首页 | 本学科首页   官方微博 | 高级检索  
相似文献
 共查询到20条相似文献,搜索用时 15 毫秒
1.
The synthesis, crystal structure, and physical characterization of five new radical salts formed by the organic donor bis(ethylenediseleno)tetrathiafulvalene (BEST) and the paramagnetic tris(oxalato)metalate anions [M(C2O4)3]3- (M = FeIII and CrIII) are reported. The salts isolated are (BEST)4[M(C2O4)3].PhCOOH.H2O with MIII = Cr (1) or Fe (2) (crystal data: 1, triclinic, space group P(-)1 with a = 14.0999(4) A, b = 15.3464(4) A, c =19.5000(4) A, alpha = 76.711(5) degrees, beta = 71.688(5) degrees, gamma = 88.545(5) degrees, V = 3893.5(2) A3, and Z = 2; 2, triclinic, space group P(-)1 with a = 14.0326(3) A, b =15.1981(4) A, c =19.4106(4) A, alpha = 76.739(5) degrees, beta = 71.938(5) degrees, gamma = 88.845(5) degrees, V = 3824.9(2) A3, and Z = 2), (BEST)4[M(C2O4)3].1.5H2O with MIII = Cr (3) or Fe (4) (crystal data: 3, monoclinic, space group C2/m with a = 33.7480(10) A, b =12.3151(7) A, c = 8.8218(5) A, beta = 99.674(5) degrees, V = 3614.3(3) A3, and Z = 2; 4, monoclinic, space group C2/m with a = 33.659(6) A, b =12.248(2) A, c = 8.759(2) A, beta = 99.74(3) degrees, V = 3558.9(12) A3, and Z = 2), and (BEST)9[Fe(C2O4)3]2.7H2O (5) (crystal data: triclinic, space group P(-)1 with a =12.6993(3) A, b =18.7564(4) A, c = 18.7675(4) A, alpha = 75.649(5) degrees, beta = 107.178(5) degrees, gamma = 79.527(5) degrees, V = 3977.5(3) A3, and Z = 1). The structures of all these salts consist of alternating layers of the organic donors and tris(oxalato)metalate anions. In 1 and 2 the anionic layers contain also benzoic acid molecules H-bonded to the terminal oxygen atoms of the anions. In all salts the organic layers adopt beta-type packings. Along the parallel stacks the donors form dimers in 3 and 4, trimers in 5, and tetramers in 1 and 2. All the compounds are paramagnetic semiconductors with high room-temperature conductivities and magnetic susceptibilities dominated by the Fe- or Cr-containing anions.  相似文献   

2.
The compounds Cp2Ln[N(QPPh2)2] (Ln = La (1), Gd (2), Er (3), or Yb (4) for Q = Se, Ln = Yb (5) for Q = S) have been synthesized from the corresponding rare-earth tris(cyclopentadienyl) compound and H[N(QPPh2)2]. The structures of compounds 1, 2, 3, and 5, as determined by X-ray crystallography, consist of a Cp2Ln fragment, coordinated eta 3 through two chalcogen atoms and an N atom of the imidodiphosphinochalcogenido ligand [N(QPPh2)2]-. In compound 4, the Cp2Yb moiety is coordinated eta 2 through the two Se atoms of the [N(SePPh2)2]-ligand. 31P and 77Se (for 1) NMR spectroscopies lend insight into the solution nature of these species. Crystal data: 1, C34H30LaNP2Se2, triclinic, P1, a = 9.7959(10) A, b = 12.4134(13) A, c = 13.9077(14) A, alpha = 88.106(2) degrees, beta = 88.327(2) degrees, gamma = 68.481(2) degrees, V = 1572.2(3) A3, T = 153 K, Z = 2, and R1(F) = 0.0257 for the 5947 reflections with I > .2 sigma(I); 2, C34H30GdNP2Se2, triclinic, P1, a = 9.7130(14) A, b = 12.2659(17) A, c = 13.953(2) A, alpha = 88.062(2) degrees, beta = 87.613(2) degrees, gamma = 69.041(2) degrees, V = 1550.7(4) A3, T = 153 K, Z = 2, and R1(F) = 0.0323 for the 5064 reflections with I > 2 sigma(I); 3, C34H30ErNP2Se2, triclinic, P1, a = 9.704(2) A, b = 12.222(3) A, c = 13.980(4) A, alpha = 88.230(4) degrees, beta = 87.487(4) degees, gamma = 69.107(4) degrees, V = 1547.4(7) A3, T = 153 K, Z = 2, and R1(F) = 0.0278 for the 6377 reflections with I > 2 sigma(I); 4, C34H30NP2Se2Yb.C4H8O, triclinic, P1, a = 12.087(4) A, b = 12.429(4) A, c = 23.990(7) A, alpha = 89.406(5) degrees, beta = 86.368(5) degrees, gamma = 81.664(5) degrees, V = 3558.8(18) A3, T = 153 K, Z = 4, and R1(F) = 0.0321 for the 11,883 reflections with I > 2 sigma(I); and 5, C34H30NP2S2Yb, monoclinic, P21/n, a = 13.8799(18) A, b = 12.6747(16) A, c = 17.180(2) A, beta = 91.102(3) degrees, V = 3021.8(7) A3, T = 153 K, Z = 4, and R1(F) = 0.0218 for the 6698 reflections with I > 2 sigma(I).  相似文献   

3.
Novel alkaline earth metal aryl-substituted silylamides were prepared using alkane (Mg) and salt elimination reactions (Mg, Ca, Sr, and Ba). The salt elimination regime involved the treatment of the alkaline earth metal iodides with 2 equiv of the respective potassium amide KNDiip(SiMe(3)), (Diip = 2,6-i-Pr(2)C(6)H(3)). The organomagnesium source for the alkane elimination was ((n)()Bu/(s)()Bu)(2)Mg. All compounds were characterized using (1)H, (13)C NMR, and IR spectroscopy, in addition to X-ray crystallography (except Mg[NDiip(SiMe(3))](2)THF(2)). Crystal data with Mo Kalpha (lambda = 0.710 73 A) are as follows: Mg[NDiip(SiMe(3))](2), 1, a = 9.4687(6) A, b = 9.6818(6) A, c = 17.9296(1) A, alpha = 96.487(1) degrees, beta = 94.537(1) degrees, gamma = 89.222(1) degrees, V = 1608.8(2) A(3), Z = 2 (two independent molecules), triclinic, space group P(-)1, R1 (all data) = 0.0508; (n)()BuMg[NDiip(SiMe(3))]THF(2), 2, a = 9.5413(1) A, b = 16.493(2) A, c = 9.8218(1) A, beta = 108.149(2) degrees, V = 1468.7(4) A(3), Z = 2, monoclinic, space group P2(1), R1(all data) = 0.1232; Ca[NDiip(SiMe(3))](2)THF(2), 4, a = 9.7074(1) A, b = 20.9466(4) A, c = 21.6242(3) A, alpha = 73.573(1) degrees, beta = 78.632(1) degrees, gamma = 89.621(1) degrees, V = 4129.1(1) A(3), Z = 4 (two independent molecules), triclinic, space group P(-)1, R1 (all data) = 0.0902; Sr[NDiip(SiMe(3))](2)THF(2), 5, a = 20.5874(5) A, b = 9.8785(2) A, c = 20.8522(5) A, beta = 102.035(2) degrees, V = 4147.6(2) A(3), Z = 4 (two independent molecules), monoclinic, space group P2/n, R1 (all data) = 0.0756; Ba[NDiip(SiMe(3))](2)THF(2), 6, a = 20.5476(2) A, b = 10.0353(2) A, c = 20.9020(4) A, beta = 101.657(1) degrees, V = 4221.0(1) A(3), Z = 4 (two independent molecules), monoclinic, space group P2/n, R1 (all data) = 0.0573.  相似文献   

4.
Dong YB  Wang HY  Ma JP  Shen DZ  Huang RQ 《Inorganic chemistry》2005,44(13):4679-4692
Two new bent bis(cyanophenyl)oxadiazole ligands, 2,5-bis(4-cyanophenyl)-1,3,4-oxadiazole (L7) and 2,5-bis(3-cyanophenyl)-1,3,4-oxadiazole (L8), were synthesized. The coordination chemistry of these ligands with various Ag(I) salts has been investigated. Seven new coordination polymers, namely, {[Ag(L7)(H2O)]ClO4}n) (1) (triclinic, P1, a = 9.342(4) A, b = 9.889(4) A, c = 10.512(4) A, alpha = 68.978(6) degrees, beta = 78.217(6) degrees, gamma = 81.851(7) degrees, Z = 2), {[Ag(L7)]SO3CF3}n (2) (monoclinic, P2(1)/n, a = 7.559(2) A, b = 23.739(6) A, c = 10.426(3) A, beta = 108.071(4) degrees, Z = 4), {[Ag(L8)]BF4 x 0.5(C6H6) x H2O}n (3) (triclinic, P1, a = 7.498(3) A, b = 10.649(4) A, c = 13.673(5) A, alpha = 98.602(5) degrees, beta = 100.004(5) degrees, gamma =110.232(5) degrees, Z = 2), {[Ag(L8)SbF6] x H2O}n (4) (triclinic, P1, a = 8.2621(9) A, b = 10.6127(12) A, c = 13.3685(15) A, alpha = 98.012(2) degrees, beta = 106.259(2) degrees, gamma = 112.362(2) degrees, Z = 2), {[Ag2(L8)2(SO3CF3)] x H2O}n (5) (triclinic, P1, a = 10.713(4) A, b = 13.449(5) A, c = 15.423(5) A, alpha = 65.908(5) degrees, beta = 74.231(5) degrees, gamma = 83.255(5) degrees, Z = 2), {[Ag2(L8)(C6H6)(ClO4)] x ClO4}n (6) (monoclinic, P2(1)/n, a = 6.9681(17) A, b = 20.627(5) A, c = 17.437(4) A, beta = 95.880(4) degrees, Z = 4), and {[Ag2(L8)(H2PO4)2]}n (7) (triclinic, P1, a = 7.956(2) A, b = 9.938(3) A, c = 14.242(4) A, alpha = 106.191(4) degrees, beta = 97.322(4) degrees, gamma = 107.392(4) degrees, Z = 1), were obtained by the combination of L7 and L8 with Ag(I) salts in a benzene/methylene chloride mixed-solvent system and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescence and electrical conductance properties of compounds 1-6 and the host-guest chemistry of compound 3 were investigated.  相似文献   

5.
Treatment of the hydrosulfido-bridged titanium-ruthenium heterobimetallic complex [Cp2Ti(mu2-SH)2RuCl(eta5-C5Me5)] (1; Cp = eta5-C5H5) with an excess of triethylamine followed by addition of [RuCl2(PPh3)3] and [[(cod)M]2(mu2-Cl)2] (M = Rh, Ir; cod = 1,5-cyclooctadiene) led to the formation of the TiRu2 and TiRuM mixed-metal sulfido clusters [(CpTi)[(eta5-C5Me5)Ru][Ru(PPh3)2](mu3-S)2(mu2-Cl)2] (3) and [(CpTi)[(eta5-C5Me5)Ru][M(cod)](mu3-S)2(mu2-Cl)] (M = Rh (4a), Ir (4b)), respectively. On the other hand, the reactions of 1 with [M(PPh3)4] (M = Pd, Pt) afforded the TiRuM trinuclear clusters [(CpTiCl)[(eta5-C5Me5)Ru][M(PPh3)2](mu3-S)(mu2-S)(mu2-H)] (M = Pd (5a), Pt (5b)) with an unprecedented M3(mu3-S)(mu2-S) core. The detailed structures of these triangular clusters 3-5 have been determined by X-ray crystallography. Crystal data: 3, triclinic, P1, a = 12.448(4) A, b = 12.773(4) A, c = 17.270(4) A, alpha = 100.16(2) degrees, beta = 99.93(2) degrees, gamma = 114.11(3) degrees, V = 2373(1) A(3), Z = 2; 4a, triclinic, P1, a = 7.714(2) A, b = 11.598(3) A, c = 14.802(4) A, alpha = 80.46(2) degrees, beta = 82.53(2) degrees, gamma = 71.47(2) degrees, V = 1234.0(6) A3, Z = 2; 4b, triclinic, P1, a = 7.729(1) A, b = 11.577(2) A, c = 14.766(3) A, alpha = 80.14(1) degrees, beta = 82.71(1) degrees, gamma = 71.55(1) degrees, V = 1231.1(4) A3, Z = 2; 5a, monoclinic, P2(1)/c, a = 11.259(4) A, b = 16.438(4) A, c = 26.092(5) A, beta = 102.23(3) degrees, V = 4719(2) A(3), Z = 4; 5b, monoclinic, P2(1)/n, a = 11.369(2) A, b = 16.207(3) A, c = 26.116(2) A, beta = 102.29(1) degrees, V = 4701(1) A3, Z = 4.  相似文献   

6.
Six new homodinuclear lanthanide(III) complexes with a flexible tripodal carboxylate ligand (H(3)L), of formulae [Ln(2)L(2)(DMF)(4)]·4DMF (Ln = La (1), Nd (2), Eu (3), Gd (4), Tb (5), Dy (6), DMF = N, N-Dimethylformamide) have been synthesized. Among them, 1, 2, 3, 4, 6 were characterized by single-crystal X-ray diffraction, which crystallized in the monoclinic space group P2(1)/n with a = 13.309(2) ?, b = 27.404(4) ?, c = 16.686(3) ?, β = 105.115(2) and V = 5875.2(17) ?(3) for 1, a = 13.3016(5) ?, b = 27.1952(12) ?, c = 16.6339(7) ?, β = 105.030(2) and V = 5811.3(4) ?(3) for 2, a = 13.2797(10) ?, b = 27.072(2) ?, c = 16.6564(13) ?, β = 104.9390(10) and V = 5785.7(8) ?(3) for 3, a = 13.2855(3) ?, b = 27.0074(6) ?, c = 16.6357(3) ?, β = 104.9790(10) and V = 5766.2(2) ?(3) for 4, a = 13.2837(5) ?, b = 26.9105(10) ?, c = 16.6066(6) ?, β = 104.917(2) and V = 5736.3(4) ?(3) for 6. The crystal structures reveal that these complexes are isostructural, and molecules are connected from 0D to 3D supramolecular structures by hydrogen bonds. All of them were characterized by elemental analysis, IR spectroscopy, XRD and TGA. Unusually, non-luminescent Tb(III) complex was obtained. The photophysical property of the Eu(III) complex and the magnetic property of Gd(III) complex are investigated and discussed in detail.  相似文献   

7.
A series of optically active silatrane derivatives, [Si{N(CHRCH(2)O)(CH(2)CH(2)O)(2)}X] (R = Me, i-Pr; X = Ph, OMe) has been synthesized by the reaction of optically active triethanolamine derivatives with XSi(OMe)(3), and characterized by (1)H NMR, (13)C NMR, (29)Si NMR, and mass spectroscopy, and the structures of six compounds have been determined by X-ray analysis. Molecular mechanics methods have also been employed to obtain the energy-minimized structures. The (29)Si NMR chemical shifts and the lengths of Si-N determined by X-ray analysis are sensitive to the bulkiness of the substituent (R). The Si-X bond lengths (X: trans position to nitrogen) do not appreciably differ from one another. The MM2 calculations indicated that the substituent exists in the equatorial position, and the results are in agreement with those of X-ray analysis and (1)H NMR spectroscopy. Crystallographic data: [R = H; X = OMe], C(7)H(15)NO(4)Si, orthorhombic, Pna2(1), a = 13.407(1) ?, b = 8.761(2) ?, c = 8.191(1) ?, Z = 4; [R = Me; X = OMe], C(8)H(17)NO(4)Si, orthorhombic, P2(1)2(1)2(1), a = 10.110(3) ?, b = 11.083(2) ?, c = 9.474(2) ?, Z = 4; [R = i-Pr; X = OMe], C(10)H(21)NO(4)Si, monoclinic, P2(1), a = 8.481(1) ?, b = 7.805(1) ?, c = 10.218(2) ?, beta = 111.31(1) degrees, Z = 2; [R = Me; X = Ph], C(13)H(19)NO(3)Si, orthorhombic, P2(1)2(1)2(1), a = 8.813(1) ?, b = 11.137(2) ?, c = 13.757(1) ?, Z = 4; [R = i-Pr; X = Ph], C(15)H(23)NO(3)Si, orthorhombic, P2(1)2(1)2(1), a = 8.365(1) ?, b = 13.538(2) ?, c = 13.841(2) ?, Z = 4.  相似文献   

8.
Syntheses and Crystal Structures of Pyrazoline Derivants   总被引:1,自引:0,他引:1  
史海斌  纪顺俊  张勇 《结构化学》2005,24(5):586-591
SNNHNH2 OSSNNHNH2 OS1 INTRODUCTION Pyrazoline derivatives, used as carrier transporting as well as emitting materials[1], have been widely investigated in many areas due to their blue light emission with high quantum yield[2~5], ready acces- sibility and easy processability. 1,3,5-Triaryl-2-pyrazo- lines are reported as the hole transporting or emitting Scheme 1N NN SEtOHmaterials in organic EL devices[6~8]. However, ben- zothiazoyl pyrazolinederivatives containing aro…  相似文献   

9.
Kawano T  Kuwana J  Du CX  Ueda I 《Inorganic chemistry》2002,41(16):4078-4080
The reaction of chiral 1,2-bis(2-pyridylethynyl)benzene ligands with copper(I) ions in dichloromethane at room temperature gives rise to the formation of molecular rectangular boxes in high yields. The structures of these complexes were confirmed by X-ray crystallographic analysis. The compound CL1 crystallizes in the triclinic space group P1, with a = 13.707(4) A, b = 14.891(3) A, c = 12.030(1) A, alpha = 101.65(2) degrees, beta = 115.08(2) degrees, gamma = 97.66(1) degrees, V = 2110.8(2) A(3), Z = 1 (T = 288 K). The compound CL2 crystallizes in the triclinic space group P1, with a = 13.539(4) A, b = 14.755(2) A, c = 11.951(2) A, alpha = 101.70(1) degrees, beta = 115.11(1) degrees, gamma = 97.44(2) degrees, V = 2053.8(8) A(3), Z = 1 (T = 198 K). The formation of box-type structure is caused by steric hindrance between bulky substituents of the ligands.  相似文献   

10.
A convenient and one-pot synthetic method of lanthanide thiolate compounds was developed. An excess of metallic samarium, europium, and ytterbium directly reacted with diaryl disulfides in THF to give selectively Ln(II) thiolate complexes, [Ln(SAr)(&mgr;-SAr)(thf)(3)](2) (1, Ln = Sm; 2, Ln = Eu; Ar = 2,4,6-triisopropylphenyl), Yb(SAr)(2)(py)(4) (3, py = pyridine), and [{Ln(hmpa)(3)}(2)(&mgr;-SPh)(3)][SPh] (6, Ln = Sm; 7, Ln = Eu; 8, Ln = Yb; hmpa = hexamethylphosphoric triamide). Reaction of metallic lanthanides with 3 equiv of disulfides afforded Ln(III) thiolate complexes, Ln(SAr)(3)(py)(n)()(thf)(3)(-)(n)() (9a, Ln = Sm, n = 3; 9b, Ln = Sm, n = 2; 10, Ln = Yb, n = 3) and Ln(SPh)(3)(hmpa)(3) (11, Ln = Sm; 12, Ln = Eu; 13, Ln = Yb). Thus, Ln(II) and Ln(III) thiolate complexes were prepared from the same source by controlling the stoichiometry of the reactants. X-ray analysis of 8 revealed that 8 has the first ionic structure composed of triply bridged dinuclear cation and benezenethiolate anion [8, orthorhombic, space group P2(1)2(1)2(1) with a = 21.057(9), b = 25.963(7), c = 16.442(8) ?, V = 8988(5) ?(3), Z = 4, R = 0.040, R(w) = 0.039 for 5848 reflections with I > 3sigma(I) and 865 parameters]. The monomeric structures of 11 and 13 were revealed by X-ray crystallographic studies [11, triclinic, space group P&onemacr; with a = 14.719(3), b = 17.989(2), c = 11.344(2) ?, alpha = 97.91(1), beta = 110.30(2), gamma = 78.40(1) degrees, V = 2751.9(9) ?(3), Z = 2, R = 0.045, R(w) = 0.041 for 7111 reflections with I > 3sigma(I) and 536 parameters; 13, triclinic, space group P&onemacr; with a = 14.565(2), b = 17.961(2), c = 11.302(1) ?, alpha = 97.72(1), beta = 110.49(1), gamma = 78.37(1) degrees, V = 2706.0(7) ?(3), Z = 2, R = 0.031, R(w) = 0.035 for 9837 reflections with I > 3sigma(I) and 536 parameters]. A comparison with the reported mononuclear and dinuclear lanthanide thiolate complexes has been made to indicate that the Ln-S bonds weakened by the coordination of HMPA to lanthanide metals have ionic character.  相似文献   

11.
Five one-dimensional coordination polymers, Ni(BDC)(1,10-phen) (1), Ni(BDC)(2,2'-bipy).0.75H(2)BDC (2), Ni(BDC)(1,10-phen)(H(2)O) (3), Ni(BDC)(1,10-phen)(H(2)O).0.5H(2)BDC (4) and Ni(BDC)(2,2'-bipy)(H(2)O) (5) [where BDC = 1,4-benzenedicarboxylate, 2,2-bipy = 2,2'-bipyridine, and 1,10-phen = 1,10-phenanthroline] that have the same topology but markedly different geometry and packing of the chains have been synthesized by hydrothermal reactions. The results of variations of synthesis conditions and substitutions of 1,10-phenanthroline with 2,2'-bipyridine indicate that incorporation of the coordinating water molecule, which affects the degree of bending of the chain, is primarily influenced by the amine ligand size, suggesting a substantial structural role of aromatic-aromatic interactions and amine ligand steric effects. The incorporation of the guest H(2)BDC molecules was found to be favored by lower pH conditions. Crystal data: 1, monoclinic, space group P2(1)/n, a = 9.5589(6) A, b = 12.6776(8) A, c = 13.5121(9) A, beta = 95.437(1) degrees, Z = 4; 2, monoclinic, space group P2(1)/c, a = 20.532(3) A, b = 21.505(3) A, c = 18.872(3) A, beta = 93.86(1) degrees, Z = 16; 3, triclinic, space group P1, a = 8.618(3) A, b = 10.058(4) A, c = 11.353(4) A, alpha = 115.31(1) degrees, beta = 92.33(1) degrees, gamma = 94.03(1) degrees, Z = 2; 4, triclinic, space group P1, a = 9.7682(12) A, b = 10.6490(13) A, c = 11.2468(14) A, alpha = 76.685(2) degrees, beta = 65.309(2) degrees, gamma = 85.612(2) degrees, Z = 2; 5, monoclinic, space group P2(1)/c, a = 13.9683(9) A, b = 17.4489(11) A, c = 13.7737(9) A, beta = 99.12(1) degrees, Z = 8.  相似文献   

12.
Synthesis of a new class of heteroleptic samarium aryloxide complexes has been achieved by the use of homoleptic samarium(II) bis(aryloxide) Sm(OAr)(2)(THF)(3) (1, Ar = C(6)H(2)Bu(t)(2)-2,6-Me-4) as a starting material, which is easily obtained by reaction of Sm(N(SiMe(3))(2))(2)(THF)(2) with 2 equiv of ArOH in THF. 1 reacts with 1 equiv of SmI(2) in THF to give Sm(II) mixed aryloxide/iodide [(ArO)Sm(&mgr;-I)(THF)(3)](2) (2), which adopts a dimeric structure via very weak Sm.I (3.534(2) ?) interactions. Reaction of 2 with C(5)Me(5)K in THF/HMPA affords the corresponding Sm(II) aryloxide/cyclopentadienide (C(5)Me(5))Sm(OAr)(HMPA)(2) (3). Oxidation of 1 with 0.5 equiv of I(2) in THF gives monomeric samarium(III) aryloxide/iodide (ArO)(2)SmI(THF)(2) (4), while the similar reaction of 1 with ClCH(2)CH(2)Cl or (t)BuCl in THF affords dimeric samarium(III) aryloxide/chloride [(ArO)(2)Sm(&mgr;-Cl)(THF)](2) (5). Crystal data for 1: monoclinic, space group P2(1), a = 9.903(3) ?, b = 16.718(5) ?, c = 13.267(2) ?, beta = 95.17(2) degrees, V = 2187(2) ?(3), Z = 2, D(c) = 1.223 g cm(-)(3), R = 0.0634. Crystal data for 2.2THF: monoclinic, space group P2(1)/a, a = 18.330(6) ?, b = 14.320(4) ?, c = 13.949(3) ?, beta = 103.16(2) degrees, V = 3563(2) ?(3), Z = 2, D(c) = 1.46 g cm(-)(3), R = 0.0606. Crystal data for 3: triclinic, space group P&onemacr;, a = 10.528(1) ?, b = 12.335(2) ?, c = 19.260(2) ?, alpha = 101.33(1) degrees, beta = 95.230(9) degrees, gamma = 108.54(1) degrees, V = 2293.1(5) ?(3), Z = 2, D(c) = 1.25 g cm(-)(3), R = 0.0358. Crystal data for 4: monoclinic, space group C2/c, a = 17.191(7) ?, b = 10.737(6) ?, c = 21.773(7) ?, beta = 98.80(3) degrees, V = 3971(3) ?(3), Z = 4, D(c) = 1.44 g cm(-)(3), R = 0.0467. Crystal data for 5: monoclinic, space group P2(1)/n, a = 13.750(3) ?, b = 17.231(3) ?, c = 14.973(6) ?, beta = 95.81(2) degrees, V = 3529(2) ?(3), Z = 2, D(c) = 1.31 g cm(-)(3), R = 0.0557.  相似文献   

13.
The investigation of the supramolecular interactions between the zinc chloride salts and the crown ether in tetrahydrofuran (THF) with the diffusion of in situ formed DMA (DMA = dimethylamine) ligand leads to two novel zinc-DMA compounds, [(H3O)·(18C-6)][ZnCl3(DMA)] 1 and [(HDMA)·(18C-6)][ZnCl3(DMA)] 2 (18C-6 = 18-crown-6), whose emissions fall into the blue-emission field. Crystal data for compound 1: monoclinic, space group P21/c, a = 8.753(1), b = 14.538(2), c = 19.969(3)A, β = 110.121(7)°, V = 2386.2(5)A^3, T = 293(2) K, Z = 4, Mr = 500.14, Dc= 1.392 g/cm^3,μ = 1.395 mm^-1, F(000) = 1048, S = 1.006, R = 0.0611 and wR = 0.1755 for 3676 observed reflections with I 〉 2σ(I) and 235 parameters. For 2: triclinic, space group P1^-, a = 9.2672(4), b = 11.8778(2), c = 13.3846(1) A, a = 67.09(1), β = 75.54(2), ),γ = 81.32(2)°, V = 1311.74(6) A^3, T = 293(2) K, Z = 2, Mr = 527.21, Dc = 1.335 g/cm^3,μ = 1.271 mm^-1, F(000) = 556, S = 1.006, R = 0.0393 and wR = 0.1034 for 3839 observed reflections with I〉 2σ(I).  相似文献   

14.
2,4,6-Tris(2-pyridyl)-1,3,5-triazine (TPT) bridged dinuclear rhenium(I) tricarbonyl halide complexes with the composition (mu-TPT)[ReX(CO)(3)](2) (3, X = Cl; 4, X = Br) can be made either by one-pot reaction of TPT with 2 equiv of [ReX(CO)(5)] (X = Cl and Br) in chloroform or by reacting mononuclear [ReX(CO)(3)(TPT)] (2) (1, X = Cl; 2, X = Br) with an excess amount of [ReX(CO)(5)]. Crystal data are as follows. 1: monoclinic, P2(1)/c, a = 11.751(1) A, b = 11.376(1) A, c = 15.562(2) A, beta = 103.584(2) degrees, V = 2022.0(4) A(3), Z = 4. 2: monoclinic, P2(1)/c, a = 11.896(1) A, b = 11.396(1) A, c = 15.655(1) A, beta = 104.474(2) degrees, V = 2054.9(3) A(3), Z = 4. 3: triclinic, P1, a = 11.541(2) A, b = 12.119(2) A, c = 13.199(2) A, alpha = 80.377(2) degrees, beta = 76.204(3) degrees, gamma = 66.826(2) degrees, V = 1642.5(4) A(3), Z = 2. Crystals of 4 crystallized from acetone: triclinic, P1, a = 11.586(5) A, b = 12.144(5) A, c = 13.364(6) A, alpha = 80.599(7) degrees, beta = 76.271(8) degrees, gamma = 67.158(8) degrees, V = 1678.0(12) A(3), Z = 2. Crystals of 4' are obtained from CH(2)Cl(2)-pentane solution: monoclinic, C2/c, a = 17.555(4) A, b = 15.277(3) A, c = 13.093(3) A, beta = 111.179(3) degrees, V = 3274.0(12) A(3), Z = 4. By contrast, similar reactions in the presence of methanol yielded complexes with the composition [mu-C(3)N(3)(OMe)(py)(2)(pyH)][ReX(CO)(3)](2) (5, X = Cl; 6, X = Br). Crystal data for 5: monoclinic, C2/c, a = 26.952(2) A, b = 16.602(1) A, c = 14.641(1) A, beta = 116.147(1) degrees, V = 5880.5(8) A(3), Z = 8. 6: monoclinic, C2/c, a = 27.513(3) A, b = 16.740(2) A, c = 14.837(2) A, beta = 116.925(2) degrees, V = 6092.8(10) A(3), Z = 8. An unusual metal-induced methoxylation at the carbon atom of the triazine ring of the bridging TPT ligand was observed. The nucleophilic attack of MeO(-) on C(3) results in a tetrahedral geometry around the carbon atom. Concomitantly, the uncoordinated pyridyl ring is protonated and rotated into a perpendicular orientation relative to the central C(3)N(3) ring. Reaction of TPT with [NEt(4)](2)[ReBr(3)(CO)(3)] in benzene-methanol resulted in an unexpected dinuclear complex 7, with formulation [mu-C(3)N(3)(OMe)(py)(3)][Re(CO)(3)][ReBr(CO)(3)]. The methoxylated TPT ligand functions simultaneously as a tridentate and bidentate ligand with two fac-Re(CO)(3)(+) cores. Crystal data for 7: monoclinic, P2(1)/n, a = 12.114(1) A, b = 14.878(1) A, c = 15.807(1) A, beta = 104.601(1) degrees, V = 2756.9(3) A(3), Z = 4.  相似文献   

15.
Crystal structures of three Ni(CN)(4)(2)(-) salts all with eclipsed ligands and varying axial stacking arrangements are presented. The absorption spectra of all three salts show a slight red shift in the x,y-polarizations and a large red shift in their z-polarizations upon crystallization from solution. Semiempirical ZINDO calculations provide a good model of the solid state, even with only a three-molecule segment, allowing reproduction of the red-shifting and intensity increase upon crystallization found experimentally. The modified nickel beta(s,p) bonding parameter of -5 found appropriate for Ni coordination in our previous studies of single Ni(CN)(4)(2-) planes and a helically stacked Cs(2)[Ni(CN)(4)].H(2)O crystal was changed to -3 for the more parallel-stacked Ni(CN)(4)(2-) planes in this case, while beta(d) was retained at -41. Crystal data are as follows: Na(2)[Ni(CN)(4)].3H(2)O, triclinic space group P1, a = 7.2980(10) A, b = 8.8620(10) A, c = 15.132(2) A, alpha = 89.311(5) degrees, beta = 87.326(5) degrees, gamma = 83.772(6) degrees, V = 971.8(2) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.064; Sr[Ni(CN)(4)].5H(2)O, monoclinic space group C2/m, a = 10.356(2) A, b = 15.272(3) A, c = 7.1331(10) A, beta = 98.548(12) degrees, V = 1115.6(3) A(3), T = 100 K, Z = 4, R = 0.024, R(w) = 0.059; Rb(2)[Ni(CN)(4)].1.05H(2)O, triclinic space group P1, a = 8.6020(10) A, b = 9.6930(10) A, c = 12.006(2) A, alpha = 92.621(6) degrees, beta = 94.263(6) degrees, gamma = 111.795(10) degrees, V = 924.0(2) A(3), T = 100 K, Z = 4, R = 0.034, R(w) = 0.067.  相似文献   

16.
The molecular structures of novel donor-functionalized terphenyl derivatives of trivalent ytterbium, yttrium, and samarium of composition [DanipYb(mu2-Cl)2(mu3-Cl)Li(THF)]2 (1) and [DanipLn(mu2-Cl)2(mu2-Cl)Li(THF)2]2 (Ln = Y, 2; Ln = Sm, 3) are reported [Danip = 2,6-di(o-anisol)phenyl]. The complexes are obtained from the reaction of equimolar amounts of DanipLi and LnCl3 (Ln = Yb, Y, Sm) in tetrahydrofuran at room temperature in 60% yield. 1-2 toluene crystallizes in the monoclinic space group Ponebar. Crystal data for 1-2 toluene at 203 K: a = 9.7281(9) A; b = 12.7989(12) A; c = 13.4870(12) A; alpha = 91.553(2) degrees; beta = 103.957(2) degrees; gamma = 109.916(2) degrees; V = 1521.2(2) A(3); Z' = 1; D(calcd) = 1.615 g cm(-3); R1 = 3.43%. 2-toluene crystallizes in the monoclinic space group Ponebar. Crystal data for 2-toluene at 203 K: a = 10.4152(10) A; b = 12.5783(12) A; c = 14.4640(14) A; alpha = 69.963(2) degrees; beta = 80.900(2) degrees; gamma = 66.603(2) degrees; V = 1633.3(3) A(3); Z' = 1; D(calcd) = 1.386 g cm(-3); R1 = 4.07%. 3-toluene crystallizes in the monoclinic space group Ponebar. Crystal data for 3-toluene at 203 K: a = 10.3457(8) A; b = 12.5658(10) A; c = 14.4365(11) A; alpha = 70.2250(10) degrees; beta = 81.2820(10) degrees; gamma = 66.8330(10) degrees; V = 1623.3(2) A(3); Z' = 1; D(calcd) = 1.521 g cm(-3); R1 = 3.40%. Complexes 1-3 represent first examples of donor-functionalized terphenyl complexes of the elements ytterbium, yttrium, and samarium, respectively. The molecular structures of 1-3 feature a "constraint geometry" type arrangement of the Danip ligand at the lanthanide atom. The complexes reported are dimeric and composed of lithium chloride bridged DanipLnCl(2) moieties (Ln = Yb, Y, Sm), stabilized through additional coordination of two methoxy functions to the lanthanide atom.  相似文献   

17.
A series of copper(II) complexes with tripodal polypyridylmethylamine ligands, such as tris(2-pyridylmethyl)amine (tpa), ((6-methyl-2-pyridyl)methyl)bis(2-pyridylmethyl)amine (Me(1)tpa), bis((6-methyl-2-pyridyl)methyl)(2-pyridylmethyl)amine (Me(2)tpa), and tris((6-methyl-2-pyridyl)methyl)amine (Me(3)tpa), have been synthesized and characterized by X-ray crystallography. [Cu(H(2)O)(tpa)](ClO(4))(2) (1) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.029(7) ?, b = 9.268(2) ?, c = 17.948(5) ?, beta = 113.80(3) degrees, and Z = 4 (R = 0.061, R(w) = 0.059). [CuCl(Me(1)tpa)]ClO(4) (2) crystallized in the triclinic system, space group P&onemacr;, with a = 13.617(4) ?, b = 14.532(4) ?, c = 12.357(4) ?, alpha = 106.01(3) degrees, beta = 111.96(2) degrees, gamma = 71.61(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.037). [CuCl(Me(2)tpa)]ClO(4) (3) crystallized in the monoclinic system, space group P2(1)/n, with a = 19.650(4) ?, b = 13.528(4) ?, c = 8.55(1) ?, beta = 101.51(5) degrees, and Z = 4 (R = 0.071, R(w) = 0.050). [CuCl(Me(3)tpa)][CuCl(2)(Me(3)tpa)]ClO(4) (4) crystallized in the monoclinic system, space group P2(1)/a, with a = 15.698(6) ?, b = 14.687(7) ?, c = 19.475(4) ?, beta = 97.13(2) degrees, and Z = 4 (R = 0.054, R(w) = 0.038). All the Cu atoms of 1-4 have pentacoordinate geometries with three pyridyl and one tertiary amino nitrogen atoms, and a chloride or aqua oxygen atom. Nitrite ion coordinated to the Cu(II) center of Me(1)tpa, Me(2)tpa, and Me(3)tpa complexes with only oxygen atom to form nitrito adducts. The cyclic voltammograms of [Cu(H(2)O)(Me(n)()tpa)](2+) (n = 0, 1, 2, and 3) in the presence of NO(2)(-) in H(2)O (pH 7.0) revealed that the catalytic activity for the reduction of NO(2)(-) increases in the order Me(3)tpa < Me(2)tpa < Me(1)tpa < tpa complexes.  相似文献   

18.
The synthesis and characterization of the tetrameric lithium thiolate (LiSC(6)H(2)-2,4,6-Ph(3))(4).C(7)H(8) (1), the trimeric lithium thiolate (LiSC(6)H(3)-2,6-Mes(2))(3).C(6)H(14)()()(2) (Mes = 2,4,6-Me(3)C(6)H(2)), the thiol HSC(6)H(3)-2,6-Trip(2) (3) (Trip = 2,4,6-i-Pr(3)C(6)H(2)), and the complete alkali metal series of dimeric thiolates (MSC(6)H(3)-2,6-Trip(2))(2) (M = Li (4, 5), Na (6), K (7), Rb (8), Cs (9)) are described. The compounds were characterized by (1)H, (7)Li, and (13)C NMR and IR spectroscopy and by X-ray crystallography. The compounds 1 and 2 crystallize as four- and three-rung ladder framework structures. The compounds 4-9 crystallize as dimers with M(2)S(2) cores. In addition, the metal ions interact with the ortho aryl groups to varying degrees in all the structures. The extent of these interactions appears to be determined mainly by ionic sizes and geometric factors. The coordination geometry of the thiolato sulfurs also varies from pyramidal in 1, 2, 4, 5, and 6 and one planar and one slightly pyramidal sulfur geometry in 7 to both sulfurs being planar coordinated in 8 and 9. Crystal data at 130 K are as follows: (LiSC(6)H(2)-2,4,6-Ph(3))(4).C(7)H(8) (1), a = 15.961(2) ?, b = 16.243(3) ?, c = 17.114(3) ?, alpha = 89.375(14) degrees, beta = 85.334(14) degrees, gamma = 63.343(12) degrees, V = 3950(1) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.082; (LiSC(6)H(3)-2,6-Mes(2))(3).C(6)H(14)()()(2), a = 14.554(4) ?, b = 14.010(4) ?, c = 32.832(8) ?, beta = 95.20(2) degrees, V = 6667(2) ?(3), space group P2(1)/n, Z = 4, R(1) = 0.089; HSC(6)H(3)-2,6-Trip(2) (3), a = 8.180(2) ?, b = 25.437(5) ?, c = 15.752(3) ?, V = 3278(1) ?(3), space group Pnma, Z = 4, R(1) = 0.045; (LiC(6)H(3)-2,6-Trip(2))(2) (4), a = 12.652(2) ?, b = 14.218(1) ?, c = 18.713(2) ?, alpha = 83.56(1) degrees, beta = 84.36(1) degrees, gamma = 73.82(1) degrees, V = 3205(1) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.055; (LiC(6)H(3)-2,6-Trip(2))(2).C(7)H(8) (5), a = 15.383(3) ?, b = 14.381(2) ?, c = 16.524(2) ?, beta = 111.10(1), V = 3410.3(9) ?(3), space group P2(1)/n, Z = 2, R(1) = 0.086; (NaSC(6)H(3)-2,6-Trip(2))(2).0.5C(7)H(8) (6), a = 13.952(2) ?, b = 20.267(2) ?, c = 24.475(3) ?, beta = 98.673(9) degrees, V = 6842(1) ?(3), space group P2(1)/n, Z = 4, R(1) = 0.068; (KSC(6)H(3)-2,6-Trip(2))(2).C(7)H(8) (7), a = 13.683(4) ?, b = 15.071(4) ?, c = 17.824(5) ?, alpha = 82.73(2), beta = 86.09(2), gamma = 88.46(2), V = 3637(2) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.072; (RbSC(6)H(3)-2,6-Trip(2))(2).C(7)H(8) (8), a = 19.710(3) ?, b = 20.892(3) ?, c = 18.755(2) ?, beta = 106.900(9) degrees, V = 7389(2) ?(3), space group P2(1)/n, Z = 4, R(1) = 0.069; (CsSC(6)H(3)-2,6-Trip(2))(2) (9), a = 13.109(3) ?, b = 15.941(3) ?, c = 17.748(4) ?, alpha = 101.65(2) degrees, beta = 100.76(2) degrees, gamma = 104.25(2) degrees, V = 3410(1) ?(3), space group P&onemacr;, Z = 2, R(1) = 0.048.  相似文献   

19.
Two new macrocyclic compounds, [Cu2(L)2](ClO4)4·2CH3OH (1) and [Cu(L)](ClO4)2·2H2O (2) (L = 1,3,10,12,15,18-hexaazatetracyclodocosane) were synthesized by condensation reactions involving amines and formaldehyde in the presence of copper anion. Compound 1 crystallizes in triclinic, space group Pí with a = 10.442(2), b = 14.197(3), c = 17.388(4), α = 91.218(4), β = 90.69(3), γ = 93.756(4)o, V = 2520.4(9)3, Z = 2, F(000) = 1260, Dc = 1.589 Mg/m3, Mr = 1205.92, μ = 1.137 mm-1, λ = 0.71073, the final R = 0.0668 and wR = 0.1573 for 9703 observed reflections with I > 2σ(I). Compound 2 crystallizes in monoclinic, space group C2/c with a = 16.911(2), b = 11.4172(15), c = 27.059(4), β = 107.787(2)o, V = 4974.7(12)3, Z = 8, F(000) = 2504, Dc = 1.610 Mg/m3, Mr = 602.92, μ = 1.155 mm-1, λ = 0.71073 , the final R = 0.0419 and wR = 0.1131 for 4374 observed reflections with I > 2σ(I).  相似文献   

20.
Pyridine-2,6-dicarboxylic acid (pdcH(2) ) reacts with nitrate salts of La(III), Ce(III), and Nd(III) under hydrothermal conditions to form three-dimensional network structures, 1-4. All the compounds crystallize in the monoclinic space group P2(1)/c with the following lattice parameters: [La(2)(pdc)(3).3H(2)O] 1, a = 10.966(3) A, b = 17.534(4) A, c = 13.578(2) A, beta = 100.23(3) degrees, V( )()= 2569.3(9) A(3), Z = 4, R1 = 0.052, wR2 = 0.143, S = 1.06; [Ce(2)(pdc)(3).3H(2)O] 2, a = 12.701(3) A, b = 9.979(1) A, c = 19.401(4) A, beta = 97.73(2) degrees, V( )()= 2436.6(8) A(3), Z = 4, R1 = 0.039, wR2 = 0.117, S = 1.30; [Ce(2)(pdc)(3).3H(2)O] 3, a = 10.961(5) A, b = 17.523(5) A, c = 13.505(2) A, beta = 100.89(3) degrees, V( )()= 2547.2(8) A(3), Z = 4, R1 = 0.040, wR2 = 0.103, S = 1.08; [Nd(2)(pdc)(3).3H(2)O] 4, a = 10.944(3) A, b = 17.448(5) A, c = 13.397(2) A, beta = 101.19(3) degrees, V( )()= 2569.3(9) A(3), Z = 4, R1 = 0.052, wR2 = 0.143, S = 1.06. Compounds 1, 3, and 4 form infinite single helical chains with large widths and pitches containing four metal ions per turn while 2 forms a different helix with smaller width and pitch containing two metal ions per turn. Each helix is further bonded on either side via carboxylate bridging producing three-dimensional metal-organic framework structures.  相似文献   

设为首页 | 免责声明 | 关于勤云 | 加入收藏

Copyright©北京勤云科技发展有限公司  京ICP备09084417号