首页 | 本学科首页   官方微博 | 高级检索  
相似文献
 共查询到20条相似文献,搜索用时 265 毫秒
1.
Two new noncentrosymmetric (NCS) polar oxides, BaMgTe(2)O(7) and BaZnTe(2)O(7), have been synthesized and characterized, with their crystal structures determined by single crystal X-ray diffraction. The iso-structural materials exhibit structures consisting of layers of corner-shared MgO(5) or ZnO(5), Te(6+)O(6), and Te(4+)O(4) polyhedra that are separated by Ba(2+) cations. The Te(4+) cation is found in a highly asymmetric and polar coordination environment attributable to its stereoactive lone-pair. The alignment of the individual TeO(4) polar polyhedra results in macroscopic polarity for BaMgTe(2)O(7) and BaZnTe(2)O(7). Powder second-harmonic generation (SHG) measurements revealed a moderate SHG efficiency of approximately 5 × KDP (or 200 × α-SiO(2)) for both materials. Piezoelectric charge constants of 70 and 57 pm/V, and pyroelectric coefficients of -18 and -10 μC·m(-2)·K(-1) were obtained for BaMgTe(2)O(7) and BaZnTe(2)O(7), respectively. Although the materials are polar, frequency dependent polarization measurements indicated that the materials are not ferroelectric, that is, the observed macroscopic polarization cannot be reversed. Infrared, UV-vis diffuse spectroscopy, and thermal properties were also measured. Crystal data: BaMgTe(2)O(7), orthorhombic, space group Ama2 (No. 40), a = 5.558(2) ?, b = 15.215(6) ?, c = 7.307(3) ?, V = 617.9(4) ?(3), and Z = 4; BaZnTe(2)O(7), orthorhombic, space group Ama2 (No. 40), a = 5.5498(4) ?, b = 15.3161(11) ?, c = 7.3098(5) ?, V = 621.34(8) ?(3), and Z = 4.  相似文献   

2.
Two new noncentrosymmetric (NCS) polar oxide materials, Zn(2)(MoO(4))(AO(3)) (A = Se(4+) or Te(4+)), have been synthesized by hydrothermal and solid-state techniques. Their crystal structures have been determined, and characterization of their functional properties (second-harmonic generation, piezoelectricity, and polarization) has been performed. The isostructural materials exhibit a three-dimensional network consisting of ZnO(4), ZnO(6), MoO(4), and AO(3) polyhedra that share edges and corners. Powder second-harmonic generation (SHG) measurements using 1064 nm radiation indicate the materials exhibit moderate SHG efficiencies of 100 × and 80 × α-SiO(2) for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively. Particle size vs SHG efficiency measurements indicate the materials are type 1 non-phase-matchable. Converse piezoelectric measurements resulted in d(33) values of ~14 and ~30 pm/V for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively, whereas pyroelectric measurements revealed coefficients of -0.31 and -0.64 μC/m(2) K at 55 °C for Zn(2)(MoO(4))(SeO(3)) and Zn(2)(MoO(4))(TeO(3)), respectively. Frequency-dependent polarization measurements confirmed that all of the materials are nonferroelectric; that is, the macroscopic polarization is not reversible, or "switchable". Infrared, UV-vis, thermogravimetric, and differential thermal analysis measurements were also performed. First-principles density functional theory (DFT) electronic structure calculations were also done. Crystal data: Zn(2)(MoO(4))(SeO(3)), monoclinic, space group P2(1) (No. 4), a = 5.1809(4) ?, b = 8.3238(7) ?, c = 7.1541(6) ?, β = 99.413(1)°, V = 305.2(1) ?(3), Z = 2; Zn(2)(MoO(4))(TeO(3)), monoclinic, space group P2(1) (No. 4), a = 5.178(4) ?, b = 8.409(6) ?, c = 7.241(5) ?, β = 99.351(8)°, V = 311.1(4) ?(3), Z = 2.  相似文献   

3.
Five new vanadium selenites, Ca(2)(VO(2))(2)(SeO(3))(3)(H(2)O)(2), Sr(2)(VO(2))(2)(SeO(3))(3), Ba(V(2)O(5))(SeO(3)), Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), have been synthesized and characterized. Their crystal structures were determined by single crystal X-ray diffraction. The compounds exhibit one- or two-dimensional structures consisting of corner- and edge-shared VO(4), VO(5), VO(6), and SeO(3) polyhedra. Of the reported materials, A(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) (A = Sr(2+) or Pb(2+)) are noncentrosymmetric (NCS) and polar. Powder second-harmonic generation (SHG) measurements revealed SHG efficiencies of approximately 130 and 150 × α-SiO(2) for Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), respectively. Piezoelectric charge constants of 43 and 53 pm/V, and pyroelectric coefficients of -27 and -42 μC/m(2)·K at 70 °C were obtained for Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)) and Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), respectively. Frequency dependent polarization measurements confirmed that the materials are not ferroelectric, that is, the observed polarization cannot be reversed. In addition, the lone-pair on the Se(4+) cation may be considered as stereo-active consistent with calculations. For all of the reported materials, infrared, UV-vis, thermogravimetric, and differential thermal analysis measurements were performed. Crystal data: Ca(2)(VO(2))(2)(SeO(3))(3)(H(2)O)(2), orthorhombic, space group Pnma (No. 62), a = 7.827(4) ?, b = 16.764(5) ?, c = 9.679(5) ?, V = 1270.1(9) ?(3), and Z = 4; Sr(2)(VO(2))(2)(SeO(3))(3), monoclinic, space group P2(1)/c (No. 12), a = 14.739(13) ?, b = 9.788(8) ?, c = 8.440(7) ?, β = 96.881(11)°, V = 1208.8(18) ?(3), and Z = 4; Ba(V(2)O(5))(SeO(3)), orthorhombic, space group Pnma (No. 62), a = 13.9287(7) ?, b = 5.3787(3) ?, c = 8.9853(5) ?, V = 673.16(6) ?(3), and Z = 4; Sr(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), orthorhombic, space group Fdd2 (No. 43), a = 25.161(3) ?, b = 12.1579(15) ?, c = 12.8592(16) ?, V = 3933.7(8) ?(3), and Z = 8; Pb(4)(VO(2))(2)(SeO(3))(4)(Se(2)O(5)), orthorhombic, space group Fdd2 (No. 43), a = 25.029(2) ?, b = 12.2147(10) ?, c = 13.0154(10) ?, V = 3979.1(6) ?(3), and Z = 8.  相似文献   

4.
The sulfates Nb(2)O(2)(SO(4))(3), MoO(2)(SO(4)), WO(SO(4))(2,) and two modifications of Re(2)O(5)(SO(4))(2) have been synthesized by the solvothermal reaction of NbCl(5), WOCl(4), Re(2)O(7)(H(2)O)(2), and MoO(3) with sulfuric acid/SO(3) mixtures at temperatures between 200 and 300 °C. Besides the X-ray crystal structure determination of all compounds, the thermal behavior was investigated using thermogravimetric studies. WO(SO(4))(2) (monoclinic, P2(1)/n, a = 7.453(1) ?, b = 11.8232(8) ?, c = 7.881(1) ?, β = 107.92(2)°, V = 660.7(1) ?(3), Z = 4) and both modifications of Re(2)O(5)(SO(4))(2) (I: orthorhombic, Pba2, a = 9.649(1) ?, b = 8.4260(8) ?, c = 5.9075(7) ?, V = 480.27(9) ?(3), Z = 2; II: orthorhombic, Pbcm, a = 7.1544(3) ?, b = 7.1619(3) ?, c = 16.8551(7) ?, V = 863.64(6) ?(3), Z = 4) are the first structurally characterized examples of tungsten and rhenium oxide sulfates. Their crystal structure contains layers of sulfate connected [W═O] moieties or [Re(2)O(5)] units, respectively. The cohesion between layers is realized through weak M-O contacts (343-380 pm). Nb(2)O(2)(SO(4))(3) (orthorhombic, Pna2(1), a = 9.9589(7) ?, b = 11.7983(7) ?, c = 8.6065(5) ?, V = 1011.3(1) ?(3), Z = 4) represents a new sulfate-richer niobium oxide sulfate. The crystal structure contains a three-dimensional network of sulfate connected [Nb═O] moieties. In MoO(2)(SO(4)) (monoclinic, I2/a, a = 8.5922(6) ?, b = 12.2951(6) ?, c = 25.671(2) ?, β = 94.567(9)°, V = 2703.4(3) ?(3), Z = 24) [MoO(2)] units are connected through sulfate ions to a three-dimensional network, which is pervaded by channels along [100] accommodating the terminal oxide ligands. In all compounds except WO(SO(4))(2), the metal ions are octahedrally coordinated by monodentate sulfate ions and oxide ligands forming short M═O bonds. In WO(SO(4))(2), the oxide ligand and two monodentate and two bidentate sulfate ions build a pentagonal bipyramid around W. The thermal stability of the sulfates decreases in the order Nb > Mo > W > Re; the residues formed during the decomposition are the corresponding oxides.  相似文献   

5.
The synthesis, crystal structures, second-harmonic generation (SHG), piezoelectric, pyroelectric, and ferroelectric properties of three polar noncentrosymmetric (NCS) hexagonal tungsten bronze-type oxides are reported. The materials KNbW 2O 9, RbNbW 2O 9, and KTaW 2O 9 were synthesized by standard solid-state techniques and structurally characterized by laboratory powder X-ray diffraction. The compounds are isostructural, crystallizing in the polar NCS space group Cmm2. The materials exhibit a corner-shared MO 6 (M = Nb (5+)/W (6+) or Ta (5+)/W (6+)) octahedral framework, with K (+) or Rb (+) occupying the "hexagonal" tunnels. The d (0) transition metals, Nb (5+), Ta (5+), and W (6+), are displaced from the center of their oxide octahedra attributable to second-order Jahn-Teller effects. SHG measurements using 1064 nm radiation revealed frequency-doubling efficiencies ranging from 180 to 220 x alpha-SiO 2. Converse piezoelectric measurements resulted in d 33 values ranging from 10 to 41 pm V (-1). The total pyroelectric coefficient, p, at 50 degrees C ranged from -6.5 to -34.5 muC K (-1) m (-2). The reported materials are also ferroelectric, as demonstrated by hysteresis loops (polarization vs electric field). Spontaneous polarization values, P s, ranging from 2.1 to 8.4 muC cm (-2) were measured. The magnitudes of the SHG efficiency, piezoelectric response, pyroelectric coefficient, and ferroelectric polarization are strongly dependent on the out-of-center distortion of the d (0) transition metals. Structure-property relationships are discussed and explored. Crystal data: KNbW 2O 9, orthorhombic, space group Cmm2 (No. 35), a = 21.9554(2) A, b = 12.60725(15) A, c = 3.87748(3) A, V = 1073.273(13) A (3), and Z = 6; RbNbW 2O 9, orthorhombic, space group Cmm2 (No. 35), a = 22.00985(12) A, b = 12.66916(7) A, c = 3.8989(2) A, V = 1086.182(10) A (3), and Z = 6; KTaW 2O 9, orthorhombic, space group Cmm2 (No. 35), a = 22.0025(2) A, b = 12.68532(14) A, c = 3.84456(4) A, V = 1073.05(2) A (3), and Z = 6.  相似文献   

6.
Two new mixed-valent tellurium oxides with vanadium(V), A(4)V(6)[Te(2)(4+)Te(6+)]O(24) (A = K and Rb), have been synthesized by hydrothermal and conventional solid state techniques. Their structures were determined by single-crystal X-ray diffraction analysis. These two iso-structural compounds exhibit layered structural topologies consisting of [V(6)Te(3)O(24)](4-) anionic units. In these anionic structural units, a Te(6+)O(6) octahedron is connected to six VO(4) tetrahedra by corner-sharing to generate a [V(6)TeO(24)] unit, and each of these [V(6)TeO(24)] units are interconnected by sharing two Te(4+)O(3) polyhedra to complete the infinite [V(6)Te(3)O(24)](4-) sheets. Infrared spectroscopy, UV-Visible diffuse reflectance spectroscopy, and thermogravimetric analysis were also performed on these two compounds. Crystal data: K(4)V(6)Te(3)O(24), trigonal, space group R ?3c (No. 167) with a = b = 9.7075(6) ?, c = 42.701(3) ?, V = 3484.9(4) ?(3), and Z = 6; Rb(4)V(6)Te(3)O(24), trigonal, space group R ?3c (No. 167) with a = b = 9.8399(9) ?, c = 43.012(4) ?, V = 3606.6(6) ?(3), and Z = 6.  相似文献   

7.
Two new quaternary mixed metal oxide materials--InVTe(2)O(8) and InVSe(2)O(8)--have been synthesized, as crystals and pure bulk powders by standard solid-state reactions using In(2)O(3), V(2)O(5), and TeO(2) (or SeO(2)) as reagents. The crystal structures of the reported materials were determined using single-crystal X-ray diffraction. InVTe(2)O(8) crystallizes in the monoclinic centrosymmetric space group P2(1)/n (No. 14), with unit-cell parameters of a = 7.8967(16) ?, b = 5.1388(10) ?, c = 16.711(3) ?, β = 94.22(3)°, and Z = 4, and InVSe(2)O(8) crystallizes in the noncentrosymmetric space group Pm (No. 6) with unit-cell parameters of a = 4.6348(9) ?, b = 6.9111(14) ?, c = 10.507(2) ?, β = 97.77(3)°, and Z = 2. While the centrosymmetric InVTe(2)O(8) shows a two-dimensional (2D) layered structure composed of InO(6) octahedra, VO(4) tetrahedra, and TeO(4) polyhedra, the noncentrosymmetric InVSe(2)O(8) exhibits a three-dimensional (3D) framework structure with distorted InO(6) octahedra, VO(5) square pyramids, and SeO(3) polyhedra. Powder second-harmonic generation (SHG) measurements on InVSe(2)O(8), using 1064-nm radiation, indicate that the material has a SHG efficiency ~30 times that of α-SiO(2). Additional SHG measurements reveal that the material is not phase-matchable (Type 1). Infrared, ultraviolet-visible light (UV-vis) diffuse reflectance, and thermogravimetric analyses for the two compounds are also presented, as are dipole moment calculations.  相似文献   

8.
Lube MS  Wells RL  White PS 《Inorganic chemistry》1996,35(17):5007-5014
The 1:1 mole ratio reactions of boron trihalides (BX(3)) with tris(trimethylsilyl)phosphine [P(SiMe(3))(3)] produced 1:1 Lewis acid/base adducts [X(3)B.P(SiMe(3))(3), X = Cl (1), Br (2), I (5)]. Analogous 1:1 mole ratio reactions of these boron trihalides with lithium bis(trimethylsilyl)phosphide [LiP(SiMe(3))(2)] produced dimeric boron-phosphorus ring compounds {[X(2)BP(SiMe(3))(2)](2), X = Br (3), Cl (4)}. X-ray crystallographic studies were successfully conducted on compounds 1-4. Compound 1 crystallized in the orthorhombic space group Pbca, with a = 13.420(3) ?, b = 17.044(5) ?, c = 21.731(7) ?, V = 4970.6(25) ?(3), and D(calc) = 1.229 g cm(-3) for Z = 8; the B-P bond length was 2.022(9) ?, Compound 2 crystallized in the orthorhombic space group Pbca, with a = 13.581(6) ?, b = 17.106(7) ?, c = 22.021(9) ?, V = 5116(4) ?(3), and D(calc) = 1.540 g cm(-3) for Z = 8; the B-P bond length was 2.00(2) ?. Compound 3 crystallized in the monoclinic space group P2(1)/n, with a = 9.063(5) ?, b = 16.391(8) ?, c = 9.331(4) ?, V = 1379.2(12) ?(3), and D(calc) = 1.676 g cm(-3) for Z = 2; the B-P bond length was 2.023(10) ?. Compound 4 crystallized in the monoclinic space group P2(1)/n, with a = 9.143(5) ?, b = 16.021(8) ?, c = 9.170(4) ?, V = 1342.2(11) ?(3), and D(calc) = 1.282 g cm(-3) for Z = 2; the B-P bond length was 2.025(3) ?. Thermal decomposition studies were performed on compounds 1-4, yielding colored powders with boron:phosphorus ratios greater than 1:1 and significant C and H contamination indicated by elemental analyses.  相似文献   

9.
X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions.  相似文献   

10.
Reactions of [Ni(tren)(H(2)O)(2)]X(2) (tren = tris(2-aminoethyl)amine; X = Cl (1a), Br (1b); X(2) = SO(4) (1c)) with mannose-type aldoses, having a 2,3-cis configuration (D-mannose and L-rhamnose), afforded {bis(N-aldosyl-2-aminoethyl)(2-aminoethyl)amine}nickel(II) complexes, [Ni(N,N'-(aldosyl)(2)-tren)]X(2) (aldosyl = D-mannosyl, X = Cl (2a), Br (2b), X(2) = SO(4) (2c); aldosyl = L-rhamnosyl, X(2) = SO(4) (3c)). The structure of 1c was confirmed by X-ray crystallography to be a mononuclear [Ni(II)N(4)O(2)] complex with the tren acting as a tetradentate ligand (1c.2H(2)O: orthorhombic, Pbca, a = 15.988(2) ?, b = 18.826(4) ?, c = 10.359(4) ?, V = 3118 ?(3), Z = 8, R = 0.047, and R(w) = 0.042). Complexes 2a,c and 3c were characterized by X-ray analyses to have a mononuclear octahedral Ni(II) structure ligated by a hexadentate N-glycoside ligand, bis(N-aldosyl-2-aminoethyl)(2-aminoethyl)amine (2a.CH(3)OH: orthorhombic, P2(1)2(1)2(1), a = 16.005(3) ?, b = 20.095(4) ?, c = 8.361(1) ?, V = 2689 ?(3), Z = 4, R = 0.040, and R(w) = 0.027. 2c.3CH(3)OH: orthorhombic, P2(1)2(1)2(1), a = 14.93(2) ?, b = 21.823(8) ?, c = 9.746(2) ?, V = 3176 ?(3), Z = 4, R = 0.075, and R(w) = 0.080. 3c.3CH(3)OH: orthorhombic, P2(1)2(1)2(1), a = 14.560(4) ?, b = 21.694(5) ?, c = 9.786(2) ?, V = 3091 ?(3), Z = 4, R = 0.072, and R(w) = 0.079). The sugar part of the complex involves novel intramolecular sugar-sugar hydrogen bondings around the metal center. The similar reaction with D-glucose, D-glucosamine, and D-galactosamine, having a 2,3-trans configuration, resulted in the formation of a mono(sugar) complex, [Ni(N-(aldosyl)-tren)(H(2)O)(2)]Cl(2) (aldosyl = D-glucosyl (4b), 2-amino-2-deoxy-D-glucosyl (5a), and 2-amino-2-deoxy-D-galactosyl (5b)), instead of a bis(sugar) complex. The hydrogen bondings between the sugar moieties as observed in 2 and 3 should be responsible for the assembly of two sugar molecules on the metal center. Reactions of tris(N-aldosyl-2-aminoethyl)amine with nickel(II) salts gave the tris(sugar) complexes, [Ni(N,N',N"-(aldosyl)(3)-tren)]X(2) (aldosyl = D-mannosyl, X = Cl (6a), Br (6b); L-rhamnosyl, X = Cl (7a), Br (7b); D-glucosyl, X = Cl (9); maltosyl, X = Br (10); and melibiosyl, X = Br (11)), which were assumed to have a shuttle-type C(3) symmetrical structure with Delta helical configuration for D-type aldoses on the basis of circular dichroism and (13)C NMR spectra. When tris(N-rhamnosyl)-tren was reacted with NiSO(4).6H(2)O at low temperature, a labile neutral complex, [Ni(N,N',N"-(L-rhamnosyl)(3)-tren)(SO(4))] (8), was successfully isolated and characterized by X-ray crystallography, in which three sugar moieties are anchored only at the N atom of the C-1 position (8.3CH(3)OH.H(2)O: orthorhombic, P2(1)2(1)2(1), a = 16.035(4) ?, b = 16.670(7) ?, c = 15.38(1) ?, V = 4111 ?(3), Z = 4, R = 0.084, and R(w) = 0.068). Complex 8 could be regarded as an intermediate species toward the C(3) symmetrical tris(sugar) complexes 7, and in fact, it was readily transformed to 7b by an action of BaBr(2).  相似文献   

11.
The hydrothermal reaction of Th(NO3)4.xH2O with V2O5 and H6TeO6 at 200 degrees C under autogenously generated pressure results in the formation of Th(VO2)2(TeO6)(H2O)2 as a pure phase. The single-crystal X-ray data indicate that Th(VO2)2(TeO6)(H2O)2 possesses a three-dimensional structure constructed from ThO9 tricapped trigonal prisms, VO5 distorted square pyramids, VO4 distorted tetrahedra, and TeO6 distorted octahedra. Both of the vanadium polyhedra contain VO2+ vanadyl units with two short V=O bond distances. The tellurate octahedron is tetragonally distorted and utilizes all of its oxygen atoms to bond to adjacent metal centers, sharing edges with ThO9 and VO5 units, and corners with two ThO9, one VO5, and two VO4 polyhedra. Crystallographic data: Th(VO2)2(TeO6)(H2O)2, orthorhombic, space group Pbca, a = 12.6921(7), b = 11.5593(7), c = 13.0950(8) A, Z = 8 (T = 193 K). The UV-vis diffuse reflectance spectrum of Th(VO2)2(TeO6)(H2O)2 shows vanadyl-based charge-transfer absorption features. Th(VO2)2(TeO6)(H2O)2 decomposes primarily to Th(VO3)4 when heated at 600 degrees C in air.  相似文献   

12.
Li[V(eddadp)]·3H(2)O (1a) and Cs[V(eddadp)]·2H(2)O (1b) were characterized by X-ray crystallography. 1a crystallizes in the monoclinic space group Cc with a = 11.467(7) ?, b = 13.398(8) ?, c = 12.529(8) ?, β = 114.85(4)°; V = 1746.7(2) ?(3), and Z = 4; 1b crystallizes in the monoclinic space group P2(1)/n with a = 10.265(5) ?, b = 11.673(6) ?, c = 15.507(8) ?, β = 104.29(2)°, V = 1800.6(2) ?(3), and Z = 4. The solution structure of 1 has been ascertained to be predominantly six-coordinated with a hexadentate eddadp which is based on a comparison of the electronic and Raman spectra of aqueous solutions of 1 with those in the solid state.  相似文献   

13.
An extensive series of radical salts formed by the organic donor bis(ethylenedithio)tetrathiafulvalene (ET), the paramagnetic tris(oxalato)ferrate(III) anion [Fe(C(2)O(4))(3)](3-), and halobenzene guest molecules has been synthesized and characterized. The change of the halogen atom in this series has allowed the study of the effect of the size and charge polarization on the crystal structures and physical properties while keeping the geometry of the guest molecule. The general formula of the salts is ET(4)[A(I)Fe(C(2)O(4))(3)]·G with A/G = H(3)O(+)/PhF (1); H(3)O(+)/PhCl (2); H(3)O(+)/PhBr (3), and K(+)/PhI (4), (crystal data at room temperature: (1) monoclinic, space group C2/c with a = 10.3123(2) ?, b = 20.0205(3) ?, c = 35.2732(4) ?, β = 92.511(2)°, V = 7275.4(2) ?(3), Z = 4; (2) monoclinic, space group C2/c with a = 10.2899(4) ?, b = 20.026(10) ?, c = 35.411(10) ?, β = 92.974°, V = 7287(4) ?(3), Z = 4; (3) monoclinic, space group C2/c with a = 10.2875(3) ?, b = 20.0546(15) ?, c = 35.513(2) ?, β = 93.238(5)°, V = 7315.0(7) ?(3), Z = 4; (4) monoclinic, space group C2/c with a = 10.2260(2) ?, b = 19.9234(2) ?, c = 35.9064(6) ?, β = 93.3664(6)°, V = 7302.83(18) ?(3), Z = 4). The crystal structures at 120 K evidence that compounds 1-3 undergo a structural transition to a lower symmetry phase when the temperature is lowered (crystal data at 120 K: (1) triclinic, space group P1 with a = 10.2595(3) ?, b = 11.1403(3) ?, c = 34.9516(9) ?, α = 89.149(2)°, β = 86.762(2)°, γ = 62.578(3)°, V = 3539.96(19) ?(3), Z = 2; (2) triclinic, space group P1 with a = 10.25276(14) ?, b = 11.15081(13) ?, c = 35.1363(5) ?, α = 89.0829(10)°, β = 86.5203(11)°, γ = 62.6678(13)°, V = 3561.65(8) ?(3), Z = 2; (3) triclinic, space group P1 with a = 10.25554(17) ?, b = 11.16966(18) ?, c = 35.1997(5) ?, α = 62.7251(16)°, β = 86.3083(12)°, γ = 62.7251(16)°, V = 3575.99(10) ?(3), Z = 2; (4) monoclinic, space group C2/c with a = 10.1637(3) ?, b = 19.7251(6) ?, c = 35.6405(11) ?, β = 93.895(3)°, V = 7128.7(4) ?(3), Z = 4). A detailed crystallographic study shows a change in the symmetry of the crystal for compound 3 at about 200 K. This structural transition arises from the partial ordering of some ethylene groups in the ET molecules and involves a slight movement of the halobenzene guest molecules (which occupy hexagonal cavities in the anionic layers) toward one of the adjacent organic layers, giving rise to two nonequivalent organic layers at 120 K (compared to only one at room temperature). The structural transition at about 200 K is also observed in the electrical properties of 1-3 and in the magnetic properties of 1. The direct current (dc) conductivity shows metallic behavior in salts 1-3 with superconducting transitions at about 4.0 and 1.0 K in salts 3 and 1, respectively. Salt 4 shows a semiconductor behavior in the temperature range 300-50 K with an activation energy of 64 meV. The magnetic measurements confirm the presence of high spin S = 5/2 [Fe(C(2)O(4))(3)](3-) isolated monomers together with a Pauli paramagnetism, typical of metals, in compounds 1-3. The magnetic properties can be very well reproduced in the whole temperature range with a simple model of isolated S = 5/2 ions with a zero field splitting plus a temperature independent paramagnetism (Nα) with the following parameters: g = 1.965, |D| = 0.31 cm(-1), and Nα = 1.5 × 10(-3) emu mol(-1) for 1, g = 2.024, |D| = 0.65 cm(-1), and Nα = 1.4 × 10(-3) emu mol(-1) for 2, and g = 2.001, |D| = 0.52 cm(-1), and Nα = 1.5 × 10(-3) emu mol(-1) for 3.  相似文献   

14.
A series of novel organically templated metal sulfates, [C(5)H(14)N(2)][M(II)(H(2)O)(6)](SO(4))(2) with (M(II) = Mn (1), Fe (2), Co (3) and Ni (4)), have been successfully synthesized by slow evaporation and characterized by single-crystal X-ray diffraction as well as with infrared spectroscopy, thermogravimetric analysis and magnetic measurements. All compounds were prepared using a racemic source of the 2-methylpiperazine and they crystallized in the monoclinic systems, P2(1)/n for (1, 3) and P2(1)/c for (2,4). Crystal data are as follows: [C(5)H(14)N(2)][Mn(H(2)O)(6)](SO(4))(2), a = 6.6385(10) ?, b = 11.0448(2) ?, c = 12.6418(2) ?, β = 101.903(10)°, V = 906.98(3) ?(3), Z = 2; [C(5)H(14)N(2)][Fe(H(2)O)(6)](SO(4))(2), a = 10.9273(2) ?, b = 7.8620(10) ?, c = 11.7845(3) ?, β = 116.733(10)°, V = 904.20(3) ?(3), Z = 2; [C(5)H(14)N(2)][Co(H(2)O)(6)](SO(4))(2), a = 6.5710(2) ?, b = 10.9078(3) ?, c = 12.5518(3) ?, β = 101.547(2)°, V = 881.44(4) ?(3), Z = 2; [C(5)H(14)N(2)][Ni(H(2)O)(6)](SO(4))(2), a = 10.8328(2) ?, b = 7.8443(10) ?, c = 11.6790(2) ?, β = 116.826(10)°, V = 885.63(2) ?(3), Z = 2. The three-dimensional structure networks for these compounds consist of isolated [M(II)(H(2)O)(6)](2+) and [C(5)H(14)N(2)](2+) cations and (SO(4))(2-) anions linked by hydrogen-bonds only. The use of racemic 2-methylpiperazine results in crystallographic disorder of the amines and creation of inversion centers. The magnetic measurements indicate that the Mn complex (1) is paramagnetic, while compounds 2, 3 and 4, (M(II) = Fe, Co, Ni respectively) exhibit single ion anisotropy.  相似文献   

15.
The X-ray crystal structure of the p-sulfonatocalix[5]arene(5)(-) anion (1b) in the form of the dimeric hydrate Na(10)[p-sulfonatocalix[5]arene](2).33.5H(2)O (2) is reported. The reactions of 1b with a number of transition metal salts to form transition metal bridged bis(calixarene) inclusion complexes have also been investigated. The X-ray crystal structure of the "Co(H(2)O)(4)(2+)" bridged species Na(8)[Co(H(2)O)(4)(p-sulfonatocalix[5]arene)(2)].2CH(3)C(O)N(CH(3))(2).37H(2)O (3) which incorporates a "supercavity" large enough to encompass 2 N,N-dimethylacetamide (dma) guest molecules as well as ca. 15 water molecules and Na(+) ions is reported. Crystal data are as follows: for 2, monoclinic space group P2(1)/c, Z = 4, a = 22.0644(4), b = 19.1180(3), c = 27.7834(4) ?, beta = 91.780(1), V = 11714.1(5) ?(3); complex 3, orthorhombic space group Pnma, Z = 4, a = 22.2271(5), b = 30.1693(6), c = 18.8503(4) ?, V = 12640.6(5) ?(3).  相似文献   

16.
Su T  Xing H  Xu J  Yu J  Xu R 《Inorganic chemistry》2011,50(3):1073-1078
Three new open-framework metal borophosphates, [Na(6)Co(3)B(2)P(5)O(21)Cl]·H(2)O (JIS-4), K(5)Mn(2)B(2)P(5)O(19)(OH)(2) (JIS-5), (NH(4))(8)[Co(2)B(4)P(8)O(30)(OH)(4)] (JIS-6), have been prepared under ionothermal conditions using ionic liquid 1-ethyl-3-methylimidazolium ([Emim]Br) as the solvent. They are the first examples of metalloborophosphate prepared by the ionothermal method. Their structures are determined by single-crystal X-ray diffraction. The 3-D open framework of JIS-4 is made of CoO(5)Cl octahedra, CoO(5) square pyramids, and PO(4) and BO(4) tetrahedra forming 12-ring channels along the [010] direction. It is noted that JIS-4 is the first 3-D open-framework structure in the family of borophosphate with the B/P ratio of 2/5, which features a borophosphate cluster anionic partial structure. Such cluster anionic partial structures connect with MnO(6) octahedra and MnO(5) trigonal bipyramids resulting in the formation of the 2-D layer structure of JIS-5 with the same B/P ratio as JIS-4. The 2-D layer structure of JIS-6 belongs to the largest family of borophosphate with a B/P ratio of 1/2 which features a unique 1-D chain anionic partial structure. Crystal data for JIS-4, orthorhombic, Pnma, a = 14.0638(8) ?, b = 9.8813(7) ?, c = 14.0008(10) ?, V = 1945.7(2) ?(3), and Z = 2; for JIS-5, monoclinic, P2(1)/n, a = 14.4939(3) ?, b = 9.2539(3) ?, c = 14.8031(4) ?, β = 101.4600(10)°, V = 1945.88(9) ?(3), and Z = 4. For JIS-6, triclinic, P1, a = 9.6928(3) ?, b = 9.8747(3) ?, c = 10.0125(2) ?, α = 62.057(2)°, β = 82.456(2)°, γ = 76.095(2)°, V = 821.60(4) ?(3), and Z = 1.  相似文献   

17.
Three methods have been developed to prepare gallium and indium complexes of three tetradentate N(2)S(2) ligands of the general formula M(N(2)S(2))R (M = Ga, In; R = Cl, Br, SCN, O(2)CC(6)H(5)-O,O'). The ancillary ligand (Cl, SCN, O(2)CC(6)H(5)-O,O') was varied with the tetradentate ligand BAT-TM. X-ray crystallography shows that the coordination geometry about the d(10) metal ion is influenced by the steric requirements of the ligands. X-ray crystallography of four molecules results in the following data: GaCl(BAT-TM) (1), formula = C(10)H(22)ClGaN(2)S(2), space group = Pnma, a = 12.387(4) ?, b = 21.116(6) ?, c = 5.986(2) ?, V = 1565.8(9) ?(3), Z = 4; InCl(BAT-TM) (2), formula = C(10)H(22)ClInN(2)S(2), space group = Pnma, a = 12.968(9) ?, b = 29.29(1) ?, c = 5.866(2) ?, V = 1620(2) ?(3), Z = 4; InNCS(BAT-TM) (3), formula = C(11)H(24)ClInN(3)S(3), space group = Pbca, a = 11.812(3) ?, b = 11.679(3) ?, c = 24.238(9) ?, V = 3449.7 (17) ?(3), Z = 8; In(O,O'-O(2)CC(6)H(5))(BAT-TM) (4), formula = C(19)H(29)O(2)InN(2)S(2), space group = P2(1)/n, a = 10.783(2) ?, b = 18.708(4) ?, c = 12.335(4) ?, V = 2321.7(9) ?(3), Z = 4. Proton NMR studies show that the complexes are stable in solution; in polar solvents such as acetonitrile, for certain molecules, two metal-ligand complexes are observed. Similarly, two metal-ligand complexes are seen in NMR data taken in 80% acetonitrile/20% D(2)O (pD = 4.6) mixture. HPLC studies (acetonitrile/50 mM sodium acetate, pH = 4.6) show that the lipophilicity of the ligand determines the retention time of the complex.  相似文献   

18.
An attempt to synthesize a complex between copper(I) cyanide and thioacetamide (ta) by a direct combination in aqueous solution, surprisingly, produced instead Cu(4)(S(2)O(3))(2)(ta)(10).ta (1), a complex lacking cyanide but including thiosulfate. We know of no precedent for the production of thiosulfate from an aqueous solution of ta. Using a new synthetic approach, a complex of CuCN and ta was subsequently prepared-(CuCN)(ta), 2. In the new method, which has been found to be widely applicable to water-soluble ligands, CuCN is made "available" for coordination by dissolving it in aqueous sodium thiosulfate. Complex 1 crystallizes in the triclinic space group P&onemacr; (No. 2) with unit cell dimensions a = 10.139(3) ?, b = 12.230(4) ?, c = 12.665(4) ?, alpha = 85.20(2) degrees, beta = 67.32(2) degrees, gamma = 68.47(2) degrees, V = 1345(2) ?(3), and Z = 2. Complex 2 crystallizes in the orthorhombic space group Pna2(1) (No. 33) with unit cell dimensions a = 6.993(9) ?, b = 8.744(3) ?, c = 9.372(6) ?, V = 573(1) ?(3), and Z = 4. Some possible pathways for the production of thiosulfate are discussed.  相似文献   

19.
The syntheses, structures, and characterization of four new lead(II)-tellurium(IV)-oxide halides, Pb(3)Te(2)O(6)X(2) and Pb(3)TeO(4)X(2) (X = Cl or Br) are reported. The materials are synthesized by solid-state techniques, using Pb(3)O(2)Cl(2) or Pb(3)O(2)Br(2) and TeO(2) as reagents. The compounds have three-dimensional structural topologies consisting of lead-oxide halide polyhedra connected to tellurium oxide groups. In addition, the Pb(2+) and Te(4+) cations are in asymmetric coordination environments attributable to their stereoactive lone pair. We also demonstrate that Pb(3)Te(2)O(6)X(2) and Pb(2)TeO(4)X(2) can be interconverted reversibly through the loss or addition of TeO(2). X-ray data: Pb(3)Te(2)O(6)Cl(2), monoclinic, space group C2/m (No. 12), a = 16.4417(11) A, b = 5.6295(4) A, c = 10.8894(7) A, beta = 103.0130(10) degrees, Z = 4; Pb(3)Te(2)O(6)Br(2), monoclinic, space group C2/m (No. 12), a = 16.8911(8) A, b = 5.6804(2) A, c = 11.0418(5) A, beta = 104.253(2) degrees, Z = 4; Pb(3)TeO(4)Cl(2), orthorhombic, space group Bmmb (No. 63), a = 5.576(1) A, b = 5.559(1) A, c = 12.4929(6) A, Z = 4; Pb(3)TeO(4)Br(2), orthorhombic, space group Bmmb (No. 63), a = 5.6434(4) A, b = 5.6434(5) A, c = 12.9172(6) A, Z = 4.  相似文献   

20.
Reaction of the amide ligand N-[2-((2-pyridylmethylene)amino)phenyl]pyridine-2-carboxamide (Hcapca) with VCl(3) affords the compound trans-[VCl(2)(capca)] (1), the first example of a vanadium(III) complex containing a vanadium-deprotonated amide nitrogen bond, while reaction of bis(pentane-2,4-dionato)oxovanadium(IV) with the related ligands N-[2-((2-phenolylmethylene)amino)phenyl]pyridine-2-carboxamide (H(2)phepca), 1-(2-hydroxybenzamido)-2-(2-pyridinecarboxamido)benzene (H(3)hypyb), and 1,2-bis(2-hydroxybenzamido)benzene (H(4)hybeb) yields the complexes [VO(phepca)] (2), Na[VO(hypyb)].2CH(3)OH (4.2CH(3)OH), and Na(2)[VO(hybeb)].3CH(3)OH (5.3CH(3)OH) respectively. The preparation of the complex {N-[2-((2-thiophenoylmethylene)amino)phenyl]pyridine-2-carboxamido}oxovanadium(IV) (3) has been achieved by reaction of N-(2-aminophenyl)pyridine-2-carboxamide and 2-mercaptobenzaldehyde with [VO(CH(3)COO)(2)](x)(). Oxidation of complex 5.3CH(3)OH with silver nitrate gives its vanadium(V) analogue (8.CH(3)OH), which is readily converted to its corresponding tetraethylammonium salt (10.CH(2)Cl(2)) by a reaction with Et(4)NCl. The crystal structures of the octahedral 1.CH(3)CN, and the square-pyramidal complexes 3, 4.CH(3)CN, 5.2CH(3)OH, and 10 were demonstrated by X-ray diffraction analysis. Crystal data are as follows: 1.CH(3)CN, C(18)H(13)Cl(2)N(4)OV.CH(3)CN M(r) = 464.23, monoclinic, P2(1)/n, a = 10.5991(7) ?, b = 13.9981(7) ?, c = 14.4021(7) ?, beta = 98.649(2)(o), V = 2112.5(3) A(3), Z = 4, R = 0.0323, and R(w) 0.0335; 3, C(19)H(13)N(3)O(2)SV, M(r) = 398.34, monoclinic, P2(1)/n, a = 12.1108(10) ?, b = 19.4439(18) ?, c = 7.2351(7) ?, beta = 103.012(3) degrees, V = 1660.0(4) ?(3), Z = 4, R = 0.0355, and R(w) = 0.0376; 4.CH(3)CN, C(19)H(12)N(3)O(4)VNa.CH(3)CN, M(r) = 461.31, monoclinic, P2(1)/c, a = 11.528(1) ?, b = 11.209(1) ?, c = 16.512(2) ?, beta = 103.928(4)(o), V = 2071.0(5) ?(3), Z = 4, R = 0.0649, and R(w) = 0.0806; 5.2CH(3)OH, C(20)H(10)N(2)O(5)VNa(2).2CH(3)OH, M(r) = 519.31, triclinic, P1, a = 12.839(1) ?, b = 8.334(1) ?, c = 12.201(1) ?, alpha = 106.492(2) degrees, beta = 105.408(2) degrees, gamma = 73.465(2) degrees, V = 1175.6(3) ?(3), Z = 2, R = 0.0894, and R(w) = 0.1043; 10, C(28)H(32)N(3)O(5)V M(r) = 541.52, monoclinic, P2(1)/c, a = 11.711(3) ?, b = 18.554(5) ?, c = 12.335(3) ?, beta = 95.947(9) degrees, V = 2666(2) ?(3), Z = 4, R = 0.0904, and R(w) = 0.0879. In addition to the synthesis and crystallographic studies, we report the optical, infrared, magnetic, and electrochemical properties of these complexes. Electron paramagnetic resonance [of oxovanadium(IV) species] and (1)H, (13)C{(1)H}, and (51)V nuclear magnetic resonance [of oxovanadium(V) complex] properties are reported as well. This study represents the first systematic study of vanadium(III), V(IV)O(2+), and V(V)O(3+) species containing a vanadium-deprotonated amide nitrogen bond.  相似文献   

设为首页 | 免责声明 | 关于勤云 | 加入收藏

Copyright©北京勤云科技发展有限公司  京ICP备09084417号