共查询到20条相似文献,搜索用时 31 毫秒
1.
Five new d0 transition metal iodates, BaTi(IO3)6, LaTiO(IO3)5, Ba2VO2(IO3)4.(IO3), K2MoO2(IO3)4, and BaMoO2(IO3)4.H2O, have been synthesized by hydrothermal methods using Ba(OH)2.8H2O, La2O3, K2CO3, TiO2, V2O5, MoO3, and HIO3 as reagents. The structures of these compounds were determined by single-crystal X-ray diffraction. All of the reported materials have zero-dimensional or pseudo-one-dimensional crystal structures composed of MO6 (M = Ti4+, V5+, or Mo6+) octahedra connected to IO3 polyhedra. Infrared and Raman spectroscopy, thermogravimetric analysis, and UV-vis diffuse reflectance spectroscopy are also presented. Crystal data: BaTi(IO3)6, trigonal, space group R-3 (No. 148), with a = b = 11.4711(10) A, c = 11.1465(17) A, V = 1270.2(2) A3, and Z = 3; LaTiO(IO3)5, monoclinic, space group P2(1)/n (No. 14), with a = 7.4798(10) A, b = 18.065(2) A, c = 10.4843(14) A, beta = 91.742(2) degrees , V = 1416.0(3) A3, and Z = 4; Ba2VO2(IO3)4.(IO3), monoclinic, space group P2(1)/c (No. 14), with a = 7.5012(9) A, b = 33.032(4) A, c = 7.2150(9) A, beta = 116.612(2) degrees , V = 1598.3(3) A3, and Z = 4; K2MoO2(IO3)4, monoclinic, space group C2/c (No. 15), with a = 12.959(2) A, b = 6.0793(9) A, c = 17.748(3) A, beta = 102.410(4) degrees , V = 1365.5(4) A3, and Z = 4; BaMoO2(IO3)4.H(2)O, monoclinic, space group P2(1)/n (No. 14), with a = 13.3368(17) A, b = 5.6846(7) A, c = 18.405(2) A, beta = 103.636(2) degrees , V = 1356.0(3) A3, and Z = 4. 相似文献
2.
The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4. 相似文献
3.
The 1/2V2O5-H2C2O4/H3PO4/NH4OH system was investigated using hydrothermal techniques. Four new phases, (NH4)VOPO(4).1.5H2O (1), (NH4)0.5VOPO(4).1.5H2O (2), (NH4)2[VO(H2O)3]2[VO(H2O)][VO(PO4)2]2.3H2O (3), and (NH4)2[VO(HPO4)]2(C2O4).H2O (4), have been prepared and structurally characterized. Compounds 1 and 2 have layered structures closely related to VOPO(4).2H2O and A0.5VOPO4.yH2O (A = mono- or divalent metals), whereas 3 has a 3D open-framework structure. Compound 4 has a layered structure and contains both oxalate and phosphate anions coordinated to vanadium cations. Crystal data: (NH4)VOPO(4).1.5H2O, tetragonal (I), space group I4/mmm (No. 139), a = 6.3160(5) A, c = 13.540(2) A, Z = 4; (NH4)0.5VOPO(4).1.5H2O, monoclinic, space group P2(1)/m (No. 11), a = 6.9669(6) A, b = 17.663(2) A, c = 8.9304(8) A, beta = 105.347(1) degrees, Z = 8; (NH4)2[VO(H2O)3]2[VO(H2O)][VO(PO4)2]2.3H2O, triclinic, space group P1 (No. 2), a = 10.2523(9) A, b = 12.263(1) A, c = 12.362(1) A, alpha = 69.041(2) degrees, beta = 65.653(2) degrees, gamma = 87.789(2) degrees, Z = 2; (NH4)2[VO(HPO4)]2(C2O4).5H2O, monoclinic (C), space group C2/m (No. 12), a = 17.735(2) A, b = 6.4180(6) A, c = 22.839(2) A, beta = 102.017(2) degrees, Z = 6. 相似文献
4.
Three new strontium vanadium borophosphate compounds, (NH4)2(C2H10N2)6[Sr(H2O)5]2[V2P2BO12]6 10H2O (Sr-VBPO1) (1), (NH4)2(C3H12N2)6[Sr(H2O)4]2[V2P2BO12]6 17H2O (Sr-VBPO2) (2), and (NH4)3(C4H14N2)4.5[Sr(H2O)5]2[Sr(H2O)4][V2P2BO12]6 10H2O (Sr-VBPO3) (3) have been synthesized by interdiffusion methods in the presence of diprotonated ethylenediamine, 1,3-diaminopropane, and 1,4-diaminobutane. Compound 1 has a chain structure, whereas 2 and 3 have layered structures with different arrangements of [(NH4) [symbol: see text] [V2P2BO12]6] cluster anions within the layers. Crystal data: (NH4)2(C2H10N2)6[Sr(H2O)5]2[V2P2BO12]6 10H2O, monoclinic, space group C2/c (no. 15), a = 21.552(1) A, b = 27.694(2) A, c = 20.552(1) A, beta = 113.650(1) degrees, Z = 4; (NH4)2(C3H12N2)6[Sr(H2O)4]2[V2P2BO12]6 17H2O, monoclinic, space group I2/m (no. 12), a = 15.7618(9) A, b = 16.4821(9) A, c = 21.112(1) A, beta = 107.473(1) degrees, Z = 2; (NH4)3(C4H14N2)4.5[Sr(H2O)5]2[Sr(H2O)4] [V2P2BO12]6 10H2O, monoclinic, space group C2/c (no. 15), a = 39.364(2) A, b = 14.0924(7) A, c = 25.342(1) A, beta = 121.259(1) degrees, Z = 4. The differences in the three structures arise from the different steric requirements of the amines that lead to different amine-cluster hydrogen bonds. 相似文献
5.
A family of inorganic-organic hybrid vanadium selenites with zero-, one-, two-, and three-dimensional structures, (1,10-phen)(2)V(2)SeO(7), (2,2'-bipy)VSeO(4), (4,4'-bipy)V(2)Se(2)O(8), and (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O (where phen = phenanthroline and bipy = bipyridine), were hydrothermally synthesized and characterized by single-crystal X-ray diffraction. Different bidentate organodiamine ligands and reactant concentrations were used in the four reaction systems, which are responsible for the variety of structural dimensions of the compounds. (1,10-phen)(2)V(2)SeO(7) crystallizes in a monoclinic system with space group P2(1)/n and cell parameters a = 8.6509(3) A,( )b = 7.8379(2) A, c = 34.0998(13) A, beta = 91.503(2) degrees, and Z = 4. (2,2'-bipy)VSeO(4) crystallizes in a monoclinic system with space group C2/c and cell parameters a = 17.0895(12) A, b = 14.7707(10) A, c = 11.7657(8) A, beta = 131.354(3) degrees, and Z = 8. (4,4'-bipy)V(2)Se(2)O(8) crystallizes in a triclinic system with space group Ponemacr; and cell parameters a = 7.1810(10) A, b = 10.8937(13) A, c = 11.1811(15) A, alpha = 115.455(3) degrees, beta = 107.582(3) degrees, gamma = 91.957(4) degrees, and Z = 2. (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O crystallizes in a monoclinic system with space group Pc and cell parameters a = 7.9889(9) A, b = 7.8448 A, c = 23.048(3) A, beta = 99.389(4) degrees, and Z = 2. (1,10-phen)(2)V(2)SeO(7) has an isolated structure, (2,2'-bipy)VSeO(4) has a chain structure, (4,4'-bipy)V(2)Se(2)O(8) has a layered structure, and (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O has a framework structure. The chains are constructed from VO(4)N(2) octahedra and SeO(3) pyramids, laced by organic ligands (2,2'-bipy). The layers consist of vanadium selenite chains [(VO)(2)(SeO(3))(2)]( infinity ), linked by 4,4'-bipy molecules. The framework is composed of vanadium selenite sheets [V(4)Se(3)O(16)]( infinity ), pillared by 4,4'-bipy molecules. All of the compounds are thermally stable to 300 degrees C, and the magnetic susceptibilities confirm the existence of tetravalent V atoms in the antiferromagnetic (4,4'-bipy)V(2)Se(2)O(8) complex and mixed tetravalent and pentavalent V atoms in the paramagnetic complex (4,4'-bipy)(2)V(4)Se(3)O(15).H(2)O. 相似文献
6.
Four new layered mixed-valence vanadium oxides, which contain interlamellar organic cations, alpha-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1a), beta-(H(3)N(CH(2))(2)NH(3))[V(4)O(10)] (1b), alpha-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2a), and beta-(H(2)N(C(2)H(4))(2)NH(2))[V(4)O(10)] (2b), have been prepared under hydrothermal conditions and their single-crystal structures determined: 1a, triclinic, space group P&onemacr;, a = 6.602(2) ?, b = 7.638(2) ?, c = 5.984(2) ?, alpha = 109.55(3) degrees, beta = 104.749(2) degrees, gamma = 82.31(3) degrees, Z = 1; 1b, triclinic, P&onemacr;, a = 6.387(1) ?, b = 7.456(2) ?, c = 6.244(2) ?, alpha = 99.89(2) degrees, beta = 102.91(2) degrees, gamma = 78.74(2) degrees, Z = 1; 2a, triclinic, P&onemacr;, a = 6.3958(5) ?, b = 8.182(1) ?, c = 6.3715(7) ?, alpha = 105.913(9) degrees, beta = 104.030(8) degrees, gamma = 94.495(8) degrees, Z = 1; 2b, monoclinic, space group P2(1)/n, a = 9.360(2) ?, b = 6.425(3) ?, c = 10.391(2) ?, beta = 105.83(1) degrees, Z = 2. All four of the compounds contain mixed-valence V(5+)/V(4+) vanadium oxide layers constructed from V(5+)O(4) tetrahedra and pairs of edge-sharing V(4+)O(5) square pyramids with protonated organic amines occupying the interlayer space. 相似文献
7.
The alkali metal and alkaline-earth metal uranyl iodates K(2)[(UO(2))(3)(IO(3))(4)O(2)] and Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) have been prepared from the hydrothermal reactions of KCl or BaCl(2) with UO(3) and I(2)O(5) at 425 and 180 degrees C, respectively. While K(2)[(UO(2))(3)(IO(3))(4)O(2)] can be synthesized under both mild and supercritical conditions, the yield increases from <5% to 73% as the temperature is raised from 180 to 425 degrees C. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), however, has only been isolated from reactions performed in the mild temperature regime. Thermal measurements (DSC) indicate that K(2)[(UO(2))(3)(IO(3))(4)O(2)] is more stable than Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) and that both compounds decompose through thermal disproportionation at 579 and 575 degrees C, respectively. The difference in the thermal behavior of these compounds provides a basis for the divergence of their preparation temperatures. The structure of K(2)[(UO(2))(3)(IO(3))(4)O(2)] is composed of [(UO(2))(3)(IO(3))(4)O(2)](2)(-) chains built from the edge-sharing UO(7) pentagonal bipyramids and UO(6) octahedra. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) consists of one-dimensional [(UO(2))(2)(IO(3))(2)O(2)](2)(-) ribbons formed from the edge sharing of distorted UO(7) pentagonal bipyramids. In both compounds the iodate groups occur in both bridging and monodentate binding modes and further serve to terminate the edges of the uranium oxide chains. The K(+) or Ba(2+) cations separate the chains or ribbons in these compounds forming bonds with terminal oxygen atoms from the iodate ligands. Crystallographic data: K(2)[(UO(2))(3)(IO(3))(4)O(2)], triclinic, space group P_1, a = 7.0372(5) A, b = 7.7727(5) A, c = 8.9851(6) A, alpha = 93.386(1) degrees, beta = 105.668(1) degrees, gamma = 91.339(1) degrees, Z = 1; Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), monoclinic, space group P2(1)/c, a = 8.062(4) A, b = 6.940(3) A, c = 21.67(1), beta= 98.05(1) degrees, Z = 4. 相似文献
8.
The syntheses, structures, and characterization of four new lead(II)-tellurium(IV)-oxide halides, Pb(3)Te(2)O(6)X(2) and Pb(3)TeO(4)X(2) (X = Cl or Br) are reported. The materials are synthesized by solid-state techniques, using Pb(3)O(2)Cl(2) or Pb(3)O(2)Br(2) and TeO(2) as reagents. The compounds have three-dimensional structural topologies consisting of lead-oxide halide polyhedra connected to tellurium oxide groups. In addition, the Pb(2+) and Te(4+) cations are in asymmetric coordination environments attributable to their stereoactive lone pair. We also demonstrate that Pb(3)Te(2)O(6)X(2) and Pb(2)TeO(4)X(2) can be interconverted reversibly through the loss or addition of TeO(2). X-ray data: Pb(3)Te(2)O(6)Cl(2), monoclinic, space group C2/m (No. 12), a = 16.4417(11) A, b = 5.6295(4) A, c = 10.8894(7) A, beta = 103.0130(10) degrees, Z = 4; Pb(3)Te(2)O(6)Br(2), monoclinic, space group C2/m (No. 12), a = 16.8911(8) A, b = 5.6804(2) A, c = 11.0418(5) A, beta = 104.253(2) degrees, Z = 4; Pb(3)TeO(4)Cl(2), orthorhombic, space group Bmmb (No. 63), a = 5.576(1) A, b = 5.559(1) A, c = 12.4929(6) A, Z = 4; Pb(3)TeO(4)Br(2), orthorhombic, space group Bmmb (No. 63), a = 5.6434(4) A, b = 5.6434(5) A, c = 12.9172(6) A, Z = 4. 相似文献
9.
Six new actinide metal thiophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6) (I), K(10)Th(3)(P(2)S(7))(4)(PS(4))(2) (II), K(5)U(PS(4))(3) (III), K(5)Th(PS(4))(3) (IV), Rb(5)Th(PS(4))(3) (V), and Cs(5)Th(PS(4))(3) (VI). Compound I crystallizes in the monoclinic space group P2(1)/c with a = 33.2897(1) A, b = 14.9295(1) A, c = 17.3528(2) A, beta = 115.478(1) degrees, Z = 8. Compound II crystallizes in the monoclinic space group C2/c with a = 32.8085(6) A, b = 9.0482(2) A, c = 27.2972(3) A, beta = 125.720(1) degrees, Z = 8. Compound III crystallizes in the monoclinic space group P2(1)/c with a = 14.6132(1) A, b = 17.0884(2) A, c = 9.7082(2) A, beta = 108.63(1) degrees, Z = 4. Compound IV crystallizes in the monoclinic space group P2(1)/n with a = 9.7436(1) A, b = 11.3894(2) A, c = 20.0163(3) A, beta = 90.041(1) degrees, Z = 4, as a pseudo-merohedrally twinned cell. Compound V crystallizes in the monoclinic space group P2(1)/c with a = 13.197(4) A, b = 9.997(4) A, c = 18.189(7) A, beta = 100.77(1) degrees, Z = 4. Compound VI crystallizes in the monoclinic space group P2(1)/c with a = 13.5624(1) A, b = 10.3007(1) A, c = 18.6738(1) A, beta = 100.670(1) degrees, Z = 4. Optical band-gap measurements by diffuse reflectance show that compounds I and III contain tetravalent uranium as part of an extended electronic system. Thorium-containing compounds are large-gap materials. Raman spectroscopy on single crystals displays the vibrational characteristics expected for [PS(4)](3)(-), [P(2)S(7)](4-), and the new [P(3)S(10)](5)(-) building blocks. This new thiophosphate building block has not been observed except in the structure of the uranium-containing compound Cs(8)U(5)(P(3)S(10))(2)(PS(4))(6). 相似文献
10.
Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials. 相似文献
11.
Two americium(III) iodates, beta-Am(IO3)3 (I) and alpha-Am(IO3)3 (II), have been prepared from the aqueous reactions of Am(III) with KIO(4) at 180 degrees C and have been characterized by single-crystal X-ray diffraction, diffuse reflectance, and Raman spectroscopy. The alpha-form is consistent with the known structure type I of anhydrous lanthanide iodates. It consists of a three-dimensional network of pyramidal iodate groups bridging [AmO8] polyhedra where each of the americium ions are coordinated to eight iodate ligands. The beta-form reveals a novel architecture that is unknown within the f-element iodate series. beta-Am(IO3)3 exhibits a two-dimensional layered structure with nine-coordinate Am(III) atoms. Three crystallographically unique pyramidal iodate anions link the Am atoms into corrugated sheets that interact with one another through intermolecular IO3-...IO3- interactions forming dimeric I2O10 units. One of these anions utilizes all three O atoms to simultaneously bridge three Am atoms. The other two iodate ligands bridge only two Am atoms and have one terminal O atom. In contrast to alpha-Am(IO3)3, where the [IO3] ligands are solely corner-sharing with [AmO8] polyhedra, a complex arrangement of corner- and edge-sharing mu2- and mu3-[IO3] pyramids can be found in beta-Am(IO3)3. Crystallographic data: I, monoclinic, space group P2(1)/n, a = 8.871(3) A, b = 5.933(2) A, c = 15.315(4) A, beta = 96.948(4) degrees , V = 800.1(4) A(3), Z = 4; II, monoclinic, space group P2(1)/c, a = 7.243(2) A, b = 8.538(3) A, c = 13.513(5) A, beta = 100.123(6) degrees , V = 822.7(5) A(3), Z = 4. 相似文献
12.
An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters. 相似文献
13.
An alkali-metal sulfur reactive flux has been used to synthesize a series of quaternary rare-earth metal compounds. These include KLaP(2)S(6) (I), K(2)La(P(2)S(6))(1/2)(PS(4)) (II), K(3)La(PS(4))(2) (III), K(4)La(0.67)(PS(4))(2) (IV), K(9-x)La(1+x/3)(PS(4))(4) (x = 0.5) (V), K(4)Eu(PS(4))(2) (VI), and KEuPS(4) (VII). Compound I crystallizes in the monoclinic space group P2(1)/c with the cell parameters a = 11.963(12) A, b = 7.525(10) A, c = 11.389(14) A, beta = 109.88(4) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/n with a = 9.066(6) A, b = 6.793(3) A, c = 20.112(7) A, beta = 97.54(3) degrees, and Z = 4. Compound III crystallizes in the monoclinic space group P2(1)/c with a= 9.141(2) A, b = 17.056(4) A, c = 9.470(2) A, beta = 90.29(2) degrees, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ibam with a = 18.202(2) A, b = 8.7596(7) A, c = 9.7699(8) A, and Z = 4. Compound V crystallizes in the orthorhombic space group Ccca with a = 17.529(9) A, b = 36.43(3) A, c = 9.782(4) A, and Z = 8. Compound VI crystallizes in the orthorhombic space group Ibam with a = 18.29(5) A, b = 8.81(2) A, c= 9.741(10) A, and Z = 4. Compound VII crystallizes in the orthorhombic space group Pnma with a = 16.782(2) A, b = 6.6141(6) A, c = 6.5142(6) A, and Z = 4. The sulfur compounds are in most cases isostructural to their selenium counterparts. By controlling experimental conditions, these structures can be placed in quasi-quaternary phase diagrams, which show the reaction conditions necessary to obtain a particular thiophosphate anionic unit in the crystalline product. These structures have been characterized by Raman and IR spectroscopy and UV-vis diffuse reflectance optical band gap analysis. 相似文献
14.
Hydrothermal reactions of the V2O5/2,2':6':2"-terpyridine/ZnO/H2O system under a variety of conditions yielded the organic-inorganic hybrid materials [V2O4(terpy)2]3[V10O28].2H2O (VOXI-10), [VO2(terpy)][V4O10] (VOXI-11), and [V9O22(terpy)3] (VOXI-12). The structure of VOXI-10 consists of discrete binuclear cations [V2O4(terpy)2]2+ and one-dimensional chains [V10O28]6-, constructed of cyclic [V4O12]4- clusters linked through (VO4) tetrahedra. In contrast, the structure of VOXI-11 exhibits discrete mononuclear cations [VO2(terpy)]1+ and a two-dimensional vanadium oxide network, [V4O10]1-. The structure of the oxide layer is constructed from ribbons of edge-sharing square pyramids; adjacent ribbons are connected through corner-sharing interactions into the two-dimensional architecture. VOXI-12 is also a network structure; however, in this case the terpy ligand is incorporated into the two-dimensional oxide network whose unique structure is constructed from cyclic [V6O18]6- clusters and linear (V3O5(terpy)3) moieties of corner-sharing vanadium octahedra. The rings form chains through corner-sharing linkages; adjacent chains are connected through the trinuclear units. Crystal data: VOXI-10, C90H70N18O42V16, triclinic P1, a = 12.2071(7) A, b = 13.8855(8) A, 16.9832(10) A, alpha = 69.584(1) degrees, beta = 71.204(1) degrees, gamma = 84.640(1) degrees, Z = 1; VOXI-11, C15H11N3O12V5, monoclinic, P2(1)/n, a = 7.7771(1) A, b = 10.3595(2) A, c = 25.715(4) A, beta = 92.286(1) degrees, Z = 4; VOXI-12, C45H33N9O22V9, monoclinic C2/c, a = 23.774(2) A, b = 9.4309(6) A, c = 25.380(2) A, beta = 112.047(1) degrees, Z = 4. 相似文献
15.
Two new phosphates, Bi(4.25)(PO4)2O(3.375) and Bi(5)(PO(4))(2)O(4.5), have been analyzed by single-crystal X-ray diffraction in the series Bi(4+x)(PO4)2O(3+3x/2) (0.175 < or = x < or = 1). The syntheses of the compositions ranging from x = 0.175 to 0.475 were carried out by the ceramic route. The compositions from x = 0.175 to 0.475 form a solid solution with a structure similar to that of Bi(4.25)(PO4)2O(3.375), while Bi(5)(PO4)2O(4.5) was isolated from a mixture of two phases. Both of the phases form fluorite-related structures but, nevertheless, differ from each other with respect to the arrangement of the bismuth atoms. The uniqueness in the structures is the appearance of isolated PO(4) tetrahedra separated by interleaving [Bi2O2] units. ac impedance studies indicate conductivity on the order of 10(-5) S cm(-1) for Bi(4.25)(PO4)2O(3.375). Crystal data: Bi(4.25)(PO4)2O(3.375), triclinic, space group P (No. 1), with a = 7.047(1) A, b = 9.863(2) A, c = 15.365(4) A, alpha = 77.604(4) degrees, beta = 84.556(4) degrees, gamma = 70.152(4) degrees, V = 980.90(4) A3, and Z = 4; Bi(5)(PO4)2O(4.5), monoclinic, space group C2/c (No. 15), with a = 13.093(1) A, b = 5.707(1) A, c = 15.293(1) A, beta = 98.240(2) degrees, V = 1130.95(4) A(3), and Z = 8. 相似文献
16.
The one-electron oxidized linear pentanuclear nickel complexes [Ni(5)(tpda)(4)(H(2)O)(BF(4))](BF(4))(2) (1) and [Ni(5)(tpda)(4)(SO(3)CF(3))(2)](SO(3)CF(3)) (2) have been synthesized by reacting the neutral compound [Ni(5)(tpda)(4)Cl(2)] with the corresponding silver salts. These compounds have been characterized by various spectroscopic techniques. Compound 1 crystallizes in the monoclinic space group P2(1)/n with a = 15.3022(1) A, b = 31.0705(3) A, c = 15.8109(2) A, beta = 92.2425(4) degrees, V = 7511.49(13) A(3), Z = 4, and compound 2 crystallizes in the monoclinic space group C2/c with a = 42.1894(7) A, b = 17.0770(3) A, c = 21.2117(4) A, beta = 102.5688(8) degrees, V = 14916.1(5) A(3), Z = 8. X-ray structural studies reveal an unsymmetrical Ni(5) unit for both compounds 1 and 2. Compounds 1 and 2 show stronger Ni-Ni interactions as compared to those of the neutral compounds. 相似文献
17.
Two new vanadates, Ba(2.5)(VO2)3(SeO3)4.H2O and La(VO2)3(TeO6).3H2O, have been synthesized by hydrothermal methods using BaCO3, Ba(OH)2.H2O, La(NO3)3.6H2O, V2O5, TeO2, and H2SeO3 as reagents. The structures were determined by single-crystal X-ray diffraction. Ba(2.5)(VO2)3(SeO3)4.H2O exhibits a two-dimensional layered structure consisting of VO(5) square pyramids and SeO3 polyhedra, whereas La(VO2)3(TeO6).3H2O has a three-dimensional framework structure composed of VO(4) tetrahedra and TeO6 octahedra. Infrared and Raman spectroscopy, UV-vis diffuse reflectance spectroscopy, and thermogravimetric analysis are also presented. Crystal data: Ba(2.5)(VO2)3(SeO3)4.H2O, trigonal, space group P (No. 147) with a = b = 12.8279(15) A, c = 7.2631(9) A, V = 1035.1(2) A(3), and Z = 2; La(VO2)3(TeO6).3H2O, trigonal, space group R3c (No. 161) with a = b = 9.4577(16) A, c = 23.455(7) A, V = 1816.9(7) A3, and Z = 6. 相似文献
18.
Five new rare-earth metal polyselenophosphates have been synthesized by the reactive flux method and characterized by single-crystal X-ray diffraction: K(2)La(P(2)Se(6))(1/2)(PSe(4)) (I), K(3)La(PSe(4))(2) (II), K(4)La(0.67)(PSe(4))(2) (III), K(9-x)()La(1+)(x/3)(PSe(4))(4) (x = 0.5) (IV), and KEuPSe(4) (V). Compound I crystallizes in the monoclinic space group P2(1)/n with a = 9.4269(1) A, b = 7.2054(1) A, c = 21.0276(5) A, beta = 97.484(1) degrees, and Z = 4. Compound II crystallizes in the monoclinic space group P2(1)/c with a = 9.5782(2) A, b = 17.6623(4) A, c = 9.9869(3) A, beta = 90.120(1) degrees, and Z = 4. Compound III crystallizes in the orthorhombic space group Ibam with a = 19.0962(2) A, b = 9.1408(1) A, c = 10.2588(2) A, and Z = 4. Compound IV crystallizes in the orthorhombic space group Ccca with a = 18.2133(1) A, b = 38.0914(4) A, c = 10.2665(1) A, and Z = 8. Compound V crystallizes in the orthorhombic space group Pnma with a = 17.5156(11) A, b = 7.0126(5) A, c = 6.9015(4) A, and Z = 4. Optical band gap measurements show that compound V has an optical band gap of 1.88 eV. Solid-state Raman spectroscopy of compounds II-V shows the four normal vibrations expected for the (PSe(4))(3-) unit. The observation of compounds I-V in several reactions has allowed the creation of a quasi-quaternary phase diagram for potassium rare-earth-metal polyselenophosphates. This phase diagram can qualitatively be separated into three regions on the basis of the oxidation state of phosphorus in the crystalline products observed and takes the next step in designing solid-state compounds. 相似文献
19.
Na2[UO2(IO3)4(H2O)] has been synthesized under mild hydrothermal conditions. Its structure consists of Na+ cations and [UO2(IO3)4(H2O)](2-) anions. The [UO2(IO3)4(H2O)](2-) anions are formed from the coordination of a nearly linear uranyl, UO2(2+), cation by four monodentate IO(3-) anions and a coordinating water molecule to yield a pentagonal bipyramidal environment around the uranium center. The water molecules form intermolecular hydrogen bonds with the terminal oxo atoms of neighboring [UO2(IO3)4(H2O)](2-) anions to yield one-dimensional chains that extend down the b axis. There are two crystallographically unique iodate anions in the structure of Na2[UO2(IO3)4(H2O)]. One of these anions is aligned so that the lone-pair of electrons is also directed along the b axis. The overall structure is therefore polar, owing to the cooperative alignment of both the hydrogen bonds and the lone-pair of electrons on iodate. The polarity of the monoclinic space group C2 (a = 11.3810(12) A, b = 8.0547(8) A, c = 7.6515(8) A, beta = 90.102(2) degrees , Z = 2, T = 193 K) found for this compound is consistent with the structure. Second-harmonic generation of 532 nm light from a 1064 nm laser source yields a response of approximately 16x alpha-SiO2. 相似文献
20.
The hydrothermal reaction of MoO(3) with BaH(3)IO(6) at 180 degrees C for 3 days results in the formation of Ba[(MoO(2))(6)(IO(4))(2)O(4)] x H(2)O (1). Under similar conditions, the reaction of Ba(OH)(2) x 8H(2)O with MoO(3) and Ba(IO(4))(2) x 6H(2)O yields Ba(3)[(MoO(2))(2)(IO(6))(2)] x 2H(2)O (2). The structure of 1, determined by single-crystal X-ray diffraction, consists of corner- and edge-sharing distorted MoO(6) octahedra that create two-dimensional slabs. Contained within this molybdenum oxide framework are approximately C(2v) tetraoxoiodate(V) anions, IO(4)(3-), that are involved in bonding with five Mo(VI) centers. The two equatorial oxygen atoms of the IO(4)(3-) anion chelate a single Mo(VI) center, whereas the axial atoms are mu(3)-oxo groups and complete the octahedra of four MoO(6) units. The coordination of the tetraoxoiodate(V) anion to these five highly electropositive centers is probably responsible for stabilizing the substantial anionic charge of this anion. The Ba(2+) cations separate the layers from one another and form long ionic contacts with neighboring oxygen atoms and a water molecule. Compound 2 also contains distorted MoO(6) octahedra. However, these solely edge-share with octahedral hexaoxoiodate(VII), IO(6)(5-), anions to form zigzagging one-dimensional, (1)(infinity)[(MoO(2))(IO(6))](3-), chains that are polar. These chains are separated from one another by Ba(2+) cations that are coordinated by additional water molecules. Bond valence sums for the iodine atoms in 1 and 2 are 5.01 and 7.03, respectively. Crystallographic data: 1, monoclinic, space group C2/c, a = 13.584(1) A, b = 7.3977(7) A, c = 20.736(2) A, beta = 108.244(2) degrees, Z = 4; 2, orthorhombic, space group Fdd2, a = 13.356(7) A, b = 45.54(2) A, c = 4.867(3) A, Z = 8. 相似文献