Cation-cation interactions in Sr5(UO2)20(UO6)2O16(OH)6(H2O)6 and Cs(UO2)9U3O16(OH)5

Two novel U6+ compounds, Sr5(UO2)20(UO6)2O16(OH)6(H2O)6 (SrFm) and Cs(UO2)9U3O16(OH)5 (CsFm), have been synthesized by mild hydrothermal reactions. The structures of SrFm (orthorhombic, C2221, a = 11.668(1), b = 21.065 (3), c = 13.273 A, V = 3532.5(1) A3, Z = 2) and CsFm (trigonal, R3c, a = 11.395(2), c = 43.722(7) A, V = 4916.7(1) A3, Z = 6) are rare examples of uranyl compounds that contain cation-cation interactions where an O atom of one uranyl ion is directly linked to another uranyl ion. Both structures are complex frameworks. SrFm contains sheets of polyhedra that are linked through cation-cation interactions with uranyl ions located between the sheets. CsFm possesses an unusually complex framework of vertex- and edge-sharing U6+ polyhedra that incorporates cation-cation interactions.     

Synthesis and structure of Ag(6)[(UO(2))(3)O(MoO(4))(5)]: a novel sheet of triuranyl clusters and MoO(4) tetrahedra

The new uranyl molybdate Ag(6)[(UO(2))(3)O(MoO(4))(5)] (1) with an unprecedented uranyl molybdate sheet has been synthesized at 650 degrees C. The structure (monoclinic, C2/c, a = 16.4508(14) A, b = 11.3236(14) A, c = 12.4718(13) A, beta = 100.014(4)(o), V = 2337.4(4) A(3), Z = 4) contains [(UO(2))(3)O(MoO(4))(5)] sheets composed of triuranyl [(UO(2))(3)O] clusters that are connected by MoO(4) tetrahedra. The topology of the uranyl molybdate sheet in 1 represents a major departure from sheets observed in other uranyl compounds. Of the approximately 120 known inorganic uranyl compounds containing sheets of polyhedra, 1 is the only structure that contains trimers of uranyl pentagonal bipyramids that are connected only by the sharing of vertexes with other polyhedra. The sheets are parallel to (001) and are linked by Ag cations.     

Occurence of an octanuclear motif of uranyl isophthalate with cation-cation interactions through edge-sharing connection mode

An uranyl isophthalate has been hydrothermally synthesized at 200 °C for 24 h, from a mixture of uranyl nitrate, isophthalic acid, and hydrazine in water. It was characterized by single-crystal analysis [triclinic, P ?1, a = 7.3934(3) ?, b = 13.3296(5) ?, c = 15.4432(5) ?, α = 111.865(2)°, β = 90.637(2)°, γ = 104.867(2)°, V = 1355.49(9) ?(3)] and different spectroscopic techniques (Raman, IR-ATR, UV-visible). The 3D structure of the phase (UO(2))(8)O(2)(OH)(4)(H(2)O)(4)(1,3-bdc)(4)·4H(2)O (1,3-bdc = 1,3-benzenedicarboxylate) reveals octanuclear units based on the association of 7-fold coordinated uranyl cations (pentagonal bipyramid) involving a rare case of cation-cation interaction together with edge-sharing polyhedral connection mode. UV-visible absorption spectroscopy confirmed that uranium was only involved in the structure as uranyl forms (excluding the presence of tetravalent or pentavalent uranium). Additionally, μ-Raman and IR-ATR experiments allowed assigning four uranyl contributions to the four types of uranyl entities in the structure, in agreement with the XRD analysis.     

Aqueous reactions of U(VI) at high chloride concentrations: syntheses and structures of new uranyl chloride polymers

The reactions of UO(3) with acidic aqueous chloride solutions resulted in the formation of two new polymeric U(VI) compounds. Single crystals of Cs(2)[(UO(2))(3)Cl(2)(IO(3))(OH)O(2)].2H(2)O (1) were formed under hydrothermal conditions with HIO(3) and CsCl, and Li(H(2)O)(2)[(UO(2))(2)Cl(3)(O)(H(2)O)] (2) was obtained from acidic LiCl solutions under ambient temperature and pressure. Both compounds contain pentagonal bipyramidal coordination of the uranyl dication, UO(2)(2+). The structure of 1 consists of infinite [(UO(2))(3)Cl(2)(IO(3))(mu(3)-OH)(mu(3)-O)(2)](2-) ribbons that run down the b axis that are formed from edge-sharing pentagonal bipyramidal [UO(6)Cl] and [UO(5)Cl(2)] units. The Cs(+) cations separate the chains from one another and form long ionic contacts with terminal oxygen atoms from iodate ligands, uranyl oxygen atoms, water molecules, and chloride anions. In 2, edge-sharing [UO(3)Cl(4)] and [UO(5)Cl(2)] units build up tetranuclear [(UO(2))(4)(mu-Cl)(6)(mu(3)-O)(2)(H(2)O)(2)](2-) anions that are bridged by chloride to form one-dimensional chains. These chains are connected in a complex network of hydrogen bonds and interactions of uranyl oxygen atoms with Li(+) cations. Crystal data: 1, orthorhombic, space group Pnma, a = 8.2762(4) A, b = 12.4809(6) A, c = 17.1297(8) A, Z = 4; 2, triclinic, space group P1, a = 8.110(1) A, b = 8.621(1) A, c = 8.740(1) A, Z = 2.     

Mixed-metal uranium(VI) iodates: hydrothermal syntheses,structures, and reactivity of Rb[UO(2)(CrO(4))(IO(3))(H(2)O)], A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K,Rb, Cs), and K(2)[UO(2)(MoO(4))(IO(3))(2)

The reactions of the molecular transition metal iodates A[CrO(3)(IO(3))] (A = K, Rb, Cs) with UO(3) under mild hydrothermal conditions provide access to four new, one-dimensional, uranyl chromatoiodates, Rb[UO(2)(CrO(4))(IO(3))(H(2)O)] (1) and A(2)[UO(2)(CrO(4))(IO(3))(2)] (A = K (2), Rb (3), Cs (4)). Under basic conditions, MoO(3), UO(3), and KIO(4) can be reacted to form K(2)[UO(2)(MoO(4))(IO(3))(2)] (5), which is isostructural with 2 and 3. The structure of 1 consists of one-dimensional[UO(2)(CrO(4))(IO(3))(H(2)O)](-) ribbons that contain uranyl moieties bound by bridging chromate and iodate anions as well as a terminal water molecule to create [UO(7)] pentagonal bipyramidal environments around the U(VI) centers. These ribbons are separated from one another by Rb(+) cations. When the iodate content is increased in the hydrothermal reactions, the terminal water molecule is replaced by a monodentate iodate anion to yield 2-4. These ribbons can be further modified by replacing tetrahedral chromate anions with MoO(4)(2)(-) anions to yield isostructural, one-dimensional [UO(2)(MoO(4))(IO(3))(2)](2)(-) ribbons. Crystallographic data: 1, triclinic, space group P(-)1, a = 7.3133(5) A, b = 8.0561(6) A, c = 8.4870(6) A, alpha = 88.740(1) degrees, beta = 87.075(1) degrees, gamma = 71.672(1) degrees, Z = 2; 2, monoclinic, space group P2(1)/c, a = 11.1337(5) A, b = 7.2884(4) A, c = 15.5661(7) A, beta = 107.977(1) degrees, Z = 4; 3, monoclinic, space group P2(1)/c, a = 11.3463(6) A, b = 7.3263(4) A, c = 15.9332(8) A, beta = 108.173(1) degrees, Z = 4; 4, monoclinic, space group P2(1)/n, a = 7.3929(5) A, b = 8.1346(6) A, c = 22.126(2) A, beta = 90.647(1) degrees, Z = 4; 5, monoclinic, space group P2(1)/c, a = 11.3717(6) A, b = 7.2903(4) A, c = 15.7122(8) A, beta = 108.167(1) degrees, Z = 4.     

Hydrothermal syntheses, structures, and properties of the new uranyl selenites Ag(2)(UO(2))(SeO(3))(2), M[(UO(2))(HSeO(3))(SeO(3))] (M = K, Rb, Cs, Tl), and Pb(UO(2))(SeO(3))(2)

The transition metal, alkali metal, and main group uranyl selenites, Ag(2)(UO(2))(SeO(3))(2) (1), K[(UO(2))(HSeO(3))(SeO(3))] (2), Rb[(UO(2))(HSeO(3))(SeO(3))] (3), Cs[(UO(2))(HSeO(3))(SeO(3))] (4), Tl[(UO(2))(HSeO(3))(SeO(3))] (5), and Pb(UO(2))(SeO(3))(2) (6), have been prepared from the hydrothermal reactions of AgNO(3), KCl, RbCl, CsCl, TlCl, or Pb(NO(3))(2) with UO(3) and SeO(2) at 180 degrees C for 3 d. The structures of 1-5 contain similar [(UO(2))(SeO(3))(2)](2-) sheets constructed from pentagonal bipyramidal UO(7) units that are joined by bridging SeO(3)(2-) anions. In 1, the selenite oxo ligands that are not utilized within the layers coordinate the Ag(+) cations to create a three-dimensional network structure. In 2-5, half of the selenite ligands are monoprotonated to yield a layer composition of [(UO(2))(HSeO(3))(SeO(3))](1-), and coordination of the K(+), Rb(+), Cs(+), and Tl(+) cations occurs through long ionic contacts. The structure of 6 contains a uranyl selenite layered substructure that differs substantially from those in 1-5 because the selenite anions adopt both bridging and chelating binding modes to the uranyl centers. Furthermore, the Pb(2+) cations form strong covalent bonds with these anions creating a three-dimensional framework. These cations occur as distorted square pyramidal PbO(5) units with stereochemically active lone pairs of electrons. These polyhedra align along the c-axis to create a polar structure. Second-harmonic generation (SHG) measurements revealed a response of 5x alpha-quartz for 6. The diffuse reflectance spectrum of 6 shows optical transitions at 330 and 440 nm. The trailing off of the 440 nm transition to longer wavelengths is responsible for the orange coloration of 6.     

Synthesis and characterization of uranyl compounds with iminodiacetate and oxydiacetate displaying variable denticity

Eight uranyl compounds containing the dicarboxylate ligands iminodiacetate (IDA) or oxydiacetate (ODA) have been characterized in the solid state. The published polymeric structures for [UO(2)(C(4)H(6)NO(4))(2)] and [UO(2)(C(4)H(4)O(5))](n) have been confirmed, while Ba[UO(2)(C(4)H(5)NO(4))(2)] x 3H(2)O, [(CH(3))(2)NH(CH(2))(2)NH(CH(3))(2)][UO(2)(C(4)H(4)O(5))(2)] [orthorhombic space group Pnma, a = 10.996(5) A, b = 21.42(1) A, c = 8.700(3) A, Z = 4], and [C(2)H(5)NH(2)(CH(2))(2)NH(2)C(2)H(5)][UO(2)(C(4)H(4)O(5))(2)] [monoclinic space group P2(1)/n, a = 6.857(3) A, b = 9.209(5) A, c = 16.410(7) A, beta = 91.69(3), Z = 2] contain monomeric anions. The distance from the uranium atom to the central heteroatom (O or N) in the ligand varies. Crystallographic study shows that U-heteroatom (O/N) distances fall into two groups, one 2.6-2.7 A in length and one 3.1-3.2 A, the latter implying no bonding interaction. By contrast, EXAFS analysis of bulk samples suggests that either a long U-heteroatom (O/N) distance (2.9 A) or a range of distances may be present. Three possible structural types, two symmetric and one asymmetric, are identified on the basis of these results and on solid-state (13)C NMR spectroscopy. The two ligands in the complex can be 1,4,7-tridentate, giving five-membered rings, or 1,7-bidentate, to form an eight-membered ring. (C(4)H(12)N(2))[(UO(2))(2)(C(4)H(5)NO(4))(2)(OH)(2)] x 8H(2)O [monoclinic space group P2(1)/a, a = 7.955(9) A, b = 24.050(8) A, c = 8.223(6) A, beta = 112.24(6), Z = 2], (C(2)H(10)N(2))[(UO(2))(2)(C(4)H(5)NO(4))(2)(OH)(2)] x 4H(2)O, and (C(6)H(13)N(4))(2)[(UO(2))(2)(C(4)H(4)O(5))(2)(OH)(2)] x 2H(2)O [monoclinic space group C2/m, a = 19.024(9) A, b = 7.462(4) A, c = 2.467(6) A, beta = 107.75(4), Z = 4] have a dimeric structure with two capping tridentate ligands and two mu(2)-hydroxo bridges, giving edge-sharing pentagonal bipyramids.     

Synthesis and characterization of heavier dioxouranium(VI) dihalides

The synthesis and characterization of the dioxouranium(VI) dibromide and iodide hydrates, UO(2)Br(2)x3H(2)O (1), [UO(2)Br(2)(OH(2))(2)](2) (2), and UO(2)I(2)x2H(2)Ox4Et(2)O (3), are reported. Moreover, adducts of UO(2)I(2) and UO(2)Br(2) with large, bulky OP(NMe(2))(3) and OPPh(3) ligands such as UO(2)I(2)(OP(NMe(2))(3))(2) (4), UO(2)Br(2)(OP(NMe(2))(3))(2) (5), and UO(2)I(2)(OPPh(3))(2)(6) are discussed. The structures of the following compounds were determined using single-crystal X-ray diffraction techniques: (1) monoclinic, P2(1)/c, a = 9.7376(8) A, b = 6.5471(5) A, c = 12.817(1) A, beta = 94.104(1) degrees , V = 815.0(1) A(3), Z = 4; (2) monoclinic, P2(1)/c, a = 6.0568(7) A, b = 10.5117(9) A, c = 10.362(1) A, beta = 99.62(1) degrees , V = 650.5(1) A(3), Z = 2; (4) tetragonal, P4(1)2(1)2, a = 10.6519(3) A, b = 10.6519(3) A, c = 24.0758(6) A, V = 2731.7(1) A(3), Z = 4; (5) tetragonal, P4(1)2(1)2, a = 10.4645(1) A, b = 10.4645(1) A, c = 23.7805(3) A, V = 2604.10(5) A(3), Z = 4, and (6) monoclinic, P2(1)/c, a = 9.6543(1) A, b = 18.8968(3) A, c = 10.9042(2) A, beta =115.2134(5) degrees , V = 1783.01(5) A(3), Z = 2. Whereas 1 and 2 are the first UO(2)Br(2) hydrates and the last missing members of the UO(2)X(2) hydrate (X = Cl --> I) series to be structurally characterized, 4 and 6 contain room-temperature stable U(VI)-I bonds with 4 being the first structurally characterized room temperature stable U(VI)-I compound which can be conveniently prepared on a gram scale in quantitative yield. The synthesis and characterization of 5 using an analogous halogen exchange reaction to that used for the preparation of 4 is also reported.     

One-dimensional array of two- and three-center cation-cation bonds in the structure of Li4[(UO2)10O10(Mo2O8)

Dark-red crystals of the new compound Li(4)[(UO(2))(10)O10(Mo(2)O(8))] (1) have been obtained by high-temperature solid-state reactions. The structure of 1 (monoclinic, P2(1)/c, a = 7.9426(4) A, b = 19.9895(9) A, c = 10.0796(5) A, beta = 90.575(2) degrees, V = 1600.24(13) A(3), Z = 4) consists of a framework of U and Mo polyhedra with Li+ cations in the channels. The framework contains seven-polyhedra-wide uranium oxide tapes interlinked by dimers of edge-sharing [4 + 1]-distorted MoO(5) polyhedra. The U-O tapes are parallel to the a axis, and their planes are oriented parallel to (021) and (02) so that they are cross-linked within the framework. The core of the tapes consists of unprecedented one-dimensional arrays of cation-cation-bonded uranyl ions. The arrays are constructed from eight-membered cycles with uranyl ions linked through two- and three-center cation-cation interactions.     

Excision of uranium oxide chains and ribbons in the novel one-dimensional uranyl iodates K(2)[(UO(2))3(IO(3))(4)O(2)] and Ba[(UO(2)2(IO(3))(2)O(2)](H(2)O)

The alkali metal and alkaline-earth metal uranyl iodates K(2)[(UO(2))(3)(IO(3))(4)O(2)] and Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) have been prepared from the hydrothermal reactions of KCl or BaCl(2) with UO(3) and I(2)O(5) at 425 and 180 degrees C, respectively. While K(2)[(UO(2))(3)(IO(3))(4)O(2)] can be synthesized under both mild and supercritical conditions, the yield increases from <5% to 73% as the temperature is raised from 180 to 425 degrees C. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), however, has only been isolated from reactions performed in the mild temperature regime. Thermal measurements (DSC) indicate that K(2)[(UO(2))(3)(IO(3))(4)O(2)] is more stable than Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) and that both compounds decompose through thermal disproportionation at 579 and 575 degrees C, respectively. The difference in the thermal behavior of these compounds provides a basis for the divergence of their preparation temperatures. The structure of K(2)[(UO(2))(3)(IO(3))(4)O(2)] is composed of [(UO(2))(3)(IO(3))(4)O(2)](2)(-) chains built from the edge-sharing UO(7) pentagonal bipyramids and UO(6) octahedra. Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O) consists of one-dimensional [(UO(2))(2)(IO(3))(2)O(2)](2)(-) ribbons formed from the edge sharing of distorted UO(7) pentagonal bipyramids. In both compounds the iodate groups occur in both bridging and monodentate binding modes and further serve to terminate the edges of the uranium oxide chains. The K(+) or Ba(2+) cations separate the chains or ribbons in these compounds forming bonds with terminal oxygen atoms from the iodate ligands. Crystallographic data: K(2)[(UO(2))(3)(IO(3))(4)O(2)], triclinic, space group P_1, a = 7.0372(5) A, b = 7.7727(5) A, c = 8.9851(6) A, alpha = 93.386(1) degrees, beta = 105.668(1) degrees, gamma = 91.339(1) degrees, Z = 1; Ba[(UO(2))(2)(IO(3))(2)O(2)](H(2)O), monoclinic, space group P2(1)/c, a = 8.062(4) A, b = 6.940(3) A, c = 21.67(1), beta= 98.05(1) degrees, Z = 4.     

Ions generated from uranyl nitrate solutions by electrospray ionization (ESI) and detected with fourier transform ion-cyclotron resonance (FT-ICR) mass spectrometry

Electrospray ionization (ESI) of uranyl nitrate solutions generates a wide variety of positively and negatively charged ions, including complex adducts of uranyl ions with methoxy, hydroxy, and nitrate ligands. In the positive ion mode, ions detected by Fourier transform ion cyclotron resonance (FT-ICR) mass spectrometry are sensitive to instrumental tuning parameters such as quadrupole operating frequency and trapping time. Positive ions correspond to oligomeric uranyl nitrate species that can be characterized as having a general formula of [(UO(2))(n)(A)(m)(CH(3)OH)(s)](+) or [(UO(2))(n)(O)(A)(m)(CH(3)OH)(s)](+) with n = 1-4, m = 1-7, s = 0 or 1, and A = OH, NO(3), CH(3)O or a combination of these, although the formation of NO(3)-containing species is preferred. In the negative ion mode, complexes of the form [(UO(2))(NO(3))(m)](-) (m = 1-3) are detected, although the formation of the oxo-containing ions [(UO(2))(O)(n)(NO(3))(m)](-) (n = 1-2, m = 1-2) and the hydroxy-containing ions [(UO(2))(OH)(n)(NO(3))(m)](-) (n = 1-2, m = 0-1) are also observed. The extent of coordinative unsaturation of both positive and negative ions can be determined by ligand association/exchange and H/D exchange experiments using D(2)O and CD(3)OD as neutral reaction partners in the gas-phase. Positive ions are of varying stability and reactivity and may fragment extensively upon collision with D(2)O, CD(3)OD and N(2) in sustained off-resonance irradiation/collision-induced dissociation (SORI-CID) experiments. Electron-transfer reactions, presumably occurring during electrospray ionization but also in SORI-CID, can result in reduction of U(VI) to U(V) and perhaps even U(IV).     

Topological evolution in uranyl dicarboxylates: synthesis and structures of one-dimensional UO2(C6H8O4)(H2O)2 and three-dimensional UO2(C6H8O4)

Two novel uranyl adipates are reported as synthesized via hydrothermal treatment of uranium oxynitrate and adipic acid. One-dimensional UO(2)(C(6)H(8)O(4))(H(2)O)(2) (1) [a = 9.6306(6) A, c = 11.8125(10) A, tetragonal, P4(3)2(1)2 (No. 96), Z = 4] consists of chains of (UO(2))O(4)(H(2)O)(2) hexagonal bipyramids tethered through a linear adipic acid backbone. Three-dimensional UO(2)(C(6)H(8)O(4)) (2) [a = 5.5835(12) A, b = 8.791(2) A, c = 9.2976(17) A, alpha = 87.769(9) degrees, beta = 78.957(8) degrees, gamma = 81.365(11) degrees, triclinic, P1 (No. 2), Z = 2] is produced by decreasing the hydration level of the reaction conditions. This structure contains a previously unreported [(UO(2))(2)O(8)] building unit cross-linked into a neutral metal-organic framework topology with vacant channels.     

A novel open framework uranyl molybdate: synthesis and structure of (NH4)4[(UO2)5(MoO4)7](H2O)5

Single crystals of (NH(4))(4)[(UO(2))(5)(MoO(4))(7)](H(2)O)(5) have been synthesized hydrothermally using (NH(4))(6)Mo(7)O(24), (UO(2))(CH(3)COO)(2).2H(2)O, and H(2)O at 180 degrees C. The phase has been characterized by single-crystal X-ray diffraction using a merohedrally twinned single crystal: it is hexagonal, P6(1), a = 11.4067(5) A, c = 70.659(5) A, V = 7961.9(7) A(3), and Z = 6. The structure is based upon an open framework with composition [(UO(2))(5)(MoO(4))(7)](4-) that is composed of UO(7) pentagonal bipyramids that share vertexes with MoO(4) tetrahedra. The framework has large channels (effective pore size: 4.8 x 4.8 A(2)) parallel to the c axis and a system of smaller channels (effective pore size: 2.5 x 3.6 A(2)) parallel to [100], [110], [010], [110], [110], and [110]. The channels are occupied by NH(4)(+) cations and H(2)O molecules. The topological structure of the uranyl molybdate framework can be described either in terms of fundamental chains of UO(7) pentagonal bipyramids and MoO(4) tetrahedra or in terms of tubular building units parallel to the c axis.     

Do secondary and tertiary ammonium cations act as structure-directing agents in the formation of layered uranyl selenites?

Two new layered uranyl selenites, [C(4)H(12)N(2)](0.5)[UO(2)(HSeO(3))(SeO(3))] (1) and [C(6)H(14)N(2)](0.5)[UO(2)(HSeO(3))(SeO(3))].0.5H(2)O.0.5CH(3)CO(2)H (2), have been isolated from mild hydrothermal reactions. The preparation of 1 was achieved by reacting UO(2)(C(2)H(3)O(2))(2).2H(2)O with H(2)SeO(4) in the presence of piperazine at 130 degrees C for 2 d. Crystals of 2 were synthesized by reacting UO(2)(C(2)H(3)O(2))(2).2H(2)O, H(2)SeO(4), and 1,4-diazabicyclo[2.2.2]octane at 150 degrees C for 2 d. The structure of 1 consists of UO(2)(2+) cations that are bound by bridging HSeO(3)(-) anions and chelating/bridging SeO(3)(2)(-) anions to yield UO(7) pentagonal bipyramids. The joining of the uranyl moieties by the hydrogen selenite and selenite anions creates two-dimensional 2(infinity) [UO(2)(HSeO(3))(SeO(3))](-) layers that extend in the bc-plane. The stereochemically active lone pair of electrons on the HSeO(3)(-) and SeO(3)(2)(-) anions align along the a-axis making each layer polar. The 2(infinity)[UO(2)(HSeO(3))(SeO(3))](-) layers and piperazinium cations stack in a AA'BAA'B sequence where two layers stack on one another without intervening piperazinium cations. While each 2(infinity)[UO(2)(HSeO(3))(SeO(3))](-) layer is polar, in the AA' stacking, the polarity of the second sheet is reversed with respect to the first, yielding an overall structure that is centrosymmetric. The structure of 2 is constructed from uranyl cations that are bound by three bridging SeO(3)(2)(-) and two bridging HSeO(3)(-) anions to create UO(7) pentagonal bipyramids. The linking of the uranyl cations by the HSeO(3)(-) and SeO(3)(2-) anions creates 2(infinity)[UO(2)(HSeO(3))(SeO(3))](-) layers that extend in the ac-plane. In 1 and 2, the organic ammonium cations form hydrogen bonds with the anionic uranyl selenite layers. Crystallographic data: 1, monoclinic, space group P2(1)/c, a = 10.9378(5) A, b = 8.6903(4) A, c = 9.9913(5) A, beta = 90.3040(8) degrees, Z = 4; 2, orthorhombic, space group Pnma, a = 13.0858(8) A, b = 17.555(1) A, c = 10.5984(7) A, Z = 8.     

Boronic acid flux synthesis and crystal growth of uranium and neptunium boronates and borates: a low-temperature route to the first neptunium(V) borate

Molten methylboronic acid has been used as a reactive flux to prepare the first neptunium(V) borate, NpO(2)[B(3)O(4)(OH)(2)] (NpBO-1), and the first actinide boronate, UO(2)(CH(3)BO(2))(H(2)O) (UCBO-1). NpBO-1 contains cation-cation interactions between the neptunyl units. In contrast, the presence of the methyl groups in the uranyl boronate leads to a one-dimensional structure.     

Cation-cation interactions between uranyl cations in a polar open-framework uranyl periodate

Novel open-framework alkali metal uranyl periodates, having the formula A[(UO2)3(HIO6)(OH)(O)(H2O)].1.5H2O (A = Li, Na, K, Rb, Cs), have been prepared through mild hydrothermal synthesis. These isostructural compounds contain distorted UO7 pentagonal bipyramids that are linked through a uranyl (UO22+) to uranyl cation-cation interaction. This interaction arises from a single axial uranyl oxygen coordinating at an equatorial site of an adjacent uranyl unit. These uranium oxide polyhedra are further bound by IO6 distorted octahedra creating an open-framework structure whose channels contain the alkali metal cations.     

Structural units in three uranyl perrhenates

Three uranyl perrhenates have been synthesized, and their structures have been determined. (UO2)2(ReO4)4(H2O)3 (1) is triclinic, space group P, a=5.2771(7), b=13.100(2), c=15.476(2) A, alpha=107.180(2), beta=99.131(3), gamma=94.114(2) degrees, V=1001.12 A3, Z=2. [(UO2)4(ReO4)2O(OH)4(H2O)7](H2O)5 (2) is also triclinic, space group P, a=7.884(1), b=11.443(2), c=16.976(2) A, alpha=83.195(4), beta=89.387(4), gamma=85.289(4) degrees, V=1515.70 A3, Z=2. Na(UO2)(ReO4)3(H2O)2 (3) is monoclinic, space group C2/m, a=12.311(3), b=22.651(6), c=5.490(1) A, beta=109.366(6) degrees, V=1444.24 A3, Z=4. These compounds are the first structurally characterized uranyl perrhenates that do not contain organic ligands. In each structure, perrhenate groups coordinate uranyl ions at the equatorial vertices of pentagonal bipyramids. 1 contains complex chains of uranyl pentagonal bipyramids that are bridged by vertex sharing with perrhenate groups. The structural units in 2 and 3 consist of three novel finite clusters that include the coordination of uranyl ions with perrhenate. In general, weakly coordinating ligands such as perchlorate, perrhenate, and pertechnetate are assumed not to form stable complexes with uranyl in solutions or solids. The current findings, together with other recently reported studies, indicate each of these ligands can coordinate uranyl, and novel structure types result.     

Expanding the remarkable structural diversity of uranyl tellurites: hydrothermal preparation and structures of K[UO(2)Te(2)O(5)(OH)], Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O,beta-Tl(2)[UO(2)(TeO(3))(2)], and Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2)

The reactions of UO(2)(C(2)H(3)O(2))(2).2H(2)O with K(2)TeO(3).H(2)O, Na(2)TeO(3) and TlCl, or Na(2)TeO(3) and Sr(OH)(2).8H(2)O under mild hydrothermal conditions yield K[UO(2)Te(2)O(5)(OH)] (1), Tl(3)[(UO(2))(2)[Te(2)O(5)(OH)](Te(2)O(6))].2H(2)O (2) and beta-Tl(2)[UO(2)(TeO(3))(2)] (3), or Sr(3)[UO(2)(TeO(3))(2)](TeO(3))(2) (4), respectively. The structure of 1 consists of tetragonal bipyramidal U(VI) centers that are bound by terminal oxo groups and tellurite anions. These UO(6) units span between one-dimensional chains of corner-sharing, square pyramidal TeO(4) polyhedra to create two-dimensional layers. Alternating corner-shared oxygen atoms in the tellurium oxide chains are protonated to create short/long bonding patterns. The one-dimensional chains of corner-sharing TeO(4) units found in 1 are also present in 2. However, in 2 there are two distinct chains present, one where alternating corner-shared oxygen atoms are protonated, and one where the chains are unprotonated. The uranyl moieties in 2 are bound by five oxygen atoms from the tellurite chains to create seven-coordinate pentagonal bipyramidal U(VI). The structures of 3 and 4 both contain one-dimensional [UO(2)(TeO(3))(2)](2-) chains constructed from tetragonal bipyramidal U(VI) centers that are bridged by tellurite anions. The chains differ between 3 and 4 in that all of the pyramidal tellurite anions in 3 have the same orientation, whereas the tellurite anions in 4 have opposite orientations on each side of the chain. In 4, there are also additional isolated TeO(3)(2-) anions present. Crystallographic data: 1, orthorhombic, space group Cmcm, a = 7.9993(5) A, b = 8.7416(6) A, c = 11.4413(8) A, Z = 4; 2, orthorhombic, space group Pbam, a = 10.0623(8) A, b = 23.024(2) A, c = 7.9389(6) A, Z = 4; 3, monoclinic, space group P2(1)/n, a = 5.4766(4) A, b = 8.2348(6) A, c = 20.849(3) A, beta = 92.329(1) degrees, Z = 4; 4, monoclinic, space group C2/c, a = 20.546(1) A, b = 5.6571(3) A, c = 13.0979(8) A, beta = 94.416(1) degrees, Z = 4.     

Expanding the crystal chemistry of actinyl peroxides: open sheets of uranyl polyhedra in Na5[(UO2)3(O2)4(OH)3](H2O)13

A uranyl peroxide, Na5[(UO2)3(O2)4(OH)3](H2O)13, with an open sheet of uranyl polyhedra has been synthesized under ambient conditions and structurally characterized. The structure (orthorombic, Cmca, a = 23.632(1) A, b = 15.886(1) A, c = 13.952(1) A, V = 5237.7 A(3), and Z = 8) consists of sheets composed of two symmetrically unique uranyl (UO2)2+ ions that are coordinated equatorially by two peroxide groups and two OH(-) groups, forming distorted uranyl hexagonal bipyramids of composition (UO2)(O2)2(OH)2(4-). The uranyl bipyramids are connected into sheets with openings with dimensions 13.7 A along [010] and 15.9 A along [100]. The shortest dimension of the cavity is 8.08 A. Sheets of two-dimensionally polymerized uranyl polyhedra are the most common structural type of inorganic uranyl phases; however, such an open topology has never been observed.     

Cation-cation complexes of pentavalent uranyl: from disproportionation intermediates to stable clusters

Three new cation-cation complexes of pentavalent uranyl, stable with respect to the disproportionation reaction, have been prepared from the reaction of the precursor [(UO(2)py(5))(KI(2)py(2))](n) (1) with the Schiff base ligands salen(2-), acacen(2-), and salophen(2-) (H(2)salen = N,N'-ethylene-bis(salicylideneimine), H(2)acacen = N,N'-ethylenebis(acetylacetoneimine), H(2)salophen = N,N'-phenylene-bis(salicylideneimine)). The preparation of stable complexes requires a careful choice of counter ions and reaction conditions. Notably the reaction of 1 with salophen(2-) in pyridine leads to immediate disproportionation, but in the presence of [18]crown-6 ([18]C-6) a stable complex forms. The solid-state structure of the four tetranuclear complexes, {[UO(2)(acacen)](4)[μ(8)-](2)[K([18]C-6)(py)](2)} (3) and {[UO(2)(acacen)](4)[μ(8)-]}?2?[K([222])(py)] (4), {[UO(2)(salophen)](4)[μ(8)-K](2)[μ(5)-KI](2)[(K([18]C-6)]}?2?[K([18]C-6)(thf)(2)]?2?I (5), and {[UO(2)(salen)(4)][μ(8)-Rb](2)[Rb([18]C-6)](2)} (9) ([222] = [222]cryptand, py = pyridine), presenting a T-shaped cation-cation interaction has been determined by X-ray crystallographic studies. NMR spectroscopic and UV/Vis studies show that the tetranuclear structure is maintained in pyridine solution for the salen and acacen complexes. Stable mononuclear complexes of pentavalent uranyl are also obtained by reduction of the hexavalent uranyl Schiff base complexes with cobaltocene in pyridine in the absence of coordinating cations. The reactivity of the complex [U(V)O(2)(salen)(py)][Cp*(2)Co] with different alkali ions demonstrates the crucial effect of coordinating cations on the stability of cation-cation complexes. The nature of the cation plays a key role in the preparation of stable cation-cation complexes. Stable tetranuclear complexes form in the presence of K(+) and Rb(+), whereas Li(+) leads to disproportionation. A new uranyl-oxo cluster was isolated from this reaction. The reaction of [U(V)O(2)(salen)(py)][Cp*(2)Co] (Cp* = pentamethylcyclopentadienyl) with its U(VI) analogue yields the oxo-functionalized dimer [UO(2)(salen)(py)](2)[Cp*(2)Co] (8). The reaction of the {[UO(2)(salen)(4)][μ(8)-K](2)[K([18]C-6)](2)} tetramer with protons leads to disproportionation to U(IV) and U(VI) species and H(2)O confirming the crucial role of the proton in the U(V) disproportionation.