Synthesis and characterization of four metal-organophosphonates with one-, two-, and three-dimensional structures

A series of metal-organic hybrid compounds were synthesized using two new phosphonic acids, pyridyl-4-phosphonic acid and p-xylylenediphosphonic acid (H(2)O(3)PCH(2)C(6)H(4)CH(2)PO(3)H(2)). The phosphonic acid ligands have been synthesized from their corresponding bromides following two different types of reactions. The reaction of pyridyl-4-phosphonic acid with three different divalent metal salts results in the formation of molecular structures of different dimensionality. The reaction of Cu(II) with the phosphonic acid under hydrothermal conditions yields a three-dimensional (3D) open framework structure having the molecular formula [Cu(4)(NC(5)H(4)-PO(3))(4)(H(2)O)(10)] (1). The reactions with Mn(II) and Zn(II) salts with the same phosphonic acid resulted in a two-dimensional layered and a dinuclear compound with molecular formulas [Mn(3)(NC(5)H(4)-PO(3))(4)(H(2)O)(6)(ClO(4))(2)] (2) and [Zn(2)(NHC(5)H(4)-PO(3)H)(2)Cl(4)] (3), respectively. Compound 1 crystallizes in the triclinic crystal system having space group P with structural parameters a = 7.4564(15) Angstrom, b = 9.1845(19) Angstrom, c = 11.582(2) Angstrom, alpha = 100.842(3) degrees, beta = 104.303(3) degrees, gamma = 94.774(3) degrees, and Z = 1. Compound 2 crystallizes in the triclinic crystal system, space group P, with structural parameters a = 7.6871(14) Angstrom, b = 10.576(2) Angstrom, c = 14.470(3)Angstrom, alpha = 81.340(3) degrees, beta = 81.561(3) degrees, gamma = 68.757(3) degrees, and Z = 2, whereas compound 3 crystallizes in a monoclinic crystal system with space group P2(1)/n. The structural parameters are as follows: a = 8.4969 (5) Angstrom, b = 9.3911 (5) Angstrom, c = 12.3779 (6) Angstrom, beta = 90.860(17) degrees, and Z = 4. The pyridylphosphonate ligand shows different ligation behavior toward the three divalent metal ions. On the other hand, p-xylylenediphosphonic acid on reaction with Co(II) formed a 3D compound [Co(2)(O(3)PCH(2)C(6)H(4)CH(2)PO(3))(2)(H(2)O)(2)] (4) with a layered and pillared structure. Compound 4 crystallizes in an orthorhombic crystal system with space group Pnma. The structural parameters are a = 21.744(4) Angstrom, b = 5.6744(10) Angstrom, c = 4.7927(9) Angstrom, and Z = 4.     

Synthesis and characterization of diverse coordination polymers. Linear and zigzag chains involving their structural transformation via intermolecular hydrogen-bonded, interpenetrating ladders polycatenane, and noninterpenetrating square grid from long, rigid N,N'-bidentate ligands: 1,4-bis[(x-pyridyl)ethynyl]benzene (x = 3 and 4)

The long, rigid ligands 1,4-bis[(3-pyridyl)ethynyl]benzene (L1) and 1,4-bis[(4-pyridyl)ethynyl]benzene (L2) were used in the synthesis of 10 new organic-inorganic coordination frameworks, each of them adopting different structural motifs. Synthesis, single-crystal X-ray structure determination, and spectroscopic and thermogravimetric analyses are presented. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] with L1 afforded the following one-dimensional zigzag chain structures: [Cd(C20H12N2)0.5(NO3)(CH3OH)]n (1, monoclinic, C2/c; a = 7.586(1) A, b = 23.222(1) A, c = 13.572(1) A, beta = 92.824(1), Z = 4); [{Cu(C20H12N2)(NO3)2(CH3OH)} x CH3OH]n (2, orthorhombic, P2(1)2(1)2(1); a = 8.589(1) A, b = 15.766(1) A, c = 17.501(1) A, Z = 4); [Co(C20H12N2)2(NO3)2(H2O)2] (5, triclinic, P1; a = 7.493(1) A, b = 8.948(1) A, c = 14.854(1) A, alpha = 100.427(1), beta = 97.324(1), gamma = 110.901(1), Z = 1); [Cu(C20H12N2)(hfac)2]n (4, monoclinic, C2/c, a = 18.828(1) A, b = 14.671(1) A, c = 13.427(1) A, beta = 90.447(1) degrees, Z = 4). Moreover, the minority phase compound formed from Cu(NO3)2 x 3H2O and L1 yielded a metallocyclic chain structure, [Cu(C20H12N2)(NO3)]n (3, triclinic, P; a = 8.728(1) A, b = 10.018(1) A, c = 11.893(1) A, alpha = 109.991(1), beta = 97.109(1), gamma = 115.542(1), Z = 1). In addition to the dinuclear coordination complex 5, all other polymeric structures (1-4) from L1 are composed of interpenetrating 2D and 3D cross-linked zigzag chains via hydrogen-bonding interactions. The reactions between M(NO3)2 x xH2O; M = Cd(II), Cu(II), and Co(II); x = 3-6 and Cu(hfac)2 x H2O [hfac = bis(hexafluoroacetylacetonato)] and L2 were dependent on the nature of the metal center and resulted in the formation of four different interpenetrating and noninterpenetrating compounds (6-10): [Co(C20H12N2)1.5(NO3)2]n (6, triclinic, P; a = 14.172(1) A, b = 15.795(1) A, c = 18.072(1) A, alpha = 115.380(1), beta = 101.319(1), gamma = 93.427(2), Z = 4), which consists of T-shaped building blocks assembled into three-dimensional interpenetrating polycatenated ladders; [Cd(C20H12N2)2(NO3)2]n (7, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), which adopts a two-dimensional noninterpenetrating square-grid motif; [Cu(C20H12N2)(hfac)2]n (8, monoclinic, I2/a; a = 11.371(1) A, b = 20.311(2) A, c = 15.240(2) A, beta = 100.201(2) degrees, Z = 4), composed of three sets of distinct one-dimensional linear chains; [Cu(C20H12N2)(EtOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2EtOH (9, triclinic, P; a = 12.248(2) A, b = 13.711(3) A, c = 18.257(4) A, alpha = 108.078(4) degrees, beta = 97.890(4) degrees, gamma = 103.139(5) degrees, Z = 2) and [Cu(C20H12N2)(MeOH)(NO3)2] [Cu(C20H12N2)1.5(NO3)2] x 2MeOH (10, triclinic, P; a = 12.136(1) A, b = 13.738(2) A, c = 17.563(3) A, alpha = 107.663(3) degrees, beta = 94.805(4) degrees, gamma = 104.021(4) degrees, Z = 2). Both 9 and 10 stack into infinite interpenetrating ladders through bundles of infinite chains and are described in our preliminary communication.     

Supramolecular Mn(II) and Mn(II)/Mn(III) grid complexes with [Mn9(mu2-O)12] core structures. Structural, magnetic, and redox properties and surface studies

A series of [3 x 3] Mn(II)(9), antiferromagnetically coupled, alkoxide-bridged, square grid complexes, derived from a group of "tritopic" dihydrazide ligands, is described. The outer ring of eight Mn(II) centers in the grids is isolated magnetically from the central Mn(II) ion, leading to an S = 0 ground state for the ring, and an S = 5/2 ground state overall in each case. Exchange in the Mn(II)(8) ring can be represented by a 1D chain exchange model. Rich electrochemistry displayed by these systems has led to the production of Mn(II)/Mn(III) mixed-oxidation-state grids by both electrochemical and chemical means. Structures are reported for [Mn(9)(2poap)(6)](C(2)N(3))(6).10H(2)O (1), [Mn(9)(2poap)(6)](2)[Mn(NCS)(4)(H(2)O)](2)(NCS)(8).10H(2)O (2), [Mn(9)(2poapz)(6)](NO(3))(6).14.5H(2)O (3), [Mn(9)(2popp)(6)](NO(3))(6).12H(2)O (4), [Mn(9)(2pomp)(6)](MnCl(4))(2)Cl(2).2CH(3)OH.7H(2)O (5), and [Mn(9)(Cl2poap)(6)](ClO(4))(9).7H(2)O (6). Compound 1 crystallized in the tetragonal system, space group P4(2)/n, with a = 21.568(1) A, c = 16.275(1) A, and Z = 2. Compound 2 crystallized in the triclinic system, space group P, with a = 25.043(1) A, b = 27.413(1) A, c = 27.538(2) A, alpha = 91.586(2) degrees, beta = 113.9200(9) degrees, gamma = 111.9470(8) degrees, and Z = 2. Compound 3 crystallized in the triclinic system, space group P, with a = 18.1578(12) A, b = 18.2887(12) A, c = 26.764(2) A, alpha = 105.7880(12) degrees, beta = 101.547(2) degrees, gamma = 91.1250(11) degrees, and Z = 2. Compound 4 crystallized in the tetragonal system, space group P4(1)2(1)2, with a = 20.279(1) A, c = 54.873(6) A, and Z = 4. Compound 5 crystallized in the tetragonal system, space group I, with a = 18.2700(2) A, c = 26.753(2) A, and Z = 2. Compound 6 crystallized in the triclinic system, space group P, with a = 19.044(2) A, b = 19.457(2) A, c = 23.978(3) A, alpha = 84.518(3) degrees, beta = 81.227(3) degrees, gamma = 60.954(2) degrees, and Z = 2. Preliminary surface studies on Au(111), with a Mn(II) grid complex derived from a sulfur-derivatized ligand, indicate monolayer coverage via gold-sulfur interactions, and the potential for information storage at high-density levels.     

Synthesis and characterization of new coordination polymers generated from bent bis(cyanophenyl)oxadiazole ligands and Ag(I) salts

Two new bent bis(cyanophenyl)oxadiazole ligands, 2,5-bis(4-cyanophenyl)-1,3,4-oxadiazole (L7) and 2,5-bis(3-cyanophenyl)-1,3,4-oxadiazole (L8), were synthesized. The coordination chemistry of these ligands with various Ag(I) salts has been investigated. Seven new coordination polymers, namely, {[Ag(L7)(H2O)]ClO4}n) (1) (triclinic, P1, a = 9.342(4) A, b = 9.889(4) A, c = 10.512(4) A, alpha = 68.978(6) degrees, beta = 78.217(6) degrees, gamma = 81.851(7) degrees, Z = 2), {[Ag(L7)]SO3CF3}n (2) (monoclinic, P2(1)/n, a = 7.559(2) A, b = 23.739(6) A, c = 10.426(3) A, beta = 108.071(4) degrees, Z = 4), {[Ag(L8)]BF4 x 0.5(C6H6) x H2O}n (3) (triclinic, P1, a = 7.498(3) A, b = 10.649(4) A, c = 13.673(5) A, alpha = 98.602(5) degrees, beta = 100.004(5) degrees, gamma =110.232(5) degrees, Z = 2), {[Ag(L8)SbF6] x H2O}n (4) (triclinic, P1, a = 8.2621(9) A, b = 10.6127(12) A, c = 13.3685(15) A, alpha = 98.012(2) degrees, beta = 106.259(2) degrees, gamma = 112.362(2) degrees, Z = 2), {[Ag2(L8)2(SO3CF3)] x H2O}n (5) (triclinic, P1, a = 10.713(4) A, b = 13.449(5) A, c = 15.423(5) A, alpha = 65.908(5) degrees, beta = 74.231(5) degrees, gamma = 83.255(5) degrees, Z = 2), {[Ag2(L8)(C6H6)(ClO4)] x ClO4}n (6) (monoclinic, P2(1)/n, a = 6.9681(17) A, b = 20.627(5) A, c = 17.437(4) A, beta = 95.880(4) degrees, Z = 4), and {[Ag2(L8)(H2PO4)2]}n (7) (triclinic, P1, a = 7.956(2) A, b = 9.938(3) A, c = 14.242(4) A, alpha = 106.191(4) degrees, beta = 97.322(4) degrees, gamma = 107.392(4) degrees, Z = 1), were obtained by the combination of L7 and L8 with Ag(I) salts in a benzene/methylene chloride mixed-solvent system and fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. In addition, the luminescence and electrical conductance properties of compounds 1-6 and the host-guest chemistry of compound 3 were investigated.     

Coordination polymers based on cobridging of rigid and flexible spacer ligands: syntheses, crystal structures, and magnetic properties of [Mn(bpy)(H2O)(C4H4O4)].0.5bpy, Mn(bpy)(C5H6O4), and Mn(bpy)(C6H8O4)

Reactions of 4,4'-bipyridine (bpy) with Mn(C(4)H(4)O(4)).4H(2)O and Mn(C(5)H(6)O(4)).4H(2)O in methanolic aqueous solutions yielded [Mn(bpy)(H(2)O)(C(4)H(4)O(4))].0.5bpy (1) and Mn(bpy)(C(5)H(6)O(4)) (2), respectively, and reactions of freshly prepared Mn(OH)(2)(-)(2)(x)(CO(3))(x).yH(2)O, adipic acid and 4,4'-bipyridine in a methanolic aqueous solution afforded Mn(bpy)(C(6)H(8)O(4)) (3). The six-coordinate Mn atoms in 1 are interlinked by flexible succinato ligands to form layers, which are sustained by rigid bpy ligands into an 3D open framework with the free bpy molecules in tunnels. The ribbonlike chains in 2 result from Mn atoms bridged by glutarato ligands and are connected by bpy ligands into open layers. In 3, the Mn atoms are bridged by both bpy and adipato ligands to form 3D nanoporous frameworks and 2-fold interpenetration of the resulting 3D frameworks completes the crystal structure. In comparison with 1 and 2, compound 3 displays significant antiferromagnetic behavior at low temperature. The antiferromagnetic exchange becomes stronger from 1 through 2 to 3, and the antiferromagnetic ordering of Mn(2+) centers is related to the syn-syn bridging mode of the terminal carboxylate groups of alpha,omega-dicarboxylate anions. Crystal data: C(19)H(18)MnN(3)O(5) (1), monoclinic P2(1)/c, a= 11.686(2) A, b = 17.847(2) A, c = 8.852(1) A, beta = 99.67(1) degrees, V = 1819.9(4) A(3), Z = 4, D(c) = 1.545 g.cm(-3); C(15)H(14)MnN(2)O(4) (2), triclinic P, a = 8.145(2) A, b = 9.574(2) A, c = 10.180(1) A, alpha = 108.01(3) degrees, beta = 93.55(3) degrees, gamma = 105.30(1) degrees, V = 719.2(2) A(3), Z = 2, D(c) = 1.576 g.cm(-3); C(15)H(14)MnN(2)O(4) (3), triclinic P, a = 8.544(1) A, b= 8.881(1) A, c = 10.949(2) A, alpha = 108.81(1) degrees, beta = 95.40(1) degrees, gamma = 101.94(1) degrees, V = 757.7(2) A(3), Z = 2, D(c) = 1.557 g.cm(-3).     

Adduct formation between alkali metal ions and divalent metal salicylaldimine complexes having methoxy substituents. A structural investigation

Sodium, potassium, and cesium salts (iodides, nitrates, acetates, and tetraphenylborates) form 1/1, 1/2 and 2/3 adducts with MLn [M = Co, Ni, Cu, and Zn; n = 1-4; H2L1 = N,N'-(3-methoxysalicyliden)ethane-1,2-diamine; H2L2, H2L3, and H2L4 are the -propane-1,2-diamine, -o-phenylenediamine, and -propane-1,3-diamine analogues of H2L1). Metal salicyladimine, alkali metal, and anion all exert influence on stoichiometry and reactivity. Sodium ions tend to reside within the planes of the salicylaldimine oxygens, as in Na(NO3)(MeOH).NiL4 (1), Na(NO3)(MeOH).CuL1 (2; both with unusual seven-coordinated sodium), and Na.(NiL4)2I.EtOH.H2O (3; with dodecahedral sodium coordination geometry). Potassium and cesium tend to locate between salicylaldimine ligands as in KI.NiL4 (4) and [Cs(NO3).NiL4]3.MeOH (5; structures with infinite sandwich assemblies), CsI.(NiL2)2.H2O (6), CsI3.(NiL4)2 (7; simple sandwich structures), and [K(MeCN)]2.(NiL4)3 (8; a triple-decker sandwich structure). Crystal data for 1 are the following: triclinic, P1, a = 7.3554(6) A, b = 11.2778(10) A, c = 13.562(2) A, alpha = 96.364(10) degrees, beta = 101.924(9) degrees, gamma = 96.809(10) degrees, Z = 2. For 2, triclinic, P1, a = 7.2247(7) A, b = 11.0427(6) A, c = 13.5610(12) A, alpha = 94.804(5) degrees, beta = 98.669(7) degrees, gamma = 99.26(6) Z = 2. For 3, orthorhombic, Pbca, a = 14.4648(19) A, b = 20.968(3) A, c = 28.404(3) A, Z = 8. For 4, triclinic, P1, a = 12.4904(17) A, b = 13.9363(13) A, c = 14.1060(12) A, alpha = 61.033(7) degrees, beta = 89.567(9) degrees, gamma = 71.579(10) degrees, Z = 2. For 5, monoclinic. P2(1)/n, a = 12.5910(2) A, b = 23.4880(2) A, c = 22.6660(2) A, beta = 99.3500(1) degree, Z = 4. For 6, orthorhombic, Pbca, a = 15.752(3) A, b = 23.276(8) A, c = 25.206(6) A, Z = 8. For 7, triclinic, P1, a = 9.6809(11) A, b = 10.0015(13) A, c = 11.2686(13) A, alpha = 101.03 degrees, beta = 90.97 degrees, gamma = 100.55 degrees, Z = 2. For 8, monoclinic, C2/c, a = 29.573(5) A, b = 18.047(3) A, c = 23.184(3) A, beta = 122.860(10) degrees, Z = 8.     

Manganese(II/II/II) and Manganese(III/II/III) Trinuclear Compounds. Structure and Solid and Solution Behavior

Two mixed-valence Mn(III)Mn(II) complexes and a homo-valence Mn(II) trinuclear manganese complex of stoichiometry Mn(III)Mn(II)Mn(III)(5-Cl-Hsaladhp)(2)(AcO)(4)(MeOH)(2).4CH(3)OH (1a), Mn(III)Mn(II)Mn(III) (Hsaladhp)(2)(AcO)(2)(5-Cl-Sal)(2)(thf)(2) (3a) and Mn(II)Mn(II)Mn(II) (AcO)(6)(pybim)(2) (1b) where H(3)saladhp is a tridentate Schiff base ligand and pybim a neutral bidentate donor ligand, have been structurally characterized by using X-ray crystallography. The structurally characterized mixed-valence complexes have strictly 180 degrees Mn(III)-Mn(II)-Mn(III) angles as required by crystallographic inversion symmetry. The complexes are valence trapped with two terminal Mn(III) ions showing Jahn-Teller distortion along the acetate or salicylate-Mn(III)-X axis. The Mn.Mn separation is 3.511 ? and 3.507 ? respectively. The mixed-valence complexes have S = (3)/(2) ground state and the homovalence complex S = (5)/(2), with small antiferromagnetic exchange J couplings, -5.6 and -1.8 cm(-1), respectively, while the powder ESR spectra at 4 K show a broad low field signal with g approximately 4.3 for Mn(III)Mn(II)Mn(III) and a broad temperature-dependent signal at g = 2 for Mn(II)Mn(II)Mn(II). Crystal data for 1a: [C(36)H(60)O(20)N(2)Cl(2)Mn(3)], triclinic, space group P&onemacr;, a = 9.272(7) ?, b = 11.046(8) ?, c = 12.635(9) ?, alpha = 76.78(2) degrees, beta = 81.84(2) degrees, gamma = 85.90(2) degrees, Z = 1. Crystal data for 3a: [C(48)H(56)O(18)N(2)Cl(2)Mn(3)], monoclinic, space group P2(1)/n, a = 8.776(3) ?, b = 22.182(7) ?, c = 13.575(4) ?, beta = 94.44(1) degrees, Z = 2. Crystal data for 1b: [C(36)H(36)O(12)N(6)Mn(3)], triclinic, space group P&onemacr;, a = 13.345(6) ?, b = 8.514(4) ?, c = 9.494(4) ?, alpha = 75.48(1) degrees, beta = 75.83(1) degrees, gamma = 76.42(1) degrees, Z = 1.     

Self-assembled dinuclear,trinuclear, tetranuclear,pentanuclear, and octanuclear Ni(II) complexes of a series of polytopic diazine based ligands: structural and magnetic properties

The nickel coordination chemistry of a series of polytopic diazine (N-N) based ligands has been examined. Self-assembly reactions lead to examples of dinuclear, trinuclear, tetranuclear, pentanuclear, and octanuclear complexes, all of which exhibit magnetic exchange coupling, with antiferromagnetic and ferromagnetic examples. Structural details are presented for [(L1)(2)Ni(2)(H(2)O)(2)](NO(3))(4).3H(2)O (1), [(L2)(2)Ni(3)(H(2)O)(2)](NO(3))(6).8H(2)O (2), [(L3)(4)Ni(4)(H(2)O)(8)] (NO(3))(4).8H(2)O (3), [(L4)(2)Ni(5)(H(2)O)(10)(NO(3))](NO(3))(7).8H(2)O (4), and [(L5)(4)Ni(8)(H(2)O)(8)](BF(4))(8).16H(2)O (5). Compound 1 crystallizes in the monoclinic system, space group P2(1)/c, with a = 14.937(1) A, b = 18.612(2) A, c = 20.583(2) A, beta = 108.862(2) degrees, Z = 4. Compound 2 crystallizes in the orthorhombic system, space group P2(1)2(1)2, with a = 21.771(4) A, b = 13.700(2) A, c = 20.017(3) A, Z = 4. Compound 3 crystallizes in the tetragonal system, space group P4(3), with a = 12.9483(7) A, c = 33.416(3) A, Z = 4. Compound 4 crystallizes in the triclinic system, space group P(-)1, with a = 12.6677(8) A, b = 18.110(1) A, c = 19.998(1) A, alpha = 100.395(1) degrees, beta = 109.514(1) degrees, gamma = 109.686(1) degrees, Z = 2. Compound 5 crystallizes in the monoclinic system, space group P2(1)/n, with a = 21.153(5) A, b = 35.778(9) A, c = 21.823(5) A, beta = 97.757(6) degrees, Z = 4. The linear trinuclear Ni(II) complex (2) has a cis-N-N single bond bridge, and a water bridge linking the central Ni(II) to each external Ni(II) center in each of two similar trinuclear subunits, and exhibits intramolecular ferromagnetic exchange (J = 5.0 cm(-1)). A novel octanuclear metallacyclic ring structure exists in 5, with trans-N-N single bond bridges linking adjacent Ni(II) centers, leading to quite strong intramolecular antiferromagnetic exchange (J = -30.4 cm(-1)).     

Sandwich-type germanotungstates: structure and magnetic properties of the dimeric polyoxoanions [M4(H2O)2(GeW9O34)2]12 - (M = Mn2+, Cu2+, Zn2+, Cd2+)

The novel dimeric germanotungstates [M(4)(H(2)O)(2)(GeW(9)O(34))(2)](12)(-) (M = Mn(2+), Cu(2+), Zn(2+), Cd(2+)) have been synthesized and characterized by IR spectroscopy, elemental analysis, magnetic measurements, and (183)W-NMR spectroscopy. X-ray single-crystal analyses were carried out on Na(12)[Mn(4)(H(2)O)(2)(GeW(9)O(34))(2)].38H(2)O (Na(12)()-1), which crystallizes in the monoclinic system, space group P2(1)/n, with a = 13.0419(8) A, b = 17.8422(10) A, c = 21.1626(12) A, beta = 93.3120(10) degrees, and Z = 2; Na(11)Cs(2)[Cu(4)(H(2)O)(2)(GeW(9)O(34))(2)]Cl.31H(2)O (Na(11)()Cs-2) crystallizes in the triclinic system, space group P, with a = 12.2338(17) A, b = 12.3833(17) A, c = 15.449(2) A, alpha = 100.041(2) degrees, beta = 97.034(2) degrees, gamma = 101.153(2) degrees, and Z = 1; Na(12)[Zn(4)(H(2)O)(2)(GeW(9)O(34))(2)].32H(2)O (Na(12)()-3) crystallizes in the triclinic system, space group P, with a = 11.589(3) A, b = 12.811(3) A, c = 17.221(4) A, alpha = 97.828(6) degrees, beta = 106.169(6) degrees, gamma = 112.113(5) degrees, and Z = 1; Na(12)[Cd(4)(H(2)O)(2)(GeW(9)O(34))(2)].32.2H(2)O (Na(12)()-4) crystallizes also in the triclinic system, space group P, with a = 11.6923(17) A, b = 12.8464(18) A, c = 17.616(2) A, alpha = 98.149(3) degrees, beta = 105.677(3) degrees, gamma = 112.233(2) degrees, and Z = 1. The polyanions consist of two lacunary B-alpha-[GeW(9)O(34)](10)(-) Keggin moieties linked via a rhomblike M(4)O(16) (M = Mn, Cu, Zn, Cd) group leading to a sandwich-type structure. (183)W-NMR studies of the diamagnetic Zn and Cd derivatives indicate that the solid-state polyoxoanion structures are preserved in solution. EPR measurements on Na(12)()-1 at frequencies up to 188 GHz and temperatures down to 4 K yield a single, exchange-narrowed peak, at g(iso) = 1.9949, typical of Mn systems, and an upper limit of |D| = 20.0 mT; its magnetization studies still await further theoretical treatment. Detailed EPR studies on Na(11)()Cs-2 over temperatures down to 2 K and variable frequencies yield g( parallel ) = 2.4303 and g( perpendicular ) = 2.0567 and A( parallel ) = 4.4 mT (delocalized over the Cu(4) framework), with |D| = 12.1 mT. Magnetization studies in addition yield the exchange parameters J(1) = -11 and J(2) = -82 cm(-)(1), in agreement with the EPR studies.     

Coordination of lanthanide triflates and perchlorates with N,N,N',N'-tetramethylsuccinamide

Compounds formed from the reaction of N,N,N',N'-tetramethylsuccinamide (TMSA) with trivalent lanthanide salts possessing the poorly coordinating counteranions triflate (CF3SO3-) and perchlorate (ClO4-) have been prepared and examined. Structural features of these Ln-TMSA compounds have been studied in the solid phase by thermogravimetric analysis, infrared spectroscopy, and, in selected cases, by single-crystal X-ray diffraction and in solution by infrared spectroscopy. Eight-coordinate compounds, [Ln(TMSA)4]3+, derived from coordination of four succinamide ligands to the metal ion could be formed with all lanthanides examined (Ln = La, Pr, Nd, Eu, Yb, Lu). Structural analyses by single-crystal X-ray diffraction were performed for the lanthanide triflate salts Ln(C8H16N2O2)4(CF3SO3)3: Ln = La, compound 1, monoclinic, P2(1)/n, a = 11.0952(2) A, b = 19.2672(2) A, c = 24.9759(3) A, beta = 90.637(1) degrees, Z = 4, Dcalcd = 1.586 g cm-3; Ln = Nd, compound 2, monoclinic, C2/c, a = 24.6586(10) A, b = 19.3078(7) A, c = 11.1429(4) A, beta = 90.450(1) degrees, Z = 4, Dcalcd = 1.603 g cm-3; Ln = Eu, compound 3, monoclinic, C2/c, a = 24.4934(2) A, b = 19.3702(1) A, c = 11.1542(1) A, beta = 90.229(1) degrees, Z = 4, Dcalcd = 1.617 g cm-3; Ln = Lu, compound 5, monoclinic, C2/c, a = 24.2435(4) A, b = 19.6141(2) A, c = 11.2635(1) A, beta = 90.049(1) degrees, Z = 4, Dcalcd = 1.626 g cm-3. X-ray analysis was also carried out for the perchlorate salt: Ln = Eu, compound 4, triclinic, P1, a = 10.9611(2) A, b = 14.6144(3) A, c = 15.7992(2) A, alpha = 106.594(1) degrees, beta = 91.538(1) degrees, gamma = 90.311(1) degrees, Z = 2, Dcalcd = 1.561 g cm-3. In the presence of significant amounts of water, 7-coordinate compounds with mixed aquo-TMSA cation structures [Ln(TMSA)3(H2O)]3+ (Ln = Yb) and [Ln(TMSA)2(H2O)3]3+ (Ln = La, Pr, Nd, Eu, Yb) have been isolated with structural determinations by single-crystal X-ray diffraction obtained for the following species: Yb(C8H16N2O2)3(H2O)(CF3SO3)3, compound 6, monoclinic, P2(1)/n, a = 8.9443(3) A, b = 11.1924(4) A, c = 44.2517(13) A, beta = 93.264(1) degrees, Z = 4, Dcalcd = 1.735 g cm-3; Yb(C8H16N2O2)3(H2O)(ClO4)3, compound 7, monoclinic, Cc, a = 19.2312(6) A, b = 11.1552(3) A, c = 19.8016(4) A, beta = 111.4260(1) degrees, Z = 4, Dcalcd = 1.690 g cm-3; Yb(C8H16N2O2)2(H2O)3(CF3SO3)3, compound 8, triclinic, P1, a = 8.6719(1) A, b = 12.2683(2) A, c = 19.8094(3) A, alpha = 75.815(1) degrees, beta = 86.805(1) degrees, gamma = 72.607(1) degrees, Z = 2, Dcalcd = 1.736 g cm-3. Unlike in the analogous nitrate salts, only bidentate binding of the succinamide ligand to the lanthanide metal is observed. IR spectroscopy studies in anhydrous acetonitrile suggest that the solid-state structures of these Ln-TMSA compounds are maintained in solution.     

Organometallic silver(I) supramolecular complexes generated from multidentate furan-containing symmetric and unsymmetric fulvene ligands and silver(I) salts

One new conjugated symmetric fulvene ligand L1 and two new unsymmetric fulvene ligands L2 and L3 were synthesized. Five new supramolecular complexes, namely Ag2(L1)3(SO3CF3)3 (1) (1, monoclinic, P2(1)/c; a = 12.702(3) A, b = 26.118(7) A, c = 13.998(4) A, beta = 96.063(4) degrees, Z = 4), [Ag(L1)]ClO4 (2) (monoclinic, C2/c; a = 17.363(2) A, b = 13.2794(18) A, c = 13.4884(18) A, beta = 100.292(2) degrees, Z = 8), [Ag(L1)(C6H6)SbF6] x 0.5C6H6 x H2O (3) (monoclinic, P2(1)/c; a = 6.8839(11) A, b = 20.242(3) A, c = 18.934(3) A, beta = 91.994(3) degrees, Z = 4), Ag(L2)(SO3CF3) (4) (triclinic, P1; a = 8.629(3) A, b = 10.915(3) A, c = 11.178(3) A, alpha = 100.978(4) degrees, beta = 91.994(3) degrees, gamma = 105.652(4) degrees, Z = 2), and Ag(L3)(H2O)(SO3CF3) (5) (triclinic, P1; a = 8.914(5) A, b = 10.809(6) A, c = 11.283(6) A, alpha = 69.255(8) degrees, beta = 87.163(9) degrees, gamma = 84.993(8) degrees, Z = 2) were obtained through self-assembly based on these three new fulvene ligands in a benzene/toluene mixed-solvent system. Compounds 1-5 have been fully characterized by infrared spectroscopy, elemental analysis, and single-crystal X-ray diffraction. The results indicate that the coordination chemistry of new fulvene ligands is versatile. They can adopt either cis- or trans-conformation to bind soft acid Ag(I) ion through not only the terminal -CN and furan functional groups but also the fulvene carbon atoms into organometallic coordination polymers or discrete complexes. In addition, the luminescent properties of L1-L3 and their Ag(I) complexes were investigated preliminarily in EtOH and solid state.     

Synthesis, structures, and emissive properties of platinum(II) complexes with a cyclometallating aryldiamine ligand

A new series of square planar Pt(II) complexes with the mer-coordinating tridentate ligand, pip(2)NCN(-) (pip(2)NCNH = 1,3-bis(piperdylmethyl)benzene), has been prepared: Pt(pip(2)NCN)Cl (2), Pt(pip(2)NCN)Br (3), Pt(pip(2)NCN)I (4), and [Pt(pip(2)NCN)(CH(3)N=C(CH(3))(2))][CF(3)SO(3)] (5). The complexes have been fully characterized by (1)H NMR spectroscopy, elemental analysis, and UV-vis spectroscopy. The X-ray crystal structures of pip(2)NCNBr (1), 2, and 5 are reported. Compound 1: triclinic, P, a = 10.081(1) A, b = 10.153(2) A, c = 10.390(1) A, alpha = 66.05(1) degrees, beta = 79.07(1) degrees, gamma = 64.51(1) degrees, V = 877.1(2) A(3), Z = 2. Complex 2: triclinic, P, a = 9.897(2) A, b = 10.191(2) A, c = 19.174(4) A, alpha = 75.09(3) degrees, beta = 76.14(3) degrees, gamma = 71.00(3) degrees, V = 1741.2(6) A(3), Z = 4. Complex 5: triclinic, P, a = 10.709(2) A, b = 11.2321(10) A, c = 12.447(2) A, alpha = 110.509(8) degrees, beta = 112.417(10) degrees, gamma = 91.066(9) degrees, V = 1276.1(3) A(3), Z = 2. In 77 K 3:1 EtOH/MeOH glassy solution, these colorless complexes exhibit weak red-orange to red emissions originating from a lowest spin-forbidden ligand field excited state.     

Binuclear manganese compounds of potential biological significance. 1. Syntheses and structural,magnetic, and electrochemical properties of dimanganese(II) and -(II,III) complexes of a bridging unsymmetrical phenolate ligand

Reactions of the unsymmetrical phenol ligand 2-(bis(2-pyridylmethyl)aminomethyl)-6-((2-pyridylmethyl)(benzyl)aminomethyl)-4-methylphenol with Mn(OAc)(2).4H(2)O or Mn(H(2)O)(6)(ClO(4))(2) in the presence of NaOBz affords the dimanganese(II) complexes 1(CH(3)OH), [Mn(2)(L)(OAc)(2)(CH(3)OH)](ClO(4)), and 2(H(2)O), [Mn(2)(L)(OBz)(2)(H(2)O)](ClO(4)), respectively. On the other hand, reaction of the ligand with hydrated manganese(III) acetate furnishes the mixed-valent derivative 3(H(2)O), [Mn(2)(L)(OAc)(2)(H(2)O)](ClO(4))( 2). The three complexes have been characterized by X-ray crystallography. 1(CH(3)OH) crystallizes in the monoclinic system, space group P2(1)/c, with a = 10.9215(6) A, b = 20.2318(12) A, c = 19.1354(12) A, alpha = 90 degrees, beta = 97.5310(10) degrees, gamma = 90 degrees, V = 4191.7 A(3), and Z = 4. 2(H(2)O) crystallizes in the monoclinic system, space group P2(1)/n, with a = 10.9215(6) A, b = 20.2318(12) A, c = 19.1354(12) A, alpha = 90 degrees, beta = 97.5310(10) degrees, gamma = 90 degrees, V = 4191.7 A(3), and Z = 4. 3(H(2)O) crystallizes in the monoclinic system, space group P2(1)/c, with a = 11.144(6) A, b = 18.737(10) A, c = 23.949(13) A, alpha = 90 degrees, beta = 95.910(10) degrees, gamma = 90 degrees, V = 4974(5) A(3), and Z = 4. Magnetic measurements revealed that the three compounds exhibit very similar magnetic exchange interactions -J = 4.3(3) cm(-)(1). They were used to establish tentative magneto-structural correlations which show that for the dimanganese(II) complexes -J decreases when the Mn-O(phenoxo) distance increases as expected from orbital overlap considerations. For the dimanganese(II,III) complexes, crystallographic results show that the Mn(II)-O(phenoxo) and Mn(III)-O(phenoxo) bond lengths are inversely correlated. An interesting magneto-structural correlation is found between -J and the difference between these bond lengths, delta(Mn)(-)(O) = d(Mn)()II(-)(O) - d(Mn)()III(-)(O): the smaller this difference, the larger -J. Electrochemical studies show that the mixed-valence state is favored in 1-3 by ca. 100 mV with respect to analogous complexes of symmetrical ligands, owing to the asymmetry of the electron density as found in the analogous diiron complexes.     

Self-assembly of a series of extended architectures based on polyoxometalate clusters and silver coordination complexes

Three unusual compounds based on polyoxometalate building blocks, [(H2O)5Na2(C6NO2H4)(C6NO2H5)3Ag2][Ag2IMo6O24(H2O)4] x 6.25H2O (1), [(H2O)4Na2(C6NO2H5)6Ag3][IMo6O24] x 6H2O (2), and (C6NO2H6)2[(C6NO2H5)2Ag][Cr(OH)6Mo6O18] x 4H2O (3), have been synthesized and characterized by elemental analysis; IR, XPS, and ESR spectroscopy; TG analysis; and single-crystal X-ray diffraction. Compound 1 is constructed from the cationic two-dimensional (2D) coordination polymer sheets which are constituted of [(H2O)5Na2(C6NO2H4)(C6NO2H5)3Ag2]3+ and anionic [Ag2IMo6O24(H2O)4]3- chains as pillars, forming a three-dimensional (3D) supramolecular framework via weak Ag-O interactions. Compound 2 is composed of the well-defined [IMo6O24]5- building blocks, which are linked through trinuclear Ag-pyridine-3-carboxylic acid, [(C6NO2H5)6Ag3]3+, fragments into a one-dimensional (1D) hybrid chain; adjacent chains are further connected by sodium cations to yield a novel 2D network. Compound 3 has a 1D chainlike structure constructed from [Cr(OH)6Mo6O18]3- building blocks and Ag-pyridine-4-carboxylic acid coordination units. The crystal data for these compounds are the following: 1, triclinic, P1, a = 13.280(3) A, b = 13.641(3) A, c = 16.356(3) A, alpha = 89.68(3) degrees, beta = 88.31(3) degrees, gamma = 75.87(3) degrees, Z = 2; 2, triclinic, P1, a = 11.978(2) A, b = 12.008(2) A, c = 13.607(3) A, alpha = 116.14(3) degrees, beta = 108.85(3) degrees, gamma = 93.86(3) degrees, Z = 1; 3, triclinic, P1, a = 10.458(2) A, b = 10.644(2) A, c = 12.295(3) A, alpha = 97.40(3) degrees, beta = 112.38(3) degrees, gamma = 113.59(3) degrees, Z = 1.     

Structure,magnetism, and electrochemistry of the multinickel polyoxoanions [Ni6As3W24O94(H2O)2]17-, [Ni3Na(H2O)2(AsW9O34)2]11-, and [Ni4Mn2P3W24O94(H2O)2]17-

The three novel, multi-nickel-substituted heteropolytungstates [Ni(6)As(3)W(24)O(94)(H(2)O)(2)](17)(-) (1), [Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)](11)(-) (2), and [Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)](17)(-) (3) have been synthesized and characterized by IR, elemental analysis, electrochemistry, and magnetic studies. Single-crystal X-ray analysis was carried out on Na(16.5)Ni(0.25)[Ni(6)As(3)W(24)O(94)(H(2)O)(2)].54H(2)O, which crystallizes in the triclinic system, space group P1, with a = 17.450(4) A, b = 17.476(4) A, c = 22.232(4) A, alpha = 85.73(3) degrees, beta = 89.74(3) degrees, gamma = 84.33(3) degrees, and Z = 2, Na(11)[Ni(3)Na(H(2)O)(2)(AsW(9)O(34))(2)].30.5H(2)O, which crystallizes in the triclinic system, space group P1, with a = 12.228(2) A, b = 16.743(3) A, c = 23.342(5) A, alpha = 78.50(3) degrees, beta = 80.69(3) degrees, gamma = 78.66(3) degrees, and Z = 2, and Na(17)[Ni(4)Mn(2)P(3)W(24)O(94)(H(2)O)(2)].50.5H(2)O, which crystallizes in the monoclinic system, space group P2(1)/c, with a = 17.540(4) A, b = 22.303(5) A, c = 35.067(7) A, beta = 95.87(3) A, and Z = 4. Polyanion 1 consists of two B-alpha-(Ni(3)AsW(9)O(40)) Keggin moieties linked via a unique AsW(6)O(16) fragment, leading to a banana-shaped structure with C(2)(v)() symmetry. The mixed-metal tungstophosphate 3 is isostructural with 1. Polyanion 2 consists of two lacunary B-alpha-[AsW(9)O(34)](9)(-) Keggin moieties linked via three nickel(II) centers and a sodium ion. Electrochemical studies show that 1-3 exhibit a unique and reproducible voltammetric pattern and that all three compounds are stable in a large pH range. An investigation of the magnetic properties of 1-3 indicates that the exchange interactions within the trimetal clusters are ferromagnetic. However, for 1 and 3 intra- and intermolecular interactions between different trinuclear clusters are also present.     

Diverse solid-state and solution structures within a series of hexaamine dicopper(II) complexes

Mono- and dicopper(II) complexes of a series of potentially bridging hexaamine ligands have been prepared and characterized in the solid state by X-ray crystallography. The crystal structures of the following Cu(II) complexes are reported: [Cu(HL3)](ClO4)(3), C11H31Cl3CuN6O12, monoclinic, P2(1)/n, a = 8.294(2) A, b = 18.364(3) A, c = 15.674(3) A, beta = 94.73(2) degrees, Z = 4; ([Cu2(L4)(CO3)](2))(ClO4)(4).4H2O, C40H100Cl4Cu4N12O26, triclinic, P1, a = 9.4888(8) A, b = 13.353(1) A, c = 15.329(1) A, alpha = 111.250(7) degrees, beta = 90.068(8) degrees, gamma = 105.081(8) degrees, Z = 1; [Cu2(L5)(OH2)(2)](ClO4)(4), C13H36Cl4Cu2N6O18, monoclinic, P2(1)/c, a = 7.225(2) A, b = 8.5555(5) A, c = 23.134(8) A, beta = 92.37(1) degrees, Z = 2; [Cu2(L6)(OH2)(2)](ClO4)(4).3H2O, C14H44Cl4Cu2N6O21, monoclinic, P2(1)/a, a = 15.204(5) A, b = 7.6810(7) A, c = 29.370(1) A, beta = 100.42(2) degrees, Z = 4. Solution spectroscopic properties of the bimetallic complexes indicate that significant conformational changes occur upon dissolution, and this has been probed with EPR spectroscopy and molecular mechanics calculations.     

Bimetallic cyanide-bridged complexes based on the photochromic nitroprusside anion and paramagnetic metal complexes. Syntheses, structures, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O, [Ni(en)2][Fe(CN)5NO]x3H2O, [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO], and [Mn(5-Brsalen)]2[Fe(CN)5NO

The synthesis, crystal structure, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O (1), [Ni(en)2][Fe(CN)5NO]x3H2O (2), [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO] (3), and [Mn(5-Brsalen)]2[Fe(CN)5NO] (4) are presented. 1 crystallizes in the monoclinic space group P2(1)/n (a = 7.407(4) A, b = 28.963(6) A, c = 14.744(5) A, alpha = 90 degrees, beta = 103.26(4) degrees, gamma = 90 degrees, Z = 2). Its structure consists of branched linear chains formed by cis-[Ni(en)2]2+ cations and ferrocyanide and nitroprusside anions. The presence of two kinds of iron(II) sites has been demonstrated by M?ssbauer spectroscopy. 2 crystallizes in the monoclinic space group P2(1)/c (a = 11.076(3) A, b = 10.983(2) A, c = 17.018(5) A, alpha = 90 degrees, beta = 107.25(2) degrees, gamma = 90 degrees, Z = 4). Its structure consists of zigzag chains formed by an alternated array of cis-[Ni(en)2]2+ cations and nitroprusside anions. 3 crystallizes in the triclinic space group P1 (a = 8.896(5) A, b = 10.430(5) A, c = 12.699(5) A, alpha = 71.110(5) degrees, beta = 79.990(5) degrees, gamma = 89.470(5) degrees, Z = 1). Its structure comprises neutral trinuclear bimetallic complexes in which a central [Fe(CN)5NO]2- anion is linked to two [Mn(3-MeOsalen)]+ cations. 4 crystallizes in the tetragonal space group P4/ncc (a = 13.630(5) A, c = 21.420(8) A, Z = 4). Its structure shows an extended 2D neutral network formed by cyclic octameric [-Mn-NC-Fe-CN-]4 units. The magnetic properties of these compounds indicate the presence of quasi-isolated paramagnetic Ni2+ and Mn3+. Irradiated samples of the four compounds have been studied by differential scanning calorimetry to detect the existence of the long-lived metastable states of nitroprusside.     

The platinum catalyst [bpyrPtCl2] in superacidic solution

The methane oxidation catalyst [bpyrPtCl(2)] (bpyr = bis-pyrimidine) dissolves in superacidic HF/SbF(5) solution under formation of a dinuclear cation [H(2)bpyrPt(mu-Cl)(2)PtbpyrH(2)](6+). Two crystal forms are isolated, [Pt(2)Cl(2)bpyr(2)H(4)](6+)(SbF(6)(-))(4)(Sb(2)F(11)(-))(2).2HF (I) (triclinic, Ponemacr;, a = 814.8(2) pm, b = 1444.8(3) pm, c = 2300.5(5) pm, alpha = 89.627(4) degrees, beta = 84.285(4) degrees, gamma = 84.665(4) degrees, Z = 2) and [Pt(2)Cl(2)bpyrH(4)](6+)(Sb(2)F(11)(-))(6).4HF (II) (triclinic, Ponemacr;, a = 879.4(2) pm, b = 1170.4(3) pm, c = 1789.9(5) pm, alpha = 95.37(2) degrees, beta = 99.97(2) degrees, gamma = 100.41(2) degrees, Z = 1). The cation in I has an angle of 148.4(1) degrees between the two square plane platinum environments, while the cation in II is fully planar. The non-platinum-bound nitrogen atoms are all protonated in the superacidic medium.     

Five new manganese-mu-azido 2D compounds synthesized in aqueous hydrazoic acid from pyrazine derivatives

The syntheses, structural characterization, and magnetic behavior of five new 2D manganese(II) complexes with empirical formulas [Mn(N(3))(2)(2,6-DiMepyz)(H(2)O)](n)() (1), [Mn(N(3))(2)(Etpyz)(H(2)O)](n)() (2), [Mn(N(3))(2)(H(2)O)(2)](n)()(2,3-DiMepyz)(n)() (3), [Mn(N(3))(2)(Clpyz)(2)](n)() (4), and [Mn(N(3))(2)(Ipyz)(2)](n)() (5) (pyz = pyrazine (1,4-diazine)) are reported. 1 crystallizes in the monoclinic system, space group P2(1)/c, with unit cell parameters a = 7.513(4) A, b = 17.438(7) A, c = 8.404(4) A, beta = 94.53(4) degrees , and Z = 4. 2 crystallizes in the triclinic system, space group P, with unit cell parameters a = 7.386(2) A, b = 8.434(2) A, c = 9.442(3) A, alpha = 71.82(2) degrees , beta = 72.08(2) degrees , gamma = 88.54(2) degrees , and Z = 2. 3 crystallizes in the monoclinic system, space group C2/c, with unit cell parameters a = 20.438(7) A, b = 7.711(2) A, c = 7.457(2) A, beta = 93.76(3) degrees , and Z = 4. 4 crystallizes in the orthorhombic system, space group Pbca, with unit cell parameters a = 8.600(2) A, b = 13.440(4) A, c = 24.083(7) A, and Z = 8. 5 crystallizes in the orthorhombic system, space group Pbca, with unit cell parameters a = 8.521(2) A, b = 13.787(3) A, c = 26.237(5) A, and Z = 8. The compounds 1-5 have only azido bridging ligands. In 1-3 each manganese atom is linked to the four nearest neighbors by only end-to-end azido bridges, forming square layers. 4 and 5 show alternating end-to-end and end-on azido bridges between manganese atoms. The magnetic properties of 1-5 are reported. At high temperatures the plots of chi(M) or chi(M)T vs T for the 1-3 compounds can be fitted as homogeneous 2D systems with J = -4.9, -4.4, and -3.9 cm(-)(1) for 1-3, respectively. For 1, 3, and 5 magnetic ordering and spontaneous magnetizations is achieved below T(c) = 35, 29, and 22 K, respectively, whereas 2 and 4 do not show spontaneous magnetization up to 2 K.     

High-dimensional architectures from the self-assembly of lanthanide ions with benzenedicarboxylates and 1,10-phenanthroline

Six new coordination polymers, [Eu(1,2-BDC)(1,2-HBDC)(phen)(H(2)O)](n) (1), [Eu(2)(1,3-BDC)(3)(phen)(2)(H(2)O)(2)](n).4nH(2)O (2), [Eu(1,4-BDC)(3/2)(phen)(H(2)O)](n) (3), [Yb(2)(1,2-BDC)(3)(phen)(H(2)O)(2)](n).3.5nH(2)O (4), [Yb(2)(1,3-BDC)(3)(phen)(1/2)](n) (5), and [Yb(2)(1,4-BDC)(3)(phen)(2)(H(2)O)](n) (6), were synthesized by hydrothermal reactions of lanthanide chlorides with three isomers of benzenedicarboxylic acid (H(2)BDC) and 1,10-phenanthroline (phen), and characterized by single-crystal X-ray diffraction. 1 has a 2-D herringbone architecture with a Z-shaped cavity. 2 and 5 have different 3-D networks, but both are formed by 1,3-BDC anions bridging metal centers (Eu or Yb) via carboxylate groups. 3 and 6 possess similar layer structures which are further constructed to form 3-D networks by hydrogen bonds and/or pi-pi aromatic interactions. 4 comprises 1-D chains that are further interlinked via hydrogen bonds, resulting in a 3-D network. In the three europium complexes, all the europium ions are eight-coordinated, while the coordination numbers of the ytterbium ions in other three-coordination polymers range from six to eight. Crystal data: for 1, monoclinic, space group P2(1)/c, with a = 12.565(6) A, b = 16.005(8) A, c = 12.891(6) A, beta = 102.173(8) degrees, and Z = 4; for 2, monoclinic, space group P2(1)/c, with a = 20.979(4) A, b = 11.5989(19) A, c = 20.810(3) A, beta = 110.391(3) degrees, and Z = 4; for 3, triclinic, space group P1, with a = 10.331(5) A, b = 10.887(5) A, c = 11.404(5) A, alpha = 107.660(7) degrees, beta = 91.787(7) degrees, gamma = 112.946(6) degrees, and Z = 2; for 4, triclinic, space group P1, with a = 11.517(5) A, b = 13.339(5) A, c = 13.595(6) A, alpha = 87.888(7) degrees, beta = 67.759(6) degrees, gamma = 68.070(6) degrees, and Z = 2; for 5, orthorhombic, space group C222(1), with a = 8.174(2) A, b = 24.497(7) A, c = 29.161(8) A, and Z = 8; for 6, triclinic, space group P1, with a = 10.349(3) A, b = 11.052(3) A, c = 19.431(6) A, alpha = 105.464(4) degrees, beta = 91.300(5) degrees, gamma = 93.655(5) degrees, and Z = 2. The magnetic properties of 1 and 4 were investigated. The photophysical properties of 1 were also studied.