Amine-templated linear vanadium sulfates with different chain structures

Amine-templated vanadium sulfates of the formula [HN(CH(2))(6)NH][(V(IV)O)(2)(OH)(2)(SO(4))(2)].H(2)O, I, [H(3)N(CH(2))(2)NH(3)][V(III)(OH)(SO(4))(2)].H(2)O, II, and [H(2)N(CH(2))(4)NH(2)][(V(IV)O)(H(2)O)(SO(4))(2)], III, have been prepared under hydrothermal conditions. These vanadium sulfates add to the new emerging family of organically templated metal sulfates. Compound I has a linear chain structure consisting of V(2)O(8) square-pyramid dimers connected by corner-sharing SO(4) tetrahedra, creating four-membered rings along the chain. Both II and III possess simple linear chain topologies formed by VO(6) octahedra and SO(4) tetrahedra, with II having the tancoite chain structure. Compound I crystallizes in the triclinic space group P1 (No. 2) with a = 7.4852(4) A, b = 9.5373(5) A, c = 11.9177(6) A, alpha = 77.22 degrees, beta = 76.47(2) degrees, gamma = 80.86 degrees, Z = 2. Compound II: monoclinic, space group P2(1)/c (No. 14), a = 6.942(2) A, b = 10.317(3) A, c = 15.102(6) A, beta = 90.64(4) degrees, Z = 4. Compound III: triclinic, space group P1 (No. 2) with a = 6.2558(10) A, b = 7.0663(14) A, c = 15.592(4) A, alpha = 90.46(2) degrees, beta = 90.47(2) degrees, gamma = 115.68(2) degrees, Z = 2. Magnetic susceptibility measurements reveal weak antiferromagnetic interactions in I and III and ferromagnetic interactions in II.     

Reactions of acetonitrile coordinated to a nitrosylruthenium complex with H2O or CH(3)OH under mild conditions: structural characterization of imido-type complexes

The reaction of cis-[Ru(NO)(CH(3)CN)(bpy)(2)](3+) (bpy = 2,2'-bipyridine) in H(2)O at room temperature proceeded to afford two new nitrosylruthenium complexes. These complexes have been identified as nitrosylruthenium complexes containing the N-bound methylcarboxyimidato ligand, cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](2+), and methylcarboxyimido acid ligand, cis-[Ru(NO)(NH=C(OH)CH(3))(bpy)(2)](3+), formed by an electrophilic reaction at the nitrile carbon of the acetonitrile coordinated to the ruthenium ion. The X-ray structure analysis on a single crystal obtained from CH(3)CN-H(2)O solution of cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](PF(6))(3) has been performed: C(22)H(20.5)N(6)O(2)P(2.5)F(15)Ru, orthorhombic, Pccn, a = 15.966(1) A, b = 31.839(1) A, c = 11.707(1) A, V = 5950.8(4) A(3), and Z = 8. The structural results revealed that the single crystal consisted of 1:1 mixture of cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](2+) and cis-[Ru(NO)(NH=C(OH)CH(3))(bpy)(2)](3+) and the structural formula of this single crystal was thus [Ru(NO)(NH=C(OH(0.5))CH(3))(bpy)(2)](PF(6))(2.5). The reaction of cis-[Ru(NO)(CH(3)CN)(bpy)(2)](3+) in dry CH(3)OH-CH(3)CN at room temperature afforded a nitrosylruthenium complex containing the methyl methylcarboxyimidate ligand, cis-[Ru(NO)(NH=C(OCH(3))CH(3))(bpy)(2)](3+). The structure has been determined by X-ray structure analysis: C(25)H(29)N(8)O(18)Cl(3)Ru, monoclinic, P2(1)/c, a = 13.129(1) A, b = 17.053(1) A, c = 15.711(1) A, beta = 90.876(5) degrees, V = 3517.3(4) A(3), and Z = 4.     

A novel open framework uranyl molybdate: synthesis and structure of (NH4)4[(UO2)5(MoO4)7](H2O)5

Single crystals of (NH(4))(4)[(UO(2))(5)(MoO(4))(7)](H(2)O)(5) have been synthesized hydrothermally using (NH(4))(6)Mo(7)O(24), (UO(2))(CH(3)COO)(2).2H(2)O, and H(2)O at 180 degrees C. The phase has been characterized by single-crystal X-ray diffraction using a merohedrally twinned single crystal: it is hexagonal, P6(1), a = 11.4067(5) A, c = 70.659(5) A, V = 7961.9(7) A(3), and Z = 6. The structure is based upon an open framework with composition [(UO(2))(5)(MoO(4))(7)](4-) that is composed of UO(7) pentagonal bipyramids that share vertexes with MoO(4) tetrahedra. The framework has large channels (effective pore size: 4.8 x 4.8 A(2)) parallel to the c axis and a system of smaller channels (effective pore size: 2.5 x 3.6 A(2)) parallel to [100], [110], [010], [110], [110], and [110]. The channels are occupied by NH(4)(+) cations and H(2)O molecules. The topological structure of the uranyl molybdate framework can be described either in terms of fundamental chains of UO(7) pentagonal bipyramids and MoO(4) tetrahedra or in terms of tubular building units parallel to the c axis.     

A novel organic-inorganic hybrid based on an 8-electron-reduced Keggin polymolybdate capped by tetrahedral, trigonal bipyramidal, and octahedral zinc: synthesis and crystal structure of (CH3NH3)(H2bipy)[Zn4(bipy)3(H2O)2MoV8MoVI4O36)(PO4)].4H2O

Hydrothermal reaction of H(3)PO(3), CH(3)NH(2), zinc(II) acetate, 4,4'-bipyridine (bipy), and (NH(4))(6)Mo(7)O(24).4H(2)O at 180 degrees C led to a novel organic-inorganic layered hybrid, [CH(3)NH(3)][H(2)bipy][Zn(4)(bipy)(3)(H(2)O)(2)Mo(V)(8)Mo(VI)O(36)(PO(4))].4H(2)O (1). Its structure was established by single-crystal X-ray diffraction. It crystallizes in the monoclinic space group P2(1)/c with cell parameters of a = 17.3032(2), b = 17.8113(3), and c = 23.4597 (4) A, beta = 106.410(1) degrees, V = 6935.6(2) A(3), and Z = 4. The structure of compound 1 features a novel 2D layer built from the 8e-reduced tetracapped Keggin [Zn(4)Mo(12)O(36)(PO(4))](3)(-) anions, which are further interconnected by bridging bipy ligands. The four zinc(II) ions are in tetrahedral, trigonal bipyramidal, and octahedral coordination geometries, respectively.     

A novel series of materials composed of arrays of vanadium oxide container molecules, [V18O42(X)] (X = H2O,Cl-, Br-): synthesis and characterization of [M2(H2N(CH2)2NH2)5][(M(H2N(CH2)2NH2)2]2V18O42(X)]. 9H2O (M = Zn,Cd)

The synthesis and characterization of the novel systems [Zn(2)(H(2)N(CH(2))(2)NH(2))(5)][(Zn(H(2)N(CH(2))(2)NH(2))(2))(2)V(18)O(42)(H(2)O)].9H(2)O (1), [Cd(2)(H(2)N(CH(2))(2)NH(2))(5)][(Cd(H(2)N(CH(2))(2)NH(2))(2))(2)V(18)O(42)(Br)].9H(2)O (2), and [Zn(2)(H(2)N(CH(2))(2)NH(2))(5)][(Zn(H(2)N(CH(2))(2)NH(2))(2))(2)V(18)O(42)(Cl)].9H(2)O (3) have been described. These materials represent a new class of solids that have been prepared by combining conventional coordination compounds with spherical polyoxovanadate clusters. The isomorphous structures of these hybrid solids consist of two-dimensional arrays of container cluster molecules [V(18)O(42)(X)] (X = H(2)O, Br-, Cl-) interlinked by the transition metal complex moieties [M(H(2)N(CH(2))(2)NH(2))(2)] (M = Zn, Cd). These compounds contain an unprecedented complex cation, [M(2)(H(2)N(CH(2))(2)NH(2))(5)](4+). Crystal data for 1: C(9)H(46)N(9)O(26)V(9)Zn(2), monoclinic space group P2(1)/m (No. 11), a = 12.3723(7) A, b = 20.9837(11) A, c = 15.8379(8) A, beta = 97.3320(10) degrees, Z = 4.     

Zinc diphosphonates templated by organic amines: syntheses and characterizations of [NH3(CH2)2NH3]Zn(hedpH2)2*2H2O and [NH3(CH2)nNH3(CH2)nNH3]Zn2(hedpH)2*2H2O (n=4,5,6) (hedp=1-hydroxyethylidenediphophonate)

Four new zinc diphosphonate compounds with formulas [NH(3)(CH(2))(2)NH(3)]Zn(hedpH(2))(2).2H(2)O, 1, [NH(3)(CH(2))(n)()NH(3)]Zn(2)(hedpH)(2).2H(2)O, (n = 4, 2; n = 5, 3; n = 6, 4) (hedp = 1-hydroxyethylidenediphosphonate) have been synthesized under hydrothermal conditions at 110 degrees C and in the presence of alkylenediamines NH(2)(CH(2))(n)()NH(2) (n = 2, 4, 5, 6). Crystallographic data for 1: monoclinic, space group C2/c, a = 24.7422(15), b = 5.2889(2), c = 16.0338(2) A, beta = 117.903(1) degrees, V = 1856.17(18) A(3), Z = 4; 2: monoclinic, space group P2(1)/n, a = 5.4970(3), b = 12.1041(6), c = 16.2814(12) A, beta = 98.619(5) degrees, V = 1071.07(11) A(3), Z = 2; 3: monoclinic, space group P2(1)/n, a = 5.5251(2), b = 12.5968(3), c = 16.1705(5) A, beta = 99.182(1) degrees, V = 1111.02(6) A(3), Z = 2; 4: triclinic, space group P-1, a = 5.4785(2), b = 14.1940(5), c = 16.0682(6) A, alpha = 81.982(2) degrees, beta = 89.435(2) degrees, gamma = 79.679(2) degrees, V = 1217.11(8) A(3), Z = 2. In compound 1, two of the phosphonate oxygens are protonated. The metal ions are bridged by the hedpH(2)(2-) groups through three of the remaining four phosphonate oxygens, forming a one-dimensional infinite chain. The protonated ethylenediamines locate between the chains in the lattice. In compounds 2-4, only one phosphonate oxygen is protonated. Compounds 2 and 3 have a similar three-dimensional open-network structure composed of [Zn(2)(hedpH)(2)](n) double chains with strong hydrogen bonding interactions between them, thus generating channels along the [100] direction. The protonated diamines and water molecules reside in the channels. Compound 4 contains two types of [Zn(2)(hedpH)(2)](n) double chains which are held together by strong hydrogen bonds, forming a two-dimensional network. The interlayer spaces are occupied by the [NH(3)(CH(2))(6)NH(3)](2+) cations and water molecules. The significant difference between structures 2-4 is also featured by the coordination geometries of the zinc atoms. The geometries of those in 2 can be described as distorted octahedral, and those in 3 as distorted square pyramidal. In 4, two independent zinc atoms are found, each with a distorted octahedral and a tetrahedral geometry, respectively.     

Imido Complexes Derived from the Reactions of Niobium and Tantalum Pentachlorides with Primary Amines: Relevance to the Chemical Vapor Deposition of Metal Nitride Films

Reactions of niobium and tantalum pentachlorides with tert-butylamine (>/=6 equiv) in benzene afford the dimeric imido complexes [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) (90%) and [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) (79%). The niobium complex exists as two isomers in solution, while the tantalum complex is composed of three major isomers and at least two minor isomers. Analogous treatments with isopropylamine (>/=7 equiv) give the monomeric complexes NbCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2) (84%) and TaCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2) (84%). The monomeric complexes are unaffected by treatment with excess isopropylamine, while the dimeric complexes are cleaved to the monomers MCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)(2) upon addition of excess tert-butylamine in chloroform solution. Treatment of niobium and tantalum pentachlorides with 2,6-diisopropylaniline affords insoluble precipitates of [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (100%) and [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[TaCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (100%), which react with 4-tert-butylpyridine to afford the soluble complexes [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (45%) and [4-t-C(4)H(9)C(5)H(4)NH](2)[TaCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] (44%). Sublimation of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), MCl(2)(N(i)Pr)(NH(i)Pr)(NH(2)(i)Pr)(2), and [NH(3)(2,6-(CH(CH(3))(2))(2)C(6)H(3))](2)[MCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] leads to decomposition to give [MCl(3)(NR)(NH(2)R)](2) as sublimates (32-49%), leaving complexes of the proposed formulation MCl(NR)(2) as nonvolatile residues. By contrast, [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) sublimes without chemical reaction. Analysis of the organic products obtained from thermal decomposition of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2) showed isobutylene and tert-butylamine in a 2.2:1 ratio. Mass spectra of [NbCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), [TaCl(2)(N(t)Bu)(NH(t)Bu)(NH(2)(t)Bu)](2), and [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2) showed the presence of dimeric imido complexes, monomeric imido complexes, and nitrido complexes, implying that such species are important gas phase species in CVD processes utilizing these molecular precursors. The crystal structures of [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))], [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2), [NbCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2), and [TaCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) were determined. [4-t-C(4)H(9)C(5)H(4)NH](2)[NbCl(5)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))] crystallizes in the space group P2(1)/c with a = 12.448(3) ?, b = 10.363(3) ?, c = 28.228(3) ?, beta = 94.92(1) degrees, V = 3628(5) ?(3), and Z = 4. [NbCl(3)(N(i)Pr)(NH(2)(i)Pr)](2) crystallizes in the space group P2(1)/c with a = 9.586(4) ?, b = 12.385(4) ?, c = 11.695(4) ?, beta = 112.89(2) degrees, V = 1279.0(6) ?(3), and Z = 2. [NbCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) crystallizes in the space group P2(1)/n with a = 10.285(3) ?, b = 11.208(3) ?, c = 23.867(6) ?, beta = 97.53 degrees, V = 2727(1) ?(3), and Z = 2. [TaCl(3)(N(2,6-(CH(CH(3))(2))(2)C(6)H(3)))(NH(2)(2,6-(CH(CH(3))(2))(2)C(6)H(3)))](2) crystallizes in the space group P2(1)/n with a = 10.273(1) ?, b = 11.241(2) ?, c = 23.929(7) ?, beta = 97.69(2) degrees, V = 2695(2) ?(3), and Z = 2. These findings are discussed in the context of niobium and tantalum nitride film depositions from molecular precursors.     

Synthesis and characterization of uranyl compounds with iminodiacetate and oxydiacetate displaying variable denticity

Eight uranyl compounds containing the dicarboxylate ligands iminodiacetate (IDA) or oxydiacetate (ODA) have been characterized in the solid state. The published polymeric structures for [UO(2)(C(4)H(6)NO(4))(2)] and [UO(2)(C(4)H(4)O(5))](n) have been confirmed, while Ba[UO(2)(C(4)H(5)NO(4))(2)] x 3H(2)O, [(CH(3))(2)NH(CH(2))(2)NH(CH(3))(2)][UO(2)(C(4)H(4)O(5))(2)] [orthorhombic space group Pnma, a = 10.996(5) A, b = 21.42(1) A, c = 8.700(3) A, Z = 4], and [C(2)H(5)NH(2)(CH(2))(2)NH(2)C(2)H(5)][UO(2)(C(4)H(4)O(5))(2)] [monoclinic space group P2(1)/n, a = 6.857(3) A, b = 9.209(5) A, c = 16.410(7) A, beta = 91.69(3), Z = 2] contain monomeric anions. The distance from the uranium atom to the central heteroatom (O or N) in the ligand varies. Crystallographic study shows that U-heteroatom (O/N) distances fall into two groups, one 2.6-2.7 A in length and one 3.1-3.2 A, the latter implying no bonding interaction. By contrast, EXAFS analysis of bulk samples suggests that either a long U-heteroatom (O/N) distance (2.9 A) or a range of distances may be present. Three possible structural types, two symmetric and one asymmetric, are identified on the basis of these results and on solid-state (13)C NMR spectroscopy. The two ligands in the complex can be 1,4,7-tridentate, giving five-membered rings, or 1,7-bidentate, to form an eight-membered ring. (C(4)H(12)N(2))[(UO(2))(2)(C(4)H(5)NO(4))(2)(OH)(2)] x 8H(2)O [monoclinic space group P2(1)/a, a = 7.955(9) A, b = 24.050(8) A, c = 8.223(6) A, beta = 112.24(6), Z = 2], (C(2)H(10)N(2))[(UO(2))(2)(C(4)H(5)NO(4))(2)(OH)(2)] x 4H(2)O, and (C(6)H(13)N(4))(2)[(UO(2))(2)(C(4)H(4)O(5))(2)(OH)(2)] x 2H(2)O [monoclinic space group C2/m, a = 19.024(9) A, b = 7.462(4) A, c = 2.467(6) A, beta = 107.75(4), Z = 4] have a dimeric structure with two capping tridentate ligands and two mu(2)-hydroxo bridges, giving edge-sharing pentagonal bipyramids.     

Salen-type compounds of calcium and strontium

Salen complexes of the heavy alkaline-earth metals, calcium and strontium, were prepared by the reaction of various salen(t-Bu)H(2) ligands with the metals in ethanol. Six new calcium and strontium compounds, [Ca(salen(t-Bu))(HOEt)(2)(thf)] (1), [Ca(salen(t-Bu))(HOEt)(2)] (2), [Ca(salpen(t-Bu))(HOEt)(3)] (3), [Ca(salophen(t-Bu))(HOEt)(thf)] (4), [Sr(salen(t-Bu))(HOEt)(3)] (5), and [Sr(salophen(t-Bu))(HOEt)(thf)(2)] (6), were formed in this way with the quatridentate Schiff-base ligands N,N'-bis(3,5-di-tert-butylsalicylidene)ethylenediamine (salen(t-Bu)H(2)), N,N'-bis(3,5-di-tert-butylsalicylidene)-1,3-propanediamine (salpen(t-Bu)H(2)), and N,N'-o-phenylenebis(3,5-di-tert-butylsalicylideneimine (salophen(t-Bu)H(2)). Initially, ammonia solutions of the metals were combined with the salen(t-Bu)H(2) ligands, and in the reaction of strontium with salen(t-Bu)H(2), the unusual tetrametallic cluster [(OC(6)H(2)(t-Bu)(2)CHN(CH(2))(2)NH(2))Sr(mu(3)-salean(t-Bu)H(2))Sr(mu(3)-OH)](2) (7) was produced (salean(t-Bu)H(4) = N,N'-bis(3,5-di-tert-butyl-2-hydroxybenzyl)ethylenediamine). In this compound, the imine bonds of the salen(t-Bu)H(2) ligand were reduced to form the known ligands salean(t-Bu)H(4) and (HO)C(6)H(2)(t-Bu)(2)CHN(CH(2))(2)NH(2). Compounds 1, 5, 6, and 7 were structurally characterized by single-crystal X-ray diffraction. Crystal data for 1 (C(44)H(74)CaN(2)O(6)): triclinic space group P(-)1, a = 8.3730(10) A, b = 14.8010(10) A, c = 18.756(2) A, alpha = 72.551(10) degrees, beta = 81.795(10) degrees, gamma = 78.031(10) degrees, Z = 2. Crystal data for 5 (C(38)H(64)SrN(2)O(5)): monoclinic space group P2(1)/c, a = 23.634(3) A, b = 8.4660(10) A, c = 24.451(3) A, beta = 101.138(10) degrees, Z = 4. Crystal data for 6 (C(46)H(67)N(2)O(5)Sr): orthorhombic space group P2(1)2(1)2(1), a = 10.5590(2) A, b = 16.2070(3) A, c = 26.7620(6) A, Z = 4. Crystal data for 7 (C(98)H(156)N(8)O(8)Sr(4)): triclinic space group P(-)1, a = 14.667(1) A, b = 15.670(1) A, c = 18.594(2) A, alpha = 92.26(1) degrees, beta = 111.84(1) degrees, gamma = 117.12(1) degrees, Z = 4.     

Controlled structural variations in templated uranium sulfates

A series of experiments in the UO(2)(CH(3)CO(2))(2).2H(2)O/H(2)SO(4)/1-(2-aminoethyl)piperazine/H(2)O system were conducted to determine the effects of variation in initial reactant concentrations on the reaction products. Several reaction gels were produced, in which the composition varied from 16:80:4:500 UO(2)(CH(3)CO(2))(2).2H(2)O/H(2)SO(4)/1-(2-aminoethyl)piperazine/H(2)O to 4:92:4:500 UO(2)(CH(3)CO(2))(2).2H(2)O/H(2)SO(4)/1-(2-aminoethyl)piperazine/H(2)O. Single crystals of two new organically templated uranium sulfates, [N(3)C(6)H(18)](2)[(UO(2))(5)(H(2)O)(SO(4))(8)].5H(2)O and [N(3)C(6)H(18)][(UO(2))(2)(H(2)O)(SO(4))(3)(HSO(4))].4.5H(2)O, were isolated. Both compounds exhibit structures in which the inorganic frameworks are two-dimensional and the protonated amines reside between layers, participating in extensive hydrogen bonding. The composition and structure of each compound is dependent on the nature of the starting concentrations. Crystal data: for [N(3)C(6)H(18)](2)[(UO(2))(5)(H(2)O)(SO(4))(8)].5H(2)O, monoclinic, space group P2(1)/n (No. 14), a = 21.5597(3) A, b = 10.2901(2) A, c = 22.8403(3) A, beta = 96.7436(7) degrees, and Z = 4; for [N(3)C(6)H(18)][(UO(2))(2)(H(2)O)(SO(4))(3)(HSO(4))].4.5H(2)O, monoclinic, space group P2(1)/a (No. 14), a = 15.7673(4) A, b = 10.5813(3) A, c = 16.7710(5) A, beta = 99.9216(9) degrees, and Z = 4.     

Kinetics of acid-catalyzed O-atom transfer from a hydroperoxorhodium complex to organic and inorganic substrates

Oxygen atom transfer from (NH(3))(4)(H(2)O)RhOOH(2+) to organic and inorganic nucleophiles takes place according to the rate law -d[(NH(3))(4)(H(2)O)RhOOH(2+)]/dt = k[H(+)] [(NH(3))(4)(H(2)O)RhOOH(2+)][nucleophile] for all the cases examined. The third-order rate constants were determined in aqueous solutions at 25 degrees C for (CH(2))(5)S (k = 430 M(-)(2) s(-)(1), micro = 0.10 M), (CH(2))(4)S(2) (182, micro = 0.10 M), CH(3)CH(2)SH (8.0, micro = 0.20 M), (en)(2)Co(SCH(2)CH(2)NH(2))(2+) (711, micro = 0.20 M), and, in acetonitrile-water, CH(3)SPh (130, 10% AN, micro = 0.20 M), PPh(3) (3.74 x 10(3), 50% AN), and (2-C(3)H(7))(2)S (45, 50% AN, micro = 0.20 M). Oxidation of PPh(3) by (NH(3))(4)(H(2)O)Rh(18)O(18)OH(2+) produced (18)OPPh(3). The reaction with a series of p-substituted triphenylphosphines yielded a linear Hammett relationship with rho = -0.53. Nitrous acid (k = 891 M(-)(2) s(-)(1)) is less reactive than the more nucleophilic nitrite ion (k = 1.54 x 10(4) M(-)(2) s(-)(1)).     

(CH3)2NH(CH2)2NH(CH3)2][(UO2)2F2(HPO4)2]: a new organically templated layered uranium phosphate fluoride--synthesis, structure, characterization, and ion-exchange reactions

A new organically templated layered uranium phosphate fluoride, [(CH(3))(2)NH(CH(2))(2)NH(CH(3))(2)][(UO(2))(2)F(2)(HPO(4))(2)] has been synthesized by hydrothermal reaction of UO(3), H(3)PO(4), HF, and (CH(3))(2)NCH(2)CH(2)N(CH(3))(2) at 140 degrees C. [(CH(3))(2)NH(CH(2))(2)NH(CH(3))(2)][(UO(2))(2)F(2)(HPO(4))(2)] has a layered crystal structure consisting of seven-coordinated UO(5)F(2) pentagonal bipyramids and four-coordinated HPO(4) tetrahedra. Each anionic layer containing three-, four-, and six-membered rings is separated by [(CH(3))(2)NH(CH(2))(2)NH(CH(3))(2)](2+) cations. The [(CH(3))(2)NH(CH(2))(2)NH(CH(3))(2)](2+) cations may be readily exchanged with the M(2+) ions (M = Ba, Sr and Ca) in water to give high crystalline AE(UO(2))(2)(PO(4))(2).6H(2)O (AE = Ca, Sr, Ba).     

Hydrothermal synthesis,structures, and magnetic properties of three novel 5-aminoisophthalic acid ligand bridged transition metal cation polymers

Three novel 5-aminoisophthalic acid (AIP) bridged polymers [Co(C(8)NH(5)O(4))(H(2)O)](n)() (1), [Ni(C(8)NH(5)O(4))(H(2)O)(2)](n)() (2), and [Zn(C(8)NH(5)O(4))(H(2)O)](n)() (3) were synthesized by hydrothermal reactions and characterized by IR, Raman, elemental analysis, ESR, and magnetic measurements. X-ray single-crystal analyses were carried out for [Co(C(8)NH(5)O(4))(H(2)O)](n)() (1), which crystallizes in the triclinic system, space group P1 macro, with a = 6.477(1) A, b = 7.130(1) A, c = 9.826(2) A, alpha = 108.9(1) degrees, beta = 93.97(3) degrees, gamma = 98.82(3) degrees, and Z = 2; for [Ni(C(8)NH(5)O(4))(H(2)O)(2)](n)() (2), in the triclinic system, space group P1 macro, a = 6.425(1) A, b = 8.115(2) A, c = 10.146(2) A, alpha = 113.09(3)(o), beta = 99.64(3)(o), gamma = 98.90(3)(o), and Z = 2; and for [Zn(C(8)NH(5)O(4))(H(2)O)](n)() (3), in the monoclinic system, space group P2(1)/n, a = 9.044(1) A, b = 8.264(1) A, c = 11.646(1) A, beta = 100.77(1) degrees, and Z = 4. The single X-ray diffraction studies reveal that 1 consists of an infinite honeycomb layer formed by four crystallographically independent motifs packed alternatively together; 2 consists of an infinite neutral railroad-like linear polymer, and 3 consists of infinite layers of alternating four-coordinated Zn(II) cations and AIP ligands. Finally, they are all packed into beautiful three-dimensional frameworks through complicated hydrogen bonding. Antiferromagnetic and ferromagnetic behaviors were observed for 1 and 2 from the magnetic measurements.     

Synthetic Strategies To Obtain V-P-O Open Frameworks Containing Organic Species as Structural Directing Agents. Crystal Structure of the V(IV)-Fe(III) Bimetallic Phosphate [H(3)N(CH(2))(2)NH(3)](2)[H(3)N(CH(2))(2)NH(2)][Fe(III)(H(2)O)(2)(V(IV)O)(8)(OH)(4)(HPO(4))(4)(PO(4))(4)].4H(2)O

A general synthetic approach to rationalize the solution preparative chemistry of oxovanadium phosphates containing organic species as structural directing agents is presented. Careful attention is payed to the hydrolysis and condensation processes involving the ionic species in solution, and a simple restatement of the partial charge model (PCM) has been used in order to organize the experimental results. The structure of a new V(IV)-Fe(III) bimetallic oxovanadium phosphate, [H(3)N(CH(2))(2)NH(3)](2)[H(3)N(CH(2))(2)NH(2)] [Fe(III)(H(2)O)(2)(V(IV)O)(8)(OH)(4)(HPO(4))(4)(PO(4))(4)].4H(2)O, has been determined by X-ray single crystal diffraction methods. This compound crystallizes in the monoclinic system, space group P2(1)/n and the cell dimensions are as follows: a = 14.383(3) ?, b = 10.150(2) ?, c = 18.355(4) ?, and beta = 90.39(3) degrees (Z = 2). The existence of a complex intercrossing channel system, including a very large channel of 18.4 ? of diameter (in which both water molecules and ethylenediamine species are located), is the more interesting feature of this structure. Thermal decomposition, including the dehydration/rehydration process, has been studied by thermal analysis and variable temperature X-ray powder diffraction techniques. A complementary SEM study of the different intermediate decomposition products is presented.     

Generation and reactivity of rhodium(IV) complexes in aqueous solutions

At pH = 1 and 25 degrees C, the Fenton-like reactions of Fe(aq)(2+) with hydroperoxorhodium complexes LRh(III)OOH(2+) (L = (H(2)O)(NH(3))(4), k = 30 M(-1) s(-1), and L = L(2) = (H(2)O)(meso-Me(6)-[14]aneN(4)), k = 31 M(-1) s(-1)) generate short-lived, reactive intermediates, believed to be the rhodium(IV) species LRh(IV)O(2+). In the rapid follow-up steps, these transients oxidize Fe(aq)(2+), and the overall reaction has the standard 2:1 [Fe(aq)(2+)]/[LRhOOH(2+)] stoichiometry. Added substrates, such as alcohols, aldehydes, and (NH(3))(4)(H(2)O)RhH(2+), compete with Fe(aq)(2+) for LRh(IV)O(2+), causing the stoichiometry to change to <2:1. Such competition data were used to determine relative reactivities of (NH(3))(4)RhO(2+) toward CH(3)OH (1), CD(3)OH (0.2), C(2)H(5)OH (2.7), 2-C(3)H(7)OH (3.4), 2-C(3)D(7)OH (1.0), CH(2)O (12.5), C(2)H(5)CHO (45), and (NH(3))(4)RhH(2+) (125). The kinetics and products suggest hydrogen atom abstraction for (NH(3))(4)RhO(2+)/alcohol reactions. A short chain reaction observed with C(2)H(5)CHO is consistent with both hydrogen atom and hydride transfer. The rate constant for the reaction between Tl(aq)(III) and L(2)Rh(2+) is 2.25 x 10(5) M(-1) s(-1).     

Two versatile N,N'-bipyridine-type ligands for preparing organic-inorganic coordination polymers: new cobalt- and nickel-containing framework materials

The Schiff base ligands 1,4-bis(4-pyridyl)-2,3-diaza-1,3-butadiene (L1, monoclinic, P2(1)/c, a = 3.856(1) A, b = 11.032(2) A, c = 12.738(3) A, beta = 92.21(3) degrees, Z = 2) and 2,5-bis(4-pyridyl)-3,4-diaza-2,4-hexadiene (L2, monoclinic, P2(1)/c, a = 10.885(2) A, b = 4.613(1) A, c = 14.978(3) A, beta = 92.827(4) degrees, Z = 2) were used in the synthesis of four new organic-inorganic coordination polymers, each of them adopting a different structural motif. Synthesis, X-ray structural determinations, and spectroscopic and thermogravimetric analyses are presented. The reaction between Co(NO(3))(2).6H(2)O and L1 afforded a two-dimensional noninterpenetrating brick-wall structure, [Co(C(12)N(4)H(10))(1.5)(NO(3))(2)(H(2)O)(CH(2)Cl(2))(2)](n)() (1, triclinic, P1; a = 10.242(7) A, b = 10.802(7) A, c = 15.100(1) A, alpha = 70.031(1), beta = 75.168(11), gamma = 76.155(11), Z = 2), while Ni(NO(3))(2).6H(2)O combined with L1 yielded an interpenetrating three-dimensional rhombus-grid polymer, [Ni(C(12)N(4)H(10))(2)(NO(3))(2)(OC(4)H(8))(1.66)(H(2)O)(0.33)](n) (2, monoclinic, C2/c; a = 20.815(8) A, b = 23.427(8) A, c = 17.291(6) A, beta = 116.148(6), Z = 8). The reaction of Co(NO(3))(2).6H(2)O and L2 was found to be solvent-sensitive and resulted in the formation of two different noninterpenetrating compounds: [Co(C(14)N(4)H(14))(2)(NO(3))(2)(C(6)H(6))(1.5)](n)() (3, monoclinic, C2/c; a = 22.760(2) A, b = 21.010(3) A, c = 25.521(2) A, beta = 97.151(2), Z = 8), which adopts a two-dimensional square-grid motif formed by propeller-type modules, and [Co(C(14)N(4)H(14))(1.5)(NO(3))(2)(CH(2)Cl(2))(2)](n)() (4, monoclinic, P2(1)/n; a = 14.432(2) A, b = 14.543(8) A, c = 15.448(4) A, beta = 96.968(0), Z = 4), consisting of T-shaped building blocks assembled into a one-dimensional ladder-type structure. These four coordination polymers all exhibit impressive thermal stability. Thermogravimetric studies showed that after complete removal of the solvents, the frameworks are stable to temperatures between 234 degrees C and 260 degrees C.     

Heteropolymolybdates of phosphate,phosphonate, and phosphite functionalized by glycine

The novel, functionalized heteropolymolybdates [RPMo(6)O(21)(O(2)CCH(2)NH(3))(3)](2)(-) (R = OH, CH(3), C(2)H(5), H) have been synthesized and characterized by IR, (31)P NMR spectroscopy, and elemental analysis. Single-crystal X-ray analysis was carried out on K(2)[HOPMo(6)O(21)(O(2)CCH(2)NH(3))(3)].8.5H(2)O, which crystallizes in the orthorhombic system, space group Pnma, with a = 14.118(2) A, b = 20.660(3) A, c = 12.191(2) A, and Z = 4; K(2)[H(3)CPMo(6)O(21)(O(2)CCH(2)NH(3))(3)].8.5H(2)O, which crystallizes in the orthorhombic system, space group Pnma, with a = 14.1643(6) A, b = 20.8658(8) A, c = 12.2235(5) A, and Z = 4; and K(2)[HPMo(6)O(21)(O(2)CCH(2)NH(3))(3)].8H(2)O, which crystallizes in the orthorhombic system, space group Pnma, with a = 14.092(3) A, b = 20.696(2) A, c = 12.199(4) A, and Z = 4. We also report on the synthesis and characterization of the isostructural derivative K(2)[H(5)C(2)PMo(6)O(21)(O(2)CCH(2)NH(3))(3)]. The four title polyanions consist of an RP (R = OH, CH(3), C(2)H(5), H) hetero group surrounded by a ring of six MoO(6) octahedra sharing edges and corners alternatingly. Three glycine molecules are each bound to two edge-sharing Mo centers via their carboxylate functionality on the same side of the ring. The central phosphorus atom is located slightly above the plane of the six molybdenums, and its terminal R group is on the same side of the ring as the glycines. NMR studies show that the solid state structures of the title compounds are preserved in solution.     

Exploration of composition space in templated uranium sulfates

The phase stability of organically templated uranium sulfates in the [UO(2)(CH(3)CO(2))(2).2H(2)O/homopiperazine/H(2)SO(4)] and [UO(2)(CH(3)CO(2))(2).2H(2)O/N,N-dimethylethylenediamine/H(2)SO(4)] systems has been studied using composition space. Two new compounds were formed in each system; [N(2)C(5)H(14)](2)[UO(2)(SO(4))(3)] (USO-17) and [N(2)C(5)H(14)][UO(2)(H(2)O)(SO(4))(2)] (USO-18) contain homopiperazine, and [N(2)C(4)H(14)][UO(2)(SO(4))(2)] (USO-19) and [N(2)C(4)H(14)][(UO(2))(2)(H(2)O)(SO(4))(3)].H(2)O (USO-20) contain N,N-dimethylethylenediamine. The relative stability of the products from each system is dependent upon the reactant mole fractions in the initial reaction gel. Crystal data: USO-17, a = 14.4975(3) A, b = 11.9109(3) A, c = 13.0157(3) A, beta = 110.475(1) degrees, monoclinic, C2/c (No. 15), Z = 4; for USO-18, a = 7.6955(2) A, b = 11.7717(3) A, c = 14.7038(4) A, orthorhombic, P22(1)2(1) (No. 18), Z = 4; for USO-19, a = 9.3322(1) A, b = 9.7743(2) A, c = 13.8897(3) A, orthorhombic, P2(1)2(1)2(1) (No. 19), Z = 4; and for USO-20, a = 11.2460(2) A, b = 10.5387(2) A, c = 17.0432(3) A, beta = 92.9884(6) degrees, monoclinic, P2(1)/c (No. 14), Z = 4.     

Synthesis and characterization of four metal-organophosphonates with one-, two-, and three-dimensional structures

A series of metal-organic hybrid compounds were synthesized using two new phosphonic acids, pyridyl-4-phosphonic acid and p-xylylenediphosphonic acid (H(2)O(3)PCH(2)C(6)H(4)CH(2)PO(3)H(2)). The phosphonic acid ligands have been synthesized from their corresponding bromides following two different types of reactions. The reaction of pyridyl-4-phosphonic acid with three different divalent metal salts results in the formation of molecular structures of different dimensionality. The reaction of Cu(II) with the phosphonic acid under hydrothermal conditions yields a three-dimensional (3D) open framework structure having the molecular formula [Cu(4)(NC(5)H(4)-PO(3))(4)(H(2)O)(10)] (1). The reactions with Mn(II) and Zn(II) salts with the same phosphonic acid resulted in a two-dimensional layered and a dinuclear compound with molecular formulas [Mn(3)(NC(5)H(4)-PO(3))(4)(H(2)O)(6)(ClO(4))(2)] (2) and [Zn(2)(NHC(5)H(4)-PO(3)H)(2)Cl(4)] (3), respectively. Compound 1 crystallizes in the triclinic crystal system having space group P with structural parameters a = 7.4564(15) Angstrom, b = 9.1845(19) Angstrom, c = 11.582(2) Angstrom, alpha = 100.842(3) degrees, beta = 104.303(3) degrees, gamma = 94.774(3) degrees, and Z = 1. Compound 2 crystallizes in the triclinic crystal system, space group P, with structural parameters a = 7.6871(14) Angstrom, b = 10.576(2) Angstrom, c = 14.470(3)Angstrom, alpha = 81.340(3) degrees, beta = 81.561(3) degrees, gamma = 68.757(3) degrees, and Z = 2, whereas compound 3 crystallizes in a monoclinic crystal system with space group P2(1)/n. The structural parameters are as follows: a = 8.4969 (5) Angstrom, b = 9.3911 (5) Angstrom, c = 12.3779 (6) Angstrom, beta = 90.860(17) degrees, and Z = 4. The pyridylphosphonate ligand shows different ligation behavior toward the three divalent metal ions. On the other hand, p-xylylenediphosphonic acid on reaction with Co(II) formed a 3D compound [Co(2)(O(3)PCH(2)C(6)H(4)CH(2)PO(3))(2)(H(2)O)(2)] (4) with a layered and pillared structure. Compound 4 crystallizes in an orthorhombic crystal system with space group Pnma. The structural parameters are a = 21.744(4) Angstrom, b = 5.6744(10) Angstrom, c = 4.7927(9) Angstrom, and Z = 4.     

Coordination polymers assembled from angular dipyridyl ligands and CuII, CdII, CoII salts: crystal structures and properties

Six new metal-organic coordination networks based on linking unit 2,5-bis(4-pyridyl)-1,3,4-thiadiazole (L(1)) or 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L(3)) and inorganic Cu(II), Cd(II), and Co(II) salts have been prepared and structurally characterized by single-crystal X-ray analysis. Using L(1) to react with three different Cu(II) salts, Cu(OAc)(2).H(2)O, Cu(NO(3))(2).3H(2)O, and CuSO(4).5H(2)O, respectively, two different one-dimensional (1-D) coordination polymers, [[Cu(2)L(1)(mu-OAc)(4)](CHCl(3))(2)](n) (1) [triclinic, space group P1, a = 7.416(3) A, b = 8.207(3) A, c = 14.137(5) A, alpha = 100.333(7) degrees, beta = 105.013(6) degrees, gamma = 94.547(6) degrees, Z = 1] and [[CuL(1)(NO(3))(2)](CHCl(3))(0.5)](n) (2) [monoclinic, space group C2/c, a = 28.070(8) A, b = 9.289(3) A, c = 15.235(4) A, beta = 113.537(5) degrees, Z = 8], and a chiral 3-D open framework, [[CuL(1)(H(2)O)(SO(4))](H(2)O)(2)](n) (3) [orthorhombic, space group P2(1)2(1)2(1), a = 5.509(2) A, b = 10.545(4) A, c = 29.399(11) A, Z = 4], were obtained. Reaction of L(1) and Cd(ClO(4))(2).6H(2)O or Co(ClO(4))(2).6H(2)O, in the presence of NH(4)SCN, yielded another 3-D open framework, [[CdL(1)(NCS)(2)](CH(3)OH)(1.5)](n) (4) [monoclinic, space group C2/c, a = 28.408(10) A, b = 9.997(5) A, c = 7.358(4) A, beta = 99.013(8) degrees, Z = 4], or a 2-D network, [[Co(L(1)())(2)(NCS)(2)](H(2)O)(2.5)](n) (5) [orthorhombic, space group Pnna, a = 22.210(5) A, b = 12.899(3) A, c = 20.232(4) A, Z = 4]. When L(1) was replaced by L(3) to react with Co(ClO(4))(2).6H(2)O and NH(4)SCN, another 2-D coordination polymer, [Co(L(3))(2)(NCS)(2)](n) (6) [monoclinic, space group P2(1)/c, a = 8.120(3) A, b = 9.829(4) A, c = 17.453(6) A, beta = 103.307(6) degrees, Z = 2], was constructed. These results indicate that the nature of the ligands, metal centers, or counteranions plays the critical role in construction of these novel coordination polymers. The interesting porous natures of two 3-D open frameworks 3 and 4 were investigated by TGA and XPRD techniques, and the magnetic properties of the Cu(II) and Co(II) complexes were studied by variable-temperature magnetic susceptibility and magnetization measurements.