共查询到20条相似文献,搜索用时 31 毫秒
1.
Sivakumar T Ramesha K Lofland SE Ramanujachary KV Subbanna GN Gopalakrishnan J 《Inorganic chemistry》2004,43(6):1857-1864
We describe the synthesis of two new quadruple perovskites, Sr(2)La(2)CuTi(3)O(12) (I) and Ca(2)La(2)CuTi(3)O(12) (II), by solid-state metathesis reaction between K(2)La(2)Ti(3)O(10) and A(2)CuO(2)Cl(2) (A = Sr, Ca). I is formed at 920 degrees C/12 h, and II, at 750 degrees C/24 h. Both the oxides crystallize in a tetragonal (P4/mmm) quadruple perovskite structure (a = 3.9098(2) and c = 15.794(1) A for I; a = 3.8729(5) and c = 15.689(2) A for II). We have determined the structures of I and II by Rietveld refinement of powder XRD data. The structure consists of perovskite-like octahedral CuO(4/2)O(2/2) sheets alternating with triple octahedral Ti(3)O(18/2) sheets along the c-direction. The refinement shows La/A disorder but no Cu/Ti disorder in the structure. The new cuprates show low magnetization (0.0065 micro(B) for I and 0.0033 micro(B) for II) suggesting that the Cu(II) spins are in an antiferromagnetically ordered state. Both I and II transform at high temperatures to 3D perovskites where La/Sr and Cu/Ti are disordered, suggesting that I and II are metastable phases having been formed in the low-temperature metathesis reaction. Interestingly, the reaction between K(2)La(2)Ti(3)O(10) and Ca(2)CuO(2)Cl(2) follows a different route at 650 degrees C, K(2)La(2)Ti(3)O(10) + Ca(2)CuO(2)Cl(2) --> CaLa(2)Ti(3)O(10) + CaCuO(2) + 2KCl, revealing multiple reaction pathways for metathesis reactions. 相似文献
2.
Adasch V Hess KU Ludwig T Vojteer N Hillebrecht H 《Chemistry (Weinheim an der Bergstrasse, Germany)》2007,13(12):3450-3458
Single crystals of two modifications of the new magnesium boride carbide MgB(12)C(2) were synthesized from the elements in a metallic melt by using tantalum ampoules. Crystals were characterized by single-crystal X-ray diffraction and electron microprobe analysis (energy-dispersive (EDX) and wavelength-dispersive (WDX) X-ray spectroscopy). Orthorhombic MgB(12)C(2) is formed in a Cu/Mg melt at 1873 K. The crystal structure of o-MgB(12)C(2) (Imma, Z=4, a=5.6133(10), b=9.828(2), c=7.9329(15) A, 574 reflections, 42 variables, R(1)(F)=0.0208, wR(2)(I)=0.0540) consists of a hexagonal primitive array of B(12) icosahedra with Mg atoms and C(2) units in trigonal-prismatic voids. Each icosahedron has six exohedral B--B and six B--C bonds. Carbon is tetrahedrally coordinated by three boron atoms and one carbon atom with a remarkably long C--C distance of 1.727 A. Monoclinic MgB(12)C(2) is formed in an Al/Mg melt at 1573 K. The structure of m-MgB(12)C(2) (C2/c, Z=4, a=7.2736(11), b=8.7768(13), c=7.2817(11) A, beta=105.33(3) degrees , 1585 reflections, 71 variables, R(1)(F)=0.0228, wR(2)(I)=0.0610) may be described as a distorted cubic close arrangement of B(12) icosahedra. Tetrahedral voids are filled by C atoms and octahedral voids are occupied by Mg atoms. The icosahedra are interconnected by four exohedral B--B bonds to linear chains and by eight interstitial C atoms to form a three-dimensional covalent network. Both compounds fulfill the electron-counting rules of Wade and Longuet-Higgins. 相似文献
3.
Ortho-linked polyphenols, quaterphenol L(OH)4, and moderately hindered terphenol PhL(OH)3 are developed as new multidentate polyaryloxide ligands for transition-metal chemistry. The polyphenols are synthesized using ortho-metalation and metal-catalyzed cross-coupling methodologies; the synthetic routes allow for facile electronic and steric modification of the basic ligand design. The Ti(IV) coordination chemistry of these ligands reveals a diverse collection of bridged structures: dimeric [Ti(mu-PhLO3)(OiPr)]2 (P2(1)/n, a = 12.2699(5) A, b = 11.7957(5) A, c = 21.238(1) A, beta = 94.551(1) degrees, Z = 2, T = 170(2) K), dimeric [Ti2(mu-PhLO3)2(mu-Cl)(Cl)(THF)] (P1, a = 11.212(1) A, b = 14.165(1) A, c = 22.447(2) A, alpha = 90.440(4) degrees, beta = 93.345(4) degrees, gamma = 111.164(4) degrees, Z = 2, T = 170(2) K), and trimeric [Ti3(mu,mu'-LO4)(mu-OiPr)2(OiPr)6] P2(1)/n, a = 11.1022(5) A, b = 18.7015(9) A, c = 24.409(1) A, beta = 95.369(2) degrees, Z = 4, T = 170(2) K). The reaction of TiCl3(THF)3 with [PhLO3]3- results in oxidation of Ti(III) to Ti(IV) and formation of the oxo dimer [Ti(PhLO3)(THF)]2(mu-O) (P1, a = 10.8649(6) A, b = 12.1882(7) A, c = 14.3349(9) A, alpha = 65.602(3) degrees, beta = 84.390(3) degrees, gamma = 86.582(3) degrees, Z = 1, T = 200(2) K); the oxo group presumably originates from the THF solvent. The titanium centers in these environments are either 5- or 6-coordinate, with distorted square pyramidal/trigonal bipyramidal and distorted octahedral geometries, respectively; the polyphenoxide chelate ligands are capable of bridging multiple oxophilic titanium sites. 相似文献
4.
The alkali metal/group 4 metal/polychalcogenides Cs(4)Ti(3)Se(13), Rb(4)Ti(3)S(14), Cs(4)Ti(3)S(14), Rb(4)Hf(3)S(14), Rb(4)Zr(3)Se(14), Cs(4)Zr(3)Se(14), and Cs(4)Hf(3)Se(14) have been synthesized by means of the reactive flux method at 823 or 873 K. Cs(4)Ti(3)Se(13) crystallizes in a new structure type in space group C(2)(2)-P2(1) with eight formula units in a monoclinic cell at T = 153 K of dimensions a = 10.2524(6) A, b = 32.468(2) A, c = 14.6747(8) A, beta = 100.008(1) degrees. Cs(4)Ti(3)Se(13) is composed of four independent one-dimensional [Ti(3)Se(13)(4-)] chains separated by Cs(+) cations. These chains adopt hexagonal closest packing along the [100] direction. The [Ti(3)Se(13)(4-)] chains are built from the face- and edge-sharing of pentagonal pyramids and pentagonal bipyramids. Formal oxidation states cannot be assigned in Cs(4)Ti(3)Se(13). The compounds Rb(4)Ti(3)S(14), Cs(4)Ti(3)S(14), Rb(4)Hf(3)S(14), Rb(4)Zr(3)Se(14), Cs(4)Zr(3)Se(14), and Cs(4)Hf(3)Se(14) crystallize in the K(4)Ti(3)S(14) structure type with four formula units in space group C(2)(h)()(6)-C2/c of the monoclinic system at T = 153 K in cells of dimensions a = 21.085(1) A, b = 8.1169(5) A, c = 13.1992(8) A, beta = 112.835(1) degrees for Rb(4)Ti(3)S(14);a = 21.329(3) A, b = 8.415(1) A, c = 13.678(2) A, beta = 113.801(2) degrees for Cs(4)Ti(3)S(14); a = 21.643(2) A, b = 8.1848(8) A, c = 13.331(1) A, beta = 111.762(2) degrees for Rb(4)Hf(3)S(14); a = 22.605(7) A, b = 8.552(3) A, c = 13.880(4) A, beta = 110.919(9) degrees for Rb(4)Zr(3)Se(14); a = 22.826(5) A, b = 8.841(2) A, c = 14.278(3) A, beta = 111.456(4) degrees for Cs(4)Zr(3)Se(14); and a = 22.758(5) A, b = 8.844(2) A, c = 14.276(3) A, beta = 111.88(3) degrees for Cs(4)Hf(3)Se(14). These A(4)M(3)Q(14) compounds (A = alkali metal; M = group 4 metal; Q = chalcogen) contain hexagonally closest-packed [M(3)Q(14)(4-)] chains that run in the [101] direction and are separated by A(+) cations. Each [M(3)Q(14)(4-)] chain is built from a [M(3)Q(14)] unit that consists of two MQ(7) pentagonal bipyramids or one distorted MQ(8) bicapped octahedron bonded together by edge- or face-sharing. Each [M(3)Q(14)] unit contains six Q(2)(2-) dimers, with Q-Q distances in the normal single-bond range 2.0616(9)-2.095(2) A for S-S and 2.367(1)-2.391(2) A for Se-Se. The A(4)M(3)Q(14) compounds can be formulated as (A(+))(4)(M(4+))(3)(Q(2)(2-))(6)(Q(2-))(2). 相似文献
5.
The flexible and larger ring size macrocycle 4 (C(36)H(46)N(6)Se(2)) afforded stable complex 5 [Hg(2)(PF(6))(2)[C(36)H(46)N(6)Se(2)]] on treatment with 1 equiv of mercuric acetate followed by addition of NH(4)PF(6). The reaction of Pb(OCOCH(3))(2).4H(2)O with 4 followed by treatment with NH(4)PF(6) resulted in a dinuclear lead complex (6) [Pb(2)(PF(6))(2)(OCOCH(3))(2)[C(36)H(46)N(6)Se(2)]]. The crystal structures of complexes 5 and 6 are described: C(36)H(46)F(12)Hg(2)N(6)P(2)Se(2) a = 9.5106(5) A, b = 11.5222(6) A, c = 11.8161(6) A, alpha = 115.6110(10) degrees , beta = 96.5190(10) degrees , gamma = 106.2910(10) degrees , monoclinic, P, Z =1; C(44)H(57)F(12)N(8)O(4)P(2)Pb(2)Se(2) a = 9.4668(5) A, b = 11.9937(6) A, c = 25.2319(14) A, alpha = 102.4130(10) degrees , beta = 97.6130(10) degrees , gamma = 94.8540(10) degrees , monoclinic, P, Z = 2. The crystal structure of 5 revealed that Hg(2)(2+) is trapped inside the cavity of the macrocycle. The geometry around the mercurous ion is antiprismatic with Hg(2)(2+) coordinating to six nitrogen atoms forming four five-membered rings, and there is no interaction between the mercurous ion and the selenium donor atoms. The single crystal X-ray crystal structure of 6 indicates a distorted octahedral geometry around each lead atom in the cavity of the macrocycle due to presence of the sterochemically active lone pair on Pb(II). The octahedral geometry around each Pb(II) is satisfied by coordination to 3 nitrogen atoms, two oxygen atoms of the chelating acetate group, and bridging of one of the oxygen atoms of the nearby acetate. 相似文献
6.
Cu4Mo6Se8 has been synthesized by intercalation of Cu into Cu2Mo6Se8 at room temperature, and its crystal structure has been determined. This compound crystallizes in the triclinic space group P, with a = 6.7609(8) A, b = 6.8122(7) A, c = 7.9355(10) A, alpha = 70.739(4) degrees , beta = 72.669(4) degrees , gamma = 84.555(5) degrees , and Z = 1. Instead of residing in the voids between corners or edges of Mo6Se8 clusters as in the classic R Chevrel structure, the Cu atoms in Cu4Mo6Se8 fully occupy four sites between faces of two adjacent Mo6Se8 clusters. Thus, two of the six Mo atoms in each cluster do not have capping Se atoms from neighboring clusters. This represents a new triclinic structure type for Chevrel phases. In addition to the synthesis and crystal structure, we present and discuss results from electronic structure calculations using both extended Hückel and density functional theory. These calculations predict Cu4Mo6Se8 to be metallic. We also report results from Cu intercalation into Chevrel phase sulfides and tellurides. Preliminary experiments suggest that a telluride analogue of Cu4Mo6Se8 exists. 相似文献
7.
Ti(C5H5)2(C8H4S8) (1), Ti(C5Me5)2(C8H4S8) (2), [NMe4][Ti(C5H5)(C8H4S8)2] (3), and [NMe4][Ti(C5Me5)(C8H4S8)2] (4) [C8H4S8(2-) = 2-(4,5-ethylenedithio)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5- dithiolate(2-)] were prepared by reaction of Ti(C5H5)2Cl2, Ti(C5Me5)2Cl2, Ti(C5H5)Cl3, or Ti(C5Me5)Cl3 with Li2C8H4S8 or [NMe4]2[C8H4S8] in THF. They were oxidized by iodine, the ferrocenium cation, or TCNQ (7,7,8,8-tetracyano-p-quinodimethane) in CH2Cl2 or in acetone to afford one-electron-oxidized and over-one-electron-oxidized species, [Ti(C5H5)2(C8H4S8)].I3, [Ti(C5H5)2(C8H4S8)][PF6], [Ti(C5Me5)2(C8H4S8)].I3, [Ti(C5Me5)2(C8H4S8)][PF6], [Ti(C5H5)(C8H4S8)2].I0.9, [Ti(C5H5)(C8H4S8)2][TCNQ]0.3, [Ti(C5Me5)(C8H4S8)2].I2.4, and [Ti(C5Me5)(C8H4S8)2][TCNQ]0.3, with the C8H4S8 ligand-centered oxidation. They exhibited electrical conductivities of 1.6 x 10(-1) to 7.6 x 10(-4) S cm-1 measured for compacted pellets at room temperature. The crystal structure of 2 was clarified to consist of isolated dimerized units of the molecules through some sulfur-sulfur nonbonded contacts: monoclinic, P2(1)/c, a = 9.534(2) A, b = 18.227(2) A, c = 17.775(2) A, beta = 94.39(1) degrees, Z = 4. 相似文献
8.
Ozturk II Hadjikakou SK Hadjiliadis N Kourkoumelis N Kubicki M Baril M Butler IS Balzarini J 《Inorganic chemistry》2007,46(21):8652-8661
Five new antimony(III) complexes with the heterocyclic thiones 2-mercapto-benzimidazole (MBZIM), 5-ethoxy-2-mercapto-benzimidazole (EtMBZIM), and 2-mercapto-thiazolidine (MTZD) of formulas {[SbCl(2)(MBZIM)4]+.Cl-.2H(2)O. (CH(3)OH)} (1), {[SbCl(2)(MBZIM)4]+.Cl-.3H(2)O.(CH3CN)} (2), [SbCl(3)(MBZIM)2] (3), [SbCl(3)(EtMBZIM)(2)] (4), and [SbCl(3)(MTZD)2] (5) have been synthesized and characterized by elemental analysis, FT-IR, far-FT-IR, differential thermal analysis-thermogravimetry, X-ray diffraction, and conductivity measurements. Complex {[SbCl2(tHPMT)(2)]+Cl-}, (tHPMT = 2-mercapto-3,4,5,6-tetrahydro-pyrimidine), already known, was also prepared, and its X-ray crystal structure was solved. It is shown that the complex is better described as {[SbCl3(tHPMT)(2)]} (6). Crystal structures of all other complexes (1-5) have also been determined by X-ray diffraction at ambient conditions. The crystal structure of the hydrated ligand, EtMBZIM.H2O is also reported. Compound [C(28)H(24)Cl(2)N(8)S(4)Sb.2H(2)O.Cl.(CH(3)OH)] (1) crystallizes in space group P2(1), with a = 7.7398(8) A, b = 16.724(3) A, c = 13.717(2) A, beta = 98.632(11) degrees, and Z = 2. Complex [C(28)H(24)Cl(2)N(8)S(4)S(b).Cl.3H(2)O.(CH(3)CN)] (2) corresponds to space group P2(1), with a = 7.8216(8) A, b = 16.7426(17) A, c = 13.9375(16) A, beta = 99.218(10) degrees , and Z = 2. In both 1 and 2 complexes, four sulfur atoms from thione ligands and two chloride ions form an octahedral (Oh) cationic [SbS(4)Cl(2)]+ complex ion, where chlorides lie at axial positions. A third chloride counteranion neutralizes it. Complexes 1 and 2 are the first examples of antimony(III) compounds with positively charged Oh geometries. Compound [C(14)H(12)Cl(3)N(4)S(2)S(b)] (3) crystallizes in space group P, with a = 7.3034(5) A, b = 11.2277(7) A, c = 12.0172(8) A, alpha = 76.772(5) degrees, beta = 77.101(6) degrees, gamma = 87.450(5) degrees, and Z = 2. Complex [C(18)H(20)Cl(3)N(4)O(2)S(2)S(b)] (4) crystallizes in space group P1, with a = 8.6682(6) A, b = 10.6005(7) A, c = 13.0177(9) A, alpha = 84.181(6) degrees, beta = 79.358(6) degrees, gamma = 84.882(6) degrees, and Z = 2, while complex [C(6)H(10)Cl(3)N(2)S(4)S(b)] (5) in space group P2(1)/c shows a = 8.3659(10) A, b = 14.8323(19) A, c = 12.0218(13) A, beta = 99.660(12) degrees, and Z = 4 and complex [C(8)H(16)Cl(3)N(4)S(2)S(b)] (6) in space group P1 shows a = 7.4975(6) A, b = 10.3220(7) A, c = 12.1094(11) A, alpha = 71.411(7) degrees, beta = 84.244(7) degrees, gamma = 73.588(6) degrees, and Z = 2. Crystals of complexes 3-6 grown from acetonitrile solutions adopt a square-pyramidal (SP) geometry, with two sulfur atoms from thione ligands and three chloride anions around Sb(III). The equatorial plane is formed by two sulfur and two chloride atoms in complexes 3-5, in a cis-S, cis-Cl arrangement in 3 and 5 and a trans-S, trans-Cl arrangement in 4. Finally, in the case of 6, the equatorial plane is formed by three chloride ions and one sulfur from the thione ligand while the second sulfur atom takes an axial position leading to a unique SP conformation. The complexes showed a moderate cytostatic activity against tumor cell lines. 相似文献
9.
The new ternary pnictides, Ti(1-delta)Mo(1+delta)Pn4 (Pn = As, Sb), were uncovered during our search for novel thermoelectric materials. Both compounds crystallize in the OsGe2 type in the monoclinic space group C2/m, with lattice dimensions of a = 10.1222(9) A, b = 3.6080(3) A, c = 8.1884(8) A, beta = 120.230(2) degrees , and V = 258.38(7) A3 (Z = 2) for Ti(0.79(1))Mo(1.21)Sb4 and a = 9.1580(2) A, b = 3.3172(1) A, c = 7.6666(1) A, beta = 119.496(1) degrees , and V = 202.720(4) A3 (Z = 2) for Ti(0.86(2))Mo(1.14)As4. The electronic structure calculations predicted metallic behavior for these compounds, which was in agreement with the measured temperature dependence of the electrical conductivity and Seebeck coefficient. 相似文献
10.
The new compounds K(2)TiCu(2)S(4), Rb(2)TiCu(2)S(4), Rb(2)TiAg(2)S(4), Cs(2)TiAg(2)S(4), and Cs(2)TiCu(2)Se(4) have been synthesized by the reactions of A(2)Q(3) (A = K, Rb, Cs; Q = S, Se) with Ti, M (M = Cu or Ag), and Q at 823 K. The compounds Rb(2)TiCu(2)S(4), Cs(2)TiAg(2)S(4), and Cs(2)TiCu(2)Se(4) are isostructural. They crystallize with two formula units in space group P4(2)/mcm of the tetragonal system in cells of dimensions a = 5.6046(4) A, c = 13.154(1) A for Rb(2)TiCu(2)S(4), a =6.024(1) A, c = 13.566(4) A for Cs(2)TiAg(2)S(4), and a =5.852(2) A, c =14.234(5) A for Cs(2)TiCu(2)Se(4) at 153 K. Their structure is closely related to that of Cs(2)ZrAg(2)Te(4) and comprises [TiM(2)Q(4)(2)(-)] layers, which are separated by alkali metal atoms. The [TiM(2)Q(4)(2)(-)] layer is anti-fluorite-like with both Ti and M atoms tetrahedrally coordinated to Q atoms. Tetrahedral coordination of Ti(4+) is rare in the solid state. On the basis of unit cell and space group determinations, the compounds K(2)TiCu(2)S(4) and Rb(2)TiAg(2)S(4) are isostructural with the above compounds. The band gaps of K(2)TiCu(2)S(4), Rb(2)TiCu(2)S(4), Rb(2)TiAg(2)S(4), and Cs(2)TiAg(2)S(4) are 2.04, 2.19, 2.33, and 2.44 eV, respectively, as derived from optical measurements. From band-structure calculations, the optical absorption for an A(2)TiM(2)Q(4) compound is assigned to a transition from an M d and Q p valence band (HOMO) to a Ti 3d conduction band. 相似文献
11.
Reduction of TiCl(4) with 1 equiv of HSnBu(3) followed by addition of [PPh(4)]Cl and then PR(3) leads to two new dinuclear titanium(III) compounds, [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PR(3))(2)] (R = Et and R(3) = Me(2)Ph), both of which contain an anion with the face-sharing bioctahedral type structure. Their crystal structures are reported. [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PEt(3))(2)].2CH(2)Cl(2) crystallized in the triclinic space group P&onemacr;. Cell dimensions: a = 12.461(1) ?, b = 20.301(8) ?, c = 11.507(5) ?, alpha = 91.44 degrees, beta = 113.27(1) degrees, gamma = 104.27(2) degrees, and Z = 2. The distance between titanium atoms is 3.031(2) ?. [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PMe(2)Ph)(2)].CH(2)Cl(2) also crystallized in the triclinic space group P&onemacr; with cell dimensitions a = 11.635(4) ?, b = 19.544(3) ?, c = 11.480(3) ?, alpha = 100.69(2) degrees, beta = 109.70(1) degrees, gamma = 95.08(2) degrees, and Z = 2. The distance between titanium atoms in this compound is 2.942(1) ?. Variable temperature magnetic susceptibilities were measured for [PPh(4)][Ti(2)(&mgr;-Cl)(3)Cl(4)(PEt(3))(2)]. Electronic structure calculations were carried out for a model ion, [Ti(2)(&mgr;-Cl)(3)Cl(4)(PH(3))(2)](-), and another well-known anion, [Ti(2)(&mgr;-Cl)(3)Cl(6)](3)(-), by employing an ab initio configuration interaction method. The results of the calculations reveal that the metal-metal interaction in these Ti(III) face-sharing compounds can be best described by strong antiferromagnetic coulping that leads to a singlet ground state and a thermally accessible triplet first excited state. Accordingly the measured magnetic data were satisfactorily fitted to a spin-only formula. 相似文献
12.
Eight- and 16-membered cyanuric-sulfanuric ring systems of the type Ar2C2N4S2(O)2Ar'2 (3a, Ar = 4-BrC6H4, Ar' = Ph; 3b, Ar = 4-CF3C6H4, Ar' = Ph; 3c, Ar = 4-CF3C6H4, Ar' = 4-CH3C6H4) and Ar4C4N8S4(O)4Ar'4 (4b, Ar = 4-CF3C6H4, Ar' = Ph; 4c, Ar = 4-CH3C6H4, Ar' = Ph; 4d, Ar = 4-CF3C6H4, Ar' = 4-CH3C6H4), respectively, were prepared in good yields by the reaction of the corresponding sulfur(IV) systems with m-chloroperbenzoic acid. The X-ray structures of 3b, 3c.C7H14, 4b.CH2Cl2, 4c, and the S(IV) system Ar4C4N8S4Ar'4 (2c, Ar = 4-CH3C6H4, Ar' = Ph) were determined. Upon oxidation the two oxygen atoms in 3b and 3c.C7H14 adopt endo positions leading to a twist boat conformation for the C2N4S2 ring. The 16-membered C4N8S4 rings in 4b and 4c retain a cradle conformation upon oxidation. The S-N bond distances are ca. 0.06 A shorter in all the S(VI) systems compared to those in the corresponding S(IV) rings. The thermolysis of 3b at ca. 220 degrees C occurs primarily via loss of a sulfanuric group, NS(O)Ph, to give the six-membered ring (4-CF3C6H4)2C2N3S(O)Ph (6). The structure of 6 was confirmed by X-ray crystallography. Crystal data: 2c, triclinic, space group P1 with a = 13.917(2) A, b = 15.610(4) A, c = 13.491(3) A, alpha = 95.77(2) degrees, beta = 114.82(1) degrees, gamma = 76.21(2) degrees, V = 2583(1) A3, and Z = 2; 3b, monoclinic, space group P2(1)/a with a = 7.316(2) A, b = 29.508(5) A, c = 12.910(2) A, beta = 101.30(2) degrees, V = 2733(1) A3, and Z = 4; 3c.C7H14, triclinic, space group P1 with a = 12.849(4) A, b = 12.863(4) A, c = 12.610(7) A, alpha = 110.61(3) degrees, beta = 105.77(3) degrees, gamma = 62.77(2) degrees, V = 1719(1) A3, and Z = 2; 4b.CH2Cl2, triclinic, space group P1 with a = 12.647(3) A, b = 19.137(3) A, c = 12.550(2) A, alpha = 105.765(11) degrees, beta = 93.610(15) degrees, gamma = 88.877(16) degrees, V = 2917.2(9) A3, and Z = 2; 4c, orthorhombic, space group Pba2 with a = 22.657(2) A, b = 10.570(2) A, c = 10.664(3) A, alpha = beta = gamma = 90 degrees, V = 2554(1) A3, and Z = 2; 6, triclinic, space group P1 with a = 7.4667(8) A, b = 11.3406(12) A, c = 13.5470(14) A, alpha = 108.000(2) degrees, beta = 105.796(2) degrees, gamma = 94.300(2) degrees, V = 1033.8(2) A3, and Z = 2. 相似文献
13.
The crystal structure of silver azide (AgN3) in its high-temperature (HT) modification was determined from X-ray powder diffraction data, recorded at T = 170 degrees C and was further refined by the Rietveld method. The structure is monoclinic (P21/c (No. 14), a = 6.0756(2) A, b = 6.1663(2) A, c = 6.5729(2) A, beta = 114.19(0) degrees, V = 224.62(14) A3, Z = 4) and consists of two-dimensional Ag and N containing layers in which the silver atoms are coordinated by four nitrogen atoms exhibiting a distorted square coordination environment. These sheets are linked together by weaker perpendicular Ag-N contacts, thus forming a 4 + 2 coordination geometry around the silver atoms. The phase transition has been characterized by DTA, DSC, and measurement of the density, as well as of the ionic conductivity. Both, the room-temperature and the HT phase are electrically insulating. This fact is getting support by DFT band structure calculations within the generalized gradient approximation, using the PBE functional. On the basis of the DFT band structure, the bonding characteristics of both phases are essentially the same. Finally, the implication of the existence of a low-symmetry HT-phase in a crystalline explosive concerning decomposition mechanisms is discussed. 相似文献
14.
Soldatov DV Henegouwen AT Enright GD Ratcliffe CI Ripmeester JA 《Inorganic chemistry》2001,40(7):1626-1636
Four forms of nickel(II) and two of zinc(II) dibenzoylmethanates have been isolated and characterized with powder and single-crystal X-ray diffraction analyses, differential scanning calorimetry, magnetic susceptibility measurements, and solid-state 13C cross-polarization/magic angle spinning NMR. Nickel dibenzoylmethanate, Ni(DBM)2 (DBM = PhCOCHCOPh-), forms three polymorphic forms (light-green, brown, and green) and a fourth clathrate form with guest benzene included. The light-green polymorph is metastable. Substituted benzenes induce recrystallization of the polymorph into a stable brown form (C30H22NiO4; a = 26.502(3) A, b = 5.774(1) A, c = 16.456(2) A, beta = 116.03(1) degrees; monoclinic, C2/c; Z = 4). Unlike the other forms, the brown form is diamagnetic and is comprised of monomers of the low-spin [Ni(DBM)2] complex. The Ni(II) is chelated by two DBM ligands in a square planar environment by four donor oxygen atoms. When heated, the brown form transforms to a green form which is stable above 202 degrees C (C90H66Ni3O12; a = 13.819(2) A, b = 16.252(2) A, c = 17.358(2) A, beta = 108.28(1) degrees; monoclinic, P2(1)/n; Z = 2). This polymorph is formed by van der Waals packing of trimers [Ni3(DBM)6] containing linear Ni3 clusters with an Ni-Ni distance of 2.81 A. The cluster is surrounded by six DBM ligands, providing a distorted octahedral environment about each Ni by six oxygen atoms. Benzene stabilizes the trimeric structure at room temperature, forming a [Ni3(DBM)6].2(benzene) inclusion compound (Ni-Ni distance of 2.83 A) with guest benzene molecules located in channels (C90H66Ni3O12 + 2(C6H6); a = 17.670(2) A, b = 20.945(3) A, c=11.209(2) A, beta = 102.57(1) degrees; monoclinic, P2(1)/c; Z = 2). Zinc dibenzoylmethanate has been prepared in two polymorphic forms. The monomeric form contains [Zn(DBM)2] molecules with the zinc center in a distorted tetrahedral environment of four oxygens from the two chelated DBMs (C30H22O4Zn; a = 10.288(2) A, b = 10.716(2) A, c = 12.243(2) A, alpha = 89.19(1) degrees, beta = 75.39(1) degrees, gamma = 64.18(1) degrees; triclinic, P1; Z = 2). Another, dimeric form contains [Zn2(DBM)4] species, with two zinc atoms separated by a distance of 3.14 A and each zinc coordinated by five oxygen atoms (C60H44O8Zn2; a = 25.792(3) A, b = 7.274(1) A, c = 24.307(2) A, beta = 90.58(1) degrees; monoclinic, C2/c; Z = 4). The polymorphic variety of the title complexes and the peculiarities of the Ni(II) and Zn(II) coordination environments are discussed in the context of using the complexes as precursors for new metal complex hosts. 相似文献
15.
Potassium intercalation into the cation-deficient n = 2 Ruddlesden-Popper oxysulfide Y(2)Ti(2)O(5)S(2) to form KY(2)Ti(2)O(5)S(2) has been carried out by reaction of the oxysulfide with potassium vapor in sealed metal tubes at 400 degrees C, potassium naphthalide in THF at 50 degrees C, or potassium in liquid ammonia at temperatures as low as -78 degrees C. Insertion of potassium is topotactic, and although a site 12-coordinate by oxide ions is vacant in the perovskite-type oxide slabs of the structure, potassium is too large to enter this site via the 4-coordinate window, and instead enters the rock-salt-type sulfide layers of the structure which necessitates a 30% increase in the lattice parameter c normal to the layers. In contrast with one of the sodium intercalates of Y(2)Ti(2)O(5)S(2) (beta-NaY(2)Ti(2)O(5)S(2)) in which sodium occupies a tetrahedral site in the sulfide layers, potassium favors an 8-coordinate site which necessitates a relative translation of adjacent oxide slabs. KY(2)Ti(2)O(5)S(2) is tetragonal: P4/mmm, a = 3.71563(4) A, c = 14.8682(2) A (at 298 K), Z = 1. Although the resistivity (3.4(1) x 10(3) Omega cm) is larger than would be expected for a metal, temperature independent paramagnetism dominates the magnetic susceptibility, and the material is electronically very similar to the analogous sodium intercalate beta-NaY(2)Ti(2)O(5)S(2) which features reduced-titanium-containing oxide layers of very similar geometry and electron count. 相似文献
16.
The new compound Ta(4)SI(11) has been prepared by direct reaction of the elements at 430 degrees C for 2 weeks in evacuated Pyrex ampules and characterized by single-crystal X-ray diffraction, X-ray photoelectron spectroscopy, magnetic susceptibility measurements, and semiempirical electronic structure calculations. Ta(4)SI(11) crystallizes with orthorhombic symmetry in space group Pmmn; a = 16.135(3) A, b = 3.813(1) A, c = 8.131(2) A, and Z = 1. The disordered structure involves two crystallographically distinct sites for Ta atoms, both of which are 50% occupied as well as a bridging anion site that is 50% S and 50% I. Magnetic susceptibility above 100 K gives micro (eff) = 1.53 micro (B) to suggest one unpaired electron per formula unit. X-ray photoelectron spectroscopy and extended Hückel calculations suggest that the structure consists of Ta(3) triangles and "isolated" Ta atoms, leading to the formulation (Ta(3))(9+)(Ta(4+))(S(2)(-))(I(-))(11) and we hypothesize that each Ta(3) is capped by a sulfur atom. 相似文献
17.
The high-yield synthesis of Lu11Te4 by reaction of the components and annealing at 1200 degrees C is described. The structure determined by single-crystal diffraction means is monoclinic C2/m, Z = 6, a = 30.412(3) A, b = 3.9504(4) A, c = 21.073(2) A, beta = 102.96 degrees and consists of two independent condensed puckered sheets of Lu separated by individual Te atoms. Notwithstanding, the geometric structure is closely related to but distinctly different from those of both Sc8Te3 and Ti11Se4 (also C2/m), principally through displacements of pairs of atoms (the structure of the last was determined by electron diffraction). Further, close electronic similarities among the three structures are demonstrated by EHTB results in terms of both effective atom charge and bond overlap population trends between equivalent positions or functions. 相似文献
18.
Reactions of two new tripodal ligands 1,3,5-tris(1-imidazolyl)benzene (4) and 1,3-bis(1-imidazolyl)-5-(imidazol-1-ylmethyl)benzene (5) with metal [Ag(I), Cu(II), Zn(II), Ni(II)] salts lead to the formation of novel two-dimensional (2D) metal-organic frameworks [Ag(2)(4)(2)][p-C(6)H(4)(COO)(2)].H(2)O (6), [Ag(4)]ClO(4) (7), [Cu(4)(2)(H(2)O)(2)](CH(3)COO)(2).2H(2)O (8), [Zn(4)(2)(H(2)O)(2)](NO(3))(2) (9), [Ni(4)(2)(N(3))(2)].2H(2)O (10), and [Ag(5)]ClO(4) (11). All the structures were established by single-crystal X-ray diffraction analysis. Crystal data for 6: monoclinic, C2/c, a = 23.766(3) A, b = 12.0475(10) A, c = 13.5160(13) A, beta = 117.827(3) degrees, Z = 4. For compound 7: orthorhombic, P2(1)2(1)2(1), a = 7.2495(4) A, b = 12.0763(7) A, c = 19.2196(13) A, Z = 4. For compound 8: monoclinic, P2(1)/n, a = 8.2969(5) A, b = 12.2834(5) A, c = 17.4667(12) A, beta = 96.5740(10) degrees, Z = 2. For compound 9: monoclinic, P2(1)/n, a =10.5699(3) A, b = 11.5037(3) A, c = 13.5194(4) A, beta = 110.2779(10) degrees, Z = 2. For compound 10: monoclinic, P2(1)/n, a = 9.8033(3) A, b = 12.1369(5) A, c = 13.5215(5) A, beta = 107.3280(10) degrees, Z = 2. For compound 11: monoclinic C2/c, a = 18.947(2) A, b = 9.7593(10) A, c = 19.761(2) A, beta = 97.967(2) degrees, Z = 8. Both complexes 6 and 7 are noninterpenetrating frameworks based on the (6, 3) nets, and 8, 9 and 10 are based on the (4, 4) nets while complex 11 has a twofold parallel interpenetrated network with 4.8(2) topology. It is interesting that, in complexes 6,7, and 11 with three-coordinated planar silver(I) atoms, each ligand 4 or 5 connects three metal atoms, while in the case of complexes 8, 9, and 10 with six-coordinated octahedral metal atoms, each ligand 4 only links two metal atoms, and another imidazole nitrogen atom of 4 did not participate in the coordination with the metal atoms in these complexes. The results show that the nature of organic ligand and geometric needs of metal atoms have great influence on the structure of metal-organic frameworks. 相似文献
19.
Two new transition-metal gallophosphates, (H(2)C(4)H(10)N(2))(3)[(Ti(2.5)(H(2)O)(4)Ga(5.5)(PO(4))(10)].2H(2)O (TGP-1) and [H(3.5)(C(4)H(13)N(3))(2)][(Ni(0.5)(OH)(4)Ga(5.5)(PO(4))(3)(HPO(4))(4)].2H(2)O (NGP-1), have been synthesized under mild hydrothermal conditions and characterized by single-crystal X-ray diffraction, thermogravimetric analysis, electron paramagnetic resonance, electron probe microanalysis, and magnetic susceptibility data. TGP-1 exhibits a unique two-dimensional structure consisting of tetrahedral and octahedral metals centers and is the foremost paramagnetic TiGaPO material ever prepared. NGP-1 as well represents the first NiGaPO compound and adopts a layer structure that is constructed from hexameric M-O clusters of trigonal bipyramids and octahedra. In both compounds, the transition metals incorporate with gallium into octahedral sites only, while the four- and five-coordinated metals centers are only Ga(3+) ions. The unique sites for Ti(3+) and Ni(2+) ions have been initially elucidated from single-crystal structure refinements and further confirmed by bond-valence-sum calculations, EPR, and magnetic susceptibility studies. Crystal data: TGP-1, monoclinic, P2(1)/c; a = 25.692(2) A, b = 9.6552(8) A, c = 9.8418(8) A, beta = 96.737(2)(o) , V = 2424.5(3) A(3), and Z = 2; NGP-1, monoclinic, C2/c, a = 20.8363(12) A, b = 11.9546(7) A, c = 16.4577(9) A, beta = 117.285(1)(o) , V = 3643.3(1) A(3), Z = 4. 相似文献
20.
Kefalas ET Panagiotidis P Raptopoulou CP Terzis A Mavromoustakos T Salifoglou A 《Inorganic chemistry》2005,44(8):2596-2605
Titanium is a metal frequently employed in a plethora of materials supporting medical applications. In an effort to comprehend the involvement of titanium in requisite biological interactions with physiological ligands, synthetic efforts were launched targeting aqueous soluble species of Ti(IV). To this end, aqueous reactions of TiCl(4) with citric acid afforded expediently, under pH-specific conditions, the colorless crystalline materials Na(6)[Ti(C(6)H(4.5)O(7))(2)(C(6)H(5)O(7))].16H(2)O (1) and Na(3)(NH(4))(3)[Ti(C(6)H(4.5)O(7))(2)(C(6)H(5)O(7))].9H(2)O (2). Complexes 1 and 2 were characterized by elemental analysis, FT-IR, (13)C-MAS solid state and solution NMR, cyclic voltammetry, and X-ray crystallography. 1 crystallizes in the triclinic space group P, with a = 15.511(9) A, b = 15.58(1) A, c = 9.848(5) A, alpha = 85.35(2) degrees, beta = 76.53(2) degrees, gamma = 61.97(2) degrees, V = 2042(2) A(3), and Z = 2. 2 crystallizes in the triclinic space group P, with a = 12.437(5) A, b = 12.440(5) A, c = 12.041(5) A, alpha = 83.08(2) degrees, beta = 81.43(2) degrees, gamma = 67.45(2) degrees, V = 1697(2) A(3), and Z = 2. The X-ray structures of 1 and 2 reveal the presence of a mononuclear complex, with Ti(IV) coordinated to three citrate ligands in a distorted octahedral geometry around Ti(IV). The citrates employ their central alkoxide and carboxylate groups to bind Ti(V), while the terminal carboxylates stay away from the Ti(IV)O(6) core. Worth noting in 1 and 2 is the similar mode of coordination but variable degree of protonation of the bound citrates, with the locus of (de)protonation being the noncoordinating terminal carboxylates. As a result, this work suggests the presence of a number of different Ti(IV)-citrate species of the same nuclearity and coordination geometry as a function of pH. This is consistent with the so far existing pool of mononuclear Ti(IV)-citrate species and provides a logical account of the aqueous speciation in the requisite binary system. Such information is vital in trying to delineate the interactions of soluble and bioavailable Ti(IV) forms promoting biological interactions in humans. To this end, chemical properties, structural attributes, and speciation links to potential ensuing biological effects are dwelled on. 相似文献