共查询到20条相似文献,搜索用时 31 毫秒
1.
The reaction of Eu metal with HOPr(i)/toluene solutions yielded the mixed Eu(2+)/Eu(3+) alkoxide [Eu(4)(OPr(i))(10)(HOPr(i))(3)] x 2HOPr(i) (1), in contrast to the other lanthanide metals, which exclusively yield trivalent lanthanide ions in the alkoxides formed. Metathesis between EuCl(3) and 3KOPr(i) and stoichiometric hydrolysis yielded the square-pyramidal Eu(5)O(OPr(i))(13) (2), and metathesis with EuCl(3) and 3KAl(OPr(i))(4) gave EuAl(3)(OPr(i))(12) (3). The structures of these compounds were determined by single-crystal X-ray diffraction. IR spectroscopic studies showed that the solid-state molecular structure of the three alkoxides remained close to intact in solution. Further characterizations were made with UV-vis spectroscopy, differential scanning calorimetry, and solubility studies. It was also found that 1 can be converted to 2 by oxidation with dioxygen, but 2 was not reduced by Eu metal to 1. The reactions of 2 and 1 with Al(4)(OPr(i))(12) in toluene/HOPr(i) solvent were studied by IR and UV-vis spectroscopy; 2 reacted completely to form 3 in 2 h at 75 degrees C, while 1 reacted to yield 3 and other unidentified Eu(2+) containing product(s) in the same time. 相似文献
2.
The reaction of [AuCl(PR(3))] with [1,2-(Ph(2)P)(2)-1,2-C(2)B(10)H(10)] in refluxing ethanol proceeds with partial degradation (removal of a boron atom adjacent to carbon) of the closo species to give [Au{(PPh(2))(2)C(2)B(9)H(10)}(PR(3))] [PR(3) = PPh(3) (1), PPh(2)Me (2), PPh(2)(4-Me-C(6)H(4)) (3), P(4-Me-C(6)H(4))(3) (4), P(4-OMe-C(6)H(4))(3) (5)]. Similarly, the treatment of [Au(2)Cl(2)(&mgr;-P-P)] with [1,2-(Ph(2)P)(2)-1,2-C(2)B(10)H(10)] under the same conditions leads to the complexes [Au(2){(PPh(2))(2)C(2)B(9)H(10)}(2)(&mgr;-P-P)] [P-P = dppe = 1,2-bis(diphenylphosphino)ethane (6), dppp = 1,3-bis(diphenylphosphino)propane (7)], where the dppe or dppp ligands bridge two gold nido-diphosphine units. The reaction of 1 with NaH leads to removal of one proton, and further reaction with [Au(PPh(3))(tht)]ClO(4) gives the novel metallocarborane compound [Au(2){(PPh(2))(2)C(2)B(9)H(9)}(PPh(3))(2)] (8). The structure of complexes 1 and 7 have been established by X-ray diffraction. [Au{(PPh(2))(2)C(2)B(9)H(10)}(PPh(3))] (1) (dichloromethane solvate) crystallizes in the monoclinic space group P2(1)/c, with a = 17.326(3) ?, b = 20.688(3) ?, c = 13.442(2) ?, beta = 104.710(12) degrees, Z = 4, and T = -100 degrees C. [Au(2){(PPh(2))(2)C(2)B(9)H(10)}(2)(&mgr;-dppp)] (7) (acetone solvate) is triclinic, space group P&onemacr;, a = 13.432(3) ?, b = 18.888(3) ?, c = 20.021(3) ?, alpha = 78.56(2) degrees, beta = 72.02(2) degrees, gamma = 73.31(2) degrees, Z = 2, and T = -100 degrees C. In both complexes the gold atom exhibits trigonal planar geometry with the 7,8-bis(diphenylphosphino)-7,8-dicarba-nido-undecaborate(1-) acting as a chelating ligand. 相似文献
3.
Reduction of TiCl(4) with 1 equiv of HSnBu(3) followed by addition of [PPh(4)]Cl and then PR(3) leads to two new dinuclear titanium(III) compounds, [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PR(3))(2)] (R = Et and R(3) = Me(2)Ph), both of which contain an anion with the face-sharing bioctahedral type structure. Their crystal structures are reported. [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PEt(3))(2)].2CH(2)Cl(2) crystallized in the triclinic space group P&onemacr;. Cell dimensions: a = 12.461(1) ?, b = 20.301(8) ?, c = 11.507(5) ?, alpha = 91.44 degrees, beta = 113.27(1) degrees, gamma = 104.27(2) degrees, and Z = 2. The distance between titanium atoms is 3.031(2) ?. [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PMe(2)Ph)(2)].CH(2)Cl(2) also crystallized in the triclinic space group P&onemacr; with cell dimensitions a = 11.635(4) ?, b = 19.544(3) ?, c = 11.480(3) ?, alpha = 100.69(2) degrees, beta = 109.70(1) degrees, gamma = 95.08(2) degrees, and Z = 2. The distance between titanium atoms in this compound is 2.942(1) ?. Variable temperature magnetic susceptibilities were measured for [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PEt(3))(2)]. Electronic structure calculations were carried out for a model ion, [Ti(2)(&mgr;-Cl)(3)Cl(4)(PH(3))(2)](-), and another well-known anion, [Ti(2)(&mgr;-Cl)(3)Cl(6)](3)(-), by employing an ab initio configuration interaction method. The results of the calculations reveal that the metal-metal interaction in these Ti(III) face-sharing compounds can be best described by strong antiferromagnetic coulping that leads to a singlet ground state and a thermally accessible triplet first excited state. Accordingly the measured magnetic data were satisfactorily fitted to a spin-only formula. 相似文献
4.
Shieh M Sheu Cm Ho LF Cherng JJ Jang LF Ueng CH Peng SM Lee GH 《Inorganic chemistry》1996,35(19):5504-5508
The reactions of [Et(4)N](3)[Sb{Fe(CO)(4)}(4)] (1) with RX (R = Me, Et, n-Pr; X = I) in MeCN form the monoalkylated antimony complexes [Et(4)N](2)[RSb{Fe(CO)(4)}(3)] (R = Me, 2; R = Et, 4; R = n-Pr, 6) and the dialkylated antimony clusters [Et(4)N][R(2)Sb{Fe(CO)(4)}(2)] (R = Me, 3; R = Et, 5; R = n-Pr, 7), respectively. When [Et(4)N](3)[Sb{Fe(CO)(4)}(4)] reacts with i-PrI, only the monoalkylated antimony complex [Et(4)N](2)[i-PrSb{Fe(CO)(4)}(3)] (8) is obtained. The mixed dialkylantimony complex [Et(4)N][MeEtSb{Fe(CO)(4)}(2)] (9) also can be synthesized from the reaction of 2 with EtI. While the reaction with Br(CH(2))(2)Br produces [Et(4)N](2)[BrSb{Fe(CO)(4)}(3)] (10), treatment with Cl(CH(2))(3)Br forms the monoalkylated product [Et(4)N](2)[Cl(CH(2))(3)Sb{Fe(CO)(4)}(3)] (11) and a dialkylated novel antimony-iron complex [Et(4)N][{&mgr;-(CH(2))(3)}Sb{Fe(CO)(4)}(3)] (12). On the other hand, the reaction with Br(CH(2))(4)Br forms the monoalkylated antimony product and the dialkylated antimony complex [Et(4)N][{&mgr;-(CH(2))(4)}Sb{Fe(CO)(4)}(2)] (13). Complexes 2-13 are characterized by spectroscopic methods or/and X-ray analyses. On the basis of these analyses, the core of the monoalkyl clusters consists of a central antimony atom tetrahedrally bonded to one alkyl group and three Fe(CO)(4) fragments and the dialkyl products are structurally similar to the monoalkyl clusters, with the central antimony bonded to two alkyl groups and two Fe(CO)(4) moieties in each case. The dialkyl complex 3 crystallizes in the monoclinic space group P2(1)/c with a = 13.014(8) ?, b = 11.527(8) ?, c = 17.085(5) ?, beta = 105.04(3) degrees, V = 2475(2) ?(3), and Z = 4. Crystals of 12 are orthorhombic, of space group Pbca, with a = 14.791(4) ?, b = 15.555(4) ?, c = 27.118(8) ?, V = 6239(3) ?(3), and Z = 8. The anion of cluster 12 exhibits a central antimony atom bonded to three Fe(CO)(4) fragments with a -(CH(2))(3)- group bridging between the Sb atom and one Fe(CO)(4) fragment. This paper discusses the details of the reactions of [Et(4)N](3)[Sb{Fe(CO)(4)}(4)] with a series of alkyl halides and dihalides. These reactions basically proceed via a novel double-alkylation pathway, and this facile methodology can as well provide a convenient route to a series of alkylated antimony-iron carbonyl clusters. 相似文献
5.
X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions. 相似文献
6.
The reaction of W(2)(OOCCF(3))(4) with (CO)(9)Co(3)CCOOH and Na[OOCCF(3)] in a nonpolar solvent mixture leads to the formation of the cluster of clusters {[Na][W(2){OOCCCo(3)(CO)(9)}(2)(OOCCF(3))(4)(THF)(2)]}(2), 1, in 40% yield. The structure of 1.3C(6)H(5)CH(3) in the solid state corresponds to a dimer of W(2) dinuclear complexes (monoclinic P2(1)/c, a = 15.234(6) ?, b = 23.326(11) ?, c = 20.658(7) ?, beta = 102.46(3) degrees; V = 7,168(5) ?(3); Z = 4; R(F)() = 8.39%). Each W(2) unit is bridged by two cis cluster carboxylates, and the remaining four equatorial sites are occupied by monodentate [OOCCF(3)](-) ligands. The axial positions contain coordinated THF. The W(2) carboxylate is opened up (W-W distance of 2.449(2) ?) so that the free ends of the [OOCCF(3)](-) ligands on both W(2) carboxylate units can cooperate in chelating two Na(+) ions thereby forming a dimer of W(2) complexes. A distinctive EPR spectrum with g = 2.08 is consistent with each W(2) carboxylate being a mixed-valent W(II)-W(III) species. The reaction of W(2)(OOCCF(3))(4) with (CO)(9)Co(3)CCOOH in THF in the absence of Na[OOCCF(3)] leads to the expected diamagnetic W(II)-W(II) cluster carboxylate W(2){OOCCCo(3)(CO)(9)}(3)(OOCCF(3))(THF)(2), 3. 相似文献
7.
Gates DP Park P Liang M Edwards M Angelakos C Liable-Sands LM Rheingold AL Manners I 《Inorganic chemistry》1996,35(15):4301-4309
The reactions of the cyclic thionylphosphazenes [NSOX(NPCl(2))(2)] (1, X = Cl; 2, X = F) with three oxygen-based nucleophiles of increasing basicity, sodium phenoxide (NaOPh), sodium trifluoroethoxide (NaOCH(2)CF(3)), and sodium butoxide (NaOBu) have been studied. The reaction of 1 and 2 with 4 equiv of NaOPh at 25 degrees C yielded the regioselectively tetrasubstituted species [NSOX{NP(OPh)(2)}(2)] (5d, X = Cl; 6d, X = F). Further reaction of 5d with an additional 2 equiv of NaOPh over several days or at elevated temperatures gave the fully substituted compound [NSO(OPh){NP(OPh)(2)}(2)] (5e), whereas 6d did not react further. The reaction of 1 and 2 with 5 equiv of NaOCH(2)CF(3) yielded in both cases [NSO(OCH(2)CF(3)){NP(OCH(2)CF(3))(2)}(2)] (7e), and similarly reaction with 5 equiv of NaOBu yielded [NSO(OBu){NP(OBu)(2)}(2)] (9e). In all cases, the reactions were monitored by (31)P NMR and (where applicable) (19)F NMR and were found to involve complete substitution at phosphorus via a predominantly vicinal pathway, followed by substitution at sulfur. Substitutional control of the reactions of NaOPh, NaOBu, with 1 and 2 was found to conform to the following general order of reactivity, PCl(2) > PCl(OR) > SOX (X = Cl, F). Although the reaction with NaOCH(2)CF(3) followed the same order of reactivity, a significant enhancement of reaction rate was detected with each equivalent of trifluoroethoxide added. Reaction of 7e with excess NaOCH(2)CF(3) led to elimination of (CF(3)CH(2))(2)O and the formation of the salts Na[NSO(OCH(2)CF(3))NP(OCH(2)CF(3))(2)NP(OCH(2)CF(3))O] (11) and Na[NS(O)O{NP(OCH(2)CF(3))(2)}(2)] (12). Crystals of 6d are triclinic, space group P&onemacr;, with a = 9.789(3) ?, b = 11.393(4) ?, c = 12.079(5) ?, alpha = 107.40(3) degrees, beta = 91.23(3) degrees, gamma = 93.18(3), V = 1283.6(8) ?(3), and Z = 2. Crystals of 5e are monoclinic, space group C2/c, with a = 32.457(3) ?, b = 10.747(1) ?, c = 18.294(2) ?, beta = 110.37(1) degrees, V = 5982.4(9) ?(3), and Z = 8. 相似文献
8.
Karet GB Sun Z Heinrich DD McCusker JK Folting K Streib WE Huffman JC Hendrickson DN Christou G 《Inorganic chemistry》1996,35(22):6450-6460
The syntheses and properties of tetra- and pentanuclear vanadium(IV,V) carboxylate complexes are reported. Reaction of (NBzEt(3))(2)[VOCl(4)] (1a) with NaO(2)CPh and atmospheric H(2)O/O(2) in MeCN leads to formation of (NBzEt(3))(2)[V(5)O(9)Cl(O(2)CPh)(4)] 4a; a similar reaction employing (NEt(4))(2)[VOCl(4)] (1b) gives (NEt(4))(2)[V(5)O(9)Cl(O(2)CPh)(4)] (4b). Complex 4a.MeCN crystallizes in space group P2(1)2(1)2(1) with the following unit cell dimensions at -148 degrees C: a = 13.863(13) ?, b = 34.009(43) ?, c = 12.773(11) ?, and Z = 4. The reaction between (NEt(4))(2)[VOBr(4)] (2a) and NaO(2)CPh under similar conditions gives (NEt(4))(2)[V(5)O(9)Br(O(2)CPh)(4)] (6a), and the use of (PPh(4))(2)[VOBr(4)] (2b) likewise gives (PPh(4))(2)[V(5)O(9)Br(O(2)CPh)(4)] (6b). Complex 6b crystallizes in space group P2(1)2(1)2(1) with the following unit cell dimensions at -139 degrees C: a = 18.638(3) ?, b = 23.557(4) ?, c = 12.731(2) ?, and Z = 4. The anions of 4a and 6b consist of a V(5) square pyramid with each vertical face bridged by a &mgr;(3)-O(2)(-) ion, the basal face bridged by a &mgr;(4)-X(-) (X = Cl, Br) ion, and a terminal, multiply-bonded O(2)(-) ion on each metal. The RCO(2)(-) groups bridge each basal edge to give C(4)(v)() virtual symmetry. The apical and basal metals are V(V) and V(IV), respectively (i.e., the anions are trapped-valence). The reaction of 1b with AgNO(3) and Na(tca) (tca = thiophene-2-carboxylate) in MeCN under anaerobic conditions gives (NEt(4))(2)[V(4)O(8)(NO(3))(tca)(4)] (7). Complex 7.H(2)O crystallizes in space group C2/c with the following unit cell dimensions at -170 degrees C: a = 23.606(4) ?, b = 15.211(3) ?, c = 23.999(5) ?, and Z = 4. The anion of 7 is similar to those of 4a and 6b except that the apical [VO] unit is absent, leaving a V(4) square unit, and the &mgr;(4)-X(-) ion is replaced with a &mgr;(4),eta(1)-NO(3)(-) ion. The four metal centers are now at the V(IV), 3V(V) oxidation level, but the structure indicates four equivalent V centers, suggesting an electronically delocalized system. Variable-temperature magnetic susceptibility data were collected on powdered samples of 4b, 6a, and 7 in the 2.00-300 K range in a 10 kG applied field. 4b and 6a both show a slow increase in effective magnetic moment (&mgr;(eff)) from approximately 3.6-3.7 &mgr;(B) at 320 K to approximately 4.5-4.6 &mgr;(B) at 11.0 K and then a slight decrease to approximately 4.2 &mgr;(B) at 2.00 K. The data were fit to the theoretical expression for a V(IV)(4) square with two exchange parameters J = J(cis)() and J' = J(trans)() (H = -2JS(i)()S(j)()): fitting of the data gave, in the format 4b/6a, J= +39.7/+46.4 cm(-)(1), J' = -11.1/-18.2 cm(-)(1) and g = 1.83/1.90, with the complexes possessing S(T) = 2 ground states. The latter were confirmed by magnetization vs field studies in the 2.00-30.0 K and 0.500-50.0 kG ranges: fitting of the data gave S(T) = 2 and D = 0.00 cm(-)(1) for both complexes, where D is the axial zero-field splitting parameter. Complex 7 shows a nearly temperature-independent &mgr;(eff) (1.6-2.0 &mgr;(B)) consistent with a single d electron per V(4) unit. The (1)H NMR spectra of 4b and 6a in CD(3)CN are consistent with retention of their pentanuclear structure on dissolution. The EPR spectrum of 7 in a toluene/MeCN (1:2) solution at approximately 25 degrees C yields an isotropic signal with a 29-line hyperfine pattern assignable to hyperfine interactions with four equivalent I = (7)/(2) (51)V nuclei. 相似文献
9.
The salts (Ph(4)E)[M(SOCPh)(3)] (M = Zn, Cd, or Hg; E = P or As) are produced by the reaction of Zn(NO(3))(2).6 H(2)O, Cd(NO(3))(2).4H(2)O or HgCl(2) with Et(3)NH(+)PhCOS(-) and (Ph(4)E)X (E = P, X = Br; E = As, X = Cl) in aqueous MeOH in the ratios M(II):PhCOS(-):Ph(4)E(+) = 1:>/=3:>/=1. The crystal structures of (Ph(4)P)[Zn(SOCPh)(3)] (1), (Ph(4)As)[Cd(SOCPh)(3)] (2) and (Ph(4)P)[Hg(SOCPh)(3)] (3) have been determined by single-crystal X-ray diffraction experiments. Crystal data for 1: triclinic; space group P&onemacr;; Z = 2; a = 10.819(2) ?, b = 13.219(3) ?, c = 15.951(3) ?; alpha = 101.75(2) degrees, beta = 97.92(1) degrees, gamma = 109.18(2) degrees. Crystal data for 2: triclinic; space group P&onemacr;; Z= 2; a = 10.741(2) ?, b = 13.168(2) ?, c = 15.809(2) ?; alpha = 101.00(1) degrees, beta = 97.65(1) degrees, gamma = 109.88(1) degrees. Crystal data for 3: monoclinic; space group P2(1)/n; Z = 4; a = 13.302(2) ?, b = 14.276(2) ?, c = 21.108(2) ?; beta = 90.92(1) degrees. The compounds 1 and 2 are isomorphous and isostructural. In the anions [M(SOCPh)(3)](-) the metal atoms have trigonal planar coordination by three sulfur atoms. The metal atoms are further more weakly coordinated intramolecularly to one (M = Hg) or two (M = Zn, Cd) thiobenzoate oxygen atom(s). Using the Bond Valence approach it is found that the contribution of M.O bonding to the total bonding is in the order Cd > Zn > Hg. The metal ((113)Cd, (199)Hg) NMR signals of [M(SOCPh)(3)](-) (M = Cd, Hg) are more shielded than those found for MS(3) kernels in thiolate complexes, a difference attributed to the M(.)O bonding in the thiobenzoate complexes. The (113)Cd resonance of [Cd(SOCPh)(3)](-) in dilute solution is in the region anticipated from dilution data for [Na(Cd{SOCPh}(3))(2)](-). 相似文献
10.
The reactions of the singly deprotonated di-2-pyridylmethanediol ligand (dpmdH(-)) with copper(II) and bismuth(III) have been investigated. A new dinuclear bismuth(III) complex Bi(2)(dpmdH)(2)(O(2)CCF(3))(4)(THF)(2), 1, has been obtained by the reaction of BiPh(3) with di-2-pyridyl ketone in the presence of HO(2)CCF(3) in tetrahydrofuran (THF). The reaction of Cu(OCH(3))(2) with di-2-pyridyl ketone, H(2)O, and acetic acid in a 1:2:2:2 ratio yielded a mononuclear complex Cu[(2-Py)(2)CO(OH)](2)(HO(2)CCH(3))(2), 2, while the reaction of Cu(OAC)(2)(H(2)O) with di-2-pyridyl ketone and acetic acid in a 2:1:1 ratio yielded a tetranuclear complex Cu(4)[(2-Py)(2)CO(OH)](2)(O(2)CCH(3))(6)(H(2)O)(2), 3. The structures of these complexes were determined by single-crystal X-ray diffraction analyses. Three different bonding modes of the dpmdH(-) ligand were observed in compounds 1-3. In 2, the dpmdH(-) ligand functions as a tridentate chelate to the copper center and forms a hydrogen bond between the OH group and the noncoordinating HO(2)CCH(3) molecule. In 1 and 3, the dpmdH(-) ligand functions as a bridging ligand to two metal centers through the oxygen atom. The two pyridyl groups of the dpmdH(-) ligand are bound to one bismuth(III) center in 1, while in 3 they are bound two copper(II) centers, respectively. Compound 3 has an unusual one dimensional hydrogen bonded extended structure. The intramolecular magnetic interaction in 3 has been found to be dominated by ferromagnetism. Crystal data: 1, C(38)H(34)N(4)O(14)F(12)Bi(2), triclinic P&onemacr;, a = 11.764(3) ?, b = 11.949(3) ?, c = 9.737(1) ?, alpha =101.36(2) degrees, beta = 105.64(2) degrees, gamma = 63.79(2) degrees, Z = 1; 2, C(26)H(26)N(4)O(8)Cu/CH(2)Cl(2), monoclinic C2/c, a = 25.51(3) ?, b = 7.861(7) ?, c = 16.24(2) ?, beta = 113.08(9) degrees, Z = 4; 3, C(34)H(40)N(4)O(18)Cu(4)/CH(2)Cl(2), triclinic P&onemacr;, a = 10.494(2) ?, b = 13.885(2) ?, c = 7.900(4) ?, alpha =106.52(2) degrees, beta = 90.85(3) degrees, gamma = 94.12(1) degrees, Z = 1. 相似文献
11.
Reported is the first rational synthesis of a trisubstituted deltahedral Zintl ion, [Ge(9){Si(SiMe(3))(3)}(3)](-) in this case, by the addition of the three substituents in a reaction of the parent naked deltahedral Zintl ion Ge(9)(4-) with {(Me(3)Si)(3)Si}Cl. The new species were crystallized and structurally characterized in [K(2,2,2-crypt)](2)[Ge(9){Si(SiMe(3))(3)}(3)] (monoclinic, P2(1)/c, a = 26.497(3) ?, b = 24.090(2) ?, c = 29.268(3) ?, β = 113.888(2)°, V = 17082(3) ?(3), Z = 8, R1/wR2 = 0.0436/0.0812 for the observed data and 0.1023/0.1010 for all data). 相似文献
12.
An example of a direct axial interaction of a platinum(II) atom with a Mo(2) core through a uniquely designed tridentate ligand 6-(diphenylphosphino)-2-pyridonate (abbreviated as pyphos) is described. Treatment of PtX(2)(pyphosH)(2) (2a, X = Cl; 2b, X = Br; 2c, X = I) with a 1:1 mixture of Mo(2)(O(2)CCH(3))(4) and [Mo(2)(O(2)CCH(3))(2)(NCCH(3))(6)](2+) (3a) in dichloromethane afforded the linear trinuclear complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCH(3))(2)](2) (4a, X = Cl; 4b, X = Br; 4c, X = I). The reaction of [Mo(2)(O(2)CCMe(3))(2)(NCCH(3))(4)](2+) (3b) with 2a-c in dichloromethane afforded the corresponding pivalato complexes [Mo(2)PtX(2)(pyphos)(2)(O(2)CCMe(3))(2)](2) (5a, X = Cl; 5b, X = Br; 5c, X = I), whose bonding nature is discussed on the basis of the data from Raman and electronic spectra as well as cyclic voltammograms. The linear trinuclear structures in 4b and 5a-c were confirmed by NMR studies and X-ray analyses: 4b, monoclinic, space group C2/c, a = 34.733(4) ?, b = 17.81(1) ?, c = 22.530(5) ?, beta = 124.444(8) degrees, V = 11498(5) ?(3), Z = 8, R = 0.060 for 8659 reflections with I > 3sigma(I) and 588 parameters; 5a, triclinic, space group P&onemacr;, a = 13.541(3) ?, b = 17.029(3) ?, c = 12.896(3) ?, alpha = 101.20(2) degrees, beta = 117.00(1) degrees, gamma = 85.47(2) degrees, V = 2599(1) ?(3), Z = 2, R = 0.050 for 8148 reflections with I > 3sigma(I) and 604 parameters; 5b, triclinic, space group P&onemacr;, a = 12.211(2) ?, b = 20.859(3) ?, c = 10.478(2) ?, alpha = 98.88(1) degrees, beta = 112.55(2) degrees, gamma = 84.56(1) degrees, V = 2433.3(8) ?(3), Z = 2, R = 0.042 for 8935 reflections with I > 3sigma(I) and 560 parameters; 5c, monoclinic, space group P2(1)/n, a = 13.359(4) ?, b = 19.686(3) ?, c = 20.392(4) ?, beta = 107.92(2) degrees, V = 5101(2) ?(3), Z = 4, R = 0.039 for 8432 reflections with I > 3sigma(I) and 560 parameters. 相似文献
13.
The reactions of the unsymmetrical, coordinatively unsaturated dirhenium(II) complexes [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)]Y (XylNC = 2,6-dimethylphenyl isocyanide; Y = O(3)SCF(3) (3a), PF(6) (3b)) with XylNC afford at least three isomeric forms of the complex cation [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](+). Two forms have very similar bis(&mgr;-halo)-bridged edge-sharing bioctahedral structures of the type [(CO)BrRe(&mgr;-Br)(2)(&mgr;-dppm)(2)Re(CNXyl)(2)]Y (Y = O(3)SCF(3) (4a/4a'), PF(6) (4b/4b')), while the third is an open bioctahedron [(XylNC)(2)BrRe(&mgr;-dppm)(2)ReBr(2)(CO)]Y (Y = O(3)SCF(3) (5a), PF(6) (5b)). While the analogous chloro complex cation [Re(2)Cl(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](+) was previously shown to exist in three isomeric forms, only one of these has been found to be structurally similar to the bromo complexes (i.e. the isomer analogous to 5a and 5b). The reaction of 3a with CO gives the salt [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(2)(CNXyl)]O(3)SCF(3) (7), in which the edge-sharing bioctahedral cation [(XylNC)BrRe(&mgr;-Br)(&mgr;-CO)(&mgr;-dppm)(2)ReBr(CO)](+) has an all-cis arrangement of pi-acceptor ligands. The Re-Re distances in the structures of 4b', 5a, and 7 are 3.0456(8), 2.3792(7), and 2.5853(13) ?, respectively, and accord with formal Re-Re bond orders of 1, 3, and 2, respectively. Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)](PF(6))(0.78)(ReO(4))(0.22).CH(2)Cl(2) (4b') at 295 K: monoclinic space group P2(1)/n (No. 14) with a = 19.845(4) ?, b = 16.945(5) ?, c = 21.759(3) ?, beta = 105.856(13) degrees, V = 7038(5) ?(3), and Z = 4. The structure was refined to R = 0.060 (R(w) = 0.145) for 14 245 data (F(o)(2) > 2sigma(F(o)(2))). Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(CNXyl)(2)]O(3)SCF(3).C(6)H(6) (5a) at 173 K: monoclinic space group P2(1)/n (No. 14) with a = 14.785(3) ?, b = 15.289(4) ?, c = 32.067(5) ?, beta = 100.87(2) degrees, V=7118(5) ?(3), and Z = 4. The structure was refined to R = 0.046 (R(w) = 0.055) for 6962 data (I > 3.0sigma(I)). Crystal data for [Re(2)Br(3)(&mgr;-dppm)(2)(CO)(2)(CNXyl)]O(3)SCF(3).Me(2)CHC(O)Me (7) at 295 K: monoclinic space group P2(1)/n (No. 14) with a = 14.951(2) ?, b = 12.4180(19) ?, c = 40.600(5) ?, beta = 89.993(11) degrees, V = 7537(3) ?(3), and Z = 4. The structure was refined to R = 0.074 (R(w) = 0.088) for 6595 data (I > 3.0sigma(I)). 相似文献
14.
The new compounds Rb(3)(AlQ(2))(3)(GeQ(2))(7) [Q = S (1), Se (2)] feature the 3D anionic open framework [(AlQ(2))(3)(GeQ(2))(7)](3-) in which aluminum and germanium share tetrahedral coordination sites. Rb ions are located in channels formed by the connection of 8, 10, and 16 (Ge/Al)S(4) tetrahedra. The isostructural sulfur and selenium derivatives crystallize in the space group P2(1)/c. 1: a = 6.7537(3) ?, b = 37.7825(19) ?, c = 6.7515(3) ?, and β = 90.655(4)°. 2: a = 7.0580(5) ?, b = 39.419(2) ?, c = 7.0412(4) ?, β = 90.360(5)°, and Z = 2 at 190(2) K. The band gaps of the congruently melting chalcogenogermanates are 3.1 eV (1) and 2.4 eV (2). 相似文献
15.
Buil ML Espinet P Esteruelas MA Lahoz FJ Lledós A Martínez-Ilarduya JM Maseras F Modrego J Oñate E Oro LA Sola E Valero C 《Inorganic chemistry》1996,35(5):1250-1256
The dihydrido-olefin complex OsH(2)(eta(2)-CH(2)=CHEt)(CO)(P(i)Pr(3))(2) (2) reacts with H(2)SiPh(2) to give OsH(3)(SiHPh(2))(CO)(P(i)Pr(3))(2) (3). The molecular structure of 3 has been determined by X-ray diffraction (monoclinic, space group P2(1)/c with a = 16.375(2) ?, b = 11.670(1) ?, c =18.806(2) ?, beta = 107.67(1) degrees, and Z = 4) together with ab initio calculations on the model compound OsH(3)(SiH(3))(CO)(PH(3))(2). The coordination geometry around the osmium center can be rationalized as a heavily distorted pentagonal bipyramid with one hydrido ligand and the carbonyl group in the axial positions. The two other hydrido ligands lie in the equatorial plane, one between the phosphine ligands and the other between the SiHPh(2) group and one of the phosphine ligands. Complex 3 can also be prepared by reaction of OsH(eta(2)-H(2)BH(2))(CO)(P(i)Pr(3))(2) (4) with H(2)SiPh(2). Similarly, the treatment of 4 with HSiPh(3) affords OsH(3)(SiPh(3))(CO)(P(i)Pr(3))(2) (5), while the addition of H(3)SiPh to 4 in methanol yields OsH(3){Si(OMe)(2)Ph}(CO)(P(i)Pr(3))(2) (6). Complex 2 also reacts with HGeR(3) and HSnR(3) to give OsH(3)(GeR(3))(CO)(P(i)Pr(3))(2) (GeR(3) = GeHPh(2) (7), GePh(3) (8), GeEt(3) (9)) and OsH(3)(SnR(3))(CO)(P(i)Pr(3))(2) (R = Ph (10), (n)Bu (11)), respectively. In solution, compounds 3 and 5-11 are fluxional and display similar (1)H and (31)P{(1)H} NMR spectra, suggesting that they possess a similar arrangement of ligands around the osmium atom. 相似文献
16.
The hydrothermal syntheses of a family of new alkali-metal/ammonium vanadium(V) methylphosphonates, M(VO(2))(3)(PO(3)CH(3))(2) (M = K, NH(4), Rb, Tl), are described. The crystal structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) have been determined from single-crystal X-ray data. Crystal data: K(VO(2))(3)(PO(3)CH(3))(2), M(r) = 475.93, trigonal, R32 (No. 155), a = 7.139(3) ?, c = 19.109(5) ?, Z = 3; NH(4)(VO(2))(3)(PO(3)CH(3))(2), M(r) = 454.87, trigonal, R32 (No. 155), a = 7.150(3) ?, c = 19.459(5) ?, Z = 3. These isostructural, noncentrosymmetric phases are built up from hexagonal tungsten oxide (HTO) like sheets of vertex-sharing VO(6) octahedra, capped on both sides of the V/O sheets by PCH(3) entities (as [PO(3)CH(3)](2-) methylphosphonate groups). In both phases, the vanadium octahedra display a distinctive two short + two intermediate + two long V-O bond distance distribution within the VO(6) unit. Interlayer potassium or ammonium cations provide charge balance for the anionic (VO(2))(3)(PO(3)CH(3))(2) sheets. Powder X-ray, TGA, IR, and Raman data for these phases are reported and discussed. The structures of K(VO(2))(3)(PO(3)CH(3))(2) and NH(4)(VO(2))(3)(PO(3)CH(3))(2) are compared and contrasted with related layered phases based on the HTO motif. 相似文献
17.
The reaction of [Cu(acpa)](+) with [MO(4)](2)(-) (Hacpa = N-(1-acetyl-2-propyridene)(2-pyridylmethyl)amine and M = Cr and Mo) in water-methanol or water-acetonitrile solution affords dinuclear copper(II) complexes with metalate bridges, [{Cu(acpa)}(2)(&mgr;-CrO(4))].4CH(3)OH.4H(2)O (1) and [{Cu(acpa)}(2)(&mgr;-MoO(4))].4H(2)O (2), respectively. The crystal structures and the magnetic properties have been studied. Complexes 1 and 2 are isomorphous and the structures are made up of discrete dimers in which two copper(II) ions are bridged by the [MO(4)](2)(-) anion. The coordination geometry about the copper(II) ions is square planar with a N(2)O chelate group from acpa and an oxygen atom from [MO(4)](2)(-). Magnetic susceptibility measurements for 1 revealed that a ferromagnetic interaction between copper(II) ions is propagated through the [CrO(4)](2)(-) bridge and the coupling constant (2J) was evaluated to be 14.6(1) cm(-)(1) (H = -2JS(1).S(2)). In 2, two copper(II) ions bridged by [MoO(4)](2)(-) anion are antiferromagnetically coupled with the 2J value of -5.1(4) cm(-)(1). The ferromagnetic interaction in 1 is explained by means of the orbital topology of frontier orbitals. Crystal data: 1, monoclinic, space group P2(1)/m, a = 8.349(2) ?, b = 17.616(3) ?, c = 10.473 ?, beta = 107.40(2) degrees, Z= 2; 2, monoclinic, space group P2(1)/m, a = 8.486(2) ?, b = 18.043(3) ?, c = 9.753(2) ?, beta = 95.82(2) degrees, Z = 2. 相似文献
18.
Jüstel T Bendix J Metzler-Nolte N Weyhermüller T Nuber B Wieghardt K 《Inorganic chemistry》1998,37(1):35-43
Reaction of LRu(III)Cl(3) (L = 1,4,7-trimethyl-1,4,7-triazacyclononane) with 1,2-phenylenediamine (opdaH(2)) in H(2)O in the presence of air affords [LRu(II)(bqdi)(OH(2))](PF(6)) (1), where (bqdi) represents the neutral ligand o-benzoquinone diimine. From an alkaline methanol/water mixture of 1 was obtained the dinuclear species [{LRu(II)(bqdi)}(2)(&mgr;-H(3)O(2))](PF(6))(3) (1a). The coordinated water molecule in 1 is labile and can be readily substituted under appropriate reaction conditions by acetonitrile, yielding [LRu(II)(bqdi)(CH(3)CN)](PF(6))(2) (2), and by iodide and azide anions, affording [LRu(II)(bqdi)I](PF(6)).0.5H(2)O (3) and [LRu(bqdi)(N(3))](PF(6)).H(2)O (4), respectively. Heating of solid 4 in vacuum at 160 degrees C generates N(2) and the dinuclear, nitrido-bridged complex [{LRu(o-C(6)H(4)(NH)(2))}(2)(&mgr;-N)](PF(6))(2) (5). Complex 5 is a mixed-valent, paramagnetic species containing one unpaired electron per dinuclear unit whereas complexes 1-4 are diamagnetic. The crystal structures of 1, 1a.3CH(3)CN, 3, 4.H(2)O, and 5.3CH(3)CN.0.5(toluene) have been determined by X-ray crystallography: 1 crystallizes in the monoclinic space group P2(1)/m, Z = 2, with a = 8.412(2) ?, b = 15.562(3) ?, c = 10.025 ?, and beta = 109.89(2) degrees; 1a.3CH(3)CN, in the monoclinic space group C2/c, Z = 4, with a = 19.858(3) ?, b = 15.483(2) ?, c = 18.192(3) ?, and beta = 95.95(2) degrees; 3, in the orthorhombic space group Pnma, Z = 4, with a = 18.399(4) ?, b = 9.287(2) ?, and c = 12.052(2) ?, 4.H(2)O, in the monoclinic space group P2(1)/c, Z = 4, with a = 8.586(1) ?, b = 15.617(3) ?, c = 16.388(5) ?, and beta = 90.84(2) degrees; and 5.3CH(3)CN.0.5(toluene), in the monoclinic space group P2(1)/c, Z = 4, with a = 15.003(3) ?, b = 16.253(3) ?, c = 21.196(4) ?, and beta = 96.78(3) degrees. The structural data indicate that in complexes 1-4 the neutral o-benzoquinone diimine ligand prevails. In contrast, in 5 this ligand has predominantly o-phenylenediamide character, which would render 5 formally a mixed-valent Ru(IV)Ru(V) species. On the other hand, the Ru-N bond lengths of the Ru-N-Ru moiety at 1.805(5) and 1.767(5) ? are significantly longer than those in other crystallographically characterized Ru(IV)=N=Ru(IV) units (1.72-1.74 ?). It appears that the C(6)H(4)(NH)(2) ligand in 5 is noninnocent and that formal oxidation state assignments to the ligands or metal centers are not possible. 相似文献
19.
La(OSO(2)CF(3))(3) reacts with 4 equiv of LiP(t)Bu(2) in tetrahydrofuran to give dark red ((t)Bu(2)P)(2)La[(&mgr;-P(t)Bu(2))(2)Li(thf)] (1). Yb(OSO(2)CF(3))(3) reacts with LiP(t)Bu(2) in tetrahydrofuran in a 1:5 ratio to produce Yb[(&mgr;-P(t)Bu(2))(2)Li(thf)](2) (2) and 1/2 an equiv of (t)Bu(2)P-P(t)Bu(2). Both 1 and 2 crystallize in the monoclinic space group P2(1)/c. Crystal data for 1 at 214 K: a = 11.562 (1) ?, b = 15.914 (1) ?, c = 25.373 (3) ?, beta = 92.40 (1) degrees; V = 4664.5 ?(3); Z = 4; D(calcd) = 1.137 g cm(-)(3); R(F)() = 2.61%. Crystal data for 2 at 217 K: a = 21.641 (2) ?, b = 12.189 (1) ?, c = 20.485 (2) ?, beta = 109.01 (1) degrees; V = 5108.9 ?(3); Z = 4; D(calcd) = 1.185 g cm(-)(3); R(F)() = 2.80%. The molecular structures of 1 and 2 show the four-coordinate lanthanide atoms in distorted tetrahedral environments. These complexes are the first representatives of the lanthanide elements surrounded by four only-phosphorus-containing substituents. The main features of the crystal structure of 1 are the shortest La-P distances (2.857(1) and 2.861(1) ?) reported so far and a three-coordinate lithium cation. The molecular structure of 2 represents a divalent bis "ate" complex with two three-coordinate lithium cations. Complex 2 shows photoluminescent properties. VT NMR spectra ((7)Li and (31)P) are reported for 1and 2. 相似文献
20.
From the system MF(2)/PF(5)/XeF(2)/anhydrous hydrogen fluoride (aHF), four compounds [Sr(XeF(2))(3)](PF(6))(2), [Pb(XeF(2))(3)](PF(6))(2), [Sr(3)(XeF(2))(10)](PF(6))(6), and [Pb(3)(XeF(2))(11)](PF(6))(6) were isolated and characterized by Raman spectroscopy and X-ray single-crystal diffraction. The [M(XeF(2))(3)](PF(6))(2) (M = Sr, Pb) compounds are isostructural with the previously reported [Sr(XeF(2))(3)](AsF(6))(2). The structure of [Sr(3)(XeF(2))(10)](PF(6))(6) (space group C2/c; a = 11.778(6) Angstrom, b = 12.497(6) Angstrom, c = 34.60(2) Angstrom, beta = 95.574(4) degrees, V = 5069(4) Angstrom(3), Z = 4) contains two crystallographically independent metal centers with a coordination number of 10 and rather unusual coordination spheres in the shape of tetracapped trigonal prisms. The bridging XeF(2) molecules and one bridging PF(6)- anion, which connect the metal centers, form complicated 3D structures. The structure of [Pb(3)(XeF(2))(11)](PF(6))(6) (space group C2/m; a = 13.01(3) Angstrom, b = 11.437(4) Angstrom, c = 18.487(7) Angstrom, beta = 104.374(9) degrees, V = 2665(6) Angstrom(3), Z = 2) consists of a 3D network of the general formula {[Pb(3)(XeF(2))(10)](PF(6))(6)}n and a noncoordinated XeF(2) molecule fixed in the crystal structure only by weak electrostatic interactions. This structure also contains two crystallographically independent Pb atoms. One of them possesses a unique homoleptic environment built up by eight F atoms from eight XeF(2) molecules in the shape of a cube, whereas the second Pb atom with a coordination number of 9 adopts the shape of a tricapped trigonal prism common for lead compounds. [Pb(3)(XeF(2))(11)](PF(6))(6) and [Sr(3)(XeF(2))(10)](PF(6))(6) are formed when an excess of XeF(2) is used during the process of the crystallization of [M(XeF(2))(3)](PF(6))(2) from their aHF solutions. 相似文献