Binuclear manganese compounds of potential biological significance. 1. Syntheses and structural,magnetic, and electrochemical properties of dimanganese(II) and -(II,III) complexes of a bridging unsymmetrical phenolate ligand

Reactions of the unsymmetrical phenol ligand 2-(bis(2-pyridylmethyl)aminomethyl)-6-((2-pyridylmethyl)(benzyl)aminomethyl)-4-methylphenol with Mn(OAc)(2).4H(2)O or Mn(H(2)O)(6)(ClO(4))(2) in the presence of NaOBz affords the dimanganese(II) complexes 1(CH(3)OH), [Mn(2)(L)(OAc)(2)(CH(3)OH)](ClO(4)), and 2(H(2)O), [Mn(2)(L)(OBz)(2)(H(2)O)](ClO(4)), respectively. On the other hand, reaction of the ligand with hydrated manganese(III) acetate furnishes the mixed-valent derivative 3(H(2)O), [Mn(2)(L)(OAc)(2)(H(2)O)](ClO(4))( 2). The three complexes have been characterized by X-ray crystallography. 1(CH(3)OH) crystallizes in the monoclinic system, space group P2(1)/c, with a = 10.9215(6) A, b = 20.2318(12) A, c = 19.1354(12) A, alpha = 90 degrees, beta = 97.5310(10) degrees, gamma = 90 degrees, V = 4191.7 A(3), and Z = 4. 2(H(2)O) crystallizes in the monoclinic system, space group P2(1)/n, with a = 10.9215(6) A, b = 20.2318(12) A, c = 19.1354(12) A, alpha = 90 degrees, beta = 97.5310(10) degrees, gamma = 90 degrees, V = 4191.7 A(3), and Z = 4. 3(H(2)O) crystallizes in the monoclinic system, space group P2(1)/c, with a = 11.144(6) A, b = 18.737(10) A, c = 23.949(13) A, alpha = 90 degrees, beta = 95.910(10) degrees, gamma = 90 degrees, V = 4974(5) A(3), and Z = 4. Magnetic measurements revealed that the three compounds exhibit very similar magnetic exchange interactions -J = 4.3(3) cm(-)(1). They were used to establish tentative magneto-structural correlations which show that for the dimanganese(II) complexes -J decreases when the Mn-O(phenoxo) distance increases as expected from orbital overlap considerations. For the dimanganese(II,III) complexes, crystallographic results show that the Mn(II)-O(phenoxo) and Mn(III)-O(phenoxo) bond lengths are inversely correlated. An interesting magneto-structural correlation is found between -J and the difference between these bond lengths, delta(Mn)(-)(O) = d(Mn)()II(-)(O) - d(Mn)()III(-)(O): the smaller this difference, the larger -J. Electrochemical studies show that the mixed-valence state is favored in 1-3 by ca. 100 mV with respect to analogous complexes of symmetrical ligands, owing to the asymmetry of the electron density as found in the analogous diiron complexes.     

Syntheses, crystal structures, magnetic properties, and EPR spectra of tetranuclear copper(II) complexes featuring pairs of "roof-shaped" Cu2X2 dimers with hydroxide, methoxide, and azide bridges

Hydroxo- and methoxo-bridged tetranuclear copper(II) complexes of the tetramacrocyclic ligand 1,2,4,5-tetrakis(1,4,7-triazacyclonon-1-ylmethyl)benzene (Ldur), have been prepared from [Cu4Ldur(H2O)8](ClO4)8.9H2O (1). Addition of base to an aqueous solution of 1 gave [Cu4Ldur(mu2-OH)4](ClO4)4 (2). Diffusion of MeOH into a DMF solution of 2 produces [Cu4Ldur(mu2-OMe)4](ClO4)4.HClO4.2/3MeOH (3), a complex which hydrolyzes on exposure to moisture regenerating 2. The structurally related azido-bridged complex, [Cu4Ldur(mu2-N3)4](PF6)4.4H2O.6CH3CN (4), was produced by reaction of Ldur with 4 molar equiv of Cu(OAc)2.H2O and NaN3 in the presence of excess KPF6. Compounds 2-4 crystallize in the triclinic space group P1 (No. 2) with a = 10.248(1) A, b = 12.130(2) A, c = 14.353(2) A, alpha = 82.23(1) degrees, beta = 80.79(1) degrees, gamma = 65.71(1) degrees, and Z = 1 for 2, a = 10.2985(4) A, b = 12.1182(4) A, c = 13.9705(3) A, alpha = 89.978(2) degrees, beta = 82.038(2) degrees, gamma = 65.095(2) degrees, and Z = 1 for 3, and a = 12.059(2) A, b = 12.554(2) A, c = 14.051(2) A, alpha = 91.85(1) degrees, beta = 98.22(1) degrees, gamma = 105.62(1) degrees, and Z = 1 for 4. The complexes feature pairs of isolated dibridged copper(II) dimers with "roof-shaped" Cu2(mu2-X)2 cores (X = OH-, OMe-, N3-), as indicated by the dihedral angle between the two CuX2 planes (159 degrees for 2, 161 degrees for 3, and 153 degrees for 4). This leads to Cu.Cu distances of 2.940(4) A for 2, 2.962(1) A for 3, and 3.006(5) A for 4. Variable-temperature magnetic susceptibility measurements indicate weak antiferromagnetic coupling (J = -27 cm(-1)) for the hydroxo-bridged copper(II) centers in 2 and very strong antiferromagnetic coupling (J = -269 cm(-1)) for the methoxo-bridged copper(II) centers in 3. Pairs of copper(II) centers in 4 display the strongest ferromagnetic interaction (J = 94 cm(-1)) reported thus far for bis(mu2-1,1-azido)-bridged dicopper units. Spectral measurements on a neat powdered sample of 4 at 33.9 GHz or 90 Ghz confirm the spin-triplet ground state for the azido-bridged copper(II) pairs.     

Synthesis, characterization, and spontaneous resolution of chiral nickel(II) complexes with the tripod ligand tris[2-(((2-phenylimidazol-4-yl)methylidene)amino)ethyl]amine

The chiral nickel(II) complexes of a tripod-type ligand with the chemical formulas [Ni(H3L)](NO3)2.MeOH (1), [Ni(H3L)](ClO4)2.MeOH (2), and [Ni(H3L)](C6H5COO)2.6H2O (3) were synthesized and characterized (H3L = tris[2-(((2-phenylimidazol-4-yl)methylidene)amino)ethyl]amine). The crystal structures of 1-3 were determined by their single-crystal X-ray analyses. 1, C37H40N12O7Ni: orthorhombic, P2(1)2(1)2(1); a = 14.198(2) A, b = 22.422(2) A, c = 12.019(2) A, Z = 4. 2, C37H40N10O9Cl2Ni: orthorhombic, P2(1)2(1)2(1); a = 14.206(2) A, b = 22.735(3) A, c = 12.696(3) A, Z = 4. 3, C50H58N10O10Ni: triclinic, P1; a = 14.191(5) A, b = 16.048(4) A, c = 13.692(4) A, alpha = 115.25(2) degrees, beta = 111.07(3) degrees, gamma = 64.75(2) degrees, Z = 2. Each complex has an octahedral coordination environment for the nickel(II) ion, formed by the six nitrogen donor atoms, and is either a delta (clockwise) or a lambda (anticlockwise) enantiomorph, depending on the screw arrangement of the tripod-type ligand around the nickel(II) ion. The circular dichroism (CD) spectrum of a powdered sample of a crystal of 1 showed a positive and a negative peak at 915 and 630 nm, respectively, and that of another crystal showed an enantiomeric pattern. The observation of the Cotton effect and the crystal structure provided evidence for spontaneous resolution of the chiral complex molecule.     

Structure and properties of dinuclear manganese(III) complexes with pentaanionic pentadentate ligands including alkoxo, amido, and phenoxo donors

Doubly bridged mu-alkoxo-mu-X (X = pyrazolato or acetato) dinuclear MnIII complexes of 2-hydroxy-N-{2-hydroxy-3-[(2-hydroxybenzoyl)amino]propyl}benzamide) (H5L1) and 2-hydroxy-N-{2-hydroxy-4-[(2-hydroxybenzoyl)amino]butyl}benzamide (H5L2), [Mn2(L)(pz)(MeOH)4].xMeOH (1, L = L1, x = 0.5; 2, L = L2, x = 0; Hpz = pyrazole) and [Mn2(L1)(OAc)(MeOH)4] (3), have been prepared, and their structure and magnetic properties have been studied. The X-ray diffraction analysis of 1 (C24.5H34Mn2N4O9.5, triclinic, P, a = 12.2050(7) A, b = 12.7360(8) A, c = 19.2780(10) A, alpha = 99.735(5) degrees , beta = 96.003(4) degrees , gamma = 101.221(5) degrees , V = 2867.6(3) A3, Z = 4), 2 (C25H34Mn2N4O9, triclinic, P, a = 9.4560(5) A, b = 11.0112(5) A, c = 13.8831(6) A, alpha = 90.821(4) degrees , beta = 92.597(4) degrees , gamma = 93.403(4) degrees , V = 1441.29(12) A3, Z = 2), and 3 (C23H32Mn2N2O11, triclinic, P, a = 10.511(5) A, b = 11.713(5) A, c = 13.135(5) A, alpha = 64.401(5) degrees , beta = 74.000(5) degrees , gamma = 66.774(5) degrees , V = 1329.3(10) A3, Z = 2) revealed that all complexes consist of dinuclear units which are further extended into 1D (1 and 3) and 2D (2) supramolecular networks via hydrogen-bonding interactions. Magnetic susceptibility data evidence antiferromagnetic interactions for all three complexes: J = -3.6 cm-1, D approximately 0 cm-1, g = 1.93 (1); J = -2.7 cm-1, D = 0.8 cm-1, g = 1.93 (2); J = -4.9 cm-1, D = 3.8 cm-1, g = 1.95 (3).     

Ferromagnetic heterotrinuclear Cu-Ni complexes of a compartmental chiral Schiff base

Nickel(II) and copper(II) acetate react with the trinucleating compartmental Schiff base H(4)L (H(4)L = 6,6'-(E)-3,3'-(ethane-1,2-diyl)bis(1-(2-((E)-3-bromo-5-chloro-2-hydroxybenzylideneamino)ethyl)imidazolidine-3,2-diyl)bis(2-bromo-4-chlorophenol)) to produce the heterotrinuclear complexes [Ni(2)CuL(OAc)(2)]·0.25H(2)O·2.5MeOH (1·0.25H(2)O·2.5MeOH) and [NiCu(2)L(OAc)(2)]·3.25H(2)O·0.5MeOH (2·3.25H(2)O·0.5MeOH) as a function of the Ni(OAc)(2)?:?Cu(OAc)(2) molar ratio. The crystal structures of H(4)L, 1·0.25H(2)O·2.5MeOH and 2·3.25H(2)O·0.5MeOH could be solved. The free ligand presents two stereogenic methine groups on the imidazolidine heterocycles. X-Ray diffraction studies on H(4)L determined that the solved crystal structure corresponds to a racemate formed by the (2R,2'R) and (2S,2'S) enantiomers, without detecting the (2R,2'S) diastereoisomer. The crystal structures of both heterotrinuclear complexes reveal that Ni(II) has a preference for the central ligand pocket, showing that this cavity discriminates between Ni(II) and Cu(II) when both species are present in the reaction medium. These results are validated by DFT calculations. As a consequence of the coordination, 1·0.25H(2)O·2.5MeOH and 2·3.25H(2)O·0.5MeOH are also chiral, but crystallise as racemates. In addition to their asymmetric methine groups, these complexes present four other stereogenic centres: the four coordinated imidazolidine N atoms. The luminescent properties of the ligand and both complexes were analysed, showing that the presence of the metals partially inhibits the emission of the ligand and apparently tunes the position of the secondary fluorescence emission band. The magnetic characterisation of 1·0.25H(2)O·2.5MeOH and 2·3.25H(2)O·0.5MeOH was also performed, showing the ferromagnetic behaviour of both complexes.     

Metal complexes of N-benzamidoporphyrin: (N-benzimido-meso-tetraphenylporphyrinato)(methanol)zinc(II) methanol solvate and (acetato)(N-benzamido-meso-tetraphenylporphyrinato)cadmium(II) benzene solvate

The crystal structures of N-benzamido-meso-tetraphenylporphyrin (NHCOC(6)H(5)-Htpp; 1), (N-benzimido-meso-tetraphenylporphyrinato)(methanol)zinc(II) [Zn(N-NCOC(6)H(5)-tpp)(MeOH); 2(MeOH)], and (acetato)(N-benzamido-meso-tetraphenylporphyrinato)cadmium(II) [Cd(N-NHCOC(6)H(5)-tpp)(OAc); 3] were established. The coordination sphere around Zn(2+) ion in 2(MeOH) is a distorted trigonal bipyramid with N(2), N(5), and O(2) lying in the equatorial plane, whereas, for Cd(2+) ion in 3, it is a sitting-atop derivative with a distorted trigonal bipyramidal geometry in which the apical site is occupied by atoms N(2) and O(2). Cd in 3 acquires five-coordination with five strong bonds [Cd(1)-N(1) = 2.319(5) A, Cd(1)-N(2) = 2.252(5) A, Cd(1)-N(3) = 2.332(5) A, Cd(1)-O(2) = 2.292(5) A, and Cd(1)-O(3) = 2.317(5) A] and with one secondary intramolecular interaction [Cd(1)...N(4)]. The porphyrin ring in these two complexes is distorted to a large extent. The plane of the three pyrrole nitrogen atoms [i.e., N(1)-N(3)] strongly bonded to Zn(2+) in 2(MeOH) and to Cd(2+) in 3 is adopted as a reference plane 3N. For the Zn(2+) complex, the pyrrole nitrogen bonded to the benzamido (BA) ligand lies in a plane with a dihedral angle of 33.8 degrees with respect to the 3N plane, but for the Cd(2+) complex, this dihedral angle is found to be 31.4 degrees. In the former complex, Zn(2+) and N(5) are located on the different side at -0.08 and 1.39 A from its 3N plane, and in the latter one, Cd(2+) and N(5) are also located on the different side at 1.08 and -1.51 A from its 3N plane. VT NMR ((1)H and (13)C) studies of 3 show that the acetate acts as a bidentate ligand and the OAc(-) exchange does not occur in CD(2)Cl(2). Moreover, the NH proton [i.e., H(5)] of 3 in CD(2)Cl(2) is observed as a sharp singlet at delta = -1.13 ppm with Delta nu(1/2) = 4 Hz at 20 degrees C indicating that the intermolecular proton exchange between water and NH proton is rapid.     

Manganese(II/II/II) and Manganese(III/II/III) Trinuclear Compounds. Structure and Solid and Solution Behavior

Two mixed-valence Mn(III)Mn(II) complexes and a homo-valence Mn(II) trinuclear manganese complex of stoichiometry Mn(III)Mn(II)Mn(III)(5-Cl-Hsaladhp)(2)(AcO)(4)(MeOH)(2).4CH(3)OH (1a), Mn(III)Mn(II)Mn(III) (Hsaladhp)(2)(AcO)(2)(5-Cl-Sal)(2)(thf)(2) (3a) and Mn(II)Mn(II)Mn(II) (AcO)(6)(pybim)(2) (1b) where H(3)saladhp is a tridentate Schiff base ligand and pybim a neutral bidentate donor ligand, have been structurally characterized by using X-ray crystallography. The structurally characterized mixed-valence complexes have strictly 180 degrees Mn(III)-Mn(II)-Mn(III) angles as required by crystallographic inversion symmetry. The complexes are valence trapped with two terminal Mn(III) ions showing Jahn-Teller distortion along the acetate or salicylate-Mn(III)-X axis. The Mn.Mn separation is 3.511 ? and 3.507 ? respectively. The mixed-valence complexes have S = (3)/(2) ground state and the homovalence complex S = (5)/(2), with small antiferromagnetic exchange J couplings, -5.6 and -1.8 cm(-1), respectively, while the powder ESR spectra at 4 K show a broad low field signal with g approximately 4.3 for Mn(III)Mn(II)Mn(III) and a broad temperature-dependent signal at g = 2 for Mn(II)Mn(II)Mn(II). Crystal data for 1a: [C(36)H(60)O(20)N(2)Cl(2)Mn(3)], triclinic, space group P&onemacr;, a = 9.272(7) ?, b = 11.046(8) ?, c = 12.635(9) ?, alpha = 76.78(2) degrees, beta = 81.84(2) degrees, gamma = 85.90(2) degrees, Z = 1. Crystal data for 3a: [C(48)H(56)O(18)N(2)Cl(2)Mn(3)], monoclinic, space group P2(1)/n, a = 8.776(3) ?, b = 22.182(7) ?, c = 13.575(4) ?, beta = 94.44(1) degrees, Z = 2. Crystal data for 1b: [C(36)H(36)O(12)N(6)Mn(3)], triclinic, space group P&onemacr;, a = 13.345(6) ?, b = 8.514(4) ?, c = 9.494(4) ?, alpha = 75.48(1) degrees, beta = 75.83(1) degrees, gamma = 76.42(1) degrees, Z = 1.     

Novel examples of high-dimensional mixed-valence copper cyanide complexes

The first examples of high-dimensional mixed-valence homometallic cyano-bridged copper complexes were synthesized and characterized: net-structured [Cu(CN)(4){Cu(cyclam)}(1.5)](2)(n)()(H(2)O)(5)(n) (1), ladder-type double-chain-structured [Cu(CN)(2){Cu(CN)(2)Cu(cyclam)}](n)()(H(2)O)(n) (2), layer-structured [{Cu(CN)(2)}(2)Cu(cycalm)](n) (3), and hydrogen-bond-based 2-D [Cu(CN)(3)Cu(cyclam)](n)()(CH(3)OH)(n) (4) (cyclam = 1,4,8,11-tetraazacyclotetradecane). (1) Crystallizes in triclinic space group P with a = 8.3589(11) A, b = 13.478(2) A, c = 14.828(2) A, alpha = 66.895(2) degrees , beta = 77.916(3) degrees , gamma = 85.939(3) degrees , and Z = 1; (2) crystallizes in triclinic space group P with a = 8.2305(12) A, b = 9.8861(15) A, c = 13.219(2) A, alpha = 84.863(3) degrees , beta = 75.744(3) degrees , gamma = 89.818(3) degrees , and Z = 2; 3 crystallizes in monoclinic space group P2(1)/c with a = 6.830(2) A, b = 8.482(2) A, c = 17.306(4) A, beta = 98.144(4) degrees , and Z = 2; 4 crystallizes in triclinic space group P with a = 9.470(1) A, b = 10.034(1) A, c = 12.064(1) A, alpha = 67.325(2), beta = 75.593(2), gamma = 70.672(2), and Z = 2. The coordination sphere of Cu(I) sites in the complexes shows diverse structures: tetrahedral [CuC(4)] for (1), tetrahedral [CuC(3)N] and triangular [CuC(2)N] for (2), triangular [CuC(2)N] for (3), and triangular [CuC(3)] for 4. In particular, (1) constitutes the first example of a structurally characterized system containing a bridging tetrahedral [Cu(CN)(4)](3)(-) unit. The diverse structural nature of these complexes is governed by the capping amines and the content of water in the reaction media. The magnetic interactions are negligible in these mixed-valence complexes.     

Coordination-position isomeric M(II)Cu(II) and Cu(II)M(II) (M = Co, Ni, Zn) complexes derived from macrocyclic compartmental ligands

The dinucleating macrocyclic ligands (L(2;2))(2-) and (L(2;3))(2-), comprised of two 2-[(N-methylamino)methyl]-6-(iminomethyl)-4-bromophenolate entities combined by the -(CH(2))(2)- chain between the two aminic nitrogen atoms and by the -(CH(2))(2)- or -(CH(2))(3)- chain between the two iminic nitrogen atoms, have afforded the following M(II)Cu(II) complexes: [CoCu(L(2;2))](ClO(4))(2).MeCN (1A), [NiCu(L(2;2))](ClO(4))(2) (2A), [ZnCu(L(2;2))](ClO(4))(2).0.5MeCN.EtOH (3A), [CoCu(L(2;3))(MeCN)(2-PrOH)](ClO(4))(2) (4A), [NiCu(L(2;3))](ClO(4))(2) (5A), and [ZnCu(L(2;3))](ClO(4))(2).1.5DMF (6A). [CoCu(L(2;2))(MeCN)(3)](ClO(4))(2) (1A') crystallizes in the monoclinic space group P2(1)/n, a = 11.691(2) A, b = 18.572(3) A, c = 17.058(3) A, beta= 91.18(2) degrees, V = 3703(1) A(3), and Z = 4. [NiCu(L(2;2))(DMF)(2)](ClO(4))(2) (2A') crystallizes in the triclinic space group P(-)1, a = 11.260(2) A, b = 16.359(6) A, c = 10.853(4) A, alpha= 96.98(3) degrees, beta= 91.18(2) degrees, gamma= 75.20(2) degrees, V = 1917(1) A(3), and Z = 2. 4A crystallizes in the monoclinic space group P2(1)/c, a = 15.064(8) A, b = 11.434(5) A, c = 21.352(5) A, beta= 95.83(2)degrees, V = 3659(2) A(3), and Z = 4. The X-ray crystallographic results demonstrate the M(II) to reside in the N(amine)(2)O(2) site and the Cu(II) in the N(imine)(2)O(2) site. The complexes 1-6 are regarded to be isomeric with [CuCo(L(2;2)))](ClO(4))(2).DMF (1B), [CuNi(L(2;2)))](ClO(4))(2).DMF.MeOH (2B), [CuZn(L(2;2)))](ClO(4))(2).H(2)O (3B)), [CuCo(L(2;3)))](ClO(4))(2).2H(2)O (4B), [CuNi(L(2;3)))](ClO(4))(2) (5B), and [CuZn(L(2;3)))](ClO(4))(2).H(2)O (6B) reported previously, when we ignore exogenous donating and solvating molecules. The isomeric M(II)Cu(II) and Cu(II)M(II) complexes are differentiated by X-ray structural, magnetic, visible spectroscopic, and electrochemical studies. The two isomeric forms are significantly stabilized by the "macrocyclic effect" of the ligands, but 1A is converted into 1B on an electrode, and 2A is converted into 2B at elevated temperature.     

2-pyrrolylthiones as monoanionic bidentate N,S-chelators: synthesis and molecular structure of 2-pyrrolylthionato complexes of nickel(II), cobalt(III), and mercury(II)

The metal-chelating ability of 2-pyrrolylthiones is described. The readily available ligands di-2-pyrrolyl thione (6), 2-thioacetylpyrrole (10), and 2-thiobenzoylpyrrole (11) constitute examples of monoanionic ligands with N,S-donor atom sets, although di-2-pyrrolyl thione (6) could theoretically also achieve chelation through an N,N-donor set. A square planar Ni(II) complex, 14, an octahedral Co(III) complex, 18, and a tetrahedral Hg(II) complex, 17, with the di-2-pyrrolyl thionato chelate have been prepared, and their structures have been characterized by 1H NMR, UV-vis, MS, IR, elemental analysis, and single-crystal X-ray diffraction. Crystal data for 14: C18H14N4NiS2.0.28H2O, trigonal, R3, a = 18.467(1) A, b = 18.467(1) A, c = 26.404(2) A, V = 7797(1) A3; Z = 18, R = 3.2%. Crystal data for 18-mer: C27H21CoN6S3.C3H6O (acetone), monoclinic, P21/n, a = 9.569(1) A, b = 23.152(1) A, c = 13.659(1) A, beta = 100.882(8) degrees, V = 2971.6(5) A3, Z = 4, R = 4.3%. Crystal data for 17: C18H14HgN4S2, triclinic, P1, a = 8.443(2), b = 14.278(1) A, c = 7.445(1) A, alpha = 90.561(9) degrees, beta = 97.64(1) degrees, gamma = 104.250(9) degrees, V = 861.3(2) A3, Z = 2, R = 4.2%. The bond lengths and angles of these metal complexes are comparable to those of known N,S-chelates. A comparison of the structural parameters of the ligand in the metal complexes with those for the free ligand 6 demonstrates the preorganization of the free ligand for complexation and demonstrates the spectator role of the noncoordinating pyrrolic unit. Chelation of Ni(II) by 2-thioacetylpyrrole (10) and 2-thiobenzoylpyrrole (11) to provide complexes 12 and 13 with structures analogous to complex 14 is also described.     

Complementarity and countercomplementarity in polynuclear copper(II) complexes with R2NCH2CH(OH)CH2NR2 (R = H, CH3): crystal structures and magnetic study

The syntheses, structural characterization and magnetic behavior of five new copper(II) polynuclear compounds with formulae [Cu4(mu2-CH3COO)2(mu-bdmap)2(micro(1,5)-dca)2(dca)2(H2O)2] 1, [Cu2(mu2-CH3COO)(mu-bdap)(mu(1,1,5)-dca)(mu(1,3)-dca)]n 2, [Cu4(mu2-CH3COO)2(mu-bdmap)2(mu(1,1)-NCS)2(NCS)2] 3, [Cu2(mu2-CH3COO)(mu-bdap)(NCS)2] 4 and [Cu2(mu(1,3)-N3)(mu-bdmap)(N3)2]n 5 in which bdmapH is 1,3-bis(dimethylamino)-2-propanol, bdapH is 1,3-bis(amino)-2-propanol and dca is the anionic dicyanamide ligand, are reported herein. Tetranuclear complex 1 crystallizes in the monoclinic system, space group P2(1)/n, with unit cell parameters a = 8.284(8), b = 21.52(1), c = 11.432(3) A, beta = 105.19(2) degrees , Z = 2. Bi-dimensional complex 2 crystallizes in the triclinic system, space group P1, with unit cell parameters a = 8.184(5), b = 8.792(2), c = 10.887(2) A, alpha = 75.65(2), beta = 76.55(3), gamma = 74.36(3) degrees , Z = 2. Tetranuclear complex 3 crystallizes in the triclinic system, space group P1, with unit cell parameters a = 8.455(4), b = 9.114(9), c = 12.744(8) A, alpha = 104.62(8), beta = 99.86(6), gamma = 106.10(8) degrees, Z = 1. Dinuclear complex 4 crystallizes in the triclinic system, space group P1, with unit cell parameters a = 8.15(1), b = 8.18(2), c = 11.44(1) A, alpha = 69.39(2), beta = 80.36(2), gamma = 80.37(2) degrees , Z = 2. One-dimensional complex 5 crystallizes in the orthorhombic system, space group P2(1)2(1)2(1), with unit cell parameters a = 20.45(4), b = 11.36(3), c = 6.43(1) A, Z = 4. The magnetic behavior of all the complexes has been checked giving a bulk antiferromagnetic coupling in all the cases with |J| values in the range 109-144 cm(-1) for 1-4. Compound 5 is diamagnetic in the 2-300 K range of temperatures. The found J values 1-5 for can be justified from the structural data taking into account the orbital countercomplementarity for 1-4 and the orbital complementarity for 5.     

Palladacyclic complexes bearing CNN-type ligands as catalysts in the Heck reaction

Preparations of novel unsymmetrical, tridentate nitrogen ligand precursors, PhN=C(CMe2)(NPh)C=N(CH2)2NMe2(1) and PhN=C(CMe2)(NPh)C=N(CH2)Py (2), are described. Treatment of 1 with 1 molar equiv. (COD)PdCl2 in the presence of NEt3 or with 1 molar equiv. Pd(OAc)2 affords orthometallated palladium(II) complexes, [PhN=C(CMe2)(N-eta1-Ph)C=N(CH2)2NMe2]PdX (X=Cl (3); X=OAc (4)), respectively. Compound can be yielded via the reaction of with an excess of LiCl in methanol. Treatment of with 1 molar equiv. of (COD)PdCl2, Pd(OAc)2 or Pd(TFA)2 affords orthometallated palladium(II) complexes, [PhN=C(CMe2)(N-eta1-Ph)C=NCH2Py]PdX (X=Cl (5); X=OAc (6); X=TFA (7)), respectively. The crystal and molecular structures are reported for compounds 2, 3, 5 and 6. The application of these novel palladacyclic complexes to the Heck reaction with aryl halide substrates was examined.     

Chemistry of Bis(aryloxo)palladium(II) Complexes with N-Donor Ligands: Structural Features of the Palladium-to-Oxygen Bond and Formation of O-H.O Bonds

Reaction of palladium acetate with 2 equiv of sodium phenoxide in the presence of a chelate diamine ligand affords the complexes [Pd(OPh)(2)(N approximately N)] (N approximately N = bpy (1), tmeda (2), teeda (3), dpe (4), dmap (5)). These yellow to orange bis(phenoxo)palladium(II) complexes are thermally stable at room temperature in the solid state as well as in solution. Addition of an excess of pentafluorophenol to 1, 2, 4, and 5 affords crystalline complexes [Pd(OC(6)F(5))(2)(N approximately N)] (N approximately N = bpy (6), tmeda (7), dpe (8), dmap (9)). Crystals of 1 and 6 have been subjected to X-ray diffraction studies. Crystals of 1 are orthorhombic, space group P2(1)2(1)2(1) (no. 19), with a = 6.7655(6) ?, b = 16.0585(10) ?, c = 16.7275(13) ?, and Z = 4. Crystals of 6 are triclinic, space group P&onemacr; (no. 2), with a = 7.567(4) ?, b = 12.708(3) ?, c = 12.912(5) ?, alpha = 61.51(3) degrees, beta = 74.74(4) degrees, gamma = 88.78(4) degrees, and Z = 2. The molecular structures of 1 and 6 show them to be square-planar complexes, and the main structural difference between these complexes is the orientation of the aromatic rings. In 6 the OC(6)F(5) ligands are almost parallel in a face-to-face orientation (pi-pi stacking interactions), whereas in 1 the OC(6)H(5) units are skewed away from each other. An unexpected "mixed" alkoxo(aryloxo) complex [Pd(OCH(CF(3))(2))(OPh)(bpy)].HOPh (10) is formed when 1 is reacted with 1,1,1,3,3,3-hexafluoro-2-propanol. The molecular structure of 10 shows O-H.O hydrogen bonding (O.O = 2.642(8) ?) between the hydroxyl hydrogen of phenol and the oxygen atom of the phenoxide ligand as well as an additional C-H.O contact (C.O) = 2.95(1) ?), which can be regarded as the initial stage of a base-assisted beta-hydrogen elimination. Crystals of 10 are monoclinic, space group P2(1)/c, with a = 8.3241(14) ?, b = 11.0316(17) ?, c = 26.376(3) ?, alpha = 93.01(1) degrees, Z = 4. Spectroscopic data of complexes 1-10 indicate that the oxygen atom of the aryloxide or alkoxide ligand is extremely electron-rich, leading to high polarization of the palladium-to-oxygen bond. The bis(phenoxide) complexes 1, 2, and 4 associate with two molecules of phenol through O-H.O hydrogen bonds to form adducts [Pd(OPh)(2)(N approximately N)].2HOPh (N approximately N = bpy (11), tmeda (12), dpe (13)). The palladium complexes 6-9 with OC(6)F(5) groups show no tendency to form adducts with alcohols.     

Cyano-bridged structures based on [MnIIN3O2-macrocycle)]2+: a synthetic, structural, and magnetic study

Reactions between the complex [MnII(L)]2+, where L is a N3O2 macrocyclic ligand, and different cyanometalate precursors such as [M(CN)n]m- (M(III) = Cr, Fe; M(II) = Fe, Ni, Pd, Pt) lead to cyano-bridged molecular assemblies exhibiting a variety of structural topologies. The reaction between [MnII(L)]2+ and [FeII(CN)6]4- forms a trinuclear complex with formula [(MnII(L)(H2O))2(FeII(micro-CN)2(CN)4)] x 2MeOH x 10H2O (1) which crystallizes in the triclinic space group P1. The reaction between [MnII(L)]2+ and [M(II)(CN)4]2-, where M(II) = Ni (2), Pd (3), Pt (4), gives rise to three isostructural linear chain compounds with stoichiometry [(MnII(L))(M(II)(micro-CN)2(CN)2)]n and which crystallize in the monoclinic space group C2/c. The self-assembly between [MnII(L)]2+ with [M(III)(CN)6]3-, where M(III) = Cr (5), Fe (6, 7, 8), forms three types of compounds. Compounds 5 and 6 are isostructural (monoclinic, space group P2(1)/n), and the structures comprise anionic linear chains [(MnII(L))(M(III)(micro-CN)2(CN)4)]n(n-) with cationic trinuclear complexes [(MnII(L)(H2O))2(M(III)(micro-CN)2(CN)4)]+ as counterions. Using an excess of K3[FeIII(CN)6], an analogous compound to 6 but with K+ as counterion is obtained (7), which crystallizes in the triclinic space group P1. Compound 8 consists of 2-D layers with formula [(MnII(L))3(FeIII(micro-CN)4(CN)2)(FeIII(micro-CN)2(CN)4)]n x 2nMeOH; it crystallizes in the monoclinic space group P2(1)/n. The magnetic properties were investigated for all samples. In particular, compound 5, which shows antiferromagnetic exchange interactions between Mn(II) and Cr(III) ions through cyanide bridging ligands, has been studied in detail; the magnetic exchange parameter amounts to J = -7.5(7) cm(-1). Compound 8 shows a magnetically ordered phase below 6.4 K which is confirmed by M?ssbauer spectroscopy; two hyperfine split spectra were observed below Tc from which IJI values of 2.1 and 1.6 cm(-1) could be deduced.     

Synthesis, spectroscopic, and structural studies on transition metal complexes involving homoleptic tripodal selenoether and telluroether coordination

The reaction of [MCl2(NCMe)2] (M = Pd or Pt) with 2 molar equiv of MeC(CH2ER)3 (E = Se, R = Me; E = Te, R = Me or Ph) and 2 molar equiv of TlPF6 affords the bis ligand complexes [M(MeC(CH2ER)3)2][PF6]2. The crystal structure of [Pt(MeC(CH2SeMe)3)2][PF6]2 (C16H36F12P2PtSe6, a = 12.272(10) A, b = 18.563(9) A, c = 15.285(7) A, beta = 113.18(3) degrees, monoclinic, P2(1)/n, Z = 4) confirms distorted square planar Se4 coordination at Pt(II), derived from two bidentate tripod selenoethers with the remaining arm not coordinated and directed away from the metal center. Solution NMR studies indicate that these species are fluxional and that the telluroether complexes are rather unstable in solution. The octahedral bis tripod complexes [Ru(MeC(CH2SMe)3)2][CF3-SO3]2 and [Ru(MeC(CH2TePh)3)2][CF3SO3]2 are obtained from [Ru(dmf)6][CF3SO3]3 and tripod ligand in EtOH solution. The thioether complex (C18H36F6O6RuS8, a = 8.658(3) A, b = 11.533(3) A, c = 8.659(2) A, alpha = 108.33(2) degrees, beta = 91.53(3) degrees, gamma = 106.01(2) degrees, triclinic, P1, Z = 1) is isostructural with its selenoether analogue, involving two facially coordinated trithioether ligands in the syn configuration. NMR spectroscopy confirms that this configuration is retained in solution for all of the bis tripod Ru(II) complexes. These low-spin d6 complexes show unusually high ligand field splittings. The hexaselenoether Rh(III) complex [Rh(MeC(CH2SeMe)3)2][PF6]3 was obtained by treatment of [Rh(H2O)6]3+ with 2 molar equiv of MeC(CH2SeMe)3 in aqueous MeOH in the presence of excess PF6- anion, while the iridium(III) analogue [Ir(MeC(CH2SeMe)3)2][PF6]3 was obtained via the reaction of the Ir(I) precursor [IrCl(C8H14)2]2 with the selenoether tripod in MeOH/aqueous HBF4. NMR studies reveal different invertomers in solution for both the Rh and Ir species. The Cu(I) complexes [Cu(MeC(CH2ER)3)2]PF6 were obtained from [Cu(NCMe)4]PF6 and tripod ligand in CH2Cl2 solution. The corresponding Ag(I) species [Ag(MeC(CH2TeR)3)2]CF3SO3 (R = Me or Ph) were obtained from Ag[CF3SO3] and tripod telluroether. In contrast, a similar reaction with 2 molar equiv of MeC(CH2SeMe)3 afforded only the 1:1 complex [Ag(MeC(CH2SeMe)3)]CF3SO3. The structure of this species (C9H18AgF3O3SSe3, a = 8.120(3) A, b = 15.374(3) A, c = 14.071(2) A, beta = 93.86(2) degrees, monoclinic, P2(1)/n, Z = 4) reveals a distorted trigonal planar geometry at Ag(I) derived from one bidentate selenoether and one monodentate selenoether. These units are then linked to adjacent Ag(I) ions to give a one-dimensional linear chain cation.     

Bimetallic cyanide-bridged complexes based on the photochromic nitroprusside anion and paramagnetic metal complexes. Syntheses, structures, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O, [Ni(en)2][Fe(CN)5NO]x3H2O, [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO], and [Mn(5-Brsalen)]2[Fe(CN)5NO

The synthesis, crystal structure, and physical characterization of the coordination compounds [Ni(en)2]4[Fe(CN)5NO]2[Fe(CN)6]x5H2O (1), [Ni(en)2][Fe(CN)5NO]x3H2O (2), [Mn(3-MeOsalen)(H2O)]2[Fe(CN)5NO] (3), and [Mn(5-Brsalen)]2[Fe(CN)5NO] (4) are presented. 1 crystallizes in the monoclinic space group P2(1)/n (a = 7.407(4) A, b = 28.963(6) A, c = 14.744(5) A, alpha = 90 degrees, beta = 103.26(4) degrees, gamma = 90 degrees, Z = 2). Its structure consists of branched linear chains formed by cis-[Ni(en)2]2+ cations and ferrocyanide and nitroprusside anions. The presence of two kinds of iron(II) sites has been demonstrated by M?ssbauer spectroscopy. 2 crystallizes in the monoclinic space group P2(1)/c (a = 11.076(3) A, b = 10.983(2) A, c = 17.018(5) A, alpha = 90 degrees, beta = 107.25(2) degrees, gamma = 90 degrees, Z = 4). Its structure consists of zigzag chains formed by an alternated array of cis-[Ni(en)2]2+ cations and nitroprusside anions. 3 crystallizes in the triclinic space group P1 (a = 8.896(5) A, b = 10.430(5) A, c = 12.699(5) A, alpha = 71.110(5) degrees, beta = 79.990(5) degrees, gamma = 89.470(5) degrees, Z = 1). Its structure comprises neutral trinuclear bimetallic complexes in which a central [Fe(CN)5NO]2- anion is linked to two [Mn(3-MeOsalen)]+ cations. 4 crystallizes in the tetragonal space group P4/ncc (a = 13.630(5) A, c = 21.420(8) A, Z = 4). Its structure shows an extended 2D neutral network formed by cyclic octameric [-Mn-NC-Fe-CN-]4 units. The magnetic properties of these compounds indicate the presence of quasi-isolated paramagnetic Ni2+ and Mn3+. Irradiated samples of the four compounds have been studied by differential scanning calorimetry to detect the existence of the long-lived metastable states of nitroprusside.     

An unsymmetrical tripodal ligand with an N2OS donor set: coordination chemistry with nickel(II)ions and aerial oxidation to the sulfinate complex

The synthesis of the previously unknown tripodal ligand H4-1 is reported. The tetradentate ligand is equipped with a completely unsymmetrical N2OS donor set. It reacts with Ni(OAc)2. 4H2O or Ni(ClO4)2.6H2O to give the multinuclear nickel(II) complexes [Ni(H-1-Imin)(OAc)]2 (2) (which contains a coordinated Schiff base obtained by reation of the primary amine with the acetone solvent) and [Ni3(H3-1)(H2-1)2]-ClO4.H2O.3 MeCN (3), respectively. A solution of 3 in DMF is readily oxidized upon exposure to air or by aqueous H2O2 to yield [Ni(H2-1-sulfinate)]2. 2MeOH (4). The molecular structures of 2-4 have been determined by X-ray diffraction. Complex 2 exhibits a strongly distorted, octahedral coordination geometry around each nickel(II)ion. The primary amino group of the ligand in this case reacted with the solvent acetone to yield a Schiff base which is coordinated to the metal center. The molecular structure of the trinuclear complex cation in 3 consists of two subunits: a nickel atom with a square-planar N2S2 coordination geometry and two other nickel atoms with a trigonal-bipyramidal N2O2S coordination environment. The dinuclear complex 4 shows distorted octahedral geometry around each nickel(II) ion. The thiolato groups of the ligands are oxidized to sulfinato groups which are O,O-bound to the nickel center. This coordination mode is unusual for nickel sulfinate complexes.     

Synthesis, structures, and magnetic properties of tri- and dinuclear copper(II)-gadolinium(III) complexes of linear oligooxime ligands

We have designed and synthesized a new Cu2Gd heterotrinuclear complex, [LCu2Gd(OAc)3] (1), where H4L is a bis(salen)-type tetraoxime ligand useful in the synthesis of discrete (3d)2(4f) complexes. Complex 1 crystallizes in the triclinic system, space group P1, with unit cell parameters a = 12.442(4) A, b = 13.397(3) A, c = 13.966(4) A, alpha = 77.052(8) degrees, beta = 88.656(10) degrees, gamma = 77.761(8) degrees, and Z = 2. In the crystal structure of 1, Cu-Gd distances are 3.3-3.5 A, whereas the two Cu atoms are separated by 6.08 A. The corresponding dinuclear CuGd complexes, 2 and 3, with mono(salen)-type chelate 3-MeOsalamo were also synthesized. Complex 2 crystallizes in the monoclinic system, space group P2(1)/c, with unit cell parameters a = 13.869(8) A, b = 13.688(7) A, c = 18.728(10) A, beta = 92.861(8) degrees, and Z = 4, and complex 3 crystallizes in the triclinic system, space group P1, with unit cell parameters a = 12.319(4) A, b = 13.989(4) A, c = 16.774(5) A, alpha = 64.699(14) degrees, beta = 66.672(13) degrees, gamma = 76.891(17) degrees, and Z = 4. Interaction between Cu(II) and Gd(III) in the dinuclear complexes 2 and 3 is ferromagnetic (J = 4.5 and 7.6 cm(-1), respectively, using spin Hamiltonian H = -JS(Cu) x S(Gd)) as observed in the previously prepared [LCuGdX3] complexes, where L is a salen-type chelate. Magnetic data for the Cu2Gd trinuclear complex can be reasonably interpreted with the use of a spin Hamiltonian H = -J(CuGd)S(Cu1) x S(Gd) - J(CuGd)S(Cu2) x S(Gd) - J(CuCu)S(Cu1) x S(Cu2) with J(CuGd) = 5.0 cm(-1) and J(CuCu) = 0 cm(-1). The S = 9/2 ground state resulted from the ferromagnetic interaction among the Cu(II)-Gd(III)-Cu(II) triad was also supported by the saturation magnetization at 1.8 K.     

Copper(II) complexes of a series of alkoxy diazine ligands: mononuclear, dinuclear, and tetranuclear examples with structural, magnetic, and DFT studies

Picolyl hydrazide ligands have two potentially bridging functional groups (micro-O, micro-N-N) and consequently can exist in different coordination conformers, both of which form spin-coupled polynuclear coordination complexes, with quite different magnetic properties. The complex [Cu(2)(POAP-H)Br(3)(H(2)O)] (1) involves a micro-N-N bridge (Cu-N-N-Cu 150.6 degrees ) and exhibits quite strong antiferromagnetic coupling (-2J = 246(1) cm(-)(1)). [Cu(2)(PZOAPZ-H)Br(3)(H(2)O)(2)] (2) has two Cu(II) centers bridged by an alkoxide group with a very large Cu-O-Cu angle of 141.7 degrees but unexpectedly exhibits quite weak antiferromagnetic exchange (-2J = 91.5 cm(-)(1)). This is much weaker than anticipated, despite direct overlap of the copper magnetic orbitals. Density functional calculations have been carried out on compound 2, yielding a similar singlet-triplet splitting energy. Structural details are reported for [Cu(2)(POAP-H)Br(3)(H(2)O)] (1), [Cu(2)(PZOAPZ-H)Br(3)(H(2)O)(2)] (2), [Cu(2)(PAOPF-2H)Br(2)(DMSO)(H(2)O)].H(2)O (3), [Cu(4)(POMP-H))(4)](NO(3))(4).2H(2)O (4), and PPOCCO (5) (a picolyl hydrazide ligand with a terminal oxime group) and its mononuclear complexes [Cu(PPOCCO-H)(NO(3))] (6) and [Cu(PPOCCO-H)Cl] (7). Compound 1 (C(12)H(13)Br(3)Cu(2)N(5)O(4)) crystallizes in the monoclinic system, space group P2(1)/c, with a = 15.1465(3) A, b = 18.1848(12) A, c = 6.8557(5) A, beta = 92.751(4) degrees, and Z = 4. Compound 2 (C(10)H(13)Br(3)Cu(2)N(7)O(4)) crystallizes in the triclinic system, space group P, with a = 9.14130(1) A, b = 10.4723(1) A, c = 10.9411(1) A, alpha = 100.769(1), beta = 106.271(1) degrees, gamma = 103.447(1) degrees, and Z = 2. Compound 3 (C(23)H(22)Br(2)Cu(2)N(7)O(5.5)S) crystallizes in the monoclinic system, space group P2(1)/c, with a = 12.406(2) A, b = 22.157(3) A, c = 10.704(2) A, beta = 106.21(1) degrees, and Z = 4. Compound 4(C(52)H(48)Cu(4)N(20)O(18)) crystallizes in the monoclinic system, space group P2(1)/n, with a = 14.4439(6) A, b = 12.8079(5) A, c = 16.4240(7) A, beta = 105.199(1) degrees, and Z = 4. Compound 5 (C(15)H(14)N(4)O(2)) crystallizes in the orthorhombic system, space group Pna2(1), with a = 7.834(3) A, b = 11.797(4) A, c = 15.281(3) A, and Z = 4. Compound 6(C(15)H(13)CuN(5)O(5)) crystallizes in the monoclinic system, space group P2(1)/c, with a = 8.2818(9) A, b = 17.886(2) A, c = 10.828(1) A, beta = 92.734(2) degrees, and Z = 4. Compound 7 (C(15)H(13)CuClN(4)O(2)) crystallizes in the orthorhombic system, space group Pna2(1), with a = 7.9487(6) A, b = 14.3336(10) A, c = 13.0014(9) A, and Z = 4. Density functional calculations on PPOCCO are examined in relation to the anti-eclipsed conformational change that occurs on coordination to copper(II).     

Copper(I) complexes, copper(I)/O(2) reactivity, and copper(II) complex adducts, with a series of tetradentate tripyridylalkylamine tripodal ligands

Copper(I) and copper(II) complexes possessing a series of related ligands with pyridyl-containing donors have been investigated. The ligands are tris(2-pyridylmethyl)amine (tmpa), bis[(2-pyridyl)methyl]-2-(2-pyridyl)ethylamine (pmea), bis[2-(2-pyridyl)ethyl]-(2-pyridyl)methylamine (pmap), and tris[2-(2-pyridyl)ethyl]amine (tepa). The crystal structures of the protonated ligand H(tepa)ClO(4), the copper(I) complexes [Cu(pmea)]PF(6) (1b-PF(6)), [Cu(pmap)]PF(6) (1c-PF(6)), and copper(II) complexes [Cu(pmea)Cl]ClO(4).H(2)O (2b-ClO(4).H(2)O), [Cu(pmap)Cl]ClO(4).H(2)O (2c-ClO(4).H(2)O), [Cu(pmap)Cl]ClO(4) (2c-ClO(4)), and [Cu(pmea)F](2)(PF(6))(2) (3b-PF(6)) were determined. Crystal data: H(tepa)ClO(4), formula C(21)H(25)ClN(4)O(4), triclinic space group P1, Z = 2, a = 10.386(2) A, b = 10.723(2) A, c = 11.663(2) A, alpha = 108.77(3) degrees, beta = 113.81(3) degrees, gamma = 90.39(3) degrees; 1b-PF(6), formula C(19)H(20)CuF(6)N(4)P, orthorhombic space group Pbca, Z = 8, a = 14.413(3) A, b = 16.043(3) A, c = 18.288(4) A, alpha = beta = gamma = 90 degrees; (1c-PF(6)), formula C(20)H(22)CuF(6)N(4)P, orthorhombic space group Pbca, Z = 8, a = 13.306(3) A, b = 16.936(3) A, c = 19.163(4) A, alpha = beta = gamma = 90 degrees; 2b-ClO(4).H(2)O, formula C(19)H(22)Cl(2)CuN(4)O(5), triclinic space group P1, Z = 4, a = 11.967(2) A, b = 12.445(3) A, c = 15.668(3) A, alpha = 84.65(3) degrees, beta = 68.57(3) degrees, gamma = 87.33(3) degrees; 2c-ClO(4).H(2)O, formula C(20)H(24)Cl(2)CuN(4)O(5), monoclinic space group P2(1)/c, Z = 4, a = 11.2927(5) A, b = 13.2389(4) A, c = 15.0939(8) A, alpha = gamma = 90 degrees, beta = 97.397(2) degrees; 2c-ClO(4), formula C(20)H(22)Cl(2)CuN(4)O(4), monoclinic space group P2(1)/c, Z = 4, a = 8.7682(4) A, b = 18.4968(10) A, c = 13.2575(8) A, alpha = gamma = 90 degrees, beta = 94.219(4) degrees; 3b-PF(6), formula [C(19)H(20)CuF(7)N(4)P](2), monoclinic space group P2(1)/n, Z = 2, a = 11.620(5) A, b = 12.752(5) A, c = 15.424(6) A, alpha = gamma = 90 degrees, beta = 109.56(3) degrees. The oxidation of the copper(I) complexes with dioxygen was studied. [Cu(tmpa)(CH(3)CN)](+) (1a) reacts with dioxygen to form a dinuclear peroxo complex that is stable at low temperatures. In contrast, only a very labile peroxo complex was observed spectroscopically when 1b was reacted with dioxygen at low temperatures using stopped-flow kinetic techniques. No dioxygen adduct was detected spectroscopically during the oxidation of 1c, and 1d was found to be unreactive toward dioxygen. Reaction of dioxygen with 1a-PF(6), 1b-PF(6), and 1c-PF(6) at ambient temperatures leads to fluoride-bridged dinuclear copper(II) complexes as products. All copper(II) complexes were characterized by UV-vis, EPR, and electrochemical measurements. The results manifest the dramatic effects of ligand variations and particularly chelate ring size on structure and reactivity.