Synthesis, characterization, and electrochemical studies on [1.1]ferrocenophanes containing aluminum, gallium, and indium

The synthesis, characterization, structure, and electrochemistry of [1.1]ferrocenophanes, bridged by the heavier group 13 elements aluminum (1a), gallium (1b), and indium (1c), are described and discussed. Compounds 1a-c have been synthesized from dilithioferrocene and intramolecularly coordinated group 13 element dihalides Ar'EX(2) (Ar' = 2-(Me(2)NCH(2))C(6)H(4); EX(2) = AlCl(2), GaCl(2), InI(2)). Although the synthesis and characterization of 1a by single-crystal X-ray analysis has been described recently (Braunschweig, H.; Burschka, C.; Clentsmith, G. K. B.; Kupfer, T.; Radacki, K. Inorg. Chem. 2005, 44, 4906), compounds 1b and 1c are described for the first time. The galla (1b) and the inda (1c) [1.1]ferrocenophane have been characterized by single-crystal X-ray determination [1b: C(38)H(40)Fe(2)Ga(2)N(2), monoclinic, P2(1)/c, a = 10.3467(5) Angstroms, b = 11.6311(4) Angstroms, c = 14.0747(7) Angstroms, beta = 105.931(2) degrees, Z = 2; 1c: C(38)H(40)Fe(2)In(2)N(2), monoclinic, P2(1)/c, a = 10.5522(7) Angstroms, b = 11.8476(8) Angstroms, c = 13.9855(9) Angstroms, beta = 104.990(3) degrees, Z = 2]. All three compounds 1a-c are anti conformers with trans orientations of the two donating NMe(2) groups. For the [1.1]ferrocenophane 1a, an unprecedented fully reversible two-electron redox process was observed by cyclic voltammetry, whereas the corresponding Ga and In species exhibit a more conventional stepwise redox chemistry. According to the Robin-Day classification, 1a is a class I and 1b and 1c are class II species. In addition to the reversible processes, compound 1a shows an irreversible oxidation at higher voltages accompanied by adsorption processes. The irreversible adsorption process was investigated with an electrochemical quartz crystal microbalance (EQCM).     

Protonation and methylation of an Anderson-type polyoxoanion [IMo6O24]5-

A series of protonated and methylated Anderson-type molybdoperiodates as well as the unprotonated [IMo6O24]5- have been synthesized and structurally characterized as tetra-n-butylammonium salts: [(n-C4H9)4N]5[IMo6O24] [monoclinic, space group C2/c, a = 33.6101(3) A, b = 15.2575(1) A, c = 24.0294(2) A, beta = 126.9569(3) degrees , Z = 4], [(n-C4H9)4N]4[IMo6O23(OH)] [monoclinic, space group P21/c, a = 9.5587(1) A, b = 24.1364(2) A, c = 18.2788(2) A, beta = 90.1562(5) degrees , Z = 2], [(n-C4H9)4N]3[IMo6O22(OH)2].2DMF [monoclinic, space group P21/a, a = 17.6105(4) A, b = 15.5432(5) A, c = 29.3316(9) A, beta = 91.475(3) degrees , Z = 4], [(n-C4H9)4N]4[IMo6O23(OMe)].3H2O [orthorhombic, space group Pbca, a = 17.0679(4) A, b = 25.6998(6) A, c = 20.7428(4) A, Z = 4], [(n-C4H9)4N]3[IMo6O22(OMe)2] [monoclinic, space group P21/n, a = 10.4009(1) A, b = 14.6658(3) A, c = 23.5395(4) A, beta = 100.324(1) degrees , Z = 2]. In all of these compounds, the [IMo6O24]5- anion is protonated or methylated selectively at O atoms shared by two Mo atoms. The results have also revealed that the protonated Anderson-type molybdoperiodates readily react with methanol in a very selective manner, while the unprotonated [IMo6O24]5- anion does not react with methanol under similar conditions.     

STRUCTURE STUDIES OF [Et_4N]_4[Cu_8(i-mnt)_6] (i-mnt=S_2C=C(CN)_2) AND [Me_4N]_4[Cu_5Ag_3(i-mnt)_6]·H_2O

<正> [Me4N]6[Ag6(i-mnt)6].H2O(1),[Et4N]4[Cu8(i-mnt)6](2) and [Me4N]4-[Cu5Ag3(i-mnt)6].H2O(3)(i-mnt=S2C=C(CN)2) were synthesized. The crystal and molecular structure of the complex 1 was reported by us.The structure of the complex 2 was determined from single crystal X-ray diffraction data. [Et4N]4[Cu8(i-mnt)s] 2, Mr=1870.46, monoclinic, P21/n, a=14.724(6), b = 17.228(3), c=15.59(1)A,β= 100.75(7)°,V=3886.3A3;Z = 2,Dc= 1.598 g/cm3. Complex 3 has been characterized by ICP elemental analyses and IR spectrum.     

1]molybdarenophanes: strained metallarenophanes with aluminum, gallium, and silicon in bridging positions

The first [1]molybdarenophanes were synthesized and structurally characterized. The aluminum and gallium compounds [(Me2Ntsi)Al(eta6-C6H5)2Mo] (2a) and [(Me2Ntsi)Ga(eta6-C6H5)2Mo] (2b) [Me2Ntsi = C(SiMe3)2(SiMe2NMe2)] were obtained from [Mo(LiC6H5)2].TMEDA and (Me2Ntsi)ECl2 [E = Al, Ga] in analytical pure form with isolated yields of 74% (2a) and 52% (2b). The silicon-bridged species [Ph2Si(eta6-C6H5)2Mo] (2c) was synthesized from [Mo(LiC6H5)2].TMEDA and Ph2SiCl2. Compound 2c was isolated as a crystalline material in an approximately 90% overall purity, from which a single crystal was used for X-ray analysis. The molecular structures of all three [1]molybdarenophanes 2a-c were determined by single-crystal X-ray analysis. The ring-tilt angle alpha was found to be 18.28(17), 21.24(10), and 20.23(29) degrees for 2a, 2b, and 2c, respectively. Variable temperature NMR measurements of 2a and 2b (-80 to 80 degrees C; 500 MHz) showed a dynamic behavior of the gallium species 2b but not of compound 2a. The dynamic behavior of 2b was rationalized by assuming that the Ga-N donor bond breaks, inversion at the nitrogen atom occurs, and a rotation of the Me2Ntsi ligand takes place followed by a re-formation of the Ga-N bond on the other side of the gallium atom. The analysis of the signals of meta and ortho protons of 2b gave approximate values of DeltaG not equal of 59.6 and 59.1 kJ mol-1, respectively. Compound 2b reacted with [Pt(PEt3)3] to give the ring-open product [(eta6-C6H6)Mo{eta6-C6H5[GaPh(Me2Ntsi)]}] (3b). The molecular structure of 3b was deduced from a single-crystal X-ray determination. The formation of the unexpected platinum-free product 3b can be rationalized by assuming that benzene reacted with 2b in a 1:1 ratio. Through a series of 1H NMR experiments with 2b it was shown that small amounts of donor molecules (e.g., THF) in benzene are needed to form 3b; in the absence of a donor molecule, 2b is thermally stable.     

Lanthanide chalcogenolate complexes: synthesis and crystal structures of the isoleptic series [Sm(TpMe,Me)2ER] (E = O, S, Se, Te; TpMe,Me = tris-3,5-dimethylpyrazolylborate)

A series of lanthanide complexes containing a chalcogenolate ligand supported by two TpMe,Me (tris-3,5-dimethylpyrazolylborate) groups has been prepared and crystallized and provides direct comparisons of bonding to hard and soft ligands at lanthanide centers. Reaction of [Sm(TpMe,Me)2Cl] with NaOR (R = Ph, Ph-Bu(t)) gives [Sm(TpMe,Me)2OR] (1a and 1b, respectively) in good yields. Reductive cleavage of dichalcogenides by samarium(II) was used to prepare the heavier congeners. Complexes of the type [Sm(TpMe,Me)2ER] for E = S, R = Ph (2a), E = S, R = Ph-4-Me (2b), E = S, R = CH2Ph (2c), E = Se, R = Ph (3a), E = Se, R = Ph-4-Bu(t) (3b), E = Se, R = CH2Ph (3c), and E = Te, R = Ph (4) have been prepared together with the corresponding complexes with TpMe,Me,4-Et as ancillary. The X-ray crystal structures of 1b, 2b, 3a, 3b, and 4 have been determined. The crystal of 1b (C40H57B2N12OSm.C7H8) was monoclinic, P2(1)/c, a = 10.6845(6) A, b = 18.5573(11) A, c = 24.4075(14) A, beta = 91.616(2) degrees, Z = 4. The crystal of 2b (C37H51B2N12SSm) was monoclinic, P2(1)/n, a = 15.0154(9) A, b = 13.1853(8) A, c = 21.1254(13) A, beta = 108.628(2) degrees, Z = 4. The crystal of 3a (C36H49B2N12SeSm.C7H8) was triclinic, P1, a = 10.7819(6) A, b = 19.3011(10) A, c = 23.0235(12) A, alpha = 79.443(2) degrees, beta = 77.428(2) degrees, gamma = 89.827(2) degrees, Z = 4. The crystal of 3b (C40H57B2N12SeSm) was triclinic, P1, a = 10.1801(6) A, b = 10.2622(6) A, c = 23.4367(14) A, alpha = 88.313(2) degrees, beta = 86.268(2) degrees, gamma = 62.503(2) degrees, Z = 2. The crystal of 4 (C36H49B2N12TeSm.C7H8) was monoclinic, P2(1)/c, a = 18.7440(10) A, b = 10.3892(6) A, c = 23.8351(13) A, beta = 94.854(2) degrees, Z = 4. The compounds form an isoleptic series of seven-coordinate complexes with terminal chalcogenolate ligands. Examination of 1b and other crystallographically characterized lanthanide alkoxides suggests that there is little correlation between bond angle and bond length. The structures of 3a and 3b, however, contain molecules in which one of the pyrazolylborate ligands undergoes a major distortion arising from twisting around a B-N bond so as to give an effectively eight-coordinate complex with pi-stacking of the phenyl group with one pyrazolyl ring. These distortions shed light on the fluxionality of these systems.     

Reaction of the stable silylene Si[(NCH2But)2C6H4-1,2] with lithium amides

The thermally stable silylene Si[(NCH2But)2C6H4-1,2] 1 undergoes oxidative addition reactions with the lithium amides LiNRR'(R = SiMe3, R' = But; R = SiMe3, R' = C6H3Me2-2,6; R = R' = Me or R = R' = Pri) to afford the new lithium amides Li(THF)2[N(R)Si(SiMe3){(NCH2But)2C6H4-1,2}][R = But2 or R = C6H3Me2-2,6 (3a)] or the new tris(amino)functionalised silyllithiums Li(THF)x[Si{(NCH2But)2C6H4-1,2}NRR'][R = SiMe3, R' = C6H3Me2-2,6, x = 2 (3); R = R'= Me, x = 3 (4) or R = R' = Pri, x = 3 (5)]. Compounds 4 and 5 are stable at ambient temperature but compound 3 is thermally labile and converts into 3a upon heating. The pathway for the formation of 2 and 3 is discussed and the X-ray structures of 2-5 are presented.     

2 + 3] cycloaddition of nitrones to platinum-bound organonitriles: effect of metal oxidation state and of nitrile substituent

The ligated benzonitriles in the platinum(II) complex [PtCl2(PhCN)2] undergo metal-mediated [2 + 3] cycloaddition with nitrones -ON+(R3)=C(R1)(R2) [R1/R2/R3 = H/Ph/Me, H/p-MeC6H4/Me, H/Ph/CH2Ph] to give delta 4-1,2,4-oxadiazoline complexes, [PtCl2(N=C(Ph)O-N(R3)-C(R1)(R2))2] (2a, 4a, 6a), as a 1:1 mixture of two diastereoisomers, in 60-75% yields, while [PtCl2(MeCN)2] is inactive toward the addition. However, a strong activation of acetonitrile was reached by application of the platinum(IV) complex [PtCl4(MeCN)2] and both [PtCl4(RCN)2] (R = Me, Ph) react smoothly with various nitrones to give [PtCl4(N=C(R)O-N(R3)-C(R1)(R2))2] (1b-6b). The latter were reduced to the corresponding platinum(II) complexes [PtCl2(N=C(R)O-N(R3)-C(R1)(R2))2] (1a-6a) by treatment with PhCH2NHOH, while the reverse reaction, i.e. conversion of 1a-6a to 1b-6b, was achieved by chlorination with Cl2. The diastereoisomers of [PtCl2(N=C(R)O-N(R3)-C(R1)(R2))2] (1a-6a) exhibit different kinetic labilities, and liberation of the delta 4-1,2,4-oxadiazolines by substitution with 1,2-bis(diphenylphosphino)ethane (dppe) in CDCl3 proceeds at different reaction rates to give free N=C(R)O-N(R3)-C(R1)(R2) and [PtCl2(dppe)] in almost quantitative NMR yield. All prepared compounds were characterized by elemental analyses, FAB mass spectrometry, and IR and 1H, 13C(1H), and 195Pt (metal complexes) NMR spectroscopies; X-ray structure determination of the first (delta 4-1,2,4-oxadiazoline)Pt(II) complexes was performed for (S,S)/(R,R)-rac-[PtCl2(N=C(Me)O-N(Me)-C(H)Ph)2] (1a) (a = 9.3562(4), b = 9.8046(3), c = 13.1146(5) A; alpha = 76.155(2), beta = 83.421(2), gamma = 73.285(2) degrees; V = 1117.39(7) A3; triclinic, P1, Z = 2), (R,S)-meso-[PtCl2(N=C(Ph)O-N(Me)-C(H)Ph)2] (2a) (a = 8.9689(9), b = 9.1365(5), c = 10.1846(10) A; alpha = 64.328(6), beta = 72.532(4), gamma = 67.744(6) degrees; V = 686.82(11) A3; triclinic, P1, Z = 1), (S,S)/(R,R)-rac-[PtCl2(N=C(Me)O-N(Me)-C(H)(p-C6H4Me))2] (3a) (a = 11.6378(2), b = 19.0767(7), c = 11.5782(4) A; beta = 111.062(2) degrees; V = 2398.76(13) A3; monoclinic, P2(1)/c, Z = 4), and (S,S)/(R,R)-rac-[PtCl2(N=C(Me)O-N(CH2Ph)-C(H)Ph2] (5a) (a = 10.664(2), b = 10.879(2), c = 14.388(3) A; alpha = 73.11(3), beta = 78.30(3), gamma = 88.88(3) degrees; V = 1562.6(6) A3; triclinic, P1, Z = 2).     

Orthopalladation of iminophosphoranes: synthesis, structure and study of stability

The reaction of Pd(OAc)(2) with polyfunctional iminophosphoranes Ph(3)P=NCH(2)CO(2)Me (1a), Ph(3)P=NCH(2)C(O)NMe(2) (1b), Ph(3)P=NCH(2)CH(2)SMe (1c) and Ph(3)P=NCH(2)-2-NC(5)H(4) (1d), gives the orthopalladated dinuclear complex [Pd(mu-Cl){C(6)H(4)(PPh(2)=NCH(2)CO(2)Me-kappa-C,N)-2}](2) (2a) and the mononuclear derivatives [PdCl{C(6)H(4)(PPh(2)=NCH(2)CONMe(2)-kappa-C,N,O)-2}] (2b), [PdCl{C(6)H(4)(PPh(2)=NCH(2)CH(2)SMe-kappa-C,N,S)-2}] (2c) and [PdCl{C(6)H(4)(PPh(2)=NCH(2)-2-NC(5)H(4)-kappa-C,N,N)-2}] (2d). The reaction implies the activation of a C-H bond in a phenyl ring of the phosphonium group, this fact being worthy of note due to the strongly deactivating nature of the phosphonium unit. The palladacycle containing the metallated carbon atom is remarkably stable toward the coordination of incoming ligands, while that formed by the iminic N atom and another heteroatom (O, 2a and 2b; S, 2c; N, 2d) is less stable and the resulting complexes can be considered as hemilabile. The X-ray crystal structures of the cyclopalladated [Pd(mu-Cl){C(6)H(4)(PPh(2)=NCH(2)CO(2)Me-kappa-C,N)-2}](2) (2a), [PdCl{C(6)H(4)(PPh(2)=NCH(2)-2-NC(5)H(4)-kappa-C,N,N)-2}] (2d), [Pd{C(6)H(4)(PPh(2)=NCH(2)CONMe(2)-kappa-C,N,O)-2}(NCMe)](ClO(4)) (7b) and [Pd{C(6)H(4)(PPh(2)NCH(2)CONMe(2)-kappa-C,N,O)-2}(py)](ClO(4)) (3b), and the coordination compound cis-[Pd(Cl)(2)(Ph(3)P=NCH(2)CH(2)SMe-kappa-N,S)] (8) are also reported.     

Structural influences of organonitrogen ligands on vanadium oxide solids. Hydrothermal syntheses and structures of the terpyridine vanadates [V2O4(terpy)2]3[V10O28], [VO2(terpy)][V4O10], and [V9O22(terpy)3

Hydrothermal reactions of the V2O5/2,2':6':2"-terpyridine/ZnO/H2O system under a variety of conditions yielded the organic-inorganic hybrid materials [V2O4(terpy)2]3[V10O28].2H2O (VOXI-10), [VO2(terpy)][V4O10] (VOXI-11), and [V9O22(terpy)3] (VOXI-12). The structure of VOXI-10 consists of discrete binuclear cations [V2O4(terpy)2]2+ and one-dimensional chains [V10O28]6-, constructed of cyclic [V4O12]4- clusters linked through (VO4) tetrahedra. In contrast, the structure of VOXI-11 exhibits discrete mononuclear cations [VO2(terpy)]1+ and a two-dimensional vanadium oxide network, [V4O10]1-. The structure of the oxide layer is constructed from ribbons of edge-sharing square pyramids; adjacent ribbons are connected through corner-sharing interactions into the two-dimensional architecture. VOXI-12 is also a network structure; however, in this case the terpy ligand is incorporated into the two-dimensional oxide network whose unique structure is constructed from cyclic [V6O18]6- clusters and linear (V3O5(terpy)3) moieties of corner-sharing vanadium octahedra. The rings form chains through corner-sharing linkages; adjacent chains are connected through the trinuclear units. Crystal data: VOXI-10, C90H70N18O42V16, triclinic P1, a = 12.2071(7) A, b = 13.8855(8) A, 16.9832(10) A, alpha = 69.584(1) degrees, beta = 71.204(1) degrees, gamma = 84.640(1) degrees, Z = 1; VOXI-11, C15H11N3O12V5, monoclinic, P2(1)/n, a = 7.7771(1) A, b = 10.3595(2) A, c = 25.715(4) A, beta = 92.286(1) degrees, Z = 4; VOXI-12, C45H33N9O22V9, monoclinic C2/c, a = 23.774(2) A, b = 9.4309(6) A, c = 25.380(2) A, beta = 112.047(1) degrees, Z = 4.     

Trimerization of alkali dicyanamides M[N(CN)2] and formation of tricyanomelaminates M3[C6N9] (M = K, Rb) in the melt: crystal structure determination of three polymorphs of K[N(CN)2], two of Rb[N(CN)2], and one of K3[C6N9] and Rb3[C6N9] from X-ray powder diffractometry

The alkali dicyanamides M[N(CN)2] (M=K, Rb) were synthesized through ion exchange, and the corresponding tricyanomelaminates M3[C6N9] were obtained by heating the respective dicyanamides. The thermal behavior of the dicyanamides and their reaction to form the tricyanomelaminates were investigated by temperature-dependent X-ray powder diffractometry and thermoanalytical measurements. Potassium dicyanamide K[N(CN)2] was found to undergo four phase transitions: At 136 degrees C the low-temperature modification alpha-K[N(CN)2] transforms to beta-K[N(CN)2], and at 187degrees C the latter transforms to the high-temperature modification gamma-K[N(CN)2], which melts at 232 degrees C. Above 310 degrees C the dicyanamide ions [N(CN)2]- trimerize and the resulting tricyanomelaminate K3[C6N9] solidifies. Two modifications of rubidium dicyanamide have been identified: Even at -25 degrees C, the a form slowly transforms to beta-Rb[N(CN)2] within weeks. Rb[N(CN)2] has a melting point of 190 degrees C. Above 260 degrees C the dicyanamide ions [N(CN)2]- of the rubidium salt trimerize in the melt and the tricyanomelaminate Rb3[C6N9] solidifies. The crystal structures of all phases were determined by powder diffraction methods and were refined by the Rietveld method. alpha-K[N(CN)2] (Pbcm, a = 836.52(1), b = 46.90(1), c =7 21.27(1) pm, Z = 4), gamma-K[N(CN)2] (Pnma, a = 855.40(3), b = 387.80(1), 1252.73(4) pm, Z = 4), and Rb[N(CN)2] (C2/c, a = 1381.56(2), b = 1000.02(1), c = 1443.28(2) pm, 116.8963(6) degrees, Z = 16) represent new structure types. The crystal structure of beta-K[N(CN)2] (P2(1/n), a = -726.92(1), b 1596.34(2), c = 387.037(5) pm, 111.8782(6) degrees, Z = 4) is similar but not isotypic to the structure of alpha Na[N(CN)2]. alpha-Rb[N(CN)2] (Pbcm, a = 856.09(1), b = 661.711(7), c = 765.067(9) pm, Z = 4) is isotypic with alpha-K[N(CN)2]. The alkali dicyanamides contain the bent planar anion [N(CN)2]- of approximate symmetry C2, (average bond lengths: C-N(bridge) 133, C-N(term) 113 pm; average angles N-C-N 170 degrees, C-N-C 120 degrees). K3[C6N9] (P2(1/c), a = 373.82(1), b = 1192.48(5), c = 2500.4(1) pm, beta = 101.406(3) degrees, Z = 4) and Rb,[C6N9] (P2(1/c), a = 389.93(2), b = 1226.06(6), c = 2547.5(1) pm, 98.741(5) degrees, Z=4) are isotypic and they contain the planar cyclic anion [C6N9]3-. Although structurally related, Na3[C6N9] is not isotypic with the tricyanomelaminates M3[C6N9] (M = K, Rb).     

Isomers of a dibismuthane, R2Bi-BiR2 [R = 2,6-(Me2NCH2)2C6H3], and unusual reactions with oxygen: formation of [R2Bi]2(O2) and R'R' 'Bi [R' = 2-(Me2NCH2)-6-{Me2N(O)CH2}C6H3; R' ' = 2-(Me2NCH2)-6-{O(O)C}C6H3

R2Bi-BiR2 [1; R = 2,6-(Me2NCH2)2C6H3], a dibismuthane that exists in different forms in the crystalline state, reacts in air with the formation of the peroxide [R(2)Bi]2(O2) (2) and partial oxidation of the pendant (dimethylamino)methyl groups, yielding the mononuclear bismuth complex R'R' 'Bi (3) [R' = 2-(Me2NCH2)-6-{Me2N(O)CH2}C6H3; R' ' = 2-(Me2NCH2)-6-{O(O)C}C6H3].     

New metalloligands [M(SC[O]Ph)(4)](-): synthesis and characterization of polymeric [A(MeCN)(x)[M(SC[O]Ph)(4)]] compounds (A = Li,Na and K; M = Ga and In; x = 0-2)

Exploiting the ability of the [M(SC[O]Ph)(4)](-) anion to behave like an anionic metalloligand, we have synthesized [Li[Ga(SC[O]Ph)(4)]] (1), [Li[In(SC[O]Ph)(4)]] (2), [Na[Ga(SC[O]Ph)(4)]] (3), [Na(MeCN)[In(SC[O]Ph)(4)]] (4), [K[Ga(SC[O]Ph)(4)]] (5), and [K(MeCN)(2)[In(SC[O]Ph)(4)]] (6) by reacting MX(3) and PhC[O]S(-)A(+) (M = Ga(III) and In(III); X = Cl(-) and NO(3)(-); and A = Li(I), Na(I), and K(I)) in the molar ratio 1:4. The structures of 2, 4, and 6 determined by X-ray crystallography indicate that they have a one-dimensional coordination polymeric structure, and structural variations may be attributed to the change in the alkali metal ion from Li(I) to Na(I) to K(I). Crystal data for 2 x 0.5MeCN x 0.25H(2)O: monoclinic space group C2/c, a = 24.5766(8) A, b = 13.2758(5) A, c = 19.9983(8) A, beta = 108.426(1) degrees, Z = 8, and V = 6190.4(4) A(3). Crystal data for 4: monoclinic space group P2(1)/c, a = 10.5774(7) A, b = 21.9723(15) A, c = 14.4196(10) A, beta = 110.121(1) degrees, Z = 4, and V = 3146.7(4) A(3). Crystal data for 6: monoclinic space group P2(1)/c, a = 12.307(3) A, b = 13.672(3) A, c = 20.575(4) A, beta = 92.356(4) degrees, Z = 4, and V = 3458.8(12) A(3). The thermal decomposition of these compounds indicated the formation of the corresponding AMS(2) materials.     

Synthesis and structural characterization of configurational isomers of tungsten-palladium complexes with bridging diphenyl(dithioalkoxycarbonyl)phosphine as a ligand and phosphine transfer from tungsten to palladium

Treatment of the complex [W(CO)5[PPh2(CS2Me)]] (2) with [Pd(PPh3)4] (1) affords binuclear complexes such as anti-[(Ph3P)2Pd[mu-eta 1,eta 2-(CS2Me)PPh2]W(CO)5] (3), syn-[(Ph3P)2Pd[mu-eta 1,eta 2-(CS2Me)PPh2]W(CO)5] (4), and trans-[W(CO)4(PPh3)2] (5). In 3 and 4, respectively, the W and Pd atoms are in anti and syn configurations with respect to the P-CS2 bond of the diphenyl(dithiomethoxycarbonyl)phosphine ligand, PPh2(CS2Me). Complex 3 undergoes extensive rearrangement in CHCl3 at room temperature by transfer of a PPh3 ligand from Pd to W, eliminating [W(CO)5(PPh3)] (7), while the PPh2CS2Me ligand transfers from W to Pd to give [[(Ph3P)Pd[mu-eta 1,eta 2-(CS2Me)PPh2]]2] (6). In complex 6, the [Pd(PPh3)] fragments are held together by two bridging PPh2(CS2Me) ligands. Each PPh2(CS2Me) ligand is pi-bonded to one Pd atom through the C=S linkage and sigma-bonded to the other Pd through the phosphorus atom, resulting in a six-membered ring. Treatment of Pd(PPh3)4 with [W(CO)5[PPh2[CS2(CH2)nCN]]] (n = 1, 8a; n = 2, 8b) in CH2Cl2 affords syn-[(Ph3P)2Pd[mu-eta 1,eta 2-[CS2(CH2)nCN]PPh2]W(CO)5] (n = 1, 9a; n = 2, 9b). Similar configurational products syn-[(Ph3P)2Pd[mu-eta 1,eta 2-(CS2R)PPh2]W(CO)5] (R = C2H5, C3H5, C2H4OH, C3H6CN, 11a-d) are synthesized by the reaction of Pd(PPh3)4 with [W(CO)5[PPh2(CS2R)]] (R = C2H5, C3H5, C2H4OH, C3H6CN, 10a-d). Although complexes 11a-d have the same configuration as 9a,b, the SR group is oriented away from Pd in the former and near Pd in the latter. In these complexes, the diphenyl(dithioalkoxycarbonyl)phosphine ligand is bound to the two metals through the C=S pi-bonding and to phosphorus through the sigma-bonding. All of the complexes are identified by spectroscopic methods, and the structures of complexes 3, 6, 9a, and 11d are determined by single-crystal X-ray diffraction. Complexes 3, 9, and 11d crystallize in the triclinic space group P1 with Z = 2, whereas 6 belongs to the monoclinic space group P2/c with Z = 4. The cell dimensions are as follows: for 3, a = 10.920(3) A, b = 14.707(5) A, c = 16.654(5) A, alpha = 99.98(3) degrees, beta = 93.75(3) degrees, gamma = 99.44(3) degrees; for 6, a = 15.106(3) A, b = 9.848(3) A, c = 20.528(4) A, beta = 104.85(2) degrees; for 9a, a = 11.125(3) A, b = 14.089(4) A, c = 17.947(7) A, alpha = 80.13(3) degrees, beta = 80.39(3) degrees, gamma = 89.76(2) degrees; for 11d, a = 11.692(3) A, b = 13.602(9) A, c = 18.471(10) A, alpha = 81.29(5) degrees, beta = 80.88(3) degrees, gamma = 88.82(1) degrees.     

Synthesis and structure of tetranuclear orthometallated Pd(II) complexes derived from bis-iminophosphoranes

The reaction of Pd(OAc)2 with bis-iminophosphoranes Ph3P=NCH2CH2CH2N=PPh3 (1a), [C6H4(C(O)N=PPh3)2-1,3] (1b) and [C6H4(C(O)N=PPh3)2-1,2] (1c), gives the orthopalladated tetranuclear complexes [{Pd(mu-Cl){C6H4(PPh2=NCH2-kappa-C,N)-2}}2CH2]2 (2a) [{Pd(mu-OAc){C6H4(PPh2=NC(O)-kappa-C,N)-2}}2C6H4-1',3']2 (2b) and [{Pd(mu-OAc){C6H4(PPh2=NC(O)-kappa-C,N)-2}}2C6H4-1',2']2 (2c). The reaction takes place in CH2Cl2 for 1a, but must be performed in glacial acetic acid for 1b and 1c. The process implies in all cases the activation of a C-H bond on a Ph ring of the phosphonium group, with concomitant formation of endo complexes. This is the expected behaviour for 1a, but for 1b and 1c reverses the exo orientation observed in other ketostabilized iminophosphoranes. The influence of the solvent in the orientation of the reaction is discussed. The dinuclear acetylacetonate complexes [{Pd(acac-O,O'){C6H4(PPh2=NCH2-kappa-C,N)-2}}2CH2] (3a), [{Pd(acac-O,O'){C6H4(PPh2=NC(O)-kappa-C,N)-2}}2C6H4-1',3'] (3b) and [{Pd(acac-O,O'){C6H4(PPh2=NC(O)-kappa-C,N)-2}}2C6H4-1',2'] (3c) have been obtained from the halide-bridging tetranuclear derivatives. The X-ray crystal structure of [3c.4CHCl3] is also reported.     

Yttrium calix[4]arene complexes. Silylation and silylamine elimination reactions on model oxo surfaces

The synthesis and the spectroscopic and structural characterization of lower-rim-silylated and rare-earth-metalated calix[4]arenes are presented. Hexamethyldisilazane, HN(SiMe3)2, reacted in a selective manner with [p-tert-buttylcalix[4]arene]H4 (1) in refluxing mesitylene to give the 1,3-silylated product [p-tert-butylcalix[4]arene(SiMe3)2]H2 (2) in high yield. The molecular structure of compound 2, as revealed by X-ray crystallography, shows the pinched cone conformation of the calixarene bowl, featuring hydrogen bonding between the phenylsilyl ether and phenolic oxygen atoms (O...O, 2.838 A). From the reaction of the sterically more crowded tetraphenyldimethyldisilazane, HN(SiMePh2)2, only starting material could be recovered. In contrast, tetramethyldisilazane, HN(SiHMe2)2, afforded the tetrakis-silylated product [p-tert-butylcalix[4]arene(SiHMe2)4] (3) in hexane solution at ambient temperature. A single-crystal X-ray diffraction study of compound 3 established the 1,2-alternate conformation, which is also present in solution, as indicated by 1H NMR spectroscopy. The yttrium complex Y[N(SiHMe2)2]3(THF)2 (4) exchanged all of its silylamide ligands when treated with an equimolar amount of 1 in toluene at ambient temperature to yield compound 5, as indicated by IR and NMR spectroscopy. The molecular structure of 5 revealed a centrosymmetric dimer of composition [Y(p-tert-butylcalix[4]arene(SiHMe2)(THF)]2. Three of the deprotonated phenolic oxygen atoms of the calixarene bowl bind to the metal center, two as terminal ligands and one in a bridging mode, while the fourth undergoes in situ silylation (nu(SiH) 2127 cm-1). The distorted-trigonal-bipyramidal coordination geometry is completed by a THF molecule. Bis-silylated 2 reacted with 4 to form the heteroleptic complex (Y[p-tert-butylcalix[4]arene(SiMe3)2][N(SiHMe2)2]) (6). Crystal data: C50H72O4Si2 (2), triclinic, P1, a = 12.8914(3) A, b = 14.9270(5) A, c = 15.1652(4) A, alpha = 77.293(2) degrees, beta = 65.019(2) degrees, gamma = 72.234(2) degrees, Z = 2; C52H80O4Si4 (3), triclinic, P1, a = 10.1774(2) A, b = 14.1680(2) A, c = 18.7206(2) A, alpha = 95.8195(8) degrees, beta = 95.5294(8) degrees, gamma = 98.1098(7) degrees, Z = 2; C100H132O10Si2Y2, 2(C6H6) (5), triclinic, P1, a = 13.2625(4) A, b = 14.5894(3) A, c = 17.0458(5) A, alpha = 65.0986(14) degrees, beta = 77.8786(8) degrees, gamma = 85.5125(13) degrees, Z = 1.     

Bimetallic cyanide-bridged complexes based on the photochromic nitroprusside anion and paramagnetic metal complexes. Syntheses, structures, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O, [Ni(en)2][Fe(CN)5NO]x3H2O, [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO], and [Mn(5-Brsalen)]2[Fe(CN)5NO

The synthesis, crystal structure, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O (1), [Ni(en)2][Fe(CN)5NO]x3H2O (2), [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO] (3), and [Mn(5-Brsalen)]2[Fe(CN)5NO] (4) are presented. 1 crystallizes in the monoclinic space group P2(1)/n (a = 7.407(4) A, b = 28.963(6) A, c = 14.744(5) A, alpha = 90 degrees, beta = 103.26(4) degrees, gamma = 90 degrees, Z = 2). Its structure consists of branched linear chains formed by cis-[Ni(en)2]2+ cations and ferrocyanide and nitroprusside anions. The presence of two kinds of iron(II) sites has been demonstrated by M?ssbauer spectroscopy. 2 crystallizes in the monoclinic space group P2(1)/c (a = 11.076(3) A, b = 10.983(2) A, c = 17.018(5) A, alpha = 90 degrees, beta = 107.25(2) degrees, gamma = 90 degrees, Z = 4). Its structure consists of zigzag chains formed by an alternated array of cis-[Ni(en)2]2+ cations and nitroprusside anions. 3 crystallizes in the triclinic space group P1 (a = 8.896(5) A, b = 10.430(5) A, c = 12.699(5) A, alpha = 71.110(5) degrees, beta = 79.990(5) degrees, gamma = 89.470(5) degrees, Z = 1). Its structure comprises neutral trinuclear bimetallic complexes in which a central [Fe(CN)5NO]2- anion is linked to two [Mn(3-MeOsalen)]+ cations. 4 crystallizes in the tetragonal space group P4/ncc (a = 13.630(5) A, c = 21.420(8) A, Z = 4). Its structure shows an extended 2D neutral network formed by cyclic octameric [-Mn-NC-Fe-CN-]4 units. The magnetic properties of these compounds indicate the presence of quasi-isolated paramagnetic Ni2+ and Mn3+. Irradiated samples of the four compounds have been studied by differential scanning calorimetry to detect the existence of the long-lived metastable states of nitroprusside.     

Tetrylenes chelated by hybrid amido-amino ligand: derivatives of 2-[(N,N-dimethylamino)methyl]aniline

Reaction of 2-[(dimethylamino)methyl]aniline with butyllithium, followed by conversion with trimethylsilyl, triphenylsilyl, triphenylgermyl, trimethylstannyl, or tri-n-butylstannyl chloride, gives the corresponding substituted aniline. These compounds were further deprotonated by butyllithium and reacted with germanium, tin, and lead dichlorides, respectively, in both stoichiometric ratios 2:1 and 1:1, providing the target homo- ([2-(Me(2)NCH(2))C(6)H(4)(YR(3))N](2)M) and heteroleptic ([2-(Me(2)NCH(2))C(6)H(4)(YR(3))N]MCl) germylenes and stannylenes, where M = Ge, Sn, Y = Si, Ge, and R = Me, Ph. Unlike all of these cases, the heteroleptic plumbylene can only be obtained with this reaction when the amide is substituted by a trimethylsilyl moiety. Anilines substituted by trimethyltin or tri-n-butyltin moieties gave transmetalation products after the second deprotonation by butyllithium. The trimethyltin-substituted stannylenes could likewise not be obtained by hexamethyldisilazane elimination of (trimethylstannyl)-2-[(dimethylamino)methyl]aniline with 0.5 mol equiv of either bis[bis(trimethylsilyl)amido]tin or {bis[bis(trimethylsilyl)amido]tin chloride}. Products of these reactions are heterocubanes with compositions {[2-(Me(2)NCH(2))C(6)H(4)N]Sn}(4) and [2-(Me(2)NCH(2))C(6)H(4)N](2)(μ(2)-SnMe(2))(2), respectively, and Me(4)Sn or Me(3)SnCl. The structures of trimethylsilyl- and triphenylgermyl-substituted germylenes, stannylenes, and plumbylenes, as well as a number of their precursors, in the crystalline state, were investigated by X-ray diffraction and NMR spectroscopy in solution. Density functional theory methods were used for evaluation of the structures of several compounds.     

Polylithiated tetraaminosilanes: synthesis and characterization of (Et2O.Li)4[Si(Nnaph)4] and X-ray structure of (THF.Li3[Si(NiPr)3(NHiPr)])2

The treatment of SiCl4 with 4 equiv of Li2(Nnaph) (naph = 1-naphthyl) in diethyl ether gives (Et2O.Li)4[Si(Nnaph)4] (4), which, upon reaction with excess tBuNH3Cl or MeO3SCF3, generates Si[N(H)naph]4 (5) or Si[N(Me)naph]4 (6), respectively. The centrosymmetric dimer (THF.Li3[Si(NiPr)3(NHiPr)])2 (7), formed via trilithiation of Si[N(H)iPr]4 with n-butyllithium, consists of a bis-THF-solvated Li6(NiPr)6 cyclic ladder bicapped by two SiN(H)iPr units. Crystal data for 7: C32H74Li6N8O2Si2, monoclinic, P2(1)/n, a = 10.661(7) A, b = 16.964(5) A, c = 12.405(4) A, beta = 93.22(4) degrees, V = 2239.9(15) A3, and Z = 2.     

Controlling substitution chemistry in ruthenium(II) systems. Synthesis of heteroleptic complexes incorporating the [Ru([9]aneS3)]2+ metal center

The complex [Ru(py)3([9]aneS3)][PF6]2, 1 (py = pyridine), has proved to be a suitable starting material for the synthesis of heteroleptic Ru(II) complexes. By exploiting unfavorable steric interactions between 2-H and 6-H hydrogens of coordinated pyridyl ligands, we have synthesized half-sandwich complexes incorporating the thiocrown [9]aneS3 and a variety of facially coordinated N-donor ligands. Such complexes are easily prepared: Stirring 1 at room temperature in the presence of a suitable nitrile ligand leads to the exclusive substitution of one py ligand to produce complexes such as [([9]aneS3)Ru(py)2(NCMe)][PF6]2, 2. However, if the same reaction is carried out at higher temperatures, two py ligands are substituted, leading to complexes such as [([9]aneS3)Ru(py)(NCMe)2][PF6]2, 3. An alternative approach to such heteroleptic species has also been developed which exploits the restricted ability of thioethers to neutralize positive charges through sigma-donation. This phenomenon allows the synthesis of heteroleptic complexes in a two-step procedure via monocationic species. By variation of the donor/acceptor properties of ligands incorporated into the [Ru([9]aneS3)]2+ metal center, it is possible to tune the Ru(III)/Ru(II) redox couple over a range of > 700 mV. The solid-state structures of 1-3 were confirmed by X-ray crystallography studies. Crystal data: C22H30F12N4O2P2RuS3 (1.CH3NO2), monoclinic, Cc, a = 23.267(5) A, b = 11.5457(18) A, c = 26.192(5) A, alpha = 90 degrees, beta = 114.836(10) degrees, gamma = 90 degrees, Z = 8; C18H25F12N3P2RuS3 (2), triclinic, P1, a = 11.3958(19) A, b = 11.4280(19) A, c = 11.930(2) A, alpha = 100.518(3) degrees, beta = 100.542(3) degrees, gamma = 112,493(3) degrees, Z = 2; C15H23F12N3P2RuS3 (3), orthorhombic, Pna2(1)), a = 14.748(5) A, b = 18.037(18) A, c = 10.341(5) A, alpha = 90 degrees, beta = 90 degrees, gamma = 90 degrees, Z = 4.     

Synthesis and structures of crystalline Li, Al and Sn(II) 1-azaallyls and beta-diketiminates derived from [Li{mu,eta3-N(SiMe3)C(Ad)C(H)SiMe3}]2 (Ad = 1-adamantyl)

The crystalline dimeric 1-azaallyllithium complex [Li{mu,eta(3-N(SiMe3)C(Ad)C(H)SiMe3}]2 (1) was prepared from equivalent portions of Li[CH(SiMe3)2] and 1-cyanoadamantane (AdCN). Complex was used as precursor to each of the crystalline complexes 2-8 which were obtained in good yield. By 1-azaallyl ligand transfer, 1 afforded (i) [Al{eta3-N(SiMe3)C(Ad)C(H)SiMe3}{kappa1-N(SiMe3)C(Ad)=C(H)SiMe3-E}Me] (5) with [AlCl2Me](2), (ii) [Sn{eta3-N(SiMe3)C(Ad)C(H)SiMe3}2] (7) with Sn[N(SiMe3)2]2, and (iii) [Li(N{C(Ad)=C(H)SiMe3-E}{Si(NN)SiMe3})(thf)2] (8) with the silylene Si[(NCH(2)Bu(t))2C6H(4)-1,2] [= Si(NN)]. By insertion into the C[triple bond, length as m-dash]N bond of the appropriate cyanoarene RCN, gave the beta-diketiminate [Li{mu-N(SiMe3)C(Ad)C(H)C(R)NSiMe3}]2 [R = Ph (2), C(6)H(4)Me-4 (3)], and yielded [Al{kappa2-N(SiMe3)C(Ad)C(H)C(Ph)NSiMe3}{kappa1-N(SiMe3)C(Ad)=C(H)SiMe3-E}Me] (6). The beta-diketiminate [Al{kappa2-N(SiMe3)C(Ad)C(H)C(Ph)NSiMe3}Me2] (4) was prepared from 2 and [AlClMe2]2. The X-ray structures of 1 and 3-8 are presented. Multinuclear NMR spectra in C6D6 or C6D5CD3 have been recorded for each of 1-8; such data on 8 revealed that in solution two minor isomers were also present.