共查询到20条相似文献,搜索用时 78 毫秒
1.
The Schiff base ligands 1,4-bis(4-pyridyl)-2,3-diaza-1,3-butadiene (L1, monoclinic, P2(1)/c, a = 3.856(1) A, b = 11.032(2) A, c = 12.738(3) A, beta = 92.21(3) degrees, Z = 2) and 2,5-bis(4-pyridyl)-3,4-diaza-2,4-hexadiene (L2, monoclinic, P2(1)/c, a = 10.885(2) A, b = 4.613(1) A, c = 14.978(3) A, beta = 92.827(4) degrees, Z = 2) were used in the synthesis of four new organic-inorganic coordination polymers, each of them adopting a different structural motif. Synthesis, X-ray structural determinations, and spectroscopic and thermogravimetric analyses are presented. The reaction between Co(NO(3))(2).6H(2)O and L1 afforded a two-dimensional noninterpenetrating brick-wall structure, [Co(C(12)N(4)H(10))(1.5)(NO(3))(2)(H(2)O)(CH(2)Cl(2))(2)](n)() (1, triclinic, P1; a = 10.242(7) A, b = 10.802(7) A, c = 15.100(1) A, alpha = 70.031(1), beta = 75.168(11), gamma = 76.155(11), Z = 2), while Ni(NO(3))(2).6H(2)O combined with L1 yielded an interpenetrating three-dimensional rhombus-grid polymer, [Ni(C(12)N(4)H(10))(2)(NO(3))(2)(OC(4)H(8))(1.66)(H(2)O)(0.33)](n) (2, monoclinic, C2/c; a = 20.815(8) A, b = 23.427(8) A, c = 17.291(6) A, beta = 116.148(6), Z = 8). The reaction of Co(NO(3))(2).6H(2)O and L2 was found to be solvent-sensitive and resulted in the formation of two different noninterpenetrating compounds: [Co(C(14)N(4)H(14))(2)(NO(3))(2)(C(6)H(6))(1.5)](n)() (3, monoclinic, C2/c; a = 22.760(2) A, b = 21.010(3) A, c = 25.521(2) A, beta = 97.151(2), Z = 8), which adopts a two-dimensional square-grid motif formed by propeller-type modules, and [Co(C(14)N(4)H(14))(1.5)(NO(3))(2)(CH(2)Cl(2))(2)](n)() (4, monoclinic, P2(1)/n; a = 14.432(2) A, b = 14.543(8) A, c = 15.448(4) A, beta = 96.968(0), Z = 4), consisting of T-shaped building blocks assembled into a one-dimensional ladder-type structure. These four coordination polymers all exhibit impressive thermal stability. Thermogravimetric studies showed that after complete removal of the solvents, the frameworks are stable to temperatures between 234 degrees C and 260 degrees C. 相似文献
2.
Four new zinc diphosphonate compounds with formulas [NH(3)(CH(2))(2)NH(3)]Zn(hedpH(2))(2).2H(2)O, 1, [NH(3)(CH(2))(n)()NH(3)]Zn(2)(hedpH)(2).2H(2)O, (n = 4, 2; n = 5, 3; n = 6, 4) (hedp = 1-hydroxyethylidenediphosphonate) have been synthesized under hydrothermal conditions at 110 degrees C and in the presence of alkylenediamines NH(2)(CH(2))(n)()NH(2) (n = 2, 4, 5, 6). Crystallographic data for 1: monoclinic, space group C2/c, a = 24.7422(15), b = 5.2889(2), c = 16.0338(2) A, beta = 117.903(1) degrees, V = 1856.17(18) A(3), Z = 4; 2: monoclinic, space group P2(1)/n, a = 5.4970(3), b = 12.1041(6), c = 16.2814(12) A, beta = 98.619(5) degrees, V = 1071.07(11) A(3), Z = 2; 3: monoclinic, space group P2(1)/n, a = 5.5251(2), b = 12.5968(3), c = 16.1705(5) A, beta = 99.182(1) degrees, V = 1111.02(6) A(3), Z = 2; 4: triclinic, space group P-1, a = 5.4785(2), b = 14.1940(5), c = 16.0682(6) A, alpha = 81.982(2) degrees, beta = 89.435(2) degrees, gamma = 79.679(2) degrees, V = 1217.11(8) A(3), Z = 2. In compound 1, two of the phosphonate oxygens are protonated. The metal ions are bridged by the hedpH(2)(2-) groups through three of the remaining four phosphonate oxygens, forming a one-dimensional infinite chain. The protonated ethylenediamines locate between the chains in the lattice. In compounds 2-4, only one phosphonate oxygen is protonated. Compounds 2 and 3 have a similar three-dimensional open-network structure composed of [Zn(2)(hedpH)(2)](n) double chains with strong hydrogen bonding interactions between them, thus generating channels along the [100] direction. The protonated diamines and water molecules reside in the channels. Compound 4 contains two types of [Zn(2)(hedpH)(2)](n) double chains which are held together by strong hydrogen bonds, forming a two-dimensional network. The interlayer spaces are occupied by the [NH(3)(CH(2))(6)NH(3)](2+) cations and water molecules. The significant difference between structures 2-4 is also featured by the coordination geometries of the zinc atoms. The geometries of those in 2 can be described as distorted octahedral, and those in 3 as distorted square pyramidal. In 4, two independent zinc atoms are found, each with a distorted octahedral and a tetrahedral geometry, respectively. 相似文献
3.
The syntheses, structural characterization, and magnetic behavior of five new 2D manganese(II) complexes with empirical formulas [Mn(N(3))(2)(2,6-DiMepyz)(H(2)O)](n)() (1), [Mn(N(3))(2)(Etpyz)(H(2)O)](n)() (2), [Mn(N(3))(2)(H(2)O)(2)](n)()(2,3-DiMepyz)(n)() (3), [Mn(N(3))(2)(Clpyz)(2)](n)() (4), and [Mn(N(3))(2)(Ipyz)(2)](n)() (5) (pyz = pyrazine (1,4-diazine)) are reported. 1 crystallizes in the monoclinic system, space group P2(1)/c, with unit cell parameters a = 7.513(4) A, b = 17.438(7) A, c = 8.404(4) A, beta = 94.53(4) degrees , and Z = 4. 2 crystallizes in the triclinic system, space group P, with unit cell parameters a = 7.386(2) A, b = 8.434(2) A, c = 9.442(3) A, alpha = 71.82(2) degrees , beta = 72.08(2) degrees , gamma = 88.54(2) degrees , and Z = 2. 3 crystallizes in the monoclinic system, space group C2/c, with unit cell parameters a = 20.438(7) A, b = 7.711(2) A, c = 7.457(2) A, beta = 93.76(3) degrees , and Z = 4. 4 crystallizes in the orthorhombic system, space group Pbca, with unit cell parameters a = 8.600(2) A, b = 13.440(4) A, c = 24.083(7) A, and Z = 8. 5 crystallizes in the orthorhombic system, space group Pbca, with unit cell parameters a = 8.521(2) A, b = 13.787(3) A, c = 26.237(5) A, and Z = 8. The compounds 1-5 have only azido bridging ligands. In 1-3 each manganese atom is linked to the four nearest neighbors by only end-to-end azido bridges, forming square layers. 4 and 5 show alternating end-to-end and end-on azido bridges between manganese atoms. The magnetic properties of 1-5 are reported. At high temperatures the plots of chi(M) or chi(M)T vs T for the 1-3 compounds can be fitted as homogeneous 2D systems with J = -4.9, -4.4, and -3.9 cm(-)(1) for 1-3, respectively. For 1, 3, and 5 magnetic ordering and spontaneous magnetizations is achieved below T(c) = 35, 29, and 22 K, respectively, whereas 2 and 4 do not show spontaneous magnetization up to 2 K. 相似文献
4.
Six new metal-organic coordination networks based on linking unit 2,5-bis(4-pyridyl)-1,3,4-thiadiazole (L(1)) or 2,5-bis(3-pyridyl)-1,3,4-oxadiazole (L(3)) and inorganic Cu(II), Cd(II), and Co(II) salts have been prepared and structurally characterized by single-crystal X-ray analysis. Using L(1) to react with three different Cu(II) salts, Cu(OAc)(2).H(2)O, Cu(NO(3))(2).3H(2)O, and CuSO(4).5H(2)O, respectively, two different one-dimensional (1-D) coordination polymers, [[Cu(2)L(1)(mu-OAc)(4)](CHCl(3))(2)](n) (1) [triclinic, space group P1, a = 7.416(3) A, b = 8.207(3) A, c = 14.137(5) A, alpha = 100.333(7) degrees, beta = 105.013(6) degrees, gamma = 94.547(6) degrees, Z = 1] and [[CuL(1)(NO(3))(2)](CHCl(3))(0.5)](n) (2) [monoclinic, space group C2/c, a = 28.070(8) A, b = 9.289(3) A, c = 15.235(4) A, beta = 113.537(5) degrees, Z = 8], and a chiral 3-D open framework, [[CuL(1)(H(2)O)(SO(4))](H(2)O)(2)](n) (3) [orthorhombic, space group P2(1)2(1)2(1), a = 5.509(2) A, b = 10.545(4) A, c = 29.399(11) A, Z = 4], were obtained. Reaction of L(1) and Cd(ClO(4))(2).6H(2)O or Co(ClO(4))(2).6H(2)O, in the presence of NH(4)SCN, yielded another 3-D open framework, [[CdL(1)(NCS)(2)](CH(3)OH)(1.5)](n) (4) [monoclinic, space group C2/c, a = 28.408(10) A, b = 9.997(5) A, c = 7.358(4) A, beta = 99.013(8) degrees, Z = 4], or a 2-D network, [[Co(L(1)())(2)(NCS)(2)](H(2)O)(2.5)](n) (5) [orthorhombic, space group Pnna, a = 22.210(5) A, b = 12.899(3) A, c = 20.232(4) A, Z = 4]. When L(1) was replaced by L(3) to react with Co(ClO(4))(2).6H(2)O and NH(4)SCN, another 2-D coordination polymer, [Co(L(3))(2)(NCS)(2)](n) (6) [monoclinic, space group P2(1)/c, a = 8.120(3) A, b = 9.829(4) A, c = 17.453(6) A, beta = 103.307(6) degrees, Z = 2], was constructed. These results indicate that the nature of the ligands, metal centers, or counteranions plays the critical role in construction of these novel coordination polymers. The interesting porous natures of two 3-D open frameworks 3 and 4 were investigated by TGA and XPRD techniques, and the magnetic properties of the Cu(II) and Co(II) complexes were studied by variable-temperature magnetic susceptibility and magnetization measurements. 相似文献
5.
Two new vanadoselenites, [SeV(3)O(11)](3)(-) and [Se(2)V(2)O(10)](2)(-), were synthesized by reacting SeO(2) with VO(3)(-). Single-crystal X-ray structural analyses of [(n-C(4)H(9))(4)N](3)[SeV(3)O(11)].0.5H(2)O [orthorhombic, space group P2(1)2(1)2, a = 22.328(5) A, b = 44.099(9) A, c = 12.287(3) A, Z = 8] and [[(C(6)H(5))(3)P](2)N](2)[Se(2)V(2)O(10)] [monoclinic, space group P2(1)/n, a = 12.2931(3) A, b = 13.5101(3) A, c = 20.9793(5) A, beta = 106.307(1) degrees, Z = 2] revealed that both anions are composed of Se(x)()V(4)(-)(x)()O(4) rings. The (51)V, (77)Se, and (17)O NMR spectra established that both [SeV(3)O(11)](3)(-) and [Se(2)V(2)O(10)](2)(-) anions maintain this ring structure in solution. 相似文献
6.
Nagao H Hirano T Tsuboya N Shiota S Mukaida M Oi T Yamasaki M 《Inorganic chemistry》2002,41(24):6267-6273
The reaction of cis-[Ru(NO)(CH(3)CN)(bpy)(2)](3+) (bpy = 2,2'-bipyridine) in H(2)O at room temperature proceeded to afford two new nitrosylruthenium complexes. These complexes have been identified as nitrosylruthenium complexes containing the N-bound methylcarboxyimidato ligand, cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](2+), and methylcarboxyimido acid ligand, cis-[Ru(NO)(NH=C(OH)CH(3))(bpy)(2)](3+), formed by an electrophilic reaction at the nitrile carbon of the acetonitrile coordinated to the ruthenium ion. The X-ray structure analysis on a single crystal obtained from CH(3)CN-H(2)O solution of cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](PF(6))(3) has been performed: C(22)H(20.5)N(6)O(2)P(2.5)F(15)Ru, orthorhombic, Pccn, a = 15.966(1) A, b = 31.839(1) A, c = 11.707(1) A, V = 5950.8(4) A(3), and Z = 8. The structural results revealed that the single crystal consisted of 1:1 mixture of cis-[Ru(NO)(NH=C(O)CH(3))(bpy)(2)](2+) and cis-[Ru(NO)(NH=C(OH)CH(3))(bpy)(2)](3+) and the structural formula of this single crystal was thus [Ru(NO)(NH=C(OH(0.5))CH(3))(bpy)(2)](PF(6))(2.5). The reaction of cis-[Ru(NO)(CH(3)CN)(bpy)(2)](3+) in dry CH(3)OH-CH(3)CN at room temperature afforded a nitrosylruthenium complex containing the methyl methylcarboxyimidate ligand, cis-[Ru(NO)(NH=C(OCH(3))CH(3))(bpy)(2)](3+). The structure has been determined by X-ray structure analysis: C(25)H(29)N(8)O(18)Cl(3)Ru, monoclinic, P2(1)/c, a = 13.129(1) A, b = 17.053(1) A, c = 15.711(1) A, beta = 90.876(5) degrees, V = 3517.3(4) A(3), and Z = 4. 相似文献
7.
The hydrothermal reactions of MoO(3), an appropriate Cu(II) source, tetra-2-pyridylpyrazine (tpypyz), and phosphoric acid and/or an organophosphonate yielded a series of organic-inorganic hybrid materials of the copper-molybdophosphonate family. A common feature of the structures is the entrainment within the extended architectures of chemically robust [Mo(5)O(15)(O(3)PR)(2)](4)(-) clusters as molecular building blocks. The cluster is a characteristic feature of the one-dimensional materials [[Cu(2)(tpypyz)(H(2)O)(3)]Mo(5)O(15)(HPO(4))(O(3)PCH(2)CO(2)H)].H(2)O (1.H(2)O) and [[Cu(2)(tpypyz)(H(2)O)]Mo(5)O(15)(O(3)PC(6)H(5))(2)].2H(2)O (2.2H(2)O), the two-dimensional network [[Cu(2)(tpypyz)(H(2)O)(3)]Mo(5)O(15)(HPO(4))(2)].2H(2)O (5.2H(2)O) and the three-dimensional frameworks [[Cu(2)(tpypyz)(H(2)O)(2)]Mo(5)O(15)[O(3)P(CH(2))(n)()PO(3)]].xH(2)O [n = 3, x = 2.25 (6.2.25H(2)O); n = 4, x = 0.33 (7.0.33H(2)O)]. In the case of methylenediphosphonate as the phosphorus component, the unique chelating nature of the ligand precludes formation of the pentamolybdate core, resulting in the chain structures [[Cu(2)(tpypyz)(H(2)O)]Mo(3)O(8) (HO(3)PCH(2)PO(3))(2)].8H(2)O (3.8H(2)O) and [[Cu(2)(tpypyz)(H(2)O)](2)(Mo(3)O(8))(2)(O(3)PCH(2)PO(3))(3)].16.9H(2)O (4.16.9H(2)O). For structures 1-7, the secondary metal-ligand building block is the binuclear [Cu(2)(tpypyz)(H(2)O)(x)](4+) cluster. There is considerable structural versatility as a result of the variability in the number of attachment sites at the phosphomolybdate clusters, the coordination geometry of the Cu(II), which may be four-, five-, or six-coordinate, the extent of aqua ligation, and the participation of phosphate oxygen atoms as well as molybdate oxo groups in bonding to the copper sites. Crystal data: 1.H(2)O, C(26)H(28)N(6)Cu(2)Mo(5)O(28)P(2), monoclinic C2/c, a = 42.497(2) A, b = 10.7421(4) A, c = 20.5617(8) A, beta = 117.178(1) degrees, V = 8350.1(5) A(3), Z = 8; 2.2H(2)O, C(36)H(32)N(6)Cu(2)Mo(5)O(24)P(2), monoclinic P2(1)/c, a = 11.2478(7) A, b = 19.513(1) A, c = 21.063(1) A, beta = 93.608(1) degrees, V = 4613.7(5) A(3), Z = 4; 3.8H(2)O, C(26)H(40)N(6)Cu(2)Mo(3)O(29)P(4), monoclinic C2/c, a = 32.580(2) A, b = 17.8676(9) A, c = 15.9612(8) A, beta = 104.430(1) degrees, V = 8993.3(8) A(3), Z = 8; 4.16.9H(2)O, C(51)H(71.75)Cu(4)Mo(6)N(12)O(51)P(6), monoclinic P2(1)/c, a = 27.929(3) A, b = 12.892(2) A, c = 22.763(3) A, beta = 90.367(2) degrees, V = 8195.7(2) A(3), Z = 4;( )()5.2H(2)O, C(24)H(28)N(6)Cu(2)Mo(5)O(28)P(2), monoclinic P2(1)/n, a = 11.3222(4) A, b = 18.7673(7) A, c = 19.4124(7) A, beta = 98.819(1) degrees, V = 4076.1(3) A(3), Z = 4; 6.2.25H(2)O, C(27)H(28.5)N(6)Cu(2)Mo(5)O(24.25)P(2), monoclinic C2/c, a = 12.8366(5) A, b = 18.4221(8) A, c = 34.326(1) A, beta = 100.546(1) degrees, V = 7980.1(6) A(3), Z = 8; 7.(1)/(3)H(2)O, C(28)H(28.7)N(6)Cu(2)Mo(5)O(23.3)P(2), monoclinic C2/c, a = 12.577(1) A, b = 18.336(1) A, c = 36.476(3) A, beta = 91.929(2) degrees, V = 8407.3 A(3), Z = 8. 相似文献
8.
Four new organic/inorganic coordination polymers, [Cd(C(10)H(8)N(2))(2)(H(2)O)(2)(NO(3))(2)](n)(1), [Co(C(10)H(8)N(2))(H(2)O)NO(3)CH(3)OH](n)(2), [Cu(C(10)H(8)N(2))(CH(3)OH)(NO(3))(2)](n) (3), and [Cu(C(10)H(8)N(2))(hfac)(2)](n)(4), were synthesized by using the rigid ligand 1,2-bis(3-pyridyl)ethyne (3,3'-DPA). Complex 1 crystallizes in space group P2/n: a = 12.462(2) A, b = 9.485(1) A, c = 13.383(2) A, beta = 96.629(2) degrees, V = 1559.6(3) A(3), Z = 4. Complex 2 crystallizes in space group Fddd: a = 9.248(4) A, b = 19.982(7) A, c = 35.093(16) A, V = 6485.0(4) A(3), Z = 8. Complex 3 crystallizes in space group I2/a: a = 18.315(2) A, b = 8.517(1) A, c = 20.494(3) A, beta = 104.042(2) degrees, V = 3101.2(7) A(3), Z = 8. Complex 4 crystallizes in space group P21/c: a = 6.576(1) A, b = 16.189(1) A, c = 11.653(1) A, beta = 91.337(1) degrees, V = 1240.3(2) A(3), Z = 2. The coordination polymers display a variety of structural architectures, ranging from sinusoidal and zigzag chains (1, 3, 4) to two-dimensional channel-type architectures (2). The effects of the orientation of the nitrogen atom in the pyridine rings on the resultant structures are discussed. 相似文献
9.
X-ray crystal structures are reported for the following complexes: [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O (tacn = 1,4,7-triazacyclononane), monoclinic P2(1)/n, Z = 4, a = 14.418(8) ?, b = 11.577(3) ?, c = 18.471(1) ?, beta = 91.08(5) degrees, V = 3082 ?(3), R(R(w)) = 0.039 (0.043) using 4067 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, monoclinic P2(1)/a, Z = 4, a = 13.638(4) ?, b = 12.283(4) ?, c = 18.679(6) ?, beta = 109.19(2) degrees, V = 3069.5 ?(3), R(R(w)) = 0.052 (0.054) using 3668 unique data with I > 2.5sigma(I) at 293 K; [Ru(2)I(3)(tacn)(2)](PF(6))(2), cubic P2(1)/3, Z = 3, a = 14.03(4) ?, beta = 90.0 degrees, V = 2763.1(1) ?(3), R (R(w)) = 0.022 (0.025) using 896 unique data with I > 2.5sigma(I) at 293 K. All of the cations have cofacial bioctahedral geometries, although [Ru(2)Cl(3)(tacn)(2)](PF(6))(2).4H(2)O, [Ru(2)Br(3)(tacn)(2)](PF(6))(2).2H(2)O, and [Ru(2)I(3)(tacn)(2)](PF(6))(2) are not isomorphous. Average bond lengths and angles for the cofacial bioctahedral cores, [N(3)Ru(&mgr;-X)(3)RuN(3)](2+), are compared to those for the analogous ammine complexes [Ru(2)Cl(3)(NH(3))(6)](BPh(4))(2) and [Ru(2)Br(3)(NH(3))(6)](ZnBr(4)). The Ru-Ru distances in the tacn complexes are longer than those in the equivalent ammine complexes, probably as a result of steric interactions. 相似文献
10.
Two novel d(10) metal coordination polymers [Zn(PDB)](n)() (1) and [Cd(3)(PDB)(2)(OH)(2)(H(2)O)(2)](n)() (2) (H(2)PDB = pyridine-3,4-dicarboxylic acid) have been synthesized under hydrothermal conditions and characterized by elemental analysis, IR, TG analysis, and single-crystal X-ray diffraction. Crystal data for 1: C(7)H(3)NO(4)Zn, orthorhombic Pna2(1), a = 8.423(17) A, b = 6.574(13) A, c = 12.899(3) A, Z = 4. Crystal data for 2: C(14)H(12)N(2)O(12)Cd(3), monoclinic C2/c, a= 20.130(4) A, b = 6.692(13) A, c = 13.081(3) A, beta = 102.78(3) degrees, Z = 4. Both compounds exhibit novel three-dimensional frameworks. Compound 1 not only possesses a one-dimensional rectangular channel but also contains infinite double-stranded helical chains. Compound 2 has two different types of channels, one being built up from pyridine rings and [CdO(5)N] and [CdO(6)] building units and the other being constructed from pyridine rings and [CdO(5)N] building units. Furthermore, both compounds show strong photoluminescence properties at room temperature. 相似文献
11.
Kortz U Nellutla S Stowe AC Dalal NS Rauwald U Danquah W Ravot D 《Inorganic chemistry》2004,43(7):2308-2317
The novel dimeric germanotungstates [M(4)(H(2)O)(2)(GeW(9)O(34))(2)](12)(-) (M = Mn(2+), Cu(2+), Zn(2+), Cd(2+)) have been synthesized and characterized by IR spectroscopy, elemental analysis, magnetic measurements, and (183)W-NMR spectroscopy. X-ray single-crystal analyses were carried out on Na(12)[Mn(4)(H(2)O)(2)(GeW(9)O(34))(2)].38H(2)O (Na(12)()-1), which crystallizes in the monoclinic system, space group P2(1)/n, with a = 13.0419(8) A, b = 17.8422(10) A, c = 21.1626(12) A, beta = 93.3120(10) degrees, and Z = 2; Na(11)Cs(2)[Cu(4)(H(2)O)(2)(GeW(9)O(34))(2)]Cl.31H(2)O (Na(11)()Cs-2) crystallizes in the triclinic system, space group P, with a = 12.2338(17) A, b = 12.3833(17) A, c = 15.449(2) A, alpha = 100.041(2) degrees, beta = 97.034(2) degrees, gamma = 101.153(2) degrees, and Z = 1; Na(12)[Zn(4)(H(2)O)(2)(GeW(9)O(34))(2)].32H(2)O (Na(12)()-3) crystallizes in the triclinic system, space group P, with a = 11.589(3) A, b = 12.811(3) A, c = 17.221(4) A, alpha = 97.828(6) degrees, beta = 106.169(6) degrees, gamma = 112.113(5) degrees, and Z = 1; Na(12)[Cd(4)(H(2)O)(2)(GeW(9)O(34))(2)].32.2H(2)O (Na(12)()-4) crystallizes also in the triclinic system, space group P, with a = 11.6923(17) A, b = 12.8464(18) A, c = 17.616(2) A, alpha = 98.149(3) degrees, beta = 105.677(3) degrees, gamma = 112.233(2) degrees, and Z = 1. The polyanions consist of two lacunary B-alpha-[GeW(9)O(34)](10)(-) Keggin moieties linked via a rhomblike M(4)O(16) (M = Mn, Cu, Zn, Cd) group leading to a sandwich-type structure. (183)W-NMR studies of the diamagnetic Zn and Cd derivatives indicate that the solid-state polyoxoanion structures are preserved in solution. EPR measurements on Na(12)()-1 at frequencies up to 188 GHz and temperatures down to 4 K yield a single, exchange-narrowed peak, at g(iso) = 1.9949, typical of Mn systems, and an upper limit of |D| = 20.0 mT; its magnetization studies still await further theoretical treatment. Detailed EPR studies on Na(11)()Cs-2 over temperatures down to 2 K and variable frequencies yield g( parallel ) = 2.4303 and g( perpendicular ) = 2.0567 and A( parallel ) = 4.4 mT (delocalized over the Cu(4) framework), with |D| = 12.1 mT. Magnetization studies in addition yield the exchange parameters J(1) = -11 and J(2) = -82 cm(-)(1), in agreement with the EPR studies. 相似文献
12.
Zhao L Xu Z Grove H Milway VA Dawe LN Abedin TS Thompson LK Kelly TL Harvey RG Miller DO Weeks L Shapter JG Pope KJ 《Inorganic chemistry》2004,43(13):3812-3824
A series of [3 x 3] Mn(II)(9), antiferromagnetically coupled, alkoxide-bridged, square grid complexes, derived from a group of "tritopic" dihydrazide ligands, is described. The outer ring of eight Mn(II) centers in the grids is isolated magnetically from the central Mn(II) ion, leading to an S = 0 ground state for the ring, and an S = 5/2 ground state overall in each case. Exchange in the Mn(II)(8) ring can be represented by a 1D chain exchange model. Rich electrochemistry displayed by these systems has led to the production of Mn(II)/Mn(III) mixed-oxidation-state grids by both electrochemical and chemical means. Structures are reported for [Mn(9)(2poap)(6)](C(2)N(3))(6).10H(2)O (1), [Mn(9)(2poap)(6)](2)[Mn(NCS)(4)(H(2)O)](2)(NCS)(8).10H(2)O (2), [Mn(9)(2poapz)(6)](NO(3))(6).14.5H(2)O (3), [Mn(9)(2popp)(6)](NO(3))(6).12H(2)O (4), [Mn(9)(2pomp)(6)](MnCl(4))(2)Cl(2).2CH(3)OH.7H(2)O (5), and [Mn(9)(Cl2poap)(6)](ClO(4))(9).7H(2)O (6). Compound 1 crystallized in the tetragonal system, space group P4(2)/n, with a = 21.568(1) A, c = 16.275(1) A, and Z = 2. Compound 2 crystallized in the triclinic system, space group P, with a = 25.043(1) A, b = 27.413(1) A, c = 27.538(2) A, alpha = 91.586(2) degrees, beta = 113.9200(9) degrees, gamma = 111.9470(8) degrees, and Z = 2. Compound 3 crystallized in the triclinic system, space group P, with a = 18.1578(12) A, b = 18.2887(12) A, c = 26.764(2) A, alpha = 105.7880(12) degrees, beta = 101.547(2) degrees, gamma = 91.1250(11) degrees, and Z = 2. Compound 4 crystallized in the tetragonal system, space group P4(1)2(1)2, with a = 20.279(1) A, c = 54.873(6) A, and Z = 4. Compound 5 crystallized in the tetragonal system, space group I, with a = 18.2700(2) A, c = 26.753(2) A, and Z = 2. Compound 6 crystallized in the triclinic system, space group P, with a = 19.044(2) A, b = 19.457(2) A, c = 23.978(3) A, alpha = 84.518(3) degrees, beta = 81.227(3) degrees, gamma = 60.954(2) degrees, and Z = 2. Preliminary surface studies on Au(111), with a Mn(II) grid complex derived from a sulfur-derivatized ligand, indicate monolayer coverage via gold-sulfur interactions, and the potential for information storage at high-density levels. 相似文献
13.
The synthesis, characterization, and reactivity of new polyether adducts of strontium and barium carboxylates of general composition M(O(2)CCF(3))(n)()(L) (M = Ba, L = 15-crown-5, (1); M = Ba (2), Sr (3), respectively, with L = tetraglyme are reported. The compounds were synthesized by reaction of BaCO(3) or MH(2) (M = Sr or Ba) with organic acids in the presence of the polyether ligands. These compounds have been characterized by IR and (13)C and (1)H NMR spectroscopies, elemental analyses, and thermogravimetric analysis. The species Ba(2)(O(2)CCF(3))(4)(15-crown-5)(2) (1) and [Ba(2)(O(2)CCF(3))(4)(tetraglyme)](infinity) (2), were also characterized by single-crystal X-ray diffraction. Ba(2)(O(2)CCF(3))(4)(15-crown-5)(2) (1) crystallizes in the orthorhombic space group Cccm with cell dimensions of a = 13.949(1) ?, b = 19.376(2) ?, c = 16.029(1) ?, and Z = 8. [Ba(2)(O(2)CCF(3))(4)(tetraglyme)](infinity) (2) crystallizes in the monoclinic space group C2/c with cell dimensions of a = 12.8673(12) ?, b = 16.6981(13) ?, c = 15.1191(12) ?, beta = 99.049(8) degrees, and Z = 4. Compounds 1-3 thermally decompose at high temperatures in the solid state to give MF(2). However, solutions of compounds 1-3 dissolved in ethanol with Ti(O-i-Pr)(4) give crystalline perovskite phase MTiO(3) films, or in the case of mixtures of 2 and 3, Ba(1)(-)(x)()Sr(x)()TiO(3) films below 600 degrees C when spin coated onto silicon substrates and thermally treated. The crystallinity, purity, and elemental composition of the films was determined by glancing angle X-ray diffraction and Auger electron spectroscopy. 相似文献
14.
The second method for the synthesis of cis-[Ru(III)Cl(2)(cyclam)]Cl (1) (cyclam = 1,4,8,11-tetraazacyclotetradecane), with use of cis-Ru(II)Cl(2)(DMSO)(4) (DMSO = dimethyl sulfoxide) as a starting complex, is reported together with the synthesis of [Ru(II)(cyclam)(bpy)](BF(4))(2).H(2)O (2) (bpy = 2,2'-bipyridine) from 1. The syntheses of Ru complexes of tris(2-aminoethyl)amine (tren) are also reported. A reaction between K(3)[Ru(III)(ox)(3)] (ox = oxalate) and tren affords fac-[Ru(III)Cl(3)(trenH)]Cl.(1)/(2)H(2)O (3) (trenH = bis(2-aminoethyl)(2-ammonioethyl)amine = monoprotonated tren) and (H(5)O(2))(2)[K(tren)][Ru(III)Cl(6)] (4) as major products and gives fac-[Ru(III)Cl(ox)(trenH)]Cl.(3)/(2)H(2)O (5) in very low reproducibility. A reaction between 3 and bpy affords [Ru(II)(baia)(bpy)](BF(4))(2) (6) (baia = bis(2-aminoethyl)(iminomethyl)amine), in which tren undergoes a selective dehydrogenation into baia. The crystal structures of 2-6 have been determined by X-ray diffraction, and their structural features are discussed in detail. Crystallographic data are as follows: 2, RuF(8)ON(6)C(20)B(2)H(34), monoclinic, space group P2(1)/c with a = 12.448(3) ?, b = 13.200(7) ?, c = 17.973(4) ?, beta = 104.28(2) degrees, V = 2862(2) ?(3), and Z = 4; 3, RuCl(4)O(0.5)N(4)C(6)H(20), monoclinic, space group P2(1)/a with a = 13.731(2) ?, b = 14.319(4) ?, c = 13.949(2) ?, beta = 90.77(1) degrees, V = 2742(1) ?(3), and Z = 8; 4, RuKCl(6)O(4)N(4)C(6)H(28), trigonal, space group R&thremacr; with a = 10.254(4), c = 35.03(1) ?, V = 3190(2) ?(3), and Z = 6; 5, RuCl(2)O(5.5)N(4)C(8)H(22), triclinic, space group P&onemacr; with a = 10.336(2) ?, b = 14.835(2) ?, c = 10.234(1) ?, alpha = 90.28(1) degrees, beta = 90.99(1) degrees, gamma = 92.07(1) degrees, V = 1567.9(4) ?(3), and Z = 4; 6, RuF(8)N(6)C(16)B(2)H(24), monoclinic, space group P2(1)/c, a = 10.779(2) ?, b = 14.416(3) ?, c = 14.190(2) ?, beta = 93.75(2) degrees, V = 2200.3(7) ?(3), and Z = 4. Compound 4 possesses a very unique layered structure made up of both anionic and cationic slabs, {[K(tren)](2)[Ru(III)Cl(6)]}(n)()(n)()(-) and {(H(5)O(2))(4)[Ru(III)Cl(6)]}(n)()(n)()(+) (n = infinity), in which both sheets {[K(tren)](2)}(n)()(2)(n)()(+) and {(H(5)O(2))(4)}(n)()(4)(n)()(+) offer cylindrical pores that are occupied with the [Ru(III)Cl(6)](3)(-) anions. The presence of a C=N double bond of baia in 6 is judged from the C-N distance of 1.28(2) ?. It is suggested that the structural restraint enhanced by the attachment of alkylene chelates at the nitrogen donors of amines results in either the mislocation or misdirection of the donors, leading to the elongation of the Ru-N(amine) distances and to the weakening of their trans influence. Such structural strain is also discussed as related to the spectroscopic and electrochemical properties of the cis-[Ru(II)L(4)(bpy)](2+) complexes (L(4) = (NH(3))(4), (ethylenediamine)(2), and cyclam). 相似文献
15.
Bernhardt PV 《Inorganic chemistry》2001,40(6):1086-1092
Mono- and dicopper(II) complexes of a series of potentially bridging hexaamine ligands have been prepared and characterized in the solid state by X-ray crystallography. The crystal structures of the following Cu(II) complexes are reported: [Cu(HL3)](ClO4)(3), C11H31Cl3CuN6O12, monoclinic, P2(1)/n, a = 8.294(2) A, b = 18.364(3) A, c = 15.674(3) A, beta = 94.73(2) degrees, Z = 4; ([Cu2(L4)(CO3)](2))(ClO4)(4).4H2O, C40H100Cl4Cu4N12O26, triclinic, P1, a = 9.4888(8) A, b = 13.353(1) A, c = 15.329(1) A, alpha = 111.250(7) degrees, beta = 90.068(8) degrees, gamma = 105.081(8) degrees, Z = 1; [Cu2(L5)(OH2)(2)](ClO4)(4), C13H36Cl4Cu2N6O18, monoclinic, P2(1)/c, a = 7.225(2) A, b = 8.5555(5) A, c = 23.134(8) A, beta = 92.37(1) degrees, Z = 2; [Cu2(L6)(OH2)(2)](ClO4)(4).3H2O, C14H44Cl4Cu2N6O21, monoclinic, P2(1)/a, a = 15.204(5) A, b = 7.6810(7) A, c = 29.370(1) A, beta = 100.42(2) degrees, Z = 4. Solution spectroscopic properties of the bimetallic complexes indicate that significant conformational changes occur upon dissolution, and this has been probed with EPR spectroscopy and molecular mechanics calculations. 相似文献
16.
The nickel coordination chemistry of a series of polytopic diazine (N-N) based ligands has been examined. Self-assembly reactions lead to examples of dinuclear, trinuclear, tetranuclear, pentanuclear, and octanuclear complexes, all of which exhibit magnetic exchange coupling, with antiferromagnetic and ferromagnetic examples. Structural details are presented for [(L1)(2)Ni(2)(H(2)O)(2)](NO(3))(4).3H(2)O (1), [(L2)(2)Ni(3)(H(2)O)(2)](NO(3))(6).8H(2)O (2), [(L3)(4)Ni(4)(H(2)O)(8)] (NO(3))(4).8H(2)O (3), [(L4)(2)Ni(5)(H(2)O)(10)(NO(3))](NO(3))(7).8H(2)O (4), and [(L5)(4)Ni(8)(H(2)O)(8)](BF(4))(8).16H(2)O (5). Compound 1 crystallizes in the monoclinic system, space group P2(1)/c, with a = 14.937(1) A, b = 18.612(2) A, c = 20.583(2) A, beta = 108.862(2) degrees, Z = 4. Compound 2 crystallizes in the orthorhombic system, space group P2(1)2(1)2, with a = 21.771(4) A, b = 13.700(2) A, c = 20.017(3) A, Z = 4. Compound 3 crystallizes in the tetragonal system, space group P4(3), with a = 12.9483(7) A, c = 33.416(3) A, Z = 4. Compound 4 crystallizes in the triclinic system, space group P(-)1, with a = 12.6677(8) A, b = 18.110(1) A, c = 19.998(1) A, alpha = 100.395(1) degrees, beta = 109.514(1) degrees, gamma = 109.686(1) degrees, Z = 2. Compound 5 crystallizes in the monoclinic system, space group P2(1)/n, with a = 21.153(5) A, b = 35.778(9) A, c = 21.823(5) A, beta = 97.757(6) degrees, Z = 4. The linear trinuclear Ni(II) complex (2) has a cis-N-N single bond bridge, and a water bridge linking the central Ni(II) to each external Ni(II) center in each of two similar trinuclear subunits, and exhibits intramolecular ferromagnetic exchange (J = 5.0 cm(-1)). A novel octanuclear metallacyclic ring structure exists in 5, with trans-N-N single bond bridges linking adjacent Ni(II) centers, leading to quite strong intramolecular antiferromagnetic exchange (J = -30.4 cm(-1)). 相似文献
17.
Three compounds with formula [Mn(L)(2)(N(3))(2)](n)(), in which L is 4-acpy = 4-acetylpyridine (1), Etinc = ethyl isonicotinate (2), and py = pyridine (3), have been studied from the magnetic point of view. The new compound [Mn(L)(2)(N(3))(2)](n)() (2) crystallizes in the monoclinic system, space group P2(1)/a (No. 14), formula [C(16)H(18)MnN(8)O(4)], with a = 15.176(5) ?, b = 9.060(3) ?, c = 15.760(6) ?, beta = 111.62(3) degrees, and Z = 4. Compounds 1 and 2 are two-dimensional systems, whereas 3 is a 3-D compound. Compound 2 shows ferromagnetic Mn(2)(N(3))(2) dimeric entities linked antiferromagnetically to the four neighboring dimeric entities by four end-to-end azido bridges, leading to an alternate ferromagnetic-antiferromagnetic two-dimensional compound. MO calculations have been performed to study the superexchange pathway for the manganese 1,3-azido system. 相似文献
18.
Self-assembly of silver(I) salts and three ortho-hydroxyl and carboxyl groups decorated arenesulfonic acids affords the formation of nine silver(I)-sulfonates, (NH(4))·[Ag(HL1)(NH(3))(H(2)O)] (1), {(NH(4))·[Ag(3)(HL1)(2)(NH(3))(H(2)O)]}(n) (2), [Ag(2)(HL1)(H(2)O)(2)](n) (3), [Ag(2)(HL2)(NH(3))(2)]·H(2)O (4), [Ag(H(2)L2)(H(2)O)](n) (5), [Ag(2)(HL2)](n) (6), [Ag(3)(L3)(NH(3))(3)](n) (7), [Ag(2)(HL3)](n) (8), and [Ag(6)(L3)(2)(H(2)O)(3)](n) (9) (H(3)L1 = 2-hydroxyl-3-carboxyl-5-bromobenzenesulfonic acid, H(3)L2 = 2-hydroxyl-4-carboxylbenzenesulfonic acid, H(3)L3 = 2-hydroxyl-5-carboxylbenzenesulfonic acid), which are characterized by elemental analysis, IR, TGA, PL, and single-crystal X-ray diffraction. Complex 1 is 3-D supramolecular network extended by [Ag(HL1)(NH(3))(H(2)O)](-) anions and NH(4)(+) cations. Complex 2 exhibits 3-D host-guest framework which encapsulates ammonium cations as guests. Complex 3 presents 2-D layer structure constructed from 1-D tape of sulfonate-bridged Ag1 dimers linked by [(Ag2)(2)(COO)(2)] binuclear units. Complex 4 exhibits 3-D hydrogen-bonding host-guest network which encapsulates water molecules as guests. Complex 5 shows 3-D hybrid framework constructed from organic linker bridged 1-D Ag-O-S chains while complex 6 is 3-D pillared layered framework with the inorganic substructure constructing from the Ag2 polyhedral chains interlinked by Ag1 dimers and sulfonate tetrahedra. The hybrid 3-D framework of complex 7 is formed by L3(-) trianions bridging short trisilver(I) sticks and silver(I) chains. Complex 8 also presents 3-D pillared layered framework, and the inorganic layer substructure is formed by the sulfonate tetrahedrons bridging [(Ag1O(4))(2)(Ag2O(5))(2)](∞) motifs. Complex 9 represents the first silver-based metal-polyhedral framework containing four kinds of coordination spheres with low coordination numbers. The structural diversities and evolutions can be attributed to the synthetic methods, different ligands and coordination modes of the three functional groups, that is, sulfonate, hydroxyl and carboxyl groups. The luminescent properties of the nine complexes have also been investigated at room temperature, especially, complex 1 presents excellent blue luminescence and can sensitize Tb(III) ion to exhibit characteristic green emission. 相似文献
19.
cis-[Ru(NO)Cl(pyca)(2)] (pyca = 2-pyridinecarboxylato), in which the two pyridyl nitrogen atoms of the two pyca ligands coordinate at the trans position to each other and the two carboxylic oxygen atoms at the trans position to the nitrosyl ligand and the chloro ligand, respectively (type I shown as in Chart 1), reacted with NaOCH(3) to generate cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I). The geometry of this complex was confirmed to be the same as the starting complex by X-ray crystallography: C(13.5)H(13)N(3)O(6.5)Ru; monoclinic, P2(1)/n; a = 8.120(1), b = 16.650(1), c = 11.510(1) A; beta = 99.07(1) degrees; V = 1536.7(2) A(3); Z = 4. The cis-trans geometrical change reaction occurred in the reactions of cis-[Ru(NO)(OCH(3))(pyca)(2)] (type I) in water and alcohol (ROH, R = CH(3), C(2)H(5)) to form [[trans-Ru(NO)(pyca)(2)](2)(H(3)O(2))](+) (type V) and trans-[Ru(NO)(OR)(pyca)(2)] (type V). The reactions of the trans-form complexes, trans-[Ru(NO)(H(2)O)(pyca)(2)](+) (type V) and trans-[Ru(NO)(OCH(3))(pyca)(2)] (type V), with Cl(-) in hydrochloric acid solution afforded the cis-form complex, cis-[Ru(NO)Cl(pyca)(2)] (type I). The favorable geometry of [Ru(NO)X(pyca)(2)](n)(+) depended on the nature of the coexisting ligand X. This conclusion was confirmed by theoretical, synthetic, and structural studies. The mono-pyca-containing nitrosylruthenium complex (C(2)H(5))(4)N[Ru(NO)Cl(3)(pyca)] was synthesized by the reaction of [Ru(NO)Cl(5)](2)(-) with Hpyca and characterized by X-ray structural analysis: C(14)H(24)N(3)O(3)Cl(3)Ru; triclinic, Ponemacr;, a = 7.631(1), b = 9.669(1), c = 13.627(1) A; alpha = 83.05(2), beta = 82.23(1), gamma = 81.94(1) degrees; V = 981.1(1) A(3); Z = 2. The type II complex of cis-[Ru(NO)Cl(pyca)(2)] was synthesized by the reaction of [Ru(NO)Cl(3)(pyca)](-) or [Ru(NO)Cl(5)](2)(-) with Hpyca and isolated by column chromatography. The structure was determined by X-ray structural analysis: C(12)H(8)N(3)O(5)ClRu; monoclinic, P2(1)/n; a = 10.010(1), b = 13.280(1), c = 11.335(1) A; beta = 113.45(1) degrees; V = 1382.4(2) A(3); Z = 4. 相似文献
20.
Matthews CJ Thompson LK Parsons SR Xu Z Miller DO Heath SL 《Inorganic chemistry》2001,40(17):4448-4454
A series of trigonal bipyramidal pentanuclear complexes involving the alkoxo-diazine ligands poap and p3oap, containing the M(5)[mu-O](6) core is described, which form by a strict self-assembly process. [Co(5)(poap-H)(6)](ClO(4))(4).3H(2)O (1), [Mn(5)(poap-H)(6)](ClO(4))(4).3.5CH(3)OH.H(2)O (2), [Mn(5)(p3oap-H)(6)](ClO(4))(4).CH(3)CH(2)OH.3H(2)O (3), and [Zn(5)(poap-H)(6)](ClO(4))(4).2.5H(2)O (4) are homoleptic pentanuclear complexes, where there is an exact match between the coordination requirements of the five metal ions in the cluster, and the available coordination pockets in the polytopic ligand. [Zn(4)(poap)(poap-H)(3)(H(2)O)(4)] (NO(3))(5).1.5H(2)O (5) is a square [2 x 2] grid with a Zn(4)[mu-O](4) core, and appears to result from the presence of NO(3), which is thought to be a competing ligand in the self-assembly. X-ray structures are reported for 1, 4, and 5. 1 crystallized in the monoclinic system, space group P2(1)/n with a = 13.385(1) A, b = 25.797(2) A, c = 28.513(3) A, beta = 98.704(2) degrees, and Z = 4. 4 crystallized in the triclinic system, space group P1 with a = 13.0897(9) A, b = 18.889(1) A, c = 20.506(2) A, alpha = 87.116(1) degrees, beta = 74.280(2) degrees, gamma = 75.809(2) degrees, and Z = 2. 5 crystallized in the monoclinic system, space group P2(1)/n with a = 14.8222(7) A, b = 21.408(1) A, c = 21.6197(9) A, beta = 90.698(1) degrees, and Z = 4. Compounds 1-3 exhibit intramolecular antiferromagnetic coupling. 相似文献