV) centers at the extremities of the cluster. The diphosphonate ligands serve to link neighboring trinuclear motifs into a layer structure three octahedra in depth. The Cs(+) cations occupy cavities within the layers, rather than the more common interlamellar positions. The structure of 4 consists of isolated {V(III)O(6)} octahedra linked by diphosphonate groups into a three-dimensional framework. Crystal data: for 1, CH(6)O(7)P(2)V(0.5)Cs, monoclinic C2, a = 10.991(2) ?, b = 10.161(2) ?, c = 7.445(1) ?, beta = 92.97(3) degrees, Z = 4; for 2, CH(3)O(7)P(2)VCs, monoclinic C2, a = 10.212(2) ?, b = 10.556(2) ?, c = 14.699(3) ?, beta = 94.57(2) degrees, Z = 8; for 3, C(2)H(8)O(16)P(4)V(3)Cs, monoclinic C2/m, a = 9.724(2) ?, b = 8.136(2) ?, c = 10.268(2) ?, beta = 103.75(3) degrees, Z = 2; for 4, CH(5)O(7)P(2)V, monoclinic P2(1)()/n, a = 5.341(1) ?, b = 11.516(2) ?, c = 10.558(2) ?, beta = 99.89(1) degrees, Z = 4.     

Hydrothermal Synthesis, Structure and Thermal Properties of a Novel Three-dimensional La(Ⅲ)-Sebacate Framework

A novel lanthanide-organic framework compound [La(seb)(Hseb)(H2O)]n (H2seb = sebacic acid) has been hydrothermally synthesized and structurally characterized by elemental analysis, IR spectra, TG and single-crystal X-ray diffraction. Complex 1 crystallizes in the triclinic system, space group P with a = 8.5849(7), b = 9.0641(8), c = 15.4049(13), α = 98.1830(10), β = 100.6870(10), γ= 97.5650(10)°, Z = 2, V = 1150.44(17) 3, Dc = 1.612 g/cm3, Mr = 558.39, λ(MoKα) = 0.71073 , μ = 1.903 mm-1, F(000) = 568, R = 0.0219 and wR = 0.0507 for 3797 observed reflections with I > 2σ(I). The structure contains edge-shared chains of [LaO8(H2O)] tricapped trigonal prisms that propagate along the b axis. In aliphatic ligand participation, complex 1 exhibits a three-dimensional supramolecular framework. Moreover, the thermal stability of complex 1 has been investigated.