共查询到20条相似文献,搜索用时 31 毫秒
1.
A series of linear-type Co(III)Pt(II)Co(III) trinuclear complexes composed of C(2)-cis(S)-[Co(aet)(2)(en)](+) (aet = 2-aminoethanethiolate) and/or Lambda(D)-trans(N)-[Co(D-pen-N,O,S)(2)](-) (D-pen = D-penicillaminate) were newly prepared, and their chiral behavior, which is markedly different from that of the corresponding Co(III)Pd(II)Co(III) complexes, is reported. The 1:1 reaction of an S-bridged Co(III)Ni(II)Co(III) trinuclear complex, [Ni[Co(aet)(2)(en)](2)]Cl(4), with K(2)[PtCl(4)] in water gave an S-bridged Co(III)Pt(II)Co(III) trinuclear complex, [Pt[Co(aet)(2)(en)](2)]Cl(4) ([1]Cl(4)), while the corresponding 1:2 reaction produced an S-bridged Co(III)Pt(II) dinuclear complex, [PtCl(2)[Co(aet)(2)(en)]]Cl ([2]Cl). Complex [1](4+) formed both racemic (DeltaDelta/LambdaLambda) and meso (DeltaLambda) forms, which were separated and optically resolved by cation-exchange column chromatography. An optically active S-bridged Co(III)Pt(II)Co(III) trinuclear complex having the pseudo LambdaLambda configuration, Lambda(D)Lambda(D)-[Pt[Co(D-pen-N,O,S)(2)](2)](0) (Lambda(D)Lambda(D)-[3]), was also prepared by reacting Lambda(D)-trans(N)-K[Co(D-pen-N,O,S)(2)] with K(2)[PtCl(4)] in a ratio of 2:1 in water. Treatment of the racemic Delta/Lambda-[2]Cl with Lambda(D)-trans(N)-K[Co(D-pen-N,O,S)(2)] in a ratio of 1:1 in water led to the formation of LambdaLambda(D)- and DeltaLambda(D)-[Pt[Co(aet)(2)(en)][Co(D-pen-N,O,S)(2)]](2+) (LambdaLambda(D)- and DeltaLambda(D)-[4](2+)) and DeltaDelta(D)-[Pt[Co(aet)(2)(en)][Co(D-pen-N,S)(2)(H(2)O)(2)]](2+) (DeltaDelta(D)-[4'](2+)), besides trace amounts of Lambda(D)Lambda(D)-[3] and DeltaDelta- and DeltaLambda-[1](4+). These Co(III)Pt(II)Co(III) complexes were characterized on the basis of electronic absorption, CD, and NMR spectra, along with single-crystal X-ray analyses for DeltaDelta/LambdaLambda-[1]Cl(4), DeltaLambda-[1]Cl(4), and DeltaLambda(D)-[4]Cl(2). Crystal data: DeltaDelta/LambdaLambda-[1]Cl(4).6H(2)O, monoclinic, space group C2/c with a = 14.983(3) A, b = 19.857(4) A, c = 12.949(3) A, beta = 113.51(2) degrees, V = 3532(1) A(3), Z = 4; DeltaLambda-[1]Cl(4).3H(2)O, orthorhombic, space group Pbca with a = 14.872(3) A, b = 14.533(3) A, c = 14.347(2) A, V = 3100(1) A(3), Z = 4; DeltaLambda(D)-[4]Cl(2).6H(2)O, monoclinic, space group P2(1) with a = 7.3836(2) A, b = 20.214(1) A, c = 10.622(2) A, beta = 91.45(1) degrees V = 1682.0(4) A(3), Z = 2. 相似文献
2.
Treatment of [RuCl(2)(DMSO)(4)] with 2-aminoethanethiol (Haet) in ethanol gave a dicationic triruthenium complex, [Ru[Ru(aet)(3)](2)]Cl(2) ([1]Cl(2)). Complex [1]Cl(2) was also obtained by treatment of RuCl(3).nH(2)O with excess Haet in water. When [1](2+) was chromatographed on a cation-exchange column of SP-Sephadex C-25, meso (DeltaLambda) and racemic (DeltaDelta/LambdaLambda) isomers of the corresponding tricationic complex, [Ru[Ru(aet)(3)](2)](3+) ([2](3+)), were eluted with aqueous NaNO(3). The racemic isomer of [2](3+) was optically resolved into DeltaDelta and LambdaLambda isomers by using [Sb(2)(R,R-tartrato)(2)](2-) as a resolving agent. The molecular structures of DeltaLambda- and DeltaDelta/LambdaLambda-[2](NO(3))(3) were determined by X-ray crystallography. In these complexes, the central Ru atom is coordinated by six thiolato groups from two terminal fac-(S)-[Ru(aet)(3)] units in an octahedral geometry, forming a linear-type S-bridged triruthenium structure. The spectroelectrochemical studies on the electronic absorption and CD spectra, together with the electrochemical studies, demonstrated that [1](2+) and [2](3+) are interconvertible with each other through a one-electron redox process, retaining the chirality of the triruthenium structure. Their electronic structures were investigated on the basis of EPR and magnetic susceptibility measurements, which indicated that [1](2+) and [2](3+) have spin ground states of S(t) = 0 and S(t) = 1/2, respectively. The corresponding L-cysteinato complex, [Ru[Ru(L-cys-N,S)(3)](2)](3-), which was formed from RuCl(3).nH(2)O and excess L-cysteine (L-H(2)cys) in water followed by air oxidation, is also presented. 相似文献
3.
Nock B Maina T Tisato F Papadopoulos M Raptopoulou CP Terzis A Chiotellis E 《Inorganic chemistry》2000,39(10):2178-2184
A series of octahedral six-coordinate oxorhenium(V) mixed ligand complexes containing the common [ReO(L)]2+ fragment (L = o-OC6H4P(C6H5)2] have been synthesized and characterized. Hence, it was shown that the [ReO(L)]2+ moiety can accommodate a variety of tridentate ligands containing a central amine group amenable to deprotonation and different combinations of lateral groups, such as ethylamine, substituted ethylamine, ethylthiol, and ethylthioether arms. In particular, by reaction of equimolar amounts of the pertinent HLn ligands with the [(n-C4H9)4N][ReOCl3(L)] precursor in refluxing acetonitrile/methanol or dichloromethane/methanol mixtures, the following series of [ReO(Ln)(L)]+/0 oxorhenium(V) complexes has been generated: ReO[[N(CH2CH2NH2)2][o-OC6H4P(C6H5)2]]Cl (1); ReO[[C2H5)2NCH2CH2NCH2CH2S][o-OC6H4P5)2]] (2); ReO[[(CH2)4NCH2CH2NCH2CH2S][o-OC6H4P(C6H4P(C6H5)2]] (3); and ReO[[C2H5SCH2CH2NCH2CH2S][o-OC6H4P(C6H5)2]] (4). The complexes are closed-shell 18-electron oxorhenium species, which adopt octahedral geometries both in solution and in the solid state, as established by conventional physicochemical techniques including multinuclear NMR and single-crystal X-ray diffraction analyses. 相似文献
4.
The reaction of [Ni[Co(aet)(2)(pyt)](2)](2+) (aet = 2-aminoethanethiolate, pyt = 2-pyridinethiolate) with [PtCl(4)](2)(-) gave an S-bridged Co(III)Pt(II)Co(III) trinuclear complex composed of two [Co(aet)(2)(pyt)] units, [Pt[Co(aet)(2)(pyt)](2)](2+) ([1](2+)). When a 1:1 mixture of [Ni[Co(aet)(2)(pyt)](2)](2+) and [Ni[Co(aet)(2)(en)](2)](4+) was reacted with [PtCl(4)](2)(-), a mixed-type S-bridged Co(III)Pt(II)Co(III) complex composed of one [Co(aet)(2)(pyt)] and one [Co(aet)(2)(en)](+) units, [Pt[Co(aet)(2)(en)][Co(aet)(2)(pyt)]](3+) ([2](3+)), was produced, together with [1](2+) and [Pt[Co(aet)(2)(en)](2)](4+). The corresponding Co(III)Pt(II)Co(III) trinuclear complexes containing pymt (2-pyrimidinethiolate), [Pt[Co(aet)(2)(pymt)](2)](2+) ([3](2+)) and [Pt[Co(aet)(2)(en)][Co(aet)(2)(pymt)]](3+) ([4](3+)), were also obtained by similar reactions, using [Ni[Co(aet)(2)(pymt)](2)](2+) instead of [Ni[Co(aet)(2)(pyt)](2)](2+). While [Pt[Co(aet)(2)(en)](2)](4+) formed both the deltalambda (meso) and deltadelta/lambdalambda (racemic) forms in a ratio of ca. 1:1, the preferential formation of the deltadelta/lambdalambda form was observed for [1](2+) (ca. deltalambda:deltadelta/lambdalambda = 1:3) and [2](3+) (ca. delta(en)lambda(pyt)/lambda(en)delta(pyt):deltadelta/lambdalambda = 1:2). Furthermore, [3](2+) and [4](3+) predominantly formed the deltadelta/lambdalambda form. These results indicate that the homochiral selectivity for the S-bridged Co(III)Pt(II)Co(III) trinuclear complexes composed of two octahedral [Co(aet)(2)(L)](0 or +) units is enhanced in the order L = en < pyt < pymt. The isomers produced were separated and optically resolved, and the crystal structures of the meso-type deltalambda-[1]Cl(2).4H(2)O and the spontaneously resolved deltadelta-[4](ClO(4))(3).H(2)O were determined by X-ray analyses. In deltalambda-[1](2+), the delta and Lambda configurational mer(S).trans(N(aet))-[Co(aet)(2)(pyt)] units are linked by a square-planar Pt(II) ion through four aet S atoms to form a linear-type S-bridged trinuclear structure. In deltadelta-[4](3+), a similar linear-type trinuclear structure is constructed from the delta-mer(S).trans(N(aet))-[Co(aet)(2)(pymt)] and delta-C(2)-cis(S)-[Co(aet)(2)(en)](+) units that are bound by a Pt(II) ion with a slightly distorted square-planar geometry through four aet S atoms. 相似文献
5.
Betke U Neuschulz K Wickleder MS 《Chemistry (Weinheim an der Bergstrasse, Germany)》2011,17(45):12784-12801
Oxide methanesulfonates of Mo, U, Re, and V have been prepared by reaction of MoO(3), UO(2)(CH(3)COO)(2)·2H(2)O, Re(2)O(7)(H(2)O)(2), and V(2)O(5) with CH(3)SO(3)H or mixtures thereof with its anhydride. These compounds are the first examples of solvent-free oxide methanesulfonates of these elements. MoO(2)(CH(3)SO(3))(2) (Pbca, a=1487.05(4), b=752.55(2), c=1549.61(5) pm, V=1.73414(9) nm(3), Z=8) contains [MoO(2)] moieties connected by [CH(3)SO(3)] ions to form layers parallel to (100). UO(2)(CH(3)SO(3))(2) (P2(1)/c, a=1320.4(1), b=1014.41(6), c=1533.7(1) pm, β=112.80(1)°, V=1.8937(3) nm(3), Z=8) consists of linear UO(2)(2+) ions coordinated by five [CH(3)SO(3)] ions, forming a layer structure. VO(CH(3)SO(3))(2) (P2(1)/c, a=1136.5(1), b=869.87(7), c=915.5(1) pm, β=113.66(1)°, V=0.8290(2) nm(3), Z=4) contains [VO] units connected by methanesulfonate anions to form corrugated layers parallel to (100). In ReO(3)(CH(3)SO(3)) (P1, a=574.0(1), b=1279.6(3), c=1641.9(3) pm, α=102.08(2), β=96.11(2), γ=99.04(2)°, V=1.1523(4) nm(3), Z=8) a chain structure exhibiting infinite O-[ReO(2)]-O-[ReO(2)]-O chains is formed. Each [ReO(2)]-O-[ReO(2)] unit is coordinated by two bidentate [CH(3)SO(3)] ions. V(2)O(3)(CH(3)SO(3))(4) (I2/a, a=1645.2(3), b=583.1(1), c=1670.2(3) pm, β=102.58(3), V=1.5637(5) pm(3), Z=4) adopts a chain structure, too, but contains discrete [VO]-O-[VO] moieties, each coordinated by two bidentate [CH(3)SO(3)] ligands. Additional methanesulfonate ions connect the [V(2)O(3)] groups along [001]. Thermal decomposition of the compounds was monitored under N(2) and O(2) atmosphere by thermogravimetric/differential thermal analysis and XRD measurements. Under N(2) the decomposition proceeds with reduction of the metal leading to the oxides MoO(2), U(3)O(7), V(4)O(7), and VO(2); for MoO(2)(CH(3)SO(3))(2), a small amount of MoS(2) is formed. If the thermal decomposition is carried out in a atmosphere of O(2) the oxides MoO(3) and V(2)O(5) are formed. 相似文献
6.
《Journal of Coordination Chemistry》2012,65(5):819-827
A series of anionic five-coordinate binary oxorhenium(V) complexes with dithiolato ligands, Bu4N[ReO(L1)2] (1a), Bu4N[ReO(L2)2] (1b), and Bu4N[ReO(L3)2] (1c), and a series of neutral octahedral ternary oxorhenium(V) complexes of mixed dithiolato and bipyridine ligands, [ReO(L1)(bpy)Cl] (2a), [ReO(L2)(bpy)Cl] (2b), and [ReO(L3)(bpy)Cl] (2c) (where L1H2 = ethane-1,2-dithiol, L2H2 = propane-1,3-dithiol, L3H2 = toluene-3,4-dithiol, and bpy = 2,2′-bipyridine), were isolated and characterized by physicochemical and spectroscopic methods. The solid state structure of 1c was established by X-ray crystallography. All the mononuclear oxorhenium(V) complexes are diamagnetic. The redox behavior of all the complexes has been studied voltammetrically. 相似文献
7.
Reactions of 2-(diphenylphosphinomethyl)aniline, H(2)L(2), with (NBu(4))[ReOCl(4)] yield different oxo rhenium(V) complexes depending on the conditions applied. This comprises monomeric compounds such as [ReOCl(3)(H(2)L(2))] (1), [ReOCl(2)(OMe)(H(2)L(2))] (2), or [ReO(2)(H(2)L(2))(2)]Cl (5) as well as the dimeric μ-oxo complex [{ReOCl(2)(H(2)L(2))}(2)]O] (3) and the oxo-bridged trimer [{ReOCl(H(2)L(2))}O](3) (4). The latter compound represents the first example of a hitherto unknown trinuclear, cyclic oxo(V) core. [{ReOCl(H(2)L(2))}O](3) contains a tensed 6-membered metallacycle, which readily undergoes rearrangements and reactions with additional ligands. Compounds of the compositions 5 and [ReO(2)(H(2)L(2))(H(2)L(1))]Cl (6) were isolated either from the decomposition of 4 in CH(2)Cl(2)/n-pentane or from reactions with 2-(diphenylphosphino)aniline, H(2)L(1). 相似文献
8.
Konno T Haneishi K Hirotsu M Yamaguchi T Ito T Yoshimura T 《Journal of the American Chemical Society》2003,125(31):9244-9245
Treatment of fac(S)-[Rh(aet)3] (aet = 2-aminoethanethiolate) with aqueous HBF4 in air led to the protonation at coordinated thiolato groups to give a rhodium(III) dimer, [{Rh(aet)2(Haet)}{Rh(aet)(Haet)2}](BF4)3 ([1](BF4)3). On the other hand, similar treatment of fac(Se)-[Rh(aes)3] (aes = 2-aminoethaneselenolate) produced a dinuclear rhodium(III) complex, [Rh2(selenocystamine)3](BF4)6 ([2](BF4)6), because of the autoxidation of coordinated selenolato groups by air. The crystal structures of [1](BF4)3, DeltaDelta-[1](BF4)3, and [2](BF4)6 were determined by X-ray crystallography. In [1]3+ two RhIII octahedrons are connected through a strong triple thiol-thiolate S-H...S hydrogen bond, while two RhIII octahedrons are directly joined by a triple diselenide bond in [2]6+. The cyclic voltammetry indicated that in acidic media the RhIII center in fac(Se)-[Rh(aes)3] is more easily oxidized to RhIV than that in fac(S)-[Rh(aet)3], which is responsible for the formation of coordinated diselenide bonds. 相似文献
9.
The symmetric rhenium(V) oxo Schiff base complexes trans-[ReO(OH2)(acac2en)]Cl and trans-[ReOCl(acac2pn)], where acac2en and acac2pn are the tetradentate Schiff base ligands N,N'-ethylenebis(acetylacetone) diimine and N,N'-propylenebis(acetylacetone) diimine, respectively, were reacted with monodentate phosphine ligands to yield one of two unique cationic phosphine complexes depending on the ligand backbone length (en vs pn) and the identity of the phosphine ligand. Reduction of the Re(V) oxo core to Re(III) resulted on reaction of trans-[ReO(OH2)(acac2en)]Cl with triphenylphosphine or diethylphenylphosphine to yield a single reduced, disubstituted product of the general type trans-[Re(III)(PR3)2(acac2en)]+. Rather unexpectedly, a similar reaction with the stronger reducing agent triethylphosphine yielded the intramolecularly rearranged, asymmetric cis-[Re(V)O(PEt3)(acac2en)]+ complex. Reactions of trans-[Re(V)O(acac2pn)Cl] with the same phosphine ligands yielded only the rearranged asymmetric cis-[Re(V)O(PR3)(acac2pn)]+ complexes in quantitative yield. The compounds were characterized using standard spectroscopic methods, elemental analyses, cyclic voltammetry, and single-crystal X-ray diffraction. The crystallographic data for the structures reported are as follows: trans-[Re(III)(PPh3)2(acac2en)]PF6 (H48C48N2O2P2Re.PF6), 1, triclinic (P), a = 18.8261(12) A, b = 16.2517(10) A, c = 15.4556(10) A, alpha = 95.522(1) degrees , beta = 97.130(1) degrees , gamma = 91.350(1) degrees , V = 4667.4(5) A(3), Z = 4; trans-[Re(III)(PEt2Ph)2(acac2en)]PF6 (H48C32N2O2P2Re.PF6), 2, orthorhombic (Pccn), a = 10.4753(6) A, b =18.4315(10) A, c = 18.9245(11) A, V = 3653.9(4) A3, Z = 4; cis-[Re(V)O(PEt3)(acac2en)]PF6 (H33C18N2O3PRe.1.25PF6, 3, monoclinic (C2/c), a = 39.8194(15) A, b = 13.6187(5) A, c = 20.1777(8) A, beta = 107.7730(10) degrees , V = 10419.9(7) A3, Z = 16; cis-[Re(V)O(PPh3)(acac2pn)]PF6 (H35C31N2O3PRe.PF6), 4, triclinic (P), a = 10.3094(10) A, b =12.1196(12) A, c = 14.8146(15) A, alpha = 105.939(2) degrees , beta = 105.383(2) degrees , gamma = 93.525(2) degrees , V = 1698.0(3) A3, Z = 2; cis-[Re(V)O(PEt2Ph)(acac2pn)]PF6 (H35C23N2O3PRe.PF6), 5, monoclinic (P2(1)/n), a = 18.1183(18) A, b = 11.580(1) A, c = 28.519(3) A, beta = 101.861(2) degrees , V = 5855.9(10) A(3), Z = 4. 相似文献
10.
Cationic Re(V) oxo complexes with poly(pyrazolyl)borates: synthesis, characterization, and stability
Cationic Re(V) oxo compounds of the type [ReO(OSiMe3)(eta 2-B(pz)4)(L)2]X [X = Cl, L = 4-(NMe2)C5H4N (1), 1-Meimz (1-methylimidazole; 2), 1/2 dmpe (1,2-bis(dimethylphosphino)ethane; 3), py (4a); X = I, L = py (4b)] can be prepared by reacting trans-[ReO2(eta 2-B(pz)4)(L)2] with XSiMe3. In solution, cations 1-4 are reactive species, and those with unidentate nitrogen donor ligands (1, 2, and 4) rearrange into the neutral derivatives [ReO(Cl)(OSiMe3)(eta 2-B(pz)4)(L)] [L = py (5), 4-(NMe2)C5H4N (6), 1-Meimz (7)], which are also reported herein. Compounds 1-3 and 5-7 have been fully characterized by the usual spectroscopic techniques, which in some cases includes X-ray crystallographic analysis (3, 6, and 7). Compound 3 crystallizes from CH2Cl2/n-hexane as yellow crystals with one molecule of CH2Cl2 solvent, and compounds 6 and 7 crystallize from THF/n-hexane as violet and red crystals, respectively, with one molecule of THF solvent in the case of 6. Crystallographic data: 3, orthorhombic space group Pn2(1)a, a = 11.311(2) A, b = 19.135(2) A, c = 15.443(2) A, V = 3342.4(8) A3, Z = 4; 6, triclinic space group P1, a = 8.7179(11) A, b = 12.5724(8) A, c = 17.750(2) A, alpha = 70.454(7) degrees, beta = 77.935(9) degrees, gamma = 77.129(8) degrees, V = 1768.1(3) A3, Z = 2; 7, monoclinic space group P2(1)/c, a = 16.356(2) A, b = 20.384(3) A, c = 17.360(3) A, beta = 106.971(12) degrees, V = 5535.8(14) A3, Z = 8. 相似文献
11.
《Journal of Coordination Chemistry》2012,65(10):1171-1182
5,12-dioxa-7,14-dimethyl-1,4,8,11-tetraazacyclotetradeca-1,8-diene (N4L) reacts with the starting oxorhenium(V) complex, H2[ReOCl5], to yield either mononuclear [ReO(N4L)(OH2)]Cl3, or dinuclear [Re2O3(N4L)2]Cl4·2H2O depending on the concentration of hydrochloric acid in rhenium complex. The reaction of (N4L) mixed with KSCN or PPh3 with the oxorhenium(V) complex in 6N HCl, yielded the mononuclear complexes [ReO(N4L)(SCN)]Cl2·H2O and [ReO(N4L)(PPh3)]Cl3·H2O respectively. Both complexes have an octahedral configuration. These complexes decompose through several isolable, as well as non-isolable, intermediates during heating. [Re2O3(N4L\)2] (N4L\ = dianionic tetradentate ions), [ReO(N4L)Cl]Cl2 and [ReO(N4L\)(SCN)], were synthesized pyrolytically in the solid state from the corresponding rhenium(V) complexes. All have octahedral configurations. The ligand (N4L) behaves in these complexes either as a neutral tetradentate or dianionic tetradentate ligand towards the oxorhenium ions. All complexes and the corresponding thermal products were isolated and their structures were elucidated by elemental analyses, conductance, IR and electronic absorption spectra, magnetic moments, 1H NMR and TG-DSC measurements as well as by mass spectroscopy. 相似文献
12.
Mandal D Chatterjee PB Ganguly R Tiekink ER Clérac R Chaudhury M 《Inorganic chemistry》2008,47(2):584-591
The tetra- and binuclear heterometallic complexes of nickel(II)-vanadium(IV/V) combinations involving a phenol-based primary ligand, viz., N,N'-dimethyl-N,N'-bis(2-hydroxy-3,5-dimethylbenzyl)ethylenediamine (H2L1), are reported in this work. Carboxylates and beta-diketonates have been used as ancillary ligands to obtain the tetranuclear complexes [Ni(II)(2)V(V)(2)(RCOO)(2)(L(1))(2)O(4)] (R = Ph, 1; R = Me(3)C, 2) and the binuclear types [(beta-diket)Ni(II)L(1)V(IV)O(beta-diket)] (3 and 4), respectively. X-ray crystallography shows that the tetranuclear complexes are constructed about an unprecedented heterometallic eight-membered Ni(2)V(2)O(4) core in which the (L(1))(2)- ligands are bound to the Ni center in a N(2)O(2) mode and simultaneously bridge a V atom via the phenoxide O atoms. The cis-N(2)O(4) coordination geometry for Ni is completed by an O atom derived from the bridging carboxylate ligand and an oxo O atom. The latter two atoms, along with a terminal oxide group, complete the O5 square-pyramidal coordination geometry for V. Each of the dinuclear compounds, [(acac)Ni(II)L(1)V(IV)O(acac)] (3) and [(dbm)Ni(II)L(1)V(IV)O(dbm)] (4) [Hdbm = dibenzoylmethane], also features a tetradentate (L(1))(2)- ligand, Ni in an octahedral cis-N(2)O(4) coordination geometry, and V in an O(5) square-pyramidal geometry. In 3 and 4, the bridges between the Ni and V atoms are provided by the (L(1))(2)- ligand. The Ni...V separations in the structures lie in the narrow range of 2.9222(4) A (3) to 2.9637(5) A (4). The paramagnetic Ni centers (S = 1) in 1 and 2 are widely separated (Ni...Ni separations are 5.423 and 5.403 A) by the double V(V)O(4) bridge that leads to weak antiferromagnetic interactions (J = -3.6 and -3.9 cm-1) and thus an ST = 0 ground state for these systems. In 3 and 4, the interactions between paramagnetic centers (Ni(II) and V(IV)) are also antiferromagnetic (J = -8.9 and -10.0 cm-1), leading to an S(T) = 1/2 ground state. Compound 4 undergoes two one-electron redox processes at E(1/2) = +0.66 and -1.34 V vs Ag/AgCl reference due to a V(IV/V) oxidation and a Ni(II)/I reduction, respectively, as indicated by cyclic and differential pulse voltammetry. 相似文献
13.
Several rhenium(V) oxo complexes with tetradentate N(2)O(2) Schiff base ligands were synthesized and characterized. The general synthetic procedure involved reaction of [NBu(4)][ReOCl(4)] with a tetradentate Schiff base ligand (L(1) = N,N'-ethylenebis(acetylacetoneimine), (acac(2)en) or L(2) = N,N'-propylenebis(acetylacetoneimine) (acac(2)pn)) in ethanol solution to generate complexes of the form trans-ReOX(L) where X = Cl(-), MeO(-), ReO(4)(-), or H(2)O. The product isolated from the reaction was found to be dependent on the reaction conditions, in particular the presence or absence of water and/or base. The mu-oxo-Re(2)O(3)(L)(2) dimers were synthesized and characterized for chemical and structural comparison to the related monomers. Conversion of the monomer to its dimer analogue was followed qualitatively by spectrophotometry. The complexes were characterized by (1)H and (13)C NMR, UV-vis, and IR spectroscopy, elemental analysis, and single crystal X-ray diffraction. The crystallographic data reported for the structures are as follows: trans-[ReO(OH(2))(acac(2)en)]Cl (H(20)C(12)ClN(2)O(4)Re) 1, triclinic (Ponemacr;), a = 7.2888(6) A, b = 9.8299(8) A, c = 10.8195(9) A, alpha = 81.7670(10) degrees, beta = 77.1510(10) degrees, gamma = 87.6200(10) degrees, V = 747.96(11) A(3), Z = 2; trans-[ReO(OReO(3))(acac(2)en)] (H(18)C(12)N(2)O(7)Re(2)) 2, monoclinic (P2(1)/c), a = 7.5547(4) A, b = 8.7409(5) A, c= 25.7794(13) A, beta = 92.7780(10) degrees, V = 1700.34(16) A(3), Z = 4; trans-[ReOCl(acac(2)pn)] (H(20)C(13)N(2)O(3)ClRe) 3, monoclinic (P2(1)/c), a = 8.1628(5) A, b = 13.0699(8) A, c = 28.3902(17) A, beta = 97.5630(10) degrees, V = 3002.5(3) A(3), Z = 8; trans-[ReO(OMe)(acac(2)pn)] (H(23)C(14)N(2)O(4)Re) 4, monoclinic (P2(1)/c), a = 6.7104(8) A, b = 27.844(3) A, c = 8.2292(9) A, beta = 92.197(2) degrees, V = 1536.4(3) A(3), Z = 4; trans-[mu-oxo-Re(2)O(3)(acac(2)en)(2)] (H(36)C(24)N(4)O(7)Re(2)) 5, monoclinic (P2(1)/n), a = 9.0064(5) A, b = 12.2612(7) A, c = 12.3695(7) A, beta = 90.2853(10) degrees, V = 1365.94(13) A(3), Z = 2; and trans-[mu-oxo Re(2)O(3)(acac(2)pn)(2)] (H(40)C(26)N(4)O(7)Re(2)) 6, monoclinic (P2(1)/n), a = 9.1190(5) A, b = 12.2452(7) A, c = 12.8863(8) A, beta = 92.0510(10) degrees, V = 1438.01(14) A(3), Z = 2. 相似文献
14.
Xu L Setyawati IA Pierreroy J Pink M Young VG Patrick BO Rettig SJ Orvig C 《Inorganic chemistry》2000,39(26):5958-5963
The oxorhenium(V) complexes with ligands containing N4 (H2pmen) and N4O2 (H2bbpen, H2Clbbpen, and H2bped) donor atom sets have been synthesized. X-ray crystallographic analyses of the [ReO(H2pmen)Cl2]+, [ReO(bbpen)]+, and [ReO(bped)]+ complexes showed that all three cations share a rare seven-coordinate structure with a distorted pentagonal bipyramidal geometry, which represents a novel and potentially general structural motif in ReV = O complexes. 1H NMR spectroscopy shows that the structures of the complexes are retained in the solution. 相似文献
15.
cis-[Ru(NO)Cl(pyca)(2)] (pyca = 2-pyridinecarboxylato), in which the two pyridyl nitrogen atoms of the two pyca ligands coordinate at the trans position to each other and the two carboxylic oxygen atoms at the trans position to the nitrosyl ligand and the chloro ligand, respectively (type I shown as in Chart 1), reacted with NaOCH(3) to generate cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I). The geometry of this complex was confirmed to be the same as the starting complex by X-ray crystallography: C(13.5)H(13)N(3)O(6.5)Ru; monoclinic, P2(1)/n; a = 8.120(1), b = 16.650(1), c = 11.510(1) A; beta = 99.07(1) degrees; V = 1536.7(2) A(3); Z = 4. The cis-trans geometrical change reaction occurred in the reactions of cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I) in water and alcohol (ROH, R = CH(3), C(2)H(5)) to form [[trans-Ru(NO)(pyca)(2)](2)(H(3)O(2))](+) (type V) and trans-[Ru(NO)(OR)(pyca)(2)] (type V). The reactions of the trans-form complexes, trans-[Ru(NO)(H(2)O)(pyca)(2)](+) (type V) and trans-[Ru(NO)(OCH(3))(pyca)(2)] (type V), with Cl(-) in hydrochloric acid solution afforded the cis-form complex, cis-[Ru(NO)Cl(pyca)(2)] (type I). The favorable geometry of [Ru(NO)X(pyca)(2)](n)(+) depended on the nature of the coexisting ligand X. This conclusion was confirmed by theoretical, synthetic, and structural studies. The mono-pyca-containing nitrosylruthenium complex (C(2)H(5))(4)N[Ru(NO)Cl(3)(pyca)] was synthesized by the reaction of [Ru(NO)Cl(5)](2)(-) with Hpyca and characterized by X-ray structural analysis: C(14)H(24)N(3)O(3)Cl(3)Ru; triclinic, Ponemacr;, a = 7.631(1), b = 9.669(1), c = 13.627(1) A; alpha = 83.05(2), beta = 82.23(1), gamma = 81.94(1) degrees; V = 981.1(1) A(3); Z = 2. The type II complex of cis-[Ru(NO)Cl(pyca)(2)] was synthesized by the reaction of [Ru(NO)Cl(3)(pyca)](-) or [Ru(NO)Cl(5)](2)(-) with Hpyca and isolated by column chromatography. The structure was determined by X-ray structural analysis: C(12)H(8)N(3)O(5)ClRu; monoclinic, P2(1)/n; a = 10.010(1), b = 13.280(1), c = 11.335(1) A; beta = 113.45(1) degrees; V = 1382.4(2) A(3); Z = 4. 相似文献
16.
Triantafillou GD Tolis EI Terzis A Deligiannakis Y Raptopoulou CP Sigalas MP Kabanos TA 《Inorganic chemistry》2004,43(1):79-91
Reaction of [V(IV)OCl(2)(THF)(2)] in aqueous solution with 2 equiv of AgBF(4) or AgSbF(6) and then with 2 equiv of 2,2'-bipyridine (bipy), 4,4'-di-tert-butyl-2,2'-bipyridine (4,4'-dtbipy), or 4,4'-di-methyl-2,2'-bipyridine (4,4'-dmbipy) affords compounds of the general formula cis-[V(IV)O(OH)(L(NN))(2)]Y [where L(NN) = bipy, Y = BF(4)(-) (1), L(NN) = 4,4'-dtbipy, Y = BF(4)(-) (2.1.2H(2)O), L(NN) = 4,4'-dmbipy, Y = BF(4)(-) (3.2H(2)O), and L(NN) = 4,4'-dtbipy, Y = SbF(6)(-) (4)]. Sequential addition of 1 equiv of Ba(ClO(4))(2) and then of 2 equiv of bipy to an aqueous solution containing 1 equiv of V(IV)OSO(4).5H(2)O yields cis-[V(IV)O(OH)(bipy)(2)]ClO(4) (5). The monomeric compounds 1-5 contain the cis-[V(IV)O(OH)](+) structural unit. Reaction of 1 equiv of V(IV)OSO(4).5H(2)O in water and of 1 equiv of [V(IV)OCl(2)(THF)(2)] in ethanol with 2 equiv of bipy gives the compounds cis-[V(IV)O(OSO(3))(bipy)(2)].CH(3)OH.1.5H(2)O (6.CH(3)OH.1.5H(2)O) and cis-[V(IV)OCl(bipy)(2)]Cl (7), respectively, while reaction of 1 equiv of [V(IV)OCl(2)(THF)(2)] in CH(2)Cl(2) with 2 equiv of 4,4'-dtbipy gives the compound cis-[V(IV)OCl(4,4'-dtbipy)(2)]Cl.0.5CH(2)Cl(2) (8.0.5CH(2)Cl(2)). Compounds cis-[V(IV)O(BF(4))(4,4'-dtbipy)(2)]BF(4) (9), cis-[V(IV)O(BF(4))(4,4'-dmbipy)(2)]BF(4) (10), and cis-[V(IV)O(SbF(6))(4,4'-dtbipy)(2)]SbF(6) (11) were synthesized by sequential addition of 2 equiv of 4,4'-dtbipy or 4,4'-dmbipy and 2 equiv of AgBF(4) or AgSbF(6) to a dichloromethane solution containing 1 equiv of [V(IV)OCl(2)(THF)(2)]. The crystal structures of 2.1.2H(2)O, 6.CH(3)OH.1.5H(2)O, and 8.0.5CH(2)Cl(2) were demonstrated by X-ray diffraction analysis. Crystal data are as follows: Compound 2.1.2H(2)O crystallizes in the orthorhombic space group Pbca with (at 298 K) a = 21.62(1) A, b = 13.33(1) A, c = 27.25(2) A, V = 7851(2) A(3), Z = 8. Compound 6.CH(3)OH.1.5H(2)O crystallizes in the monoclinic space group P2(1)/a with (at 298 K) a = 12.581(4) A, b = 14.204(5) A, c = 14.613(6) A, beta = 114.88(1) degrees, V = 2369(1), Z = 4. Compound 8.0.5CH(2)Cl(2) crystallizes in the orthorhombic space group Pca2(1) with (at 298 K) a = 23.072(2) A, b = 24.176(2) A, c = 13.676(1) A, V = 7628(2) A(3), Z = 8 with two crystallographically independent molecules per asymmetric unit. In addition to the synthesis and crystallographic studies, we report the optical, infrared, magnetic, conductivity, and CW EPR properties of these oxovanadium(IV) compounds as well as theoretical studies on [V(IV)O(bipy)(2)](2+) and [V(IV)OX(bipy)(2)](+/0) species (X = OH(-), SO(4)(2)(-), Cl(-)). 相似文献
17.
Ozturk II Hadjikakou SK Hadjiliadis N Kourkoumelis N Kubicki M Baril M Butler IS Balzarini J 《Inorganic chemistry》2007,46(21):8652-8661
Five new antimony(III) complexes with the heterocyclic thiones 2-mercapto-benzimidazole (MBZIM), 5-ethoxy-2-mercapto-benzimidazole (EtMBZIM), and 2-mercapto-thiazolidine (MTZD) of formulas {[SbCl(2)(MBZIM)4]+.Cl-.2H(2)O. (CH(3)OH)} (1), {[SbCl(2)(MBZIM)4]+.Cl-.3H(2)O.(CH3CN)} (2), [SbCl(3)(MBZIM)2] (3), [SbCl(3)(EtMBZIM)(2)] (4), and [SbCl(3)(MTZD)2] (5) have been synthesized and characterized by elemental analysis, FT-IR, far-FT-IR, differential thermal analysis-thermogravimetry, X-ray diffraction, and conductivity measurements. Complex {[SbCl2(tHPMT)(2)]+Cl-}, (tHPMT = 2-mercapto-3,4,5,6-tetrahydro-pyrimidine), already known, was also prepared, and its X-ray crystal structure was solved. It is shown that the complex is better described as {[SbCl3(tHPMT)(2)]} (6). Crystal structures of all other complexes (1-5) have also been determined by X-ray diffraction at ambient conditions. The crystal structure of the hydrated ligand, EtMBZIM.H2O is also reported. Compound [C(28)H(24)Cl(2)N(8)S(4)Sb.2H(2)O.Cl.(CH(3)OH)] (1) crystallizes in space group P2(1), with a = 7.7398(8) A, b = 16.724(3) A, c = 13.717(2) A, beta = 98.632(11) degrees, and Z = 2. Complex [C(28)H(24)Cl(2)N(8)S(4)S(b).Cl.3H(2)O.(CH(3)CN)] (2) corresponds to space group P2(1), with a = 7.8216(8) A, b = 16.7426(17) A, c = 13.9375(16) A, beta = 99.218(10) degrees , and Z = 2. In both 1 and 2 complexes, four sulfur atoms from thione ligands and two chloride ions form an octahedral (Oh) cationic [SbS(4)Cl(2)]+ complex ion, where chlorides lie at axial positions. A third chloride counteranion neutralizes it. Complexes 1 and 2 are the first examples of antimony(III) compounds with positively charged Oh geometries. Compound [C(14)H(12)Cl(3)N(4)S(2)S(b)] (3) crystallizes in space group P, with a = 7.3034(5) A, b = 11.2277(7) A, c = 12.0172(8) A, alpha = 76.772(5) degrees, beta = 77.101(6) degrees, gamma = 87.450(5) degrees, and Z = 2. Complex [C(18)H(20)Cl(3)N(4)O(2)S(2)S(b)] (4) crystallizes in space group P1, with a = 8.6682(6) A, b = 10.6005(7) A, c = 13.0177(9) A, alpha = 84.181(6) degrees, beta = 79.358(6) degrees, gamma = 84.882(6) degrees, and Z = 2, while complex [C(6)H(10)Cl(3)N(2)S(4)S(b)] (5) in space group P2(1)/c shows a = 8.3659(10) A, b = 14.8323(19) A, c = 12.0218(13) A, beta = 99.660(12) degrees, and Z = 4 and complex [C(8)H(16)Cl(3)N(4)S(2)S(b)] (6) in space group P1 shows a = 7.4975(6) A, b = 10.3220(7) A, c = 12.1094(11) A, alpha = 71.411(7) degrees, beta = 84.244(7) degrees, gamma = 73.588(6) degrees, and Z = 2. Crystals of complexes 3-6 grown from acetonitrile solutions adopt a square-pyramidal (SP) geometry, with two sulfur atoms from thione ligands and three chloride anions around Sb(III). The equatorial plane is formed by two sulfur and two chloride atoms in complexes 3-5, in a cis-S, cis-Cl arrangement in 3 and 5 and a trans-S, trans-Cl arrangement in 4. Finally, in the case of 6, the equatorial plane is formed by three chloride ions and one sulfur from the thione ligand while the second sulfur atom takes an axial position leading to a unique SP conformation. The complexes showed a moderate cytostatic activity against tumor cell lines. 相似文献
18.
Chikamoto Y Hirotsu M Yamaguchi T Yoshimura T Konno T 《Dalton transactions (Cambridge, England : 2003)》2004,(21):3654-3661
The reaction of fac(S)-[Co(aet)(3)](aet = aminoethanethiolate) with [PdCl(4)](2-) in a 2:1 ratio in water gave an S-bridged Co(III)Pd(II)Co(III) trinuclear complex composed of two mer(S)-[Co(aet)(3)] units, [Pd[Co(aet)(3)](2)](2+)([1](2+)). In [1](2+), each of the two mer(S)-[Co(aet)(3)] units is bound to a square-planar Pd(II) ion through two of three thiolato groups, leaving two non-bridging thiolato groups at the terminal. Of two geometrical forms, syn and anti, possible for [Pd[Co(aet)(3)](2)](2+), which arise from the difference in arrangement of two terminal non-bridging thiolato groups, [1](2+) afforded only the syn form. A similar reaction of fac(S)-[Co(aet)(3)] with [PtCl(4)](2-) or trans-[PtCl(2)(NH(3))(2)] produced an analogous Co(III)Pt(II)Co(III) trinuclear complex, [Pt[Co(aet)(3)](2)](2+)([2](2+)), but both the syn and anti forms were formed for [2](2+). Complexes [1](2+) and syn- and anti-[2](2+), which exclusively exist as a racemic(DeltaDelta/LambdaLambda) form, were successfully optically resolved with use of [Sb(2)(R,R-tartrato)(2)](2-) as the resolving agent. The reaction of syn-[2](2+) with [AuCl[S(CH(2)CH(2)OH)(2)]] led to the formation of an S-bridged Co(III)(4)Pt(II)(2)Au(I)(2) octanuclear metallacycle, [Au(2)[Pt[Co(aet)(3)](2)](2)](6+)([3](6+)), while the corresponding reaction of anti-[2](2+) afforded a different product ([[4](3+)](n)) that is assumed to have a polymeric structure in [[Au[Pt[Co(aet)(3)](2)]](3+)](n). 相似文献
19.
The reaction of [Ru(solvent)2(bpy)2]2+ (bpy = 2,2'-bipyridine) with Haet (2-aminoethanethiol) in ethanol/water in the presence of Ag+ gave a thiolato-bridged RuIIAgIRuII trinuclear complex, [Ag{Ru(aet)(bpy)2}2]3+, in which two [RuII(aet)(bpy)2]+ units are linked by an AgI atom. When this complex was treated with HCl in acetonitrile/water, a disulfide-bridged RuIIRuII dinuclear complex, [Ru2(cysta)(bpy)4]4+ (cysta = cystamine), was produced as a result of the removal of an AgI atom and the autoxidation of thiolato groups. It was found that the dinuclear structure in [Ru2(cysta)(bpy)4]4+ is reverted back to [Ag{Ru(aet)(bpy)2}2]3+ by treatment with Ag+ assisted by Zn reduction. 相似文献
20.
This work is part of an effort to develop chelating agents for stable binding and easy conjugation of Re-188 to biologically interesting structures. Starting from the well-known in vivo stability of [(188)ReO(DMSA)(2)](-), we want to exploit this coordination system for the design of (188)ReO(V) chelates, which are stable toward reoxidation to perrhenate and toward ligand exchange under all conditions of radiopharmaceutical development. Therefore, a new type of tetradentate ligand has been synthesized by bridging two molecules of N,N'-diisobutyl-2,3-dimercaptosuccinamide with N-(3-aminopropyl)propane-1,3-diamine. The resulting stereoisomeric tetrathiolato S(4) ligand of composition ((i)()Bu)(2)N(O)C-C(SH)-C(SH)-C(O)NH-(CH(2))(3)-NH-(CH(2))(3)-NHC(O)-C(SH)-C(SH)-C(O)N((i)Bu)(2) forms anionic five-coordinate oxorhenium(V) complexes by a ligand-exchange reaction of NBu(4)[ReOCl(4)] in methanol. In the absence of a base, the compounds were isolated as "betaine", [ReO(S(4))], with the protonated nitrogen of the bridge serving as an internal "counterion". Two representatives have been fully characterized in both the solid and solution states and found to adopt the expected square-pyramidal coordination geometry. The equatorial plane is formed by four thiolate sulfur atoms, whereas the oxygen occupies the apical position. The orientation of the metal oxo group is exo in relation to the carbamido groups in both isomers. Both complexes are stereoisomeric regarding the junction of the triamine chain. 相似文献