Hydroxo‐bridged Tetranuclear CuII Complexes: {[Cu(bpy)(OH)]4Cl2}Cl2 · 6 H2O and {[Cu(phen)(OH)]4(H2O)2}]Cl4 · 4 H2O

The blue tetranuclear Cu^II complexes {[Cu(bpy)(OH)]₄Cl₂}Cl₂ · 6 H₂O ( 1 ) and {[Cu(phen)(OH)]₄(H₂O)₂}Cl₄ · 4 H₂O ( 2 ) were synthesized and characterized by single crystal X‐ray diffraction. ( 1 ): P 1 (no. 2), a = 9.240(1) Å, b = 10.366(2) Å, c = 12.973(2) Å, α = 85.76(1)°, β = 75.94(1)°, γ = 72.94(1)°, V = 1152.2(4) ų, Z = 1; ( 2 ): P 1 (no. 2), a = 9.770(3) Å, b = 10.118(3) Å, c = 14.258(4) Å, α = 83.72(2)°, β = 70.31(1)°, γ = 70.63(1)°, V = 1252.0(9) ų, Z = 1. The building units are centrosymmetric tetranuclear {[Cu(bpy)(OH)]₄Cl₂}²⁺ and {[Cu(phen)(OH)]₄(H₂O)₂}⁴⁺ complex cations formed by condensation of four elongated square pyramids CuN₂(OH)₂L^ap with the apical ligands L^ap = Cl, H₂O, OH. The resulting [Cu₄(μ₂‐OH)₂(μ₃‐OH)₂] core has the shape of a zigzag band of three Cu₂(OH)₂ squares. The cations exhibit intramolecular and intermolecular π‐π stacking interactions and the latter form 2D layers with the non‐bonded Cl^– anions and H₂O molecules in between (bond lengths: Cu–N = 1.995–2.038 Å; Cu–O = 1.927–1.982 Å; Cu–Cl^ap = 2.563; Cu–O^ap(OH) = 2.334–2.369 Å; Cu–O^ap(H₂O) = 2.256 Å). The Cu…Cu distances of about 2.93 Å do not indicate direct interactions, but the strongly reduced magnetic moment of about 2.74 B.M. corresponds with only two unpaired electrons per formula unit of 1 (1.37 B.M./Cu) and obviously results from intramolecular spin couplings (χ_m(T‐θ) = 0.933 cm³ · mol^–1 · K with θ = –0.7 K).     

Differing Coordination Modes of (O‐Alkyl)‐p‐Ethoxyphenyldithiophosphonato Ligands in Copper(I), Silver(I) and Gold(I) Triphenylphosphine Complexes

The three (O‐methyl)‐p‐ethoxyphenyldithiophosphonato triphenylphosphine complexes of copper, silver and gold, [(Ph₃P)_nM{S₂P(OMe)C₆H₄OEt‐p}] (M = Cu, n = 2; M = Ag, Au, n = 1) investigated structurally by X‐ray diffraction exhibit remarkable structural differences. The copper compound is a four‐coordinate chelate monomer with Cu–S 2.4417(6) and 2.5048(6) Å; P–Cu–S 104.24(2)–114.01(2)°; Cu–S–P 82.49(3)° and 80.85(2)°. The silver compound is a cyclic dimer with bridging dithiophosphonato ligands and three‐coordinate silver atoms [Ag–S 2.5371(5) and 2.6867(5) Å; P–Ag–S 122.88(2)° and 122.17(2)°; Ag–S–P 89.32(2)° and 103.56(2)°]. The gold compound is monomeric with linear dicoordinate gold [Au–S 2.3218(6) Å; P–Au–S 177.72(2)°, Au–S–P 100.97(3)°].     

Synthese und Eigenschaften von Bis(tetra(n-butyl)ammonium)-μ-carbidodi(halogenophthalocyaninato(2–)ferraten(IV)); Kristallstruktur von Bis(tetra(n-butyl)ammonium)-μ-carbidodi(fluorophthalocyaninato(2–)ferrat(IV))-Trihydrat

Synthesis and Properties of Bis(tetra(n-butyl)ammonium)μ-Carbido-di(halophthalocyaninato(2–)ferrates(IV)); Crystal Structure of Bis(tetra(n-butyl)ammonium) μ-Carbido-di(fluorophthalocyaninato(2–)ferrate(IV)) Trihydrate μ-Carbido-di(pyridinephthalocyaninato(2–)iron(IV)) reacts with tetra(n-butyl)ammonium halide (ⁿBu₄N)X) in solution (X = F) or in a melt (X = Cl, Br) to yield bis(tetra(n-butyl)ammonium μ-carbido-di(halophthalo-cyaninato(2–)ferrat(IV)). The fluoro-complex salt crystallizes as a trihydrate monoclinically in the space group P12₁/n1 with the following cell parameters: a = 15.814(1) Å; b = 22.690(5) Å; c = 25.127(3) Å; β = 98.27(1)°, Z = 4. The Fe atoms are almost in the centre (Ct) of the (N_iso)₄ planes (N_iso: isoindoline-N atom) with a Fe–Ct distance of 0.053(1) Å. The average Fe–N_iso distance is 1.939(4) Å, the Fe–(μ-C) distance 1.687(4) Å and the Fe–F distance 2.033(2) Å. The Fe–(μ-C)–Fe core is linear (179.5(3)°). The pc²-ligands are staggered (φ = 42(1)°) with a convex distortion. The asymmetric Fe–(μ-C)–Fe stretch (in cm^–1) is observed in the IR spectra at 917 (X = F), 918 (Cl) and 920 (Br) and the symmetric Fe–(μ-C)–Fe stretch at 476 cm^–1 in the resonance Raman spectra. The IR active asymmetric Fe–X stretch (in cm^–1) absorbs at 336 (X = F), 203 (Cl), 182 (Br), respectively.     

Syntheses and Structures of Two Selenite Chloride Hydrates: Co(HSeO3)Cl · 3 H2O and Cu(HSeO3)Cl · 2 H2O

The first selenite chloride hydrates, Co(HSeO₃)Cl · 3 H₂O and Cu(HSeO₃)Cl · 2 H₂O, have been prepared from solution and characterised by single‐crystal X‐ray diffraction. The cobalt phase adopts an unusual “one‐dimensional” structure built up from vertex‐sharing pyramidal [HSeO₃]^2–, and octahedral [CoO₂(H₂O)₄]^2– and [CoO₂(H₂O)₂Cl₂]^4– units. Inter‐chain bonding is by way of hydrogen bonds or van der Waals' interactions. The atomic arrangement of the copper phase involves [HSeO₃]^2– pyramids and Jahn‐Teller distorted [CuCl₂(H₂O)₄] and [CuO₄Cl₂]^8– octahedra, sharing vertices by way of Cu–O–Se and Cu–Cl–Cu bonds. Crystal data: Co(HSeO₃)Cl · 3 H₂O, M_r = 276.40, triclinic, space group P 1 (No. 2), a = 7.1657(5) Å, b = 7.3714(5) Å, c = 7.7064(5) Å, α = 64.934(1)°, β = 68.894(1)°, γ = 71.795(1)°, V = 337.78(7) ų, Z = 2, R(F) = 0.036, wR(F) = 0.049. Cu(HSeO₃)Cl · 2 H₂O, M_r = 263.00, orthorhombic, space group Pnma (No. 62), a = 9.1488(3) Å, b = 17.8351(7) Å, c = 7.2293(3) Å, V = 1179.6(2) ų, Z = 8, R(F) = 0.021, wR(F) = 0.024.     

Two Novel CuII Phenanthroline Adipato Complexes with π‐π Stacking Interactions: [Cu(phen)2(C6H8O4)] · 4.5 H2O and [(Cu2(phen)2Cl2)(C6H8O4)] · 4 H2O

The blue copper complex compounds [Cu(phen)₂(C₆H₈O₄)] · 4.5 H₂O ( 1 ) and [(Cu₂(phen)₂Cl₂)(C₆H₈O₄)] · 4 H₂O ( 2 ) were synthesized from CuCl₂, 1,10‐phenanthroline (phen) and adipic acid in CH₃OH/H₂O solutions. [Cu(phen)₂‐ (C₆H₈O₄)] complexes and hydrogen bonded H₂O molecules form the crystal structure of ( 1 ) (P1 (no. 2), a = 10.086(2) Å, b = 11.470(2) Å, c = 16.523(3) Å, α = 99.80(1)°, β = 115.13(1)°, γ = 115.13(1)°, V = 1617.5(5) ų, Z = 2). The Cu atoms are square‐pyramidally coordinated by four N atoms of the phen ligands and one O atom of the adipate anion (d(Cu–O) = 1.989 Å, d(Cu–N) = 2.032–2.040 Å, axial d(Cu–N) = 2.235 Å). π‐π stacking interactions between phen ligands are responsible for the formation of supramolecular assemblies of [Cu(phen)₂(C₆H₈O₄)] complex molecules into 1 D chains along [111]. The crystal structure of ( 2 ) shows polymeric [(Cu₂(phen)₂Cl₂)(C₆H₈O₄)_2/2] chains (P1 (no. 2), a = 7.013(1) Å, b = 10.376(1) Å, c = 11.372(3) Å, α = 73.64(1)°, β = 78.15(2)°, γ = 81.44(1)°, V = 773.5(2) ų, Z = 1). The Cu atoms are fivefold coordinated by two Cl atoms, two N atoms of phen ligands and one O atom of the adipate anion, forming [CuCl₂N₂O] square pyramids with an axial Cl atom (d(Cu–O) = 1.958 Å, d(Cu–N) = 2.017–2.033 Å, d(Cu–Cl) = 2.281 Å; axial d(Cu–Cl) = 2.724 Å). Two square pyramids are condensed via the common Cl–Cl edge to centrosymmetric [Cu₂Cl₂N₄O₂] dimers, which are connected via the adipate anions to form the [(Cu₂(phen)₂Cl₂)(C₆H₈O₄)_2/2] chains. The supramolecular 3 D network results from π‐π stacking interactions between the chains. H₂O molecules are located in tunnels.     

Synthese und Eigenschaften von cis-Diacidophthalocyaninato(2–)thallaten(III); Kristallstruktur von Tetra(n-butyl)ammonium-cisdinitrito(O,O′)- und -cis-dichlorophthalocyaninato(2–)thallat(III)

Syntheses and Properties of cis -Diacidophthalocyaninato(2–)thallates(III); Crystal Structure of Tetra(n-butyl)ammonium cis -dinitrito(O,O ′)- and cis -dichlorophthalocyaninato(2–)thallate(III) Blue green cis-diacidophthalocyaninato(2–)thallate(III), ^cis[Tl(X)₂pc^2–]^– (X = Cl, ONO′, NCO) is prepared from iodophthalocyaninato(2–)thallium(III) and the corresponding tetra(n-butyl)ammonium salt, (ⁿBu₄N)X in dichloromethane, and isolated as (ⁿBu₄N)^cis[Tl(X)₂pc^2–]. (ⁿBu₄N)^cis[Tl(ONO′)₂pc^2–] ( 1 ) and (ⁿBu₄N)^cis[Tl(X)₂pc^2–] · 0,5 (C₂H₅)₂O ( 2 ) crystallize in the monoclinic space group P2₁/n with cell parameters for 1: a = 14.496(2) Å, b = 17.293(5) Å, c = 18.293(2) Å, β = 98.76(1)° resp. for 2 : a = 13.146(1) Å, b = 14.204(5) Å, c = 24.900(3) Å, β = 93.88(1)°; Z = 4. In 1 , the octa-coordinated Tl atom is surrounded by four isoindole-N atoms (N_iso) and four O atoms of the bidental nitrito(O,O′) ligands in a distorted antiprism. The Tl–N_iso distances vary between 2.257(3) and 2.312(3) Å, the Tl–O distances between 2.408(3) and 2.562(3) Å. In 2 , the hexa-coordinated Tl atom ligates four N_iso atoms and two Cl atoms in a typical cis-arrangement. The average Tl–N_iso distance is 2.276 Å, the average Tl–Cl distance is 2.550 Å. In 1 and 2 , the Tl atom is directed out of the centre of the (N_iso)₄ plane (Ct_N) towards the acido ligands (d(Tl–Ct_N) = 1.144(1) Å in 1 , 1.116(2) Å in 2 ), and the phthalocyaninato ligand is concavely distorted. The vertical displacements of the periphereal C atoms amounts up to 0.82 Å. The optical and vibrational spectra as well as the electrochemical properties are discussed.     

COPPER(I) COMPLEXES WITH N-(P-NITROPHENYL)-N′-ALKOXYCARBONYLTHIOUREA: SYNTHESES AND CRYSTAL STRUCTURES OF [Cu(H2net)2CI] · CH2CI2 AND [Cu(H2nmt)2CI]2·(CHCI3)2

Abstract

Two copper(I) complexes, [Cu(H₂net)₂Cl] · CH₂Cl₂ (1) and [Cu(H₂nmt)₂Cl]₂ · (CHCl₃)₂ (2), were synthesized by the reaction of CuCl₂ · 2H₂O with N-(p-nitrophenyl)-N′-(ethoxycarbonyl)-thiourea (H₂net) and N-(p-nitrophenyl)-N′-(methoxycarbonyl)-thiourea(H₂nmt), respectively. Both complexes crystallize in the monoclinic space group C2/c. For complex 1, a = 29.52(2), b=13.920(6), c = 14.873(3)Å; β= 101.75(2)°, V = 5984(4) ų, Z = 8 and R = 0.053; for complex 2, a = 30.68(1), b = 13.369(4), c = 14.226(7) Å, β = 99.52(4)°. V = 5754(4) ų, Z = 4 and R = 0.063. In complex 1, two H₂net molecules are bonded to Cu(I) atom through two S atoms forming a mononuclear complex with trigonal geometry for the Cu(I) ion [Cl(1)-Cu-S(1)=118.54(7), Cl(1)-Cu-S(2)=119.70(7), S(1)-Cu-S(2)=112.17(8)°, Cu-S(1) = 2.251(2), Cu-S(2) = 2.255(2), Cu-Cl(1) = 2.263(2) Å]. Complex 2 is a dimer formed by long Cu-S interactions [Cu-S* = 2.607(3) Å] from adjacent twc H₂nmt molecules; the Cu(I) ion has distorted tetrahedral coordination [Cl(1)-Cu-S(1) = 119.8(1), Cl(1)-Cu-S(2)=120.0(1), S(1)-Cu-S(2)=108.85(9)°] with unequal Cu-S [2.268(2), 2.247(2)Å] and Cu-Cl(1) [2.255(2)Å] bonds.     

STRUCTURES OF PYRIDINE CARBOXYLATE COMPLEXES OF COBALT(II) AND COPPER(II)

Abstract

The syntheses and crystal structures of [Co(nic)₂(H₂O)₄] (1). [Co(iso)₂(H₂O)₄] (2). [Cu(nic)₂(H₂O)₄] (3), and [Cu(iso)₂(H₂O)₄] (4) (nic = nicotinate; iso = isonicotinate) are reported. Complex 1 crystallizes in monoclinic, space group C2/m with cell parameters a =14.150(4). b = 6.883(2)., c = 8.497(2) Å, β= 118.28(2)° and Z = 2. The other crystals. 2. 3. and 4. are all triclinic, Pī; a = 9.777(3), b = 6.348(4), c = 6.888(3)Å, a= 113.10(6)., β= 110.55(3). γ = 97.61(5)°, and Z=l for 2; a = 7.0281(4), b = 7.7176(6), c = 8.6978(7)Å, a = 68.103(7), β = 68.526(5), γ = 62.550(6)°, and Z=1 for 3; a = 9.1807(4), b = 6.3334(3), c = 6.8871(3)Å, a= 108.213(4), β = 99.433(4), γ= 105.190(4)°, and Z= 1 for 4. The arrangements around the metal ions are trans-octahedra with two pyridyl nitrogens and two aqua oxygens in the equatorial positions and two aqua oxygens in the axial positions, although the Cu(II) complexes show a larger Jahn-Teller distortion.     

trans-Bis(triphenylphosphin)phthalocyaninato(2–)rhenium(II): Synthese,Eigenschaften und Kristallstruktur

trans -Bis(triphenylphosphine)phthalocyaninato(2–)rhenium(II): Synthesis, Properties, and Crystal Structure Dirheniumheptoxide reacts with phthalodinitrile in boiling 1-chloronaphthalene and subsequent reprecipitation of the green raw product from conc. sulfuric acid to yield an oxo-phthalocyaninate of rhenium, which is reduced by molten triphenylphosphine forming dark green trans-bis(triphenylphosphine)phthalocyaninato(2–)rhenium(II), ^trans[Re(PPh₃)₂pc^2–]. The latter crystallizes triclinic in the space group P 1 with the cell parameters as follows: a = 11.512(2) Å, b = 12.795(2) Å, c = 12.858(2) Å, α = 64.42(2)°, β = 79.45(2)°, γ = 72.74(1)°; V = 1628.1(5); Z = 1. Re is in the centre of the (N_p)₄ plane (N_p: N1, N3) and coordinates two triphenylphosphine ligands axially in trans position. The average Re–N_p and Re–P distances are 2.007(1) and 2.516(3) Å, respectively. Despite the many extra bands the typical B, Q and N regions of the pc^2– ligand are observed at ca. 16500, 28900/32900 and 35300 cm^–1. A weak band group at ca. 8900 cm^–1 is attributed to a trip-multiplet transition, another one at ca. 14500 cm^–1 to a P → Re charge transfer. The vibrational spectra are dominated by internal vibrations of the pc^2– ligand. The very weak intensity of the IR bands at 905 and 1327 cm^–1 are diagnostic of the presence of Re^II.     

Dinuclear copper(II) complex and 1-D copper(II) complex with taurine Schiff base: synthesis,crystal structure,and properties

A dinuclear copper(II) compound, [Cu(btssb)(H₂O)]₂ · 4(H₂O) (1), and a 1-D chain copper(II) compound, [Cu(ctssb)(H₂O)] _n (2) [where H₂btssb is 2-[(5-bromo-2-hydroxy-benzylidene)-amino]-ethanesulfonic acid and H₂ctssb is 2-[(3,5-dichloro-2-hydroxy-benzylidene)-amino]-ethanesulfonic acid], were prepared and characterized. Compound 1 crystallizes in the monoclinic space group P2₁/c, with a = 10.109(2) Å, b = 20.473(4) Å, c = 6.803(1) Å, β = 100.32(3)°, V = 1385.1(5) ų, and Z = 2; R ₁ for 1796 observed reflections [I > 2σ(I)] was 0.0357. The geometry around each copper(II) can be described as slightly distorted square pyramidal. The Cu^II ··· Cu^II distance is 5.471(1) Å. Compound 1 formed a 1-D network through O–H ··· O hydrogen bonds and 1-D water chains exist. The 1-D chain complex 2 crystallizes in the triclinic space group P 1, with a = 5.030(2) Å, b = 7.725(2) Å, c = 17.011(5) Å, α = 92.706(4)°, β = 97.131(4)°, γ = 102.452(3)°, V = 638.6(3) ų, and Z = 2; R ₁ for 1897 observed reflections [I > 2σ(I)] was 0.0171. In 2, Cu(II) was also a slightly distorted square pyramid formed by two oxygens and one nitrogen from ctssb, one oxygen from another ctssb, and one water molecule. The complex formed a 1-D chain through O–S–O bridge of ctssb ligand. The 1-D chain further constructed a double chain through O?H ··· O hydrogen bonds.     

Transition Metal Halide Salts and Complexes of 2-Aminopyrimidine: Cobalt(II) and Nickel(II) compounds,Crystal Structures of Bis(2-Aminopyrimidinium)MX4 [M = Co,Ni; X = Cl,Br] and 2-Aminopyrimidinium(+2) [NiBr2(H2O)4]Br2

The reaction of MX₂ (M = Co(II), Ni(II); X = Cl, Br) with 2-aminopyrimidine in aqueous acid yields compounds [(2-apmH)₂MX₄], (2-apmH)₂[MX₄], or (2-apmH₂) [MX₂(H₂O)₄]X₂ (2-apmH = 2-aminopyrimidinium; 2-apmH₂ = 2-aminopyrimidinium(2+)). All compounds have been characterized by single crystal X-ray diffraction. The compounds [(2-apmH)₂MX₄] with M = Co, X = Cl (1); M = Ni, X = Cl (3); and M = Ni, X = Br (4) are isomorphous and crystallize as nearly square planar MX₄ units with the 2-apmH cations coordinated in the axial sites through the unprotonated ring nitrogen. (2-ApmH)₂[CoBr₄] (2) crystallizes as the salt with a nearly tetrahedral CuBr₄ ^2- anion. (2-ApmH₂)[NiBr₂(H₂O)₄]Br₂ (5) forms as a cocrystal of the neutral, six-coordinate nickel complex and (2-ampH₂)Br₂, stabilized by extensive hydrogen bonding. Crystal data (1): monoclinic, P2₁/c, a = 7.540(4), b = 12.954(4), c = 7.277(3) Å, β = 110.09(6), V = 667.4(5) ų, Z = 2, D_calc = 1.955 Mg/m³, μ = 2.079 mm^-1, R = 0.0501 for [|I|≥2(I)]. For (2): triclinic, P-1, a = 7.720(2), b = 7.916(2), c = 14.797(3) Å, α = 97.264(3), β = 104.788(3), γ = 105.171(3)°, V = 825.3(3) ų, Z = 2, D_calc = 2.296 Mg/m³, μ = 10.715 mm^-1, R = 0.0308 for [|I|≥2(I)]. For (3): monoclinic, P2₁/c, a = 7.595(3), b = 12.891(4), c = 7.204(3) Å, β = 111.07(3)°, V = 658.2 ų, Z = 2, D_calc = 1.982 Mg/m³, μ = 2.279 mm^-1, R = 0.0552 for [|I|≥2(I)]. For (4): monoclinic, P2₁/c, a = 7.840(2), b = 13.358(4), c = 7.518(2) Å, β = 110.923(3)°, V = 938.6(3) ų, Z = 2, D_calc = 2.577 Mg/m³, μ = 12.18 mm^-1, R = 0.0280 for [|I|≥2(I)]. For (5): orthorhombic, Pnma, a = 16.776(6), b = 11.943(4), c = 7.079(3) Å, V = 1418.2(9) ų, Z = 4, D_calc = 2.564 Mg/m³, μ = 12.639 mm^-1, R = 0.0381 for [|I|≥2σ(I)].     

Bis(phthalocyaninato(2–)rhenium(II)): Synthesis,Properties, and Crystal Structure

Blue, paramagnetic bis(phthalocyaninato(2–)rhenium(II)) (μ_eff = 0,88 μ_B, per Re, at 300 K) is prepared by thermal decomposition of trans-bis(triphenylphosphine)phthalocyaninato(2–)rhenium(II), in boiling triphenylphosphine. It crystallizes in the triclinic space group P 1 with cell parameters as follows: a = 7.799(3) Å, b = 12.563(7) Å, c = 12.69(1) Å, α = 89.97(5)°, β = 94.14(5)°, γ = 106.39(4)°; Z = 1. Two cofacial phthalocyaninates are bonded together by a Re–Re bond with a Re–Re distance of 2.285(2) Å. The Re atoms are located distinctly outside the centre of the (N_iso)₄ planes by 0.426(3) Å. The Re–N_iso distance varies from 1.99(1) to 2.04(1) Å (average 2.02 Å). The pc^2– ligands are in an eclipsed conformation and concavely distorted. In the UV-VIS-NIR spectrum the B region is split into two bands of comparable intensity due to strong excitonic coupling. The Re–Re stretching vibration at 240 cm^–1 is selectively enhanced in the resonance Raman spectrum (λ_exc = 488 nm).     

Crystal structure of the dichlorobis(1-allyltetrazole-N4)copper(II) complex [Cu(1-CH2=CHCH2−N4CH)2Cl4/2]∞∞

The crystal structure of the dichlorobis(1-allyltetrazole-N⁴)copper(II) complex was determined by X-ray diffraction analysis. The crystals are monoclinic, a=14.233(3), b=6.755(1), c=7.273(1) Å, β=104.63(3)°, V_cell=676.6(2), ų, space group P2₁/c, Z=4, d_calc=1.741g/cm³, d_msd=1.69 g/cm³, CAD-4, λMoK_α radiation, R_F=0.0377 for 520 F_hkl>4σ(F_hkl) and 0.0560 for all 872 independent reflections. The structure is layered; the coordination polyhedron of copper is a square bipyramid, in which the equatorial positions are occupied by two chlorine atoms (Cu?Cl 2.27(2)–2.31(2) Å) and two N⁴ atoms of planar tetrazole ligands, whereas the axial positions are occupied by two chlorine atoms of the neighboring molecules of the complex (Cu?Cl 2.97(2)–3.01(2) Å). The sublattice of chlorine atoms is disordered in such a way that the [CuCl_4/2]_∞∞ layer is a superposition of two variants with weights 61(3) and 39(3)% and with similar geometrical characteristics: the equatorial chlorine atoms in variant A are replaced by the axial atoms in variant B and vice versa. The tetrazole ligand has the same position in both variants. In general, the crystal is a polytype with random alternation of A and B type blocks. It is shown that the compound is isostructural to the complex with 1-ethyltetrazole [Cu(ettz)₂Cl₂], in which only variant B is realized.     

Synthesis,crystal structure,and luminescent properties of a new modification of the zinc(II) dichloride complex with phthalazine

The coordination compound [ZnCl₂(Phtz)₂] has been synthesized by the reaction of ZnCl₂ with phthalazine (Phtz, L, C₈H₆N₂) in an ethanol solution. Its crystal structure has been determined: crystals are triclinic, space group P 0000000, a = 7.346(1) Å, b = 8.095(1) Å, c = 14.275(1) Å, α = 85.63(1)°, β = 75.75(1)°, γ = 88.43(1)°, V = 820.4(2) ų, ρ_calc = 1.605 g/cm³, Z = 2. The zinc atom is tetrahedrally coordinated to two crystallographically nonequivalent chlorine atoms and two nitrogen atoms of the ligands L (Zn(1)–N(1), 2.036(4) Å; Zn(1)–N(3), 2.043(4) Å; Zn(1)–Cl(1), 2.225(2) Å; Zn(1)–Cl(2), 2.220(2) Å; angles NZnN, 106.1(2)°; ClZnCl, 116.47(7)°). The complexes are combined into a 1D supramolecular structure by nonclassical hydrogen bonds C–H···Cl and π–π-stacking interaction between centrosymmetric pairs of aromatic rings of one of the independent ligands. The compounds [CdI₂(Phtz)] and [HgBr₂(Phtz)] have also been synthesized, and their luminescent properties have been studied.     

Synthesis,Spectroscopic, and X‐Ray Diffraction Studies of cis‐Dichlorobis(4‐propanoyl‐2,4‐dihydro‐5‐methyl‐2‐phenyl3 H‐pyrazol‐3‐onato) Tin(IV)

Reaction between an aqueous ethanol solution of tin(II) chloride and that of 4‐propanoyl‐2,4‐dihydro‐5‐methyl‐2‐phenyl‐3 H‐pyrazol‐3‐one in the presence of O₂ gave the compound cis‐dichlorobis(4‐propanoyl‐2,4‐dihydro‐5‐methyl‐2‐phenyl‐3 H‐pyrazol‐3‐onato) tin(IV) [(C₂₆H₂₆N₄O₄)SnCl₂]. The compound has a six‐coordinated Sn^IV centre in a distorted octahedral configuration with two chloro ligands in cis position. The tin atom is also at a pseudo two‐fold axis of inversion for both the ligand anions and the two cis‐chloro ligands. The orange compound crystallizes in the triclinic space group P 1 with unit cell dimensions, a = 8.741(3) Å, b = 12.325(7) Å, c = 13.922(7) Å; α = 71.59(4), β = 79.39(3), γ = 75.18(4); Z = 2 and D_x = 1.575 g cm^–3. The important bond distances in the chelate ring are Sn–O [2.041 to 2.103 Å], Sn–Cl [2.347 to 2.351 Å], C–O [1.261 to 1.289 Å] and C–C [1.401 Å] the bond angles are O–Sn–O 82.6 to 87.7° and Cl–Sn–Cl 97.59°. The UV, IR, ¹H NMR and ¹¹⁹Sn Mössbauer spectral data of the compound are reported and discussed.     

Coinage (Cu,Ag) metal derivatives of salicylaldehyde N-ethylthiosemicarbazone: synthesis,spectroscopy, and structures

Reactions of copper(I) halides with triphenyl phosphine in acetonitrile followed by the addition of salicylaldehyde N-ethylthiosemicarbazone {(2-OH–C₆H₄)(H)C²=N³–N²H–C¹(=S)N¹HEt, H₂stsc-NEt} in chloroform in 1?:?2?:?1 (Cl) or 1?:?1?:?1 (Br, I) molar ratios yield mononuclear, [CuCl(η ¹-S-H₂stsc-NHEt)(PPh₃)₂] (1) and sulfur-bridged dinuclear, [Cu₂X₂(μ-S-H₂stsc-NEt)₂(PPh₃)₂] (X?=?Br, 4; I, 5) complexes. Similarly, reaction of silver halides (Cl, Br) with H₂stsc-NEt in acetonitrile followed by the addition of PPh₃ to the solid that formed (1?:?1?:?2 molar ratio), yielding mononuclear complexes, [AgX(η ¹-S-H₂stsc-NHEt)(PPh₃)₂] (Cl, 2; Br, 3). All these complexes are characterized with analytical data, IR, and NMR spectroscopy and single-crystal X-ray crystallography. The ligand favored η ¹-S bonding in 1, 2, and 3, and μ-S bonding in 4 and 5. Cu?···?Cu contacts were 3.063?Å. The complexes form 1-D or 2-D H-bonded networks, entrapping solvent in some cases.     

Crystal and molecular structure of (hexafluoroacetylacetonato) (pivaloylacetonato)copper(II)

The crystal structure of (hexafluoroacetylacetonato)(pivaloylacetonato)copper(II) has been determined. Crystal data for CuO₄C₁₃H₁₄F₆: a = 8.288(2) Å, b = 8.682(2) Å, c = 12.307(2) Å; α = 90.75(3)°, β = 94.29(3)°, γ = 106.60(3)°; V = 845.7(3) ų, space group \(P\overline 1 \), Z = 2, d_calc = 1.617 g/cm³. The coordination polyhedron of the copper atom is formed by four oxygen atoms of two different β-diketonate ligands with Cu-O distances within 1.874–1.946 Å; the O-Cu-O bond angles are 94.8° and 90.6°. The complexes are united into centrosymmetrical “dimers” with Cu...Cu distances of 4.365 Å.     

Adducts of Cyclodiphosph(V)azenes: Synthesis and Structure

The reaction of Ph₂PCl and PhPCl₂ with bis(trimethylsilyl)sulfur diimide in the presence of GaCl₃ and AlCl₃ yields diadducts of the corresponding cyclodiphosph(V)azene: [Ph₂PN]₂·(GaCl₃)₂ ( 1 ), [Ph₂PN]₂·(AlCl₃)₂ ( 2 ), and [Ph(Cl)PN]₂·(AlCl₃)₂ ( 3 ). This reaction is triggered by Lewis acids, which catalyse the (CH₃)₃Si‐Cl and S₈ elimination. The structures of 1· 2 CH₂Cl₂, 2· 2 CH₂Cl₂ and 3 were determined by single crystal X‐ray studies ( 1 : triclinic, , a = 9.679(2) Å, b = 9.863(2) Å, c = 11.366(2) Å, α = 113.55(3)°; β = 99.59(3)°; γ = 106.67(3)°; V = 902.8(3) ų, Z = 1; 2 : triclinic, , a = 9.639(2) Å, b = 9.804(2) Å, c = 11.321(2) Å, α = 113.71(3)°; β = 99.44(3)°; γ = 106.70(3)°; V = 889.3(3) ų, Z = 1; 3 : orthorhombic, Pbca, a = 14.853(3) Å, b = 9.261(2) Å, c = 16.631(3) Å, V = 2287.7(8) ų, Z = 4.     

Coordination Chemistry of Sulfonyl Amides. 2 The Crystal Structure of Copper(II) and Silver(I) Complexes of N,N-4-Toluenesulfonyl-2-Pyridylaminato Ligand

Three structures containing the N,N-4-toluenesulfonyl-2-pyridylaminato ligand are presented. The brown crystal of Cu₂L₄ (L =N,N-4-toluenesulfonyl-2-pyridylaminato) was found to crystallize in the monoclinic space group P2,/c with a = 15.762(12), b = 15.552(5), c = 20.505(11) Å, β = 104.14(7)°; V = 4874(5) Å^3;Z = 4; the final R_F = 0.050, R_WF = 0.049 for 5142 observed reflections and 612 variables. The Cu-Cu distance is small, 2.516(2) Å and the complex is diamagnetic at room temperature. The colorless crystal of Ag₂L was found to crystallize in the monoclinic space group P2_t/n with a = 9.620(2), b = 5.625(2), c ? 23.250(3) Å, Å = 94.72(1)°; V = 1254.0(5) ų; Z = 2; the final R_F = 0.027; R_WF = 0.028 for 1929 observed reflections and 164 variables. The Ag-Ag distance is 2.739(1) Å The green crystal of CuL₂ (py)₂was found to crystallize in the monoclinic space group P2₁ with a = 9.366(2), b = 20.615(7), c = 9.862(2) Å,β = 116.73(2)°; V = 1700.5(8) ų; Z = 2; the final R_F = 0.037; R_WF = 0.038 for 1636 observed reflections and 423 variables. A reversible transformation between Cu₂L₄ and CuL₂(py)₂ is reported.     

A Novel Dinuclear Copper(II) Complex Molecule: Synthesis and Crystal Structure of Cu2(phen)2(H2O)2(C5H6O4)2 with phen = 1,10‐phenanthroline

Blue crystals of Cu₂(phen)₂(H₂O)₂(C₅H₆O₄)₂ were obtained from a CH₃OH–H₂O solution containing CuCl₂, 1,10‐phenanthroline (phen), glutaric acid and Na₂CO₃. The crystal structure (monoclinic, P2₁/c (no. 14), a = 10.271(1), b = 10.595(1), c = 15.585(1) Å, β = 107.105(3)°, Z = 2, R = 0.0328, wR² = 0.1027 for 3376 observed reflections (F ≥ 2σ(F ) out of 3728 unique reflections) is built up of dinuclear Cu₂(phen)₂(H₂O)₂(C₅H₆O₄)₂ complex molecules centered at inversion centers. The Cu atoms are square‐pyramidally coordinated by two nitrogen atoms of one bidentate chelating phen ligand and three oxygen atoms from two bridging glutarate anions and one axial water molecule (d(Cu–N) = 2.018(2), 2.024(2) Å; basal d(Cu–O) = 1.949(2), 1.956(2) Å; axial d(Cu–O) = 2.382(2) Å). Through the π‐π stacking interactions extending in a direction, the complex molecules are interlinked into 2 D layers parallel to the ac plane. The resultant 2 D layers are held together by hydrogen bonds between water molecules and uncoordinated carboxyl oxygen atoms.